mirror of
https://github.com/serai-dex/serai.git
synced 2025-12-12 05:59:23 +00:00
Compare commits
1 Commits
a141deaf36
...
rocksdb-sn
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
8404844c4e |
2
.github/LICENSE → .github/actions/LICENSE
vendored
2
.github/LICENSE → .github/actions/LICENSE
vendored
@@ -1,6 +1,6 @@
|
||||
MIT License
|
||||
|
||||
Copyright (c) 2022-2025 Luke Parker
|
||||
Copyright (c) 2022-2023 Luke Parker
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software and associated documentation files (the "Software"), to deal
|
||||
6
.github/actions/bitcoin/action.yml
vendored
6
.github/actions/bitcoin/action.yml
vendored
@@ -5,14 +5,14 @@ inputs:
|
||||
version:
|
||||
description: "Version to download and run"
|
||||
required: false
|
||||
default: "27.0"
|
||||
default: 24.0.1
|
||||
|
||||
runs:
|
||||
using: "composite"
|
||||
steps:
|
||||
- name: Bitcoin Daemon Cache
|
||||
id: cache-bitcoind
|
||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
||||
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||
with:
|
||||
path: bitcoin.tar.gz
|
||||
key: bitcoind-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
||||
@@ -37,4 +37,4 @@ runs:
|
||||
|
||||
- name: Bitcoin Regtest Daemon
|
||||
shell: bash
|
||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/bitcoin/run.sh -txindex -daemon
|
||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/bitcoin/run.sh -daemon
|
||||
|
||||
41
.github/actions/build-dependencies/action.yml
vendored
41
.github/actions/build-dependencies/action.yml
vendored
@@ -7,15 +7,13 @@ runs:
|
||||
- name: Remove unused packages
|
||||
shell: bash
|
||||
run: |
|
||||
sudo apt remove -y "*powershell*" "*nuget*" "*bazel*" "*ansible*" "*terraform*" "*heroku*" "*aws*" azure-cli
|
||||
sudo apt remove -y "*msbuild*" "*powershell*" "*nuget*" "*bazel*" "*ansible*" "*terraform*" "*heroku*" "*aws*" azure-cli
|
||||
sudo apt remove -y "*nodejs*" "*npm*" "*yarn*" "*java*" "*kotlin*" "*golang*" "*swift*" "*julia*" "*fortran*" "*android*"
|
||||
sudo apt remove -y "*apache2*" "*nginx*" "*firefox*" "*chromium*" "*chrome*" "*edge*"
|
||||
|
||||
sudo apt remove -y --allow-remove-essential -f shim-signed *python3*
|
||||
# This removal command requires the prior removals due to unmet dependencies otherwise
|
||||
sudo apt remove -y "*qemu*" "*sql*" "*texinfo*" "*imagemagick*"
|
||||
# Reinstall python3 as a general dependency of a functional operating system
|
||||
sudo apt install python3
|
||||
sudo apt autoremove -y
|
||||
sudo apt clean
|
||||
docker system prune -a --volumes
|
||||
if: runner.os == 'Linux'
|
||||
|
||||
- name: Remove unused packages
|
||||
@@ -43,34 +41,9 @@ runs:
|
||||
- name: Install solc
|
||||
shell: bash
|
||||
run: |
|
||||
cargo +1.89 install svm-rs --version =0.5.18
|
||||
svm install 0.8.26
|
||||
svm use 0.8.26
|
||||
|
||||
- name: Remove preinstalled Docker
|
||||
shell: bash
|
||||
run: |
|
||||
docker system prune -a --volumes
|
||||
sudo apt remove -y *docker*
|
||||
# Install uidmap which will be required for the explicitly installed Docker
|
||||
sudo apt install uidmap
|
||||
if: runner.os == 'Linux'
|
||||
|
||||
- name: Update system dependencies
|
||||
shell: bash
|
||||
run: |
|
||||
sudo apt update -y
|
||||
sudo apt upgrade -y
|
||||
sudo apt autoremove -y
|
||||
sudo apt clean
|
||||
if: runner.os == 'Linux'
|
||||
|
||||
- name: Install rootless Docker
|
||||
uses: docker/setup-docker-action@b60f85385d03ac8acfca6d9996982511d8620a19
|
||||
with:
|
||||
rootless: true
|
||||
set-host: true
|
||||
if: runner.os == 'Linux'
|
||||
cargo install svm-rs
|
||||
svm install 0.8.25
|
||||
svm use 0.8.25
|
||||
|
||||
# - name: Cache Rust
|
||||
# uses: Swatinem/rust-cache@a95ba195448af2da9b00fb742d14ffaaf3c21f43
|
||||
|
||||
4
.github/actions/monero-wallet-rpc/action.yml
vendored
4
.github/actions/monero-wallet-rpc/action.yml
vendored
@@ -5,14 +5,14 @@ inputs:
|
||||
version:
|
||||
description: "Version to download and run"
|
||||
required: false
|
||||
default: v0.18.3.4
|
||||
default: v0.18.3.1
|
||||
|
||||
runs:
|
||||
using: "composite"
|
||||
steps:
|
||||
- name: Monero Wallet RPC Cache
|
||||
id: cache-monero-wallet-rpc
|
||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
||||
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||
with:
|
||||
path: monero-wallet-rpc
|
||||
key: monero-wallet-rpc-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
||||
|
||||
6
.github/actions/monero/action.yml
vendored
6
.github/actions/monero/action.yml
vendored
@@ -5,14 +5,14 @@ inputs:
|
||||
version:
|
||||
description: "Version to download and run"
|
||||
required: false
|
||||
default: v0.18.3.4
|
||||
default: v0.18.3.1
|
||||
|
||||
runs:
|
||||
using: "composite"
|
||||
steps:
|
||||
- name: Monero Daemon Cache
|
||||
id: cache-monerod
|
||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
||||
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||
with:
|
||||
path: /usr/bin/monerod
|
||||
key: monerod-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
||||
@@ -43,4 +43,4 @@ runs:
|
||||
|
||||
- name: Monero Regtest Daemon
|
||||
shell: bash
|
||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/monero/run.sh --detach
|
||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/monero/run.sh --detach
|
||||
|
||||
8
.github/actions/test-dependencies/action.yml
vendored
8
.github/actions/test-dependencies/action.yml
vendored
@@ -5,12 +5,12 @@ inputs:
|
||||
monero-version:
|
||||
description: "Monero version to download and run as a regtest node"
|
||||
required: false
|
||||
default: v0.18.3.4
|
||||
default: v0.18.3.1
|
||||
|
||||
bitcoin-version:
|
||||
description: "Bitcoin version to download and run as a regtest node"
|
||||
required: false
|
||||
default: "27.1"
|
||||
default: 24.0.1
|
||||
|
||||
runs:
|
||||
using: "composite"
|
||||
@@ -19,9 +19,9 @@ runs:
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Install Foundry
|
||||
uses: foundry-rs/foundry-toolchain@8f1998e9878d786675189ef566a2e4bf24869773
|
||||
uses: foundry-rs/foundry-toolchain@cb603ca0abb544f301eaed59ac0baf579aa6aecf
|
||||
with:
|
||||
version: nightly-f625d0fa7c51e65b4bf1e8f7931cd1c6e2e285e9
|
||||
version: nightly-09fe3e041369a816365a020f715ad6f94dbce9f2
|
||||
cache: false
|
||||
|
||||
- name: Run a Monero Regtest Node
|
||||
|
||||
2
.github/nightly-version
vendored
2
.github/nightly-version
vendored
@@ -1 +1 @@
|
||||
nightly-2025-09-01
|
||||
nightly-2024-02-07
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
name: networks/ Tests
|
||||
name: coins/ Tests
|
||||
|
||||
on:
|
||||
push:
|
||||
@@ -7,18 +7,18 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
|
||||
pull_request:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
|
||||
workflow_dispatch:
|
||||
|
||||
jobs:
|
||||
test-networks:
|
||||
test-coins:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
@@ -30,7 +30,6 @@ jobs:
|
||||
run: |
|
||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
||||
-p bitcoin-serai \
|
||||
-p build-solidity-contracts \
|
||||
-p ethereum-schnorr-contract \
|
||||
-p alloy-simple-request-transport \
|
||||
-p serai-ethereum-relayer \
|
||||
-p ethereum-serai \
|
||||
-p monero-generators \
|
||||
-p monero-serai
|
||||
5
.github/workflows/common-tests.yml
vendored
5
.github/workflows/common-tests.yml
vendored
@@ -27,8 +27,5 @@ jobs:
|
||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
||||
-p std-shims \
|
||||
-p zalloc \
|
||||
-p patchable-async-sleep \
|
||||
-p serai-db \
|
||||
-p serai-env \
|
||||
-p serai-task \
|
||||
-p simple-request
|
||||
-p serai-env
|
||||
|
||||
6
.github/workflows/coordinator-tests.yml
vendored
6
.github/workflows/coordinator-tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "message-queue/**"
|
||||
- "coordinator/**"
|
||||
- "orchestration/**"
|
||||
@@ -18,7 +18,7 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "message-queue/**"
|
||||
- "coordinator/**"
|
||||
- "orchestration/**"
|
||||
@@ -37,4 +37,4 @@ jobs:
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Run coordinator Docker tests
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-coordinator-tests
|
||||
run: cd tests/coordinator && GITHUB_CI=true RUST_BACKTRACE=1 cargo test
|
||||
|
||||
10
.github/workflows/crypto-tests.yml
vendored
10
.github/workflows/crypto-tests.yml
vendored
@@ -32,17 +32,9 @@ jobs:
|
||||
-p dalek-ff-group \
|
||||
-p minimal-ed448 \
|
||||
-p ciphersuite \
|
||||
-p ciphersuite-kp256 \
|
||||
-p multiexp \
|
||||
-p schnorr-signatures \
|
||||
-p prime-field \
|
||||
-p short-weierstrass \
|
||||
-p secq256k1 \
|
||||
-p embedwards25519 \
|
||||
-p dleq \
|
||||
-p dkg \
|
||||
-p dkg-recovery \
|
||||
-p dkg-dealer \
|
||||
-p dkg-musig \
|
||||
-p dkg-evrf \
|
||||
-p modular-frost \
|
||||
-p frost-schnorrkel
|
||||
|
||||
6
.github/workflows/daily-deny.yml
vendored
6
.github/workflows/daily-deny.yml
vendored
@@ -12,13 +12,13 @@ jobs:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
|
||||
- name: Advisory Cache
|
||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
||||
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||
with:
|
||||
path: ~/.cargo/advisory-db
|
||||
key: rust-advisory-db
|
||||
|
||||
- name: Install cargo deny
|
||||
run: cargo +1.89 install cargo-deny --version =0.18.3
|
||||
run: cargo install --locked cargo-deny
|
||||
|
||||
- name: Run cargo deny
|
||||
run: cargo deny -L error --all-features check --hide-inclusion-graph
|
||||
run: cargo deny -L error --all-features check
|
||||
|
||||
2
.github/workflows/full-stack-tests.yml
vendored
2
.github/workflows/full-stack-tests.yml
vendored
@@ -19,4 +19,4 @@ jobs:
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Run Full Stack Docker tests
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-full-stack-tests
|
||||
run: cd tests/full-stack && GITHUB_CI=true RUST_BACKTRACE=1 cargo test
|
||||
|
||||
136
.github/workflows/lint.yml
vendored
136
.github/workflows/lint.yml
vendored
@@ -26,7 +26,7 @@ jobs:
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Install nightly rust
|
||||
run: rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32v1-none -c rust-src -c clippy
|
||||
run: rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32-unknown-unknown -c clippy
|
||||
|
||||
- name: Run Clippy
|
||||
run: cargo +${{ steps.nightly.outputs.version }} clippy --all-features --all-targets -- -D warnings -A clippy::items_after_test_module
|
||||
@@ -46,16 +46,16 @@ jobs:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
|
||||
- name: Advisory Cache
|
||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
||||
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||
with:
|
||||
path: ~/.cargo/advisory-db
|
||||
key: rust-advisory-db
|
||||
|
||||
- name: Install cargo deny
|
||||
run: cargo +1.89 install cargo-deny --version =0.18.3
|
||||
run: cargo install --locked cargo-deny
|
||||
|
||||
- name: Run cargo deny
|
||||
run: cargo deny -L error --all-features check --hide-inclusion-graph
|
||||
run: cargo deny -L error --all-features check
|
||||
|
||||
fmt:
|
||||
runs-on: ubuntu-latest
|
||||
@@ -73,135 +73,11 @@ jobs:
|
||||
- name: Run rustfmt
|
||||
run: cargo +${{ steps.nightly.outputs.version }} fmt -- --check
|
||||
|
||||
- name: Install foundry
|
||||
uses: foundry-rs/foundry-toolchain@8f1998e9878d786675189ef566a2e4bf24869773
|
||||
with:
|
||||
version: nightly-41d4e5437107f6f42c7711123890147bc736a609
|
||||
cache: false
|
||||
|
||||
- name: Run forge fmt
|
||||
run: FOUNDRY_FMT_SORT_INPUTS=false FOUNDRY_FMT_LINE_LENGTH=100 FOUNDRY_FMT_TAB_WIDTH=2 FOUNDRY_FMT_BRACKET_SPACING=true FOUNDRY_FMT_INT_TYPES=preserve forge fmt --check $(find . -iname "*.sol")
|
||||
|
||||
machete:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
- name: Verify all dependencies are in use
|
||||
run: |
|
||||
cargo +1.89 install cargo-machete --version =0.8.0
|
||||
cargo +1.89 machete
|
||||
|
||||
msrv:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
- name: Verify claimed `rust-version`
|
||||
shell: bash
|
||||
run: |
|
||||
cargo +1.89 install cargo-msrv --version =0.18.4
|
||||
|
||||
function check_msrv {
|
||||
# We `cd` into the directory passed as the first argument, but will return to the
|
||||
# directory called from.
|
||||
return_to=$(pwd)
|
||||
echo "Checking $1"
|
||||
cd $1
|
||||
|
||||
# We then find the existing `rust-version` using `grep` (for the right line) and then a
|
||||
# regex (to strip to just the major and minor version).
|
||||
existing=$(cat ./Cargo.toml | grep "rust-version" | grep -Eo "[0-9]+\.[0-9]+")
|
||||
|
||||
# We then backup the `Cargo.toml`, allowing us to restore it after, saving time on future
|
||||
# MSRV checks (as they'll benefit from immediately exiting if the queried version is less
|
||||
# than the declared MSRV).
|
||||
mv ./Cargo.toml ./Cargo.toml.bak
|
||||
|
||||
# We then use an inverted (`-v`) grep to remove the existing `rust-version` from the
|
||||
# `Cargo.toml`, as required because else earlier versions of Rust won't even attempt to
|
||||
# compile this crate.
|
||||
cat ./Cargo.toml.bak | grep -v "rust-version" > Cargo.toml
|
||||
|
||||
# We then find the actual `rust-version` using `cargo-msrv` (again stripping to just the
|
||||
# major and minor version).
|
||||
actual=$(cargo msrv find --output-format minimal | grep -Eo "^[0-9]+\.[0-9]+")
|
||||
|
||||
# Finally, we compare the two.
|
||||
echo "Declared rust-version: $existing"
|
||||
echo "Actual rust-version: $actual"
|
||||
[ $existing == $actual ]
|
||||
result=$?
|
||||
|
||||
# Restore the original `Cargo.toml`.
|
||||
rm Cargo.toml
|
||||
mv ./Cargo.toml.bak ./Cargo.toml
|
||||
|
||||
# Return to the directory called from and return the result.
|
||||
cd $return_to
|
||||
return $result
|
||||
}
|
||||
|
||||
# Check each member of the workspace
|
||||
function check_workspace {
|
||||
# Get the members array from the workspace's `Cargo.toml`
|
||||
cargo_toml_lines=$(cat ./Cargo.toml | wc -l)
|
||||
members=$(cat Cargo.toml | grep "members\ \=\ \[" -m1 -A$cargo_toml_lines | grep "]" -m1 -B$cargo_toml_lines)
|
||||
# Parse out any comments, including comments post-fixed on the same line as an entry
|
||||
members=$(echo "$members" | grep -Ev "^[[:space:]]+#" | grep -Ev "^[[:space:]]?$" | awk -F',' '{print $1","}')
|
||||
# Prune `members = [` to `[` by replacing the first line with just `[`
|
||||
members=$(echo "$members" | sed "1s/.*/\[/")
|
||||
# Remove the trailing comma by replacing the last line's "," with ""
|
||||
members=$(echo "$members" | sed "$(($(echo "$members" | wc -l) - 1))s/\,//")
|
||||
# Correct the last line, which was malleated to "]," when pruning comments
|
||||
members=$(echo "$members" | sed "$(echo "$members" | wc -l)s/\]\,/\]/")
|
||||
|
||||
# Don't check the patches
|
||||
members=$(echo "$members" | grep -v "patches")
|
||||
# Don't check the following
|
||||
# Most of these are binaries, with the exception of the Substrate runtime which has a
|
||||
# bespoke build pipeline
|
||||
members=$(echo "$members" | grep -v "networks/ethereum/relayer\"")
|
||||
members=$(echo "$members" | grep -v "message-queue\"")
|
||||
members=$(echo "$members" | grep -v "processor/bin\"")
|
||||
members=$(echo "$members" | grep -v "processor/bitcoin\"")
|
||||
members=$(echo "$members" | grep -v "processor/ethereum\"")
|
||||
members=$(echo "$members" | grep -v "processor/monero\"")
|
||||
members=$(echo "$members" | grep -v "coordinator\"")
|
||||
members=$(echo "$members" | grep -v "substrate/runtime\"")
|
||||
members=$(echo "$members" | grep -v "substrate/node\"")
|
||||
members=$(echo "$members" | grep -v "orchestration\"")
|
||||
|
||||
# Don't check the tests
|
||||
members=$(echo "$members" | grep -v "mini\"")
|
||||
members=$(echo "$members" | grep -v "tests/")
|
||||
|
||||
echo $members | jq -r ".[]" | while read -r member; do
|
||||
check_msrv $member
|
||||
correct=$?
|
||||
if [ $correct -ne 0 ]; then
|
||||
return $correct
|
||||
fi
|
||||
done
|
||||
}
|
||||
check_workspace
|
||||
|
||||
slither:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
- name: Slither
|
||||
run: |
|
||||
python3 -m pip install solc-select
|
||||
solc-select install 0.8.26
|
||||
solc-select use 0.8.26
|
||||
|
||||
python3 -m pip install slither-analyzer
|
||||
|
||||
slither --include-paths ./networks/ethereum/schnorr/contracts/Schnorr.sol
|
||||
slither --include-paths ./networks/ethereum/schnorr/contracts ./networks/ethereum/schnorr/contracts/tests/Schnorr.sol
|
||||
slither processor/ethereum/deployer/contracts/Deployer.sol
|
||||
slither processor/ethereum/erc20/contracts/IERC20.sol
|
||||
|
||||
cp networks/ethereum/schnorr/contracts/Schnorr.sol processor/ethereum/router/contracts/
|
||||
cp processor/ethereum/erc20/contracts/IERC20.sol processor/ethereum/router/contracts/
|
||||
cd processor/ethereum/router/contracts
|
||||
slither Router.sol
|
||||
cargo install cargo-machete
|
||||
cargo machete
|
||||
|
||||
2
.github/workflows/message-queue-tests.yml
vendored
2
.github/workflows/message-queue-tests.yml
vendored
@@ -33,4 +33,4 @@ jobs:
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Run message-queue Docker tests
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-message-queue-tests
|
||||
run: cd tests/message-queue && GITHUB_CI=true RUST_BACKTRACE=1 cargo test
|
||||
|
||||
56
.github/workflows/monero-tests.yaml
vendored
Normal file
56
.github/workflows/monero-tests.yaml
vendored
Normal file
@@ -0,0 +1,56 @@
|
||||
name: Monero Tests
|
||||
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- develop
|
||||
paths:
|
||||
- "coins/monero/**"
|
||||
- "processor/**"
|
||||
|
||||
pull_request:
|
||||
paths:
|
||||
- "coins/monero/**"
|
||||
- "processor/**"
|
||||
|
||||
workflow_dispatch:
|
||||
|
||||
jobs:
|
||||
# Only run these once since they will be consistent regardless of any node
|
||||
unit-tests:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
|
||||
- name: Test Dependencies
|
||||
uses: ./.github/actions/test-dependencies
|
||||
|
||||
- name: Run Unit Tests Without Features
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --lib
|
||||
|
||||
# Doesn't run unit tests with features as the tests workflow will
|
||||
|
||||
integration-tests:
|
||||
runs-on: ubuntu-latest
|
||||
# Test against all supported protocol versions
|
||||
strategy:
|
||||
matrix:
|
||||
version: [v0.17.3.2, v0.18.2.0]
|
||||
|
||||
steps:
|
||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
|
||||
- name: Test Dependencies
|
||||
uses: ./.github/actions/test-dependencies
|
||||
with:
|
||||
monero-version: ${{ matrix.version }}
|
||||
|
||||
- name: Run Integration Tests Without Features
|
||||
# Runs with the binaries feature so the binaries build
|
||||
# https://github.com/rust-lang/cargo/issues/8396
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --features binaries --test '*'
|
||||
|
||||
- name: Run Integration Tests
|
||||
# Don't run if the the tests workflow also will
|
||||
if: ${{ matrix.version != 'v0.18.2.0' }}
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --all-features --test '*'
|
||||
18
.github/workflows/no-std.yml
vendored
18
.github/workflows/no-std.yml
vendored
@@ -7,14 +7,14 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "tests/no-std/**"
|
||||
|
||||
pull_request:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "tests/no-std/**"
|
||||
|
||||
workflow_dispatch:
|
||||
@@ -28,18 +28,8 @@ jobs:
|
||||
- name: Install Build Dependencies
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Get nightly version to use
|
||||
id: nightly
|
||||
shell: bash
|
||||
run: echo "version=$(cat .github/nightly-version)" >> $GITHUB_OUTPUT
|
||||
|
||||
- name: Install RISC-V Toolchain
|
||||
run: |
|
||||
sudo apt update
|
||||
sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib
|
||||
rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal --component rust-src --target riscv32imac-unknown-none-elf
|
||||
run: sudo apt update && sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib && rustup target add riscv32imac-unknown-none-elf
|
||||
|
||||
- name: Verify no-std builds
|
||||
run: |
|
||||
CFLAGS=-I/usr/include cargo +${{ steps.nightly.outputs.version }} build --target riscv32imac-unknown-none-elf -Z build-std=core -p serai-no-std-tests
|
||||
CFLAGS=-I/usr/include cargo +${{ steps.nightly.outputs.version }} build --target riscv32imac-unknown-none-elf -Z build-std=core,alloc -p serai-no-std-tests --features "alloc"
|
||||
run: cd tests/no-std && CFLAGS=-I/usr/include cargo build --target riscv32imac-unknown-none-elf
|
||||
|
||||
43
.github/workflows/pages.yml
vendored
43
.github/workflows/pages.yml
vendored
@@ -1,7 +1,6 @@
|
||||
# MIT License
|
||||
#
|
||||
# Copyright (c) 2022 just-the-docs
|
||||
# Copyright (c) 2022-2024 Luke Parker
|
||||
#
|
||||
# Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
# of this software and associated documentation files (the "Software"), to deal
|
||||
@@ -21,21 +20,31 @@
|
||||
# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||
# SOFTWARE.
|
||||
|
||||
name: Deploy Rust docs and Jekyll site to Pages
|
||||
# This workflow uses actions that are not certified by GitHub.
|
||||
# They are provided by a third-party and are governed by
|
||||
# separate terms of service, privacy policy, and support
|
||||
# documentation.
|
||||
|
||||
# Sample workflow for building and deploying a Jekyll site to GitHub Pages
|
||||
name: Deploy Jekyll site to Pages
|
||||
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- "develop"
|
||||
paths:
|
||||
- "docs/**"
|
||||
|
||||
# Allows you to run this workflow manually from the Actions tab
|
||||
workflow_dispatch:
|
||||
|
||||
# Sets permissions of the GITHUB_TOKEN to allow deployment to GitHub Pages
|
||||
permissions:
|
||||
contents: read
|
||||
pages: write
|
||||
id-token: write
|
||||
|
||||
# Only allow one concurrent deployment
|
||||
# Allow one concurrent deployment
|
||||
concurrency:
|
||||
group: "pages"
|
||||
cancel-in-progress: true
|
||||
@@ -44,37 +53,27 @@ jobs:
|
||||
# Build job
|
||||
build:
|
||||
runs-on: ubuntu-latest
|
||||
defaults:
|
||||
run:
|
||||
working-directory: docs
|
||||
steps:
|
||||
- name: Checkout
|
||||
uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||
uses: actions/checkout@v3
|
||||
- name: Setup Ruby
|
||||
uses: ruby/setup-ruby@44511735964dcb71245e7e55f72539531f7bc0eb
|
||||
uses: ruby/setup-ruby@v1
|
||||
with:
|
||||
bundler-cache: true
|
||||
cache-version: 0
|
||||
working-directory: "${{ github.workspace }}/docs"
|
||||
- name: Setup Pages
|
||||
id: pages
|
||||
uses: actions/configure-pages@983d7736d9b0ae728b81ab479565c72886d7745b
|
||||
uses: actions/configure-pages@v3
|
||||
- name: Build with Jekyll
|
||||
run: cd ${{ github.workspace }}/docs && bundle exec jekyll build --baseurl "${{ steps.pages.outputs.base_path }}"
|
||||
run: bundle exec jekyll build --baseurl "${{ steps.pages.outputs.base_path }}"
|
||||
env:
|
||||
JEKYLL_ENV: production
|
||||
|
||||
- name: Get nightly version to use
|
||||
id: nightly
|
||||
shell: bash
|
||||
run: echo "version=$(cat .github/nightly-version)" >> $GITHUB_OUTPUT
|
||||
- name: Build Dependencies
|
||||
uses: ./.github/actions/build-dependencies
|
||||
- name: Buld Rust docs
|
||||
run: |
|
||||
rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32v1-none -c rust-docs
|
||||
RUSTDOCFLAGS="--cfg docsrs" cargo +${{ steps.nightly.outputs.version }} doc --workspace --all-features
|
||||
mv target/doc docs/_site/rust
|
||||
|
||||
- name: Upload artifact
|
||||
uses: actions/upload-pages-artifact@7b1f4a764d45c48632c6b24a0339c27f5614fb0b
|
||||
uses: actions/upload-pages-artifact@v1
|
||||
with:
|
||||
path: "docs/_site/"
|
||||
|
||||
@@ -88,4 +87,4 @@ jobs:
|
||||
steps:
|
||||
- name: Deploy to GitHub Pages
|
||||
id: deployment
|
||||
uses: actions/deploy-pages@d6db90164ac5ed86f2b6aed7e0febac5b3c0c03e
|
||||
uses: actions/deploy-pages@v2
|
||||
|
||||
6
.github/workflows/processor-tests.yml
vendored
6
.github/workflows/processor-tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "message-queue/**"
|
||||
- "processor/**"
|
||||
- "orchestration/**"
|
||||
@@ -18,7 +18,7 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "message-queue/**"
|
||||
- "processor/**"
|
||||
- "orchestration/**"
|
||||
@@ -37,4 +37,4 @@ jobs:
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Run processor Docker tests
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-processor-tests
|
||||
run: cd tests/processor && GITHUB_CI=true RUST_BACKTRACE=1 cargo test
|
||||
|
||||
2
.github/workflows/reproducible-runtime.yml
vendored
2
.github/workflows/reproducible-runtime.yml
vendored
@@ -33,4 +33,4 @@ jobs:
|
||||
uses: ./.github/actions/build-dependencies
|
||||
|
||||
- name: Run Reproducible Runtime tests
|
||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-reproducible-runtime-tests
|
||||
run: cd tests/reproducible-runtime && GITHUB_CI=true RUST_BACKTRACE=1 cargo test
|
||||
|
||||
40
.github/workflows/tests.yml
vendored
40
.github/workflows/tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "message-queue/**"
|
||||
- "processor/**"
|
||||
- "coordinator/**"
|
||||
@@ -17,7 +17,7 @@ on:
|
||||
paths:
|
||||
- "common/**"
|
||||
- "crypto/**"
|
||||
- "networks/**"
|
||||
- "coins/**"
|
||||
- "message-queue/**"
|
||||
- "processor/**"
|
||||
- "coordinator/**"
|
||||
@@ -39,35 +39,10 @@ jobs:
|
||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
||||
-p serai-message-queue \
|
||||
-p serai-processor-messages \
|
||||
-p serai-processor-key-gen \
|
||||
-p serai-processor-view-keys \
|
||||
-p serai-processor-frost-attempt-manager \
|
||||
-p serai-processor-primitives \
|
||||
-p serai-processor-scanner \
|
||||
-p serai-processor-scheduler-primitives \
|
||||
-p serai-processor-utxo-scheduler-primitives \
|
||||
-p serai-processor-utxo-scheduler \
|
||||
-p serai-processor-transaction-chaining-scheduler \
|
||||
-p serai-processor-smart-contract-scheduler \
|
||||
-p serai-processor-signers \
|
||||
-p serai-processor-bin \
|
||||
-p serai-bitcoin-processor \
|
||||
-p serai-processor-ethereum-primitives \
|
||||
-p serai-processor-ethereum-test-primitives \
|
||||
-p serai-processor-ethereum-deployer \
|
||||
-p serai-processor-ethereum-router \
|
||||
-p serai-processor-ethereum-erc20 \
|
||||
-p serai-ethereum-processor \
|
||||
-p serai-monero-processor \
|
||||
-p serai-processor \
|
||||
-p tendermint-machine \
|
||||
-p tributary-sdk \
|
||||
-p serai-cosign \
|
||||
-p serai-coordinator-substrate \
|
||||
-p serai-coordinator-tributary \
|
||||
-p serai-coordinator-p2p \
|
||||
-p serai-coordinator-libp2p-p2p \
|
||||
-p tributary-chain \
|
||||
-p serai-coordinator \
|
||||
-p serai-orchestrator \
|
||||
-p serai-docker-tests
|
||||
|
||||
test-substrate:
|
||||
@@ -87,16 +62,9 @@ jobs:
|
||||
-p serai-dex-pallet \
|
||||
-p serai-validator-sets-primitives \
|
||||
-p serai-validator-sets-pallet \
|
||||
-p serai-genesis-liquidity-primitives \
|
||||
-p serai-genesis-liquidity-pallet \
|
||||
-p serai-emissions-primitives \
|
||||
-p serai-emissions-pallet \
|
||||
-p serai-economic-security-pallet \
|
||||
-p serai-in-instructions-primitives \
|
||||
-p serai-in-instructions-pallet \
|
||||
-p serai-signals-primitives \
|
||||
-p serai-signals-pallet \
|
||||
-p serai-abi \
|
||||
-p serai-runtime \
|
||||
-p serai-node
|
||||
|
||||
|
||||
7680
Cargo.lock
generated
7680
Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
150
Cargo.toml
150
Cargo.toml
@@ -2,9 +2,9 @@
|
||||
resolver = "2"
|
||||
members = [
|
||||
# Version patches
|
||||
"patches/parking_lot",
|
||||
"patches/zstd",
|
||||
"patches/rocksdb",
|
||||
"patches/proc-macro-crate",
|
||||
|
||||
# std patches
|
||||
"patches/matches",
|
||||
@@ -14,19 +14,10 @@ members = [
|
||||
"patches/option-ext",
|
||||
"patches/directories-next",
|
||||
|
||||
# monero-oxide expects `ciphersuite`, yet the `ciphersuite` in-tree here has breaking changes
|
||||
# This re-exports the in-tree `ciphersuite` _without_ changes breaking to monero-oxide
|
||||
# Not included in workspace to prevent having two crates with the same name (an error)
|
||||
# "patches/ciphersuite",
|
||||
# Same for `dalek-ff-group`
|
||||
# "patches/dalek-ff-group",
|
||||
|
||||
"common/std-shims",
|
||||
"common/zalloc",
|
||||
"common/patchable-async-sleep",
|
||||
"common/db",
|
||||
"common/env",
|
||||
"common/task",
|
||||
"common/request",
|
||||
|
||||
"crypto/transcript",
|
||||
@@ -35,65 +26,27 @@ members = [
|
||||
"crypto/dalek-ff-group",
|
||||
"crypto/ed448",
|
||||
"crypto/ciphersuite",
|
||||
"crypto/ciphersuite/kp256",
|
||||
|
||||
"crypto/multiexp",
|
||||
|
||||
"crypto/schnorr",
|
||||
|
||||
"crypto/prime-field",
|
||||
"crypto/short-weierstrass",
|
||||
"crypto/secq256k1",
|
||||
"crypto/embedwards25519",
|
||||
|
||||
"crypto/dleq",
|
||||
"crypto/dkg",
|
||||
"crypto/dkg/recovery",
|
||||
"crypto/dkg/dealer",
|
||||
"crypto/dkg/musig",
|
||||
"crypto/dkg/evrf",
|
||||
"crypto/frost",
|
||||
"crypto/schnorrkel",
|
||||
|
||||
"networks/bitcoin",
|
||||
|
||||
"networks/ethereum/build-contracts",
|
||||
"networks/ethereum/schnorr",
|
||||
"networks/ethereum/alloy-simple-request-transport",
|
||||
"networks/ethereum/relayer",
|
||||
"coins/bitcoin",
|
||||
"coins/ethereum",
|
||||
"coins/monero/generators",
|
||||
"coins/monero",
|
||||
|
||||
"message-queue",
|
||||
|
||||
"processor/messages",
|
||||
"processor",
|
||||
|
||||
"processor/key-gen",
|
||||
"processor/view-keys",
|
||||
"processor/frost-attempt-manager",
|
||||
|
||||
"processor/primitives",
|
||||
"processor/scanner",
|
||||
"processor/scheduler/primitives",
|
||||
"processor/scheduler/utxo/primitives",
|
||||
"processor/scheduler/utxo/standard",
|
||||
"processor/scheduler/utxo/transaction-chaining",
|
||||
"processor/scheduler/smart-contract",
|
||||
"processor/signers",
|
||||
|
||||
"processor/bin",
|
||||
"processor/bitcoin",
|
||||
"processor/ethereum/primitives",
|
||||
"processor/ethereum/test-primitives",
|
||||
"processor/ethereum/deployer",
|
||||
"processor/ethereum/router",
|
||||
"processor/ethereum/erc20",
|
||||
"processor/ethereum",
|
||||
"processor/monero",
|
||||
|
||||
"coordinator/tributary-sdk/tendermint",
|
||||
"coordinator/tributary-sdk",
|
||||
"coordinator/cosign",
|
||||
"coordinator/substrate",
|
||||
"coordinator/tributary/tendermint",
|
||||
"coordinator/tributary",
|
||||
"coordinator/p2p",
|
||||
"coordinator/p2p/libp2p",
|
||||
"coordinator",
|
||||
|
||||
"substrate/primitives",
|
||||
@@ -101,22 +54,12 @@ members = [
|
||||
"substrate/coins/primitives",
|
||||
"substrate/coins/pallet",
|
||||
|
||||
"substrate/dex/pallet",
|
||||
"substrate/in-instructions/primitives",
|
||||
"substrate/in-instructions/pallet",
|
||||
|
||||
"substrate/validator-sets/primitives",
|
||||
"substrate/validator-sets/pallet",
|
||||
|
||||
"substrate/genesis-liquidity/primitives",
|
||||
"substrate/genesis-liquidity/pallet",
|
||||
|
||||
"substrate/emissions/primitives",
|
||||
"substrate/emissions/pallet",
|
||||
|
||||
"substrate/economic-security/pallet",
|
||||
|
||||
"substrate/in-instructions/primitives",
|
||||
"substrate/in-instructions/pallet",
|
||||
|
||||
"substrate/signals/primitives",
|
||||
"substrate/signals/pallet",
|
||||
|
||||
@@ -135,81 +78,45 @@ members = [
|
||||
|
||||
"tests/docker",
|
||||
"tests/message-queue",
|
||||
# TODO "tests/processor",
|
||||
# TODO "tests/coordinator",
|
||||
# TODO "tests/full-stack",
|
||||
"tests/processor",
|
||||
"tests/coordinator",
|
||||
"tests/full-stack",
|
||||
"tests/reproducible-runtime",
|
||||
]
|
||||
|
||||
[profile.dev.package]
|
||||
# Always compile Monero (and a variety of dependencies) with optimizations due
|
||||
# to the extensive operations required for Bulletproofs
|
||||
[profile.dev.package]
|
||||
subtle = { opt-level = 3 }
|
||||
|
||||
sha3 = { opt-level = 3 }
|
||||
blake2 = { opt-level = 3 }
|
||||
curve25519-dalek = { opt-level = 3 }
|
||||
|
||||
ff = { opt-level = 3 }
|
||||
group = { opt-level = 3 }
|
||||
|
||||
crypto-bigint = { opt-level = 3 }
|
||||
curve25519-dalek = { opt-level = 3 }
|
||||
dalek-ff-group = { opt-level = 3 }
|
||||
minimal-ed448 = { opt-level = 3 }
|
||||
|
||||
multiexp = { opt-level = 3 }
|
||||
|
||||
monero-generators = { opt-level = 3 }
|
||||
monero-borromean = { opt-level = 3 }
|
||||
monero-bulletproofs = { opt-level = 3 }
|
||||
monero-mlsag = { opt-level = 3 }
|
||||
monero-clsag = { opt-level = 3 }
|
||||
monero-oxide = { opt-level = 3 }
|
||||
|
||||
# Always compile the eVRF DKG tree with optimizations as well
|
||||
secp256k1 = { opt-level = 3 }
|
||||
secq256k1 = { opt-level = 3 }
|
||||
embedwards25519 = { opt-level = 3 }
|
||||
generalized-bulletproofs = { opt-level = 3 }
|
||||
generalized-bulletproofs-circuit-abstraction = { opt-level = 3 }
|
||||
generalized-bulletproofs-ec-gadgets = { opt-level = 3 }
|
||||
|
||||
# revm also effectively requires being built with optimizations
|
||||
revm = { opt-level = 3 }
|
||||
revm-bytecode = { opt-level = 3 }
|
||||
revm-context = { opt-level = 3 }
|
||||
revm-context-interface = { opt-level = 3 }
|
||||
revm-database = { opt-level = 3 }
|
||||
revm-database-interface = { opt-level = 3 }
|
||||
revm-handler = { opt-level = 3 }
|
||||
revm-inspector = { opt-level = 3 }
|
||||
revm-interpreter = { opt-level = 3 }
|
||||
revm-precompile = { opt-level = 3 }
|
||||
revm-primitives = { opt-level = 3 }
|
||||
revm-state = { opt-level = 3 }
|
||||
monero-serai = { opt-level = 3 }
|
||||
|
||||
[profile.release]
|
||||
panic = "unwind"
|
||||
overflow-checks = true
|
||||
|
||||
[patch.crates-io]
|
||||
# Dependencies from monero-oxide which originate from within our own tree
|
||||
std-shims = { path = "common/std-shims" }
|
||||
simple-request = { path = "common/request" }
|
||||
multiexp = { path = "crypto/multiexp" }
|
||||
flexible-transcript = { path = "crypto/transcript" }
|
||||
ciphersuite = { path = "patches/ciphersuite" }
|
||||
dalek-ff-group = { path = "patches/dalek-ff-group" }
|
||||
minimal-ed448 = { path = "crypto/ed448" }
|
||||
modular-frost = { path = "crypto/frost" }
|
||||
|
||||
# https://github.com/rust-lang-nursery/lazy-static.rs/issues/201
|
||||
lazy_static = { git = "https://github.com/rust-lang-nursery/lazy-static.rs", rev = "5735630d46572f1e5377c8f2ba0f79d18f53b10c" }
|
||||
|
||||
parking_lot = { path = "patches/parking_lot" }
|
||||
# Needed due to dockertest's usage of `Rc`s when we need `Arc`s
|
||||
dockertest = { git = "https://github.com/kayabaNerve/dockertest-rs", branch = "arc" }
|
||||
|
||||
# wasmtime pulls in an old version for this
|
||||
zstd = { path = "patches/zstd" }
|
||||
# Needed for WAL compression
|
||||
rocksdb = { path = "patches/rocksdb" }
|
||||
# proc-macro-crate 2 binds to an old version of toml for msrv so we patch to 3
|
||||
proc-macro-crate = { path = "patches/proc-macro-crate" }
|
||||
|
||||
# is-terminal now has an std-based solution with an equivalent API
|
||||
is-terminal = { path = "patches/is-terminal" }
|
||||
@@ -224,16 +131,8 @@ matches = { path = "patches/matches" }
|
||||
option-ext = { path = "patches/option-ext" }
|
||||
directories-next = { path = "patches/directories-next" }
|
||||
|
||||
# Patch to include `FromUniformBytes<64>` over Scalar
|
||||
k256 = { git = "https://github.com/kayabaNerve/elliptic-curves", rev = "4994c9ab163781a88cd4a49beae812a89a44e8c3" }
|
||||
p256 = { git = "https://github.com/kayabaNerve/elliptic-curves", rev = "4994c9ab163781a88cd4a49beae812a89a44e8c3" }
|
||||
|
||||
[workspace.lints.clippy]
|
||||
unwrap_or_default = "allow"
|
||||
map_unwrap_or = "allow"
|
||||
needless_continue = "allow"
|
||||
manual_is_multiple_of = "allow"
|
||||
incompatible_msrv = "allow" # Manually verified with a GitHub workflow
|
||||
borrow_as_ptr = "deny"
|
||||
cast_lossless = "deny"
|
||||
cast_possible_truncation = "deny"
|
||||
@@ -261,9 +160,11 @@ manual_instant_elapsed = "deny"
|
||||
manual_let_else = "deny"
|
||||
manual_ok_or = "deny"
|
||||
manual_string_new = "deny"
|
||||
map_unwrap_or = "deny"
|
||||
match_bool = "deny"
|
||||
match_same_arms = "deny"
|
||||
missing_fields_in_debug = "deny"
|
||||
needless_continue = "deny"
|
||||
needless_pass_by_value = "deny"
|
||||
ptr_cast_constness = "deny"
|
||||
range_minus_one = "deny"
|
||||
@@ -271,7 +172,6 @@ range_plus_one = "deny"
|
||||
redundant_closure_for_method_calls = "deny"
|
||||
redundant_else = "deny"
|
||||
string_add_assign = "deny"
|
||||
string_slice = "deny"
|
||||
unchecked_duration_subtraction = "deny"
|
||||
uninlined_format_args = "deny"
|
||||
unnecessary_box_returns = "deny"
|
||||
|
||||
2
LICENSE
2
LICENSE
@@ -5,4 +5,4 @@ a full copy of the AGPL-3.0 License is included in the root of this repository
|
||||
as a reference text. This copy should be provided with any distribution of a
|
||||
crate licensed under the AGPL-3.0, as per its terms.
|
||||
|
||||
The GitHub actions/workflows (`.github`) are licensed under the MIT license.
|
||||
The GitHub actions (`.github/actions`) are licensed under the MIT license.
|
||||
|
||||
@@ -24,7 +24,7 @@ wallet.
|
||||
infrastructure, to our IETF-compliant FROST implementation, to a DLEq proof as
|
||||
needed for Bitcoin-Monero atomic swaps.
|
||||
|
||||
- `networks`: Various libraries intended for usage in Serai yet also by the
|
||||
- `coins`: Various coin libraries intended for usage in Serai yet also by the
|
||||
wider community. This means they will always support the functionality Serai
|
||||
needs, yet won't disadvantage other use cases when possible.
|
||||
|
||||
@@ -59,6 +59,7 @@ issued at the discretion of the Immunefi program managers.
|
||||
- [Website](https://serai.exchange/): https://serai.exchange/
|
||||
- [Immunefi](https://immunefi.com/bounty/serai/): https://immunefi.com/bounty/serai/
|
||||
- [Twitter](https://twitter.com/SeraiDEX): https://twitter.com/SeraiDEX
|
||||
- [Mastodon](https://cryptodon.lol/@serai): https://cryptodon.lol/@serai
|
||||
- [Discord](https://discord.gg/mpEUtJR3vz): https://discord.gg/mpEUtJR3vz
|
||||
- [Matrix](https://matrix.to/#/#serai:matrix.org): https://matrix.to/#/#serai:matrix.org
|
||||
- [Reddit](https://www.reddit.com/r/SeraiDEX/): https://www.reddit.com/r/SeraiDEX/
|
||||
|
||||
6
audits/Cypher Stack coins bitcoin August 2023/README.md
Normal file
6
audits/Cypher Stack coins bitcoin August 2023/README.md
Normal file
@@ -0,0 +1,6 @@
|
||||
# Cypher Stack /coins/bitcoin Audit, August 2023
|
||||
|
||||
This audit was over the /coins/bitcoin folder. It is encompassing up to commit
|
||||
5121ca75199dff7bd34230880a1fdd793012068c.
|
||||
|
||||
Please see https://github.com/cypherstack/serai-btc-audit for provenance.
|
||||
@@ -1,7 +0,0 @@
|
||||
# Cypher Stack /networks/bitcoin Audit, August 2023
|
||||
|
||||
This audit was over the `/networks/bitcoin` folder (at the time located at
|
||||
`/coins/bitcoin`). It is encompassing up to commit
|
||||
5121ca75199dff7bd34230880a1fdd793012068c.
|
||||
|
||||
Please see https://github.com/cypherstack/serai-btc-audit for provenance.
|
||||
@@ -1,14 +0,0 @@
|
||||
# Trail of Bits Ethereum Contracts Audit, June 2025
|
||||
|
||||
This audit included:
|
||||
- Our Schnorr contract and associated library (/networks/ethereum/schnorr)
|
||||
- Our Ethereum primitives library (/processor/ethereum/primitives)
|
||||
- Our Deployer contract and associated library (/processor/ethereum/deployer)
|
||||
- Our ERC20 library (/processor/ethereum/erc20)
|
||||
- Our Router contract and associated library (/processor/ethereum/router)
|
||||
|
||||
It is encompassing up to commit 4e0c58464fc4673623938335f06e2e9ea96ca8dd.
|
||||
|
||||
Please see
|
||||
https://github.com/trailofbits/publications/blob/30c4fa3ebf39ff8e4d23ba9567344ec9691697b5/reviews/2025-04-serai-dex-security-review.pdf
|
||||
for the actual report.
|
||||
@@ -1,12 +1,12 @@
|
||||
[package]
|
||||
name = "bitcoin-serai"
|
||||
version = "0.4.0"
|
||||
version = "0.3.0"
|
||||
description = "A Bitcoin library for FROST-signing transactions"
|
||||
license = "MIT"
|
||||
repository = "https://github.com/serai-dex/serai/tree/develop/networks/bitcoin"
|
||||
repository = "https://github.com/serai-dex/serai/tree/develop/coins/bitcoin"
|
||||
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Vrx <vrx00@proton.me>"]
|
||||
edition = "2021"
|
||||
rust-version = "1.85"
|
||||
rust-version = "1.74"
|
||||
|
||||
[package.metadata.docs.rs]
|
||||
all-features = true
|
||||
@@ -18,16 +18,17 @@ workspace = true
|
||||
[dependencies]
|
||||
std-shims = { version = "0.1.1", path = "../../common/std-shims", default-features = false }
|
||||
|
||||
thiserror = { version = "2", default-features = false }
|
||||
thiserror = { version = "1", default-features = false, optional = true }
|
||||
|
||||
subtle = { version = "2", default-features = false }
|
||||
zeroize = { version = "^1.5", default-features = false }
|
||||
rand_core = { version = "0.6", default-features = false }
|
||||
|
||||
bitcoin = { version = "0.32", default-features = false }
|
||||
bitcoin = { version = "0.31", default-features = false, features = ["no-std"] }
|
||||
|
||||
k256 = { version = "^0.13.1", default-features = false, features = ["arithmetic", "bits"] }
|
||||
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.11", default-features = false, features = ["secp256k1"], optional = true }
|
||||
|
||||
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
|
||||
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["secp256k1"], optional = true }
|
||||
|
||||
hex = { version = "0.4", default-features = false, optional = true }
|
||||
serde = { version = "1", default-features = false, features = ["derive"], optional = true }
|
||||
@@ -35,7 +36,7 @@ serde_json = { version = "1", default-features = false, optional = true }
|
||||
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls", "basic-auth"], optional = true }
|
||||
|
||||
[dev-dependencies]
|
||||
secp256k1 = { version = "0.29", default-features = false, features = ["std"] }
|
||||
secp256k1 = { version = "0.28", default-features = false, features = ["std"] }
|
||||
|
||||
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
||||
|
||||
@@ -45,9 +46,8 @@ tokio = { version = "1", features = ["macros"] }
|
||||
std = [
|
||||
"std-shims/std",
|
||||
|
||||
"thiserror/std",
|
||||
"thiserror",
|
||||
|
||||
"subtle/std",
|
||||
"zeroize/std",
|
||||
"rand_core/std",
|
||||
|
||||
@@ -55,6 +55,8 @@ std = [
|
||||
"bitcoin/serde",
|
||||
|
||||
"k256/std",
|
||||
|
||||
"transcript/std",
|
||||
"frost",
|
||||
|
||||
"hex/std",
|
||||
@@ -1,6 +1,6 @@
|
||||
MIT License
|
||||
|
||||
Copyright (c) 2022-2025 Luke Parker
|
||||
Copyright (c) 2022-2023 Luke Parker
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software and associated documentation files (the "Software"), to deal
|
||||
@@ -1,30 +1,33 @@
|
||||
#[cfg(feature = "std")]
|
||||
use subtle::{Choice, ConstantTimeEq, ConditionallySelectable};
|
||||
|
||||
use k256::{elliptic_curve::sec1::ToEncodedPoint, ProjectivePoint};
|
||||
use k256::{
|
||||
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
||||
ProjectivePoint,
|
||||
};
|
||||
|
||||
use bitcoin::key::XOnlyPublicKey;
|
||||
|
||||
/// Get the x coordinate of a non-infinity point.
|
||||
///
|
||||
/// Panics on invalid input.
|
||||
fn x(key: &ProjectivePoint) -> [u8; 32] {
|
||||
/// Get the x coordinate of a non-infinity, even point. Panics on invalid input.
|
||||
pub fn x(key: &ProjectivePoint) -> [u8; 32] {
|
||||
let encoded = key.to_encoded_point(true);
|
||||
assert_eq!(encoded.tag(), Tag::CompressedEvenY, "x coordinate of odd key");
|
||||
(*encoded.x().expect("point at infinity")).into()
|
||||
}
|
||||
|
||||
/// Convert a non-infinity point to a XOnlyPublicKey (dropping its sign).
|
||||
///
|
||||
/// Panics on invalid input.
|
||||
pub(crate) fn x_only(key: &ProjectivePoint) -> XOnlyPublicKey {
|
||||
/// Convert a non-infinity even point to a XOnlyPublicKey. Panics on invalid input.
|
||||
pub fn x_only(key: &ProjectivePoint) -> XOnlyPublicKey {
|
||||
XOnlyPublicKey::from_slice(&x(key)).expect("x_only was passed a point which was infinity or odd")
|
||||
}
|
||||
|
||||
/// Return if a point must be negated to have an even Y coordinate and be eligible for use.
|
||||
#[cfg(feature = "std")]
|
||||
pub(crate) fn needs_negation(key: &ProjectivePoint) -> Choice {
|
||||
use k256::elliptic_curve::sec1::Tag;
|
||||
u8::from(key.to_encoded_point(true).tag()).ct_eq(&u8::from(Tag::CompressedOddY))
|
||||
/// Make a point even by adding the generator until it is even.
|
||||
///
|
||||
/// Returns the even point and the amount of additions required.
|
||||
#[cfg(any(feature = "std", feature = "hazmat"))]
|
||||
pub fn make_even(mut key: ProjectivePoint) -> (ProjectivePoint, u64) {
|
||||
let mut c = 0;
|
||||
while key.to_encoded_point(true).tag() == Tag::CompressedOddY {
|
||||
key += ProjectivePoint::GENERATOR;
|
||||
c += 1;
|
||||
}
|
||||
(key, c)
|
||||
}
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
@@ -37,62 +40,58 @@ mod frost_crypto {
|
||||
|
||||
use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256};
|
||||
|
||||
use transcript::Transcript;
|
||||
|
||||
use k256::{elliptic_curve::ops::Reduce, U256, Scalar};
|
||||
|
||||
use frost::{
|
||||
curve::{WrappedGroup, Secp256k1},
|
||||
curve::{Ciphersuite, Secp256k1},
|
||||
Participant, ThresholdKeys, ThresholdView, FrostError,
|
||||
algorithm::{Hram as HramTrait, Algorithm, IetfSchnorr as FrostSchnorr},
|
||||
algorithm::{Hram as HramTrait, Algorithm, Schnorr as FrostSchnorr},
|
||||
};
|
||||
|
||||
use super::*;
|
||||
|
||||
/// A BIP-340 compatible HRAm for use with the modular-frost Schnorr Algorithm.
|
||||
///
|
||||
/// If passed an odd nonce, the challenge will be negated.
|
||||
/// If passed an odd nonce, it will have the generator added until it is even.
|
||||
///
|
||||
/// If either `R` or `A` is the point at infinity, this will panic.
|
||||
/// If the key is odd, this will panic.
|
||||
#[derive(Clone, Copy, Debug)]
|
||||
pub struct Hram;
|
||||
#[allow(non_snake_case)]
|
||||
impl HramTrait<Secp256k1> for Hram {
|
||||
fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar {
|
||||
// Convert the nonce to be even
|
||||
let (R, _) = make_even(*R);
|
||||
|
||||
const TAG_HASH: Sha256 = Sha256::const_hash(b"BIP0340/challenge");
|
||||
|
||||
let mut data = Sha256::engine();
|
||||
data.input(TAG_HASH.as_ref());
|
||||
data.input(TAG_HASH.as_ref());
|
||||
data.input(&x(R));
|
||||
data.input(&x(&R));
|
||||
data.input(&x(A));
|
||||
data.input(m);
|
||||
|
||||
let c = Scalar::reduce(U256::from_be_slice(Sha256::from_engine(data).as_ref()));
|
||||
// If the nonce was odd, sign `r - cx` instead of `r + cx`, allowing us to negate `s` at the
|
||||
// end to sign as `-r + cx`
|
||||
<_>::conditional_select(&c, &-c, needs_negation(R))
|
||||
Scalar::reduce(U256::from_be_slice(Sha256::from_engine(data).as_ref()))
|
||||
}
|
||||
}
|
||||
|
||||
/// BIP-340 Schnorr signature algorithm.
|
||||
///
|
||||
/// This may panic if called with nonces/a group key which are the point at infinity (which have
|
||||
/// a negligible probability for a well-reasoned caller, even with malicious participants
|
||||
/// present).
|
||||
///
|
||||
/// `verify`, `verify_share` MUST be called after `sign_share` is called. Otherwise, this library
|
||||
/// MAY panic.
|
||||
/// This must be used with a ThresholdKeys whose group key is even. If it is odd, this will panic.
|
||||
#[derive(Clone)]
|
||||
pub struct Schnorr(FrostSchnorr<Secp256k1, Hram>);
|
||||
impl Schnorr {
|
||||
pub struct Schnorr<T: Sync + Clone + Debug + Transcript>(FrostSchnorr<Secp256k1, T, Hram>);
|
||||
impl<T: Sync + Clone + Debug + Transcript> Schnorr<T> {
|
||||
/// Construct a Schnorr algorithm continuing the specified transcript.
|
||||
#[allow(clippy::new_without_default)]
|
||||
pub fn new() -> Schnorr {
|
||||
Schnorr(FrostSchnorr::ietf())
|
||||
pub fn new(transcript: T) -> Schnorr<T> {
|
||||
Schnorr(FrostSchnorr::new(transcript))
|
||||
}
|
||||
}
|
||||
|
||||
impl Algorithm<Secp256k1> for Schnorr {
|
||||
type Transcript = <FrostSchnorr<Secp256k1, Hram> as Algorithm<Secp256k1>>::Transcript;
|
||||
impl<T: Sync + Clone + Debug + Transcript> Algorithm<Secp256k1> for Schnorr<T> {
|
||||
type Transcript = T;
|
||||
type Addendum = ();
|
||||
type Signature = [u8; 64];
|
||||
|
||||
@@ -128,13 +127,14 @@ mod frost_crypto {
|
||||
fn sign_share(
|
||||
&mut self,
|
||||
params: &ThresholdView<Secp256k1>,
|
||||
nonce_sums: &[Vec<<Secp256k1 as WrappedGroup>::G>],
|
||||
nonces: Vec<Zeroizing<<Secp256k1 as WrappedGroup>::F>>,
|
||||
nonce_sums: &[Vec<<Secp256k1 as Ciphersuite>::G>],
|
||||
nonces: Vec<Zeroizing<<Secp256k1 as Ciphersuite>::F>>,
|
||||
msg: &[u8],
|
||||
) -> <Secp256k1 as WrappedGroup>::F {
|
||||
) -> <Secp256k1 as Ciphersuite>::F {
|
||||
self.0.sign_share(params, nonce_sums, nonces, msg)
|
||||
}
|
||||
|
||||
#[must_use]
|
||||
fn verify(
|
||||
&self,
|
||||
group_key: ProjectivePoint,
|
||||
@@ -142,7 +142,11 @@ mod frost_crypto {
|
||||
sum: Scalar,
|
||||
) -> Option<Self::Signature> {
|
||||
self.0.verify(group_key, nonces, sum).map(|mut sig| {
|
||||
sig.s = <_>::conditional_select(&sum, &-sum, needs_negation(&sig.R));
|
||||
// Make the R of the final signature even
|
||||
let offset;
|
||||
(sig.R, offset) = make_even(sig.R);
|
||||
// s = r + cx. Since we added to the r, add to s
|
||||
sig.s += Scalar::from(offset);
|
||||
// Convert to a Bitcoin signature by dropping the byte for the point's sign bit
|
||||
sig.serialize()[1 ..].try_into().unwrap()
|
||||
})
|
||||
@@ -195,13 +195,13 @@ impl Rpc {
|
||||
// If this was already successfully published, consider this having succeeded
|
||||
if let RpcError::RequestError(Error { code, .. }) = e {
|
||||
if code == RPC_VERIFY_ALREADY_IN_CHAIN {
|
||||
return Ok(tx.compute_txid());
|
||||
return Ok(tx.txid());
|
||||
}
|
||||
}
|
||||
Err(e)?
|
||||
}
|
||||
};
|
||||
if txid != tx.compute_txid() {
|
||||
if txid != tx.txid() {
|
||||
Err(RpcError::InvalidResponse("returned TX ID inequals calculated TX ID"))?;
|
||||
}
|
||||
Ok(txid)
|
||||
@@ -215,7 +215,7 @@ impl Rpc {
|
||||
let tx: Transaction = encode::deserialize(&bytes)
|
||||
.map_err(|_| RpcError::InvalidResponse("node sent an improperly serialized transaction"))?;
|
||||
|
||||
let mut tx_hash = *tx.compute_txid().as_raw_hash().as_byte_array();
|
||||
let mut tx_hash = *tx.txid().as_raw_hash().as_byte_array();
|
||||
tx_hash.reverse();
|
||||
if hash != &tx_hash {
|
||||
Err(RpcError::InvalidResponse("node replied with a different transaction"))?;
|
||||
@@ -2,6 +2,8 @@ use rand_core::OsRng;
|
||||
|
||||
use secp256k1::{Secp256k1 as BContext, Message, schnorr::Signature};
|
||||
|
||||
use k256::Scalar;
|
||||
use transcript::{Transcript, RecommendedTranscript};
|
||||
use frost::{
|
||||
curve::Secp256k1,
|
||||
Participant,
|
||||
@@ -10,8 +12,7 @@ use frost::{
|
||||
|
||||
use crate::{
|
||||
bitcoin::hashes::{Hash as HashTrait, sha256::Hash},
|
||||
crypto::{x_only, Schnorr},
|
||||
wallet::tweak_keys,
|
||||
crypto::{x_only, make_even, Schnorr},
|
||||
};
|
||||
|
||||
#[test]
|
||||
@@ -20,10 +21,12 @@ fn test_algorithm() {
|
||||
const MESSAGE: &[u8] = b"Hello, World!";
|
||||
|
||||
for keys in keys.values_mut() {
|
||||
*keys = tweak_keys(keys.clone());
|
||||
let (_, offset) = make_even(keys.group_key());
|
||||
*keys = keys.offset(Scalar::from(offset));
|
||||
}
|
||||
|
||||
let algo = Schnorr::new();
|
||||
let algo =
|
||||
Schnorr::<RecommendedTranscript>::new(RecommendedTranscript::new(b"bitcoin-serai sign test"));
|
||||
let sig = sign(
|
||||
&mut OsRng,
|
||||
&algo,
|
||||
@@ -36,7 +39,7 @@ fn test_algorithm() {
|
||||
.verify_schnorr(
|
||||
&Signature::from_slice(&sig)
|
||||
.expect("couldn't convert produced signature to secp256k1::Signature"),
|
||||
&Message::from_digest_slice(Hash::hash(MESSAGE).as_ref()).unwrap(),
|
||||
&Message::from(Hash::hash(MESSAGE)),
|
||||
&x_only(&keys[&Participant::new(1).unwrap()].group_key()),
|
||||
)
|
||||
.unwrap()
|
||||
@@ -4,7 +4,7 @@ use std_shims::{
|
||||
io::{self, Write},
|
||||
};
|
||||
#[cfg(feature = "std")]
|
||||
use std::io::{Read, BufReader};
|
||||
use std_shims::io::Read;
|
||||
|
||||
use k256::{
|
||||
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
||||
@@ -13,76 +13,45 @@ use k256::{
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
use frost::{
|
||||
curve::{WrappedGroup, GroupIo, Secp256k1},
|
||||
curve::{Ciphersuite, Secp256k1},
|
||||
ThresholdKeys,
|
||||
};
|
||||
|
||||
use bitcoin::{
|
||||
consensus::encode::serialize, key::TweakedPublicKey, OutPoint, ScriptBuf, TxOut, Transaction,
|
||||
Block,
|
||||
consensus::encode::serialize, key::TweakedPublicKey, address::Payload, OutPoint, ScriptBuf,
|
||||
TxOut, Transaction, Block,
|
||||
};
|
||||
#[cfg(feature = "std")]
|
||||
use bitcoin::{hashes::Hash, consensus::encode::Decodable, TapTweakHash};
|
||||
use bitcoin::consensus::encode::Decodable;
|
||||
|
||||
use crate::crypto::x_only;
|
||||
#[cfg(feature = "std")]
|
||||
use crate::crypto::needs_negation;
|
||||
use crate::crypto::make_even;
|
||||
|
||||
#[cfg(feature = "std")]
|
||||
mod send;
|
||||
#[cfg(feature = "std")]
|
||||
pub use send::*;
|
||||
|
||||
/// Tweak keys to ensure they're usable with Bitcoin's Taproot upgrade.
|
||||
/// Tweak keys to ensure they're usable with Bitcoin.
|
||||
///
|
||||
/// This adds an unspendable script path to the key, preventing any outputs received to this key
|
||||
/// from being spent via a script. To have keys which have spendable script paths, further offsets
|
||||
/// from this position must be used.
|
||||
///
|
||||
/// After adding an unspendable script path, the key is negated if odd.
|
||||
///
|
||||
/// This has a neligible probability of returning keys whose group key is the point at infinity.
|
||||
/// Taproot keys, which these keys are used as, must be even. This offsets the keys until they're
|
||||
/// even.
|
||||
#[cfg(feature = "std")]
|
||||
pub fn tweak_keys(keys: ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
|
||||
// Adds the unspendable script path per
|
||||
// https://github.com/bitcoin/bips/blob/master/bip-0341.mediawiki#cite_note-23
|
||||
let keys = {
|
||||
use k256::elliptic_curve::{
|
||||
bigint::{Encoding, U256},
|
||||
ops::Reduce,
|
||||
group::GroupEncoding,
|
||||
};
|
||||
let tweak_hash = TapTweakHash::hash(&keys.group_key().to_bytes().as_slice()[1 ..]);
|
||||
/*
|
||||
https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki#cite_ref-13-0 states how the
|
||||
bias is negligible. This reduction shouldn't ever occur, yet if it did, the script path
|
||||
would be unusable due to a check the script path hash is less than the order. That doesn't
|
||||
impact us as we don't want the script path to be usable.
|
||||
*/
|
||||
keys.offset(<Secp256k1 as WrappedGroup>::F::reduce(U256::from_be_bytes(
|
||||
*tweak_hash.to_raw_hash().as_ref(),
|
||||
)))
|
||||
};
|
||||
|
||||
let needs_negation = needs_negation(&keys.group_key());
|
||||
keys
|
||||
.scale(<_ as subtle::ConditionallySelectable>::conditional_select(
|
||||
&Scalar::ONE,
|
||||
&-Scalar::ONE,
|
||||
needs_negation,
|
||||
))
|
||||
.expect("scaling keys by 1 or -1 yet interpreted as 0?")
|
||||
pub fn tweak_keys(keys: &ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
|
||||
let (_, offset) = make_even(keys.group_key());
|
||||
keys.offset(Scalar::from(offset))
|
||||
}
|
||||
|
||||
/// Return the Taproot address payload for a public key.
|
||||
///
|
||||
/// If the key is odd, this will return None.
|
||||
pub fn p2tr_script_buf(key: ProjectivePoint) -> Option<ScriptBuf> {
|
||||
pub fn address_payload(key: ProjectivePoint) -> Option<Payload> {
|
||||
if key.to_encoded_point(true).tag() != Tag::CompressedEvenY {
|
||||
return None;
|
||||
}
|
||||
|
||||
Some(ScriptBuf::new_p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key))))
|
||||
Some(Payload::p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key))))
|
||||
}
|
||||
|
||||
/// A spendable output.
|
||||
@@ -120,17 +89,11 @@ impl ReceivedOutput {
|
||||
/// Read a ReceivedOutput from a generic satisfying Read.
|
||||
#[cfg(feature = "std")]
|
||||
pub fn read<R: Read>(r: &mut R) -> io::Result<ReceivedOutput> {
|
||||
let offset = Secp256k1::read_F(r)?;
|
||||
let output;
|
||||
let outpoint;
|
||||
{
|
||||
let mut buf_r = BufReader::with_capacity(0, r);
|
||||
output =
|
||||
TxOut::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid TxOut"))?;
|
||||
outpoint =
|
||||
OutPoint::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid OutPoint"))?;
|
||||
}
|
||||
Ok(ReceivedOutput { offset, output, outpoint })
|
||||
Ok(ReceivedOutput {
|
||||
offset: Secp256k1::read_F(r)?,
|
||||
output: TxOut::consensus_decode(r).map_err(|_| io::Error::other("invalid TxOut"))?,
|
||||
outpoint: OutPoint::consensus_decode(r).map_err(|_| io::Error::other("invalid OutPoint"))?,
|
||||
})
|
||||
}
|
||||
|
||||
/// Write a ReceivedOutput to a generic satisfying Write.
|
||||
@@ -161,7 +124,7 @@ impl Scanner {
|
||||
/// Returns None if this key can't be scanned for.
|
||||
pub fn new(key: ProjectivePoint) -> Option<Scanner> {
|
||||
let mut scripts = HashMap::new();
|
||||
scripts.insert(p2tr_script_buf(key)?, Scalar::ZERO);
|
||||
scripts.insert(address_payload(key)?.script_pubkey(), Scalar::ZERO);
|
||||
Some(Scanner { key, scripts })
|
||||
}
|
||||
|
||||
@@ -173,17 +136,14 @@ impl Scanner {
|
||||
///
|
||||
/// This means offsets are surjective, not bijective, and the order offsets are registered in
|
||||
/// may determine the validity of future offsets.
|
||||
///
|
||||
/// The offsets registered must be securely generated. Arbitrary offsets may introduce a script
|
||||
/// path into the output, allowing the output to be spent by satisfaction of an arbitrary script
|
||||
/// (not by the signature of the key).
|
||||
pub fn register_offset(&mut self, mut offset: Scalar) -> Option<Scalar> {
|
||||
// This loop will terminate as soon as an even point is found, with any point having a ~50%
|
||||
// chance of being even
|
||||
// That means this should terminate within a very small amount of iterations
|
||||
loop {
|
||||
match p2tr_script_buf(self.key + (ProjectivePoint::GENERATOR * offset)) {
|
||||
Some(script) => {
|
||||
match address_payload(self.key + (ProjectivePoint::GENERATOR * offset)) {
|
||||
Some(address) => {
|
||||
let script = address.script_pubkey();
|
||||
if self.scripts.contains_key(&script) {
|
||||
None?;
|
||||
}
|
||||
@@ -206,7 +166,7 @@ impl Scanner {
|
||||
res.push(ReceivedOutput {
|
||||
offset: *offset,
|
||||
output: output.clone(),
|
||||
outpoint: OutPoint::new(tx.compute_txid(), vout),
|
||||
outpoint: OutPoint::new(tx.txid(), vout),
|
||||
});
|
||||
}
|
||||
}
|
||||
@@ -7,7 +7,9 @@ use thiserror::Error;
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use k256::Scalar;
|
||||
use transcript::{Transcript, RecommendedTranscript};
|
||||
|
||||
use k256::{elliptic_curve::sec1::ToEncodedPoint, Scalar};
|
||||
use frost::{curve::Secp256k1, Participant, ThresholdKeys, FrostError, sign::*};
|
||||
|
||||
use bitcoin::{
|
||||
@@ -16,12 +18,12 @@ use bitcoin::{
|
||||
absolute::LockTime,
|
||||
script::{PushBytesBuf, ScriptBuf},
|
||||
transaction::{Version, Transaction},
|
||||
OutPoint, Sequence, Witness, TxIn, Amount, TxOut,
|
||||
OutPoint, Sequence, Witness, TxIn, Amount, TxOut, Address,
|
||||
};
|
||||
|
||||
use crate::{
|
||||
crypto::Schnorr,
|
||||
wallet::{ReceivedOutput, p2tr_script_buf},
|
||||
wallet::{ReceivedOutput, address_payload},
|
||||
};
|
||||
|
||||
#[rustfmt::skip]
|
||||
@@ -44,7 +46,7 @@ pub enum TransactionError {
|
||||
#[error("fee was too low to pass the default minimum fee rate")]
|
||||
TooLowFee,
|
||||
#[error("not enough funds for these payments")]
|
||||
NotEnoughFunds { inputs: u64, payments: u64, fee: u64 },
|
||||
NotEnoughFunds,
|
||||
#[error("transaction was too large")]
|
||||
TooLargeTransaction,
|
||||
}
|
||||
@@ -59,11 +61,7 @@ pub struct SignableTransaction {
|
||||
}
|
||||
|
||||
impl SignableTransaction {
|
||||
fn calculate_weight_vbytes(
|
||||
inputs: usize,
|
||||
payments: &[(ScriptBuf, u64)],
|
||||
change: Option<&ScriptBuf>,
|
||||
) -> (u64, u64) {
|
||||
fn calculate_weight(inputs: usize, payments: &[(Address, u64)], change: Option<&Address>) -> u64 {
|
||||
// Expand this a full transaction in order to use the bitcoin library's weight function
|
||||
let mut tx = Transaction {
|
||||
version: Version(2),
|
||||
@@ -88,42 +86,16 @@ impl SignableTransaction {
|
||||
// The script pub key is not of a fixed size and does have to be used here
|
||||
.map(|payment| TxOut {
|
||||
value: Amount::from_sat(payment.1),
|
||||
script_pubkey: payment.0.clone(),
|
||||
script_pubkey: payment.0.script_pubkey(),
|
||||
})
|
||||
.collect(),
|
||||
};
|
||||
if let Some(change) = change {
|
||||
// Use a 0 value since we're currently unsure what the change amount will be, and since
|
||||
// the value is fixed size (so any value could be used here)
|
||||
tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.clone() });
|
||||
tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.script_pubkey() });
|
||||
}
|
||||
|
||||
let weight = tx.weight();
|
||||
|
||||
// Now calculate the size in vbytes
|
||||
|
||||
/*
|
||||
"Virtual transaction size" is weight ceildiv 4 per
|
||||
https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
|
||||
|
||||
https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04
|
||||
/src/policy/policy.cpp#L295-L298
|
||||
implements this almost as expected, with an additional consideration to signature operations
|
||||
|
||||
Signature operations (the second argument of the following call) do not count Taproot
|
||||
signatures per https://github.com/bitcoin/bips/blob/master/bip-0342.mediawiki#cite_ref-11-0
|
||||
|
||||
We don't risk running afoul of the Taproot signature limit as it allows at least one per
|
||||
input, which is all we use
|
||||
*/
|
||||
(
|
||||
weight.to_wu(),
|
||||
u64::try_from(bitcoin::policy::get_virtual_tx_size(
|
||||
i64::try_from(weight.to_wu()).unwrap(),
|
||||
0i64,
|
||||
))
|
||||
.unwrap(),
|
||||
)
|
||||
u64::from(tx.weight())
|
||||
}
|
||||
|
||||
/// Returns the fee necessary for this transaction to achieve the fee rate specified at
|
||||
@@ -149,10 +121,10 @@ impl SignableTransaction {
|
||||
/// If data is specified, an OP_RETURN output will be added with it.
|
||||
pub fn new(
|
||||
mut inputs: Vec<ReceivedOutput>,
|
||||
payments: &[(ScriptBuf, u64)],
|
||||
change: Option<ScriptBuf>,
|
||||
payments: &[(Address, u64)],
|
||||
change: Option<&Address>,
|
||||
data: Option<Vec<u8>>,
|
||||
fee_per_vbyte: u64,
|
||||
fee_per_weight: u64,
|
||||
) -> Result<SignableTransaction, TransactionError> {
|
||||
if inputs.is_empty() {
|
||||
Err(TransactionError::NoInputs)?;
|
||||
@@ -187,7 +159,10 @@ impl SignableTransaction {
|
||||
let payment_sat = payments.iter().map(|payment| payment.1).sum::<u64>();
|
||||
let mut tx_outs = payments
|
||||
.iter()
|
||||
.map(|payment| TxOut { value: Amount::from_sat(payment.1), script_pubkey: payment.0.clone() })
|
||||
.map(|payment| TxOut {
|
||||
value: Amount::from_sat(payment.1),
|
||||
script_pubkey: payment.0.script_pubkey(),
|
||||
})
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
// Add the OP_RETURN output
|
||||
@@ -201,33 +176,49 @@ impl SignableTransaction {
|
||||
})
|
||||
}
|
||||
|
||||
let (mut weight, vbytes) = Self::calculate_weight_vbytes(tx_ins.len(), payments, None);
|
||||
let mut weight = Self::calculate_weight(tx_ins.len(), payments, None);
|
||||
let mut needed_fee = fee_per_weight * weight;
|
||||
|
||||
let mut needed_fee = fee_per_vbyte * vbytes;
|
||||
// "Virtual transaction size" is weight ceildiv 4 per
|
||||
// https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
|
||||
|
||||
// https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04/
|
||||
// src/policy/policy.cpp#L295-L298
|
||||
// implements this as expected
|
||||
|
||||
// Technically, it takes whatever's greater, the weight or the amount of signature operations
|
||||
// multiplied by DEFAULT_BYTES_PER_SIGOP (20)
|
||||
// We only use 1 signature per input, and our inputs have a weight exceeding 20
|
||||
// Accordingly, our inputs' weight will always be greater than the cost of the signature ops
|
||||
let vsize = weight.div_ceil(4);
|
||||
debug_assert_eq!(
|
||||
u64::try_from(bitcoin::policy::get_virtual_tx_size(
|
||||
weight.try_into().unwrap(),
|
||||
tx_ins.len().try_into().unwrap()
|
||||
))
|
||||
.unwrap(),
|
||||
vsize
|
||||
);
|
||||
// Technically, if there isn't change, this TX may still pay enough of a fee to pass the
|
||||
// minimum fee. Such edge cases aren't worth programming when they go against intent, as the
|
||||
// specified fee rate is too low to be valid
|
||||
// bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE is in sats/kilo-vbyte
|
||||
if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vbytes) / 1000) {
|
||||
if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vsize) / 1000) {
|
||||
Err(TransactionError::TooLowFee)?;
|
||||
}
|
||||
|
||||
if input_sat < (payment_sat + needed_fee) {
|
||||
Err(TransactionError::NotEnoughFunds {
|
||||
inputs: input_sat,
|
||||
payments: payment_sat,
|
||||
fee: needed_fee,
|
||||
})?;
|
||||
Err(TransactionError::NotEnoughFunds)?;
|
||||
}
|
||||
|
||||
// If there's a change address, check if there's change to give it
|
||||
if let Some(change) = change {
|
||||
let (weight_with_change, vbytes_with_change) =
|
||||
Self::calculate_weight_vbytes(tx_ins.len(), payments, Some(&change));
|
||||
let fee_with_change = fee_per_vbyte * vbytes_with_change;
|
||||
let weight_with_change = Self::calculate_weight(tx_ins.len(), payments, Some(change));
|
||||
let fee_with_change = fee_per_weight * weight_with_change;
|
||||
if let Some(value) = input_sat.checked_sub(payment_sat + fee_with_change) {
|
||||
if value >= DUST {
|
||||
tx_outs.push(TxOut { value: Amount::from_sat(value), script_pubkey: change });
|
||||
tx_outs
|
||||
.push(TxOut { value: Amount::from_sat(value), script_pubkey: change.script_pubkey() });
|
||||
weight = weight_with_change;
|
||||
needed_fee = fee_with_change;
|
||||
}
|
||||
@@ -257,28 +248,54 @@ impl SignableTransaction {
|
||||
|
||||
/// Returns the TX ID of the transaction this will create.
|
||||
pub fn txid(&self) -> [u8; 32] {
|
||||
let mut res = self.tx.compute_txid().to_byte_array();
|
||||
let mut res = self.tx.txid().to_byte_array();
|
||||
res.reverse();
|
||||
res
|
||||
}
|
||||
|
||||
/// Returns the transaction, sans witness, this will create if signed.
|
||||
pub fn transaction(&self) -> &Transaction {
|
||||
&self.tx
|
||||
/// Returns the outputs this transaction will create.
|
||||
pub fn outputs(&self) -> &[TxOut] {
|
||||
&self.tx.output
|
||||
}
|
||||
|
||||
/// Create a multisig machine for this transaction.
|
||||
///
|
||||
/// Returns None if the wrong keys are used.
|
||||
pub fn multisig(self, keys: &ThresholdKeys<Secp256k1>) -> Option<TransactionMachine> {
|
||||
pub fn multisig(
|
||||
self,
|
||||
keys: &ThresholdKeys<Secp256k1>,
|
||||
mut transcript: RecommendedTranscript,
|
||||
) -> Option<TransactionMachine> {
|
||||
transcript.domain_separate(b"bitcoin_transaction");
|
||||
transcript.append_message(b"root_key", keys.group_key().to_encoded_point(true).as_bytes());
|
||||
|
||||
// Transcript the inputs and outputs
|
||||
let tx = &self.tx;
|
||||
for input in &tx.input {
|
||||
transcript.append_message(b"input_hash", input.previous_output.txid);
|
||||
transcript.append_message(b"input_output_index", input.previous_output.vout.to_le_bytes());
|
||||
}
|
||||
for payment in &tx.output {
|
||||
transcript.append_message(b"output_script", payment.script_pubkey.as_bytes());
|
||||
transcript.append_message(b"output_amount", payment.value.to_sat().to_le_bytes());
|
||||
}
|
||||
|
||||
let mut sigs = vec![];
|
||||
for i in 0 .. self.tx.input.len() {
|
||||
for i in 0 .. tx.input.len() {
|
||||
let mut transcript = transcript.clone();
|
||||
// This unwrap is safe since any transaction with this many inputs violates the maximum
|
||||
// size allowed under standards, which this lib will error on creation of
|
||||
transcript.append_message(b"signing_input", u32::try_from(i).unwrap().to_le_bytes());
|
||||
|
||||
let offset = keys.clone().offset(self.offsets[i]);
|
||||
if p2tr_script_buf(offset.group_key())? != self.prevouts[i].script_pubkey {
|
||||
if address_payload(offset.group_key())?.script_pubkey() != self.prevouts[i].script_pubkey {
|
||||
None?;
|
||||
}
|
||||
|
||||
sigs.push(AlgorithmMachine::new(Schnorr::new(), keys.clone().offset(self.offsets[i])));
|
||||
sigs.push(AlgorithmMachine::new(
|
||||
Schnorr::new(transcript),
|
||||
keys.clone().offset(self.offsets[i]),
|
||||
));
|
||||
}
|
||||
|
||||
Some(TransactionMachine { tx: self, sigs })
|
||||
@@ -288,10 +305,10 @@ impl SignableTransaction {
|
||||
/// A FROST signing machine to produce a Bitcoin transaction.
|
||||
///
|
||||
/// This does not support caching its preprocess. When sign is called, the message must be empty.
|
||||
/// This will panic if either `cache`, `from_cache` is called or the message isn't empty.
|
||||
/// This will panic if either `cache` is called or the message isn't empty.
|
||||
pub struct TransactionMachine {
|
||||
tx: SignableTransaction,
|
||||
sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr>>,
|
||||
sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||
}
|
||||
|
||||
impl PreprocessMachine for TransactionMachine {
|
||||
@@ -320,7 +337,7 @@ impl PreprocessMachine for TransactionMachine {
|
||||
|
||||
pub struct TransactionSignMachine {
|
||||
tx: SignableTransaction,
|
||||
sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr>>,
|
||||
sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||
}
|
||||
|
||||
impl SignMachine<Transaction> for TransactionSignMachine {
|
||||
@@ -358,7 +375,7 @@ impl SignMachine<Transaction> for TransactionSignMachine {
|
||||
msg: &[u8],
|
||||
) -> Result<(TransactionSignatureMachine, Self::SignatureShare), FrostError> {
|
||||
if !msg.is_empty() {
|
||||
panic!("message was passed to the TransactionSignMachine when it generates its own");
|
||||
panic!("message was passed to the TransactionMachine when it generates its own");
|
||||
}
|
||||
|
||||
let commitments = (0 .. self.sigs.len())
|
||||
@@ -400,7 +417,7 @@ impl SignMachine<Transaction> for TransactionSignMachine {
|
||||
|
||||
pub struct TransactionSignatureMachine {
|
||||
tx: Transaction,
|
||||
sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr>>,
|
||||
sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||
}
|
||||
|
||||
impl SignatureMachine<Transaction> for TransactionSignatureMachine {
|
||||
@@ -1,11 +1,14 @@
|
||||
use std::sync::LazyLock;
|
||||
use std::sync::OnceLock;
|
||||
|
||||
use bitcoin_serai::rpc::Rpc;
|
||||
|
||||
use tokio::sync::Mutex;
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub(crate) static SEQUENTIAL: LazyLock<Mutex<()>> = LazyLock::new(|| Mutex::new(()));
|
||||
static SEQUENTIAL_CELL: OnceLock<Mutex<()>> = OnceLock::new();
|
||||
#[allow(non_snake_case)]
|
||||
pub fn SEQUENTIAL() -> &'static Mutex<()> {
|
||||
SEQUENTIAL_CELL.get_or_init(|| Mutex::new(()))
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub(crate) async fn rpc() -> Rpc {
|
||||
@@ -31,7 +34,7 @@ macro_rules! async_sequential {
|
||||
$(
|
||||
#[tokio::test]
|
||||
async fn $name() {
|
||||
let guard = runner::SEQUENTIAL.lock().await;
|
||||
let guard = runner::SEQUENTIAL().lock().await;
|
||||
let local = tokio::task::LocalSet::new();
|
||||
local.run_until(async move {
|
||||
if let Err(err) = tokio::task::spawn_local(async move { $body }).await {
|
||||
@@ -2,6 +2,8 @@ use std::collections::HashMap;
|
||||
|
||||
use rand_core::{RngCore, OsRng};
|
||||
|
||||
use transcript::{Transcript, RecommendedTranscript};
|
||||
|
||||
use k256::{
|
||||
elliptic_curve::{
|
||||
group::{ff::Field, Group},
|
||||
@@ -20,10 +22,11 @@ use bitcoin_serai::{
|
||||
hashes::Hash as HashTrait,
|
||||
blockdata::opcodes::all::OP_RETURN,
|
||||
script::{PushBytesBuf, Instruction, Instructions, Script},
|
||||
address::NetworkChecked,
|
||||
OutPoint, Amount, TxOut, Transaction, Network, Address,
|
||||
},
|
||||
wallet::{
|
||||
tweak_keys, p2tr_script_buf, ReceivedOutput, Scanner, TransactionError, SignableTransaction,
|
||||
tweak_keys, address_payload, ReceivedOutput, Scanner, TransactionError, SignableTransaction,
|
||||
},
|
||||
rpc::Rpc,
|
||||
};
|
||||
@@ -45,7 +48,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
||||
"generatetoaddress",
|
||||
serde_json::json!([
|
||||
1,
|
||||
Address::from_script(&p2tr_script_buf(key).unwrap(), Network::Regtest).unwrap()
|
||||
Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())
|
||||
]),
|
||||
)
|
||||
.await
|
||||
@@ -66,7 +69,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
||||
assert_eq!(outputs, scanner.scan_transaction(&block.txdata[0]));
|
||||
|
||||
assert_eq!(outputs.len(), 1);
|
||||
assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].compute_txid(), 0));
|
||||
assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].txid(), 0));
|
||||
assert_eq!(outputs[0].value(), block.txdata[0].output[0].value.to_sat());
|
||||
|
||||
assert_eq!(
|
||||
@@ -80,7 +83,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
||||
fn keys() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, ProjectivePoint) {
|
||||
let mut keys = key_gen(&mut OsRng);
|
||||
for keys in keys.values_mut() {
|
||||
*keys = tweak_keys(keys.clone());
|
||||
*keys = tweak_keys(keys);
|
||||
}
|
||||
let key = keys.values().next().unwrap().group_key();
|
||||
(keys, key)
|
||||
@@ -92,11 +95,46 @@ fn sign(
|
||||
) -> Transaction {
|
||||
let mut machines = HashMap::new();
|
||||
for i in (1 ..= THRESHOLD).map(|i| Participant::new(i).unwrap()) {
|
||||
machines.insert(i, tx.clone().multisig(&keys[&i].clone()).unwrap());
|
||||
machines.insert(
|
||||
i,
|
||||
tx.clone()
|
||||
.multisig(&keys[&i].clone(), RecommendedTranscript::new(b"bitcoin-serai Test Transaction"))
|
||||
.unwrap(),
|
||||
);
|
||||
}
|
||||
sign_without_caching(&mut OsRng, machines, &[])
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_tweak_keys() {
|
||||
let mut even = false;
|
||||
let mut odd = false;
|
||||
|
||||
// Generate keys until we get an even set and an odd set
|
||||
while !(even && odd) {
|
||||
let mut keys = key_gen(&mut OsRng).drain().next().unwrap().1;
|
||||
if is_even(keys.group_key()) {
|
||||
// Tweaking should do nothing
|
||||
assert_eq!(tweak_keys(&keys).group_key(), keys.group_key());
|
||||
|
||||
even = true;
|
||||
} else {
|
||||
let tweaked = tweak_keys(&keys).group_key();
|
||||
assert_ne!(tweaked, keys.group_key());
|
||||
// Tweaking should produce an even key
|
||||
assert!(is_even(tweaked));
|
||||
|
||||
// Verify it uses the smallest possible offset
|
||||
while keys.group_key().to_encoded_point(true).tag() == Tag::CompressedOddY {
|
||||
keys = keys.offset(Scalar::ONE);
|
||||
}
|
||||
assert_eq!(tweaked, keys.group_key());
|
||||
|
||||
odd = true;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async_sequential! {
|
||||
async fn test_scanner() {
|
||||
// Test Scanners are creatable for even keys.
|
||||
@@ -155,7 +193,7 @@ async_sequential! {
|
||||
assert_eq!(output.offset(), Scalar::ZERO);
|
||||
|
||||
let inputs = vec![output];
|
||||
let addr = || p2tr_script_buf(key).unwrap();
|
||||
let addr = || Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap());
|
||||
let payments = vec![(addr(), 1000)];
|
||||
|
||||
assert!(SignableTransaction::new(inputs.clone(), &payments, None, None, FEE).is_ok());
|
||||
@@ -168,7 +206,7 @@ async_sequential! {
|
||||
// No change
|
||||
assert!(SignableTransaction::new(inputs.clone(), &[(addr(), 1000)], None, None, FEE).is_ok());
|
||||
// Consolidation TX
|
||||
assert!(SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, FEE).is_ok());
|
||||
assert!(SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, FEE).is_ok());
|
||||
// Data
|
||||
assert!(SignableTransaction::new(inputs.clone(), &[], None, Some(vec![]), FEE).is_ok());
|
||||
// No outputs
|
||||
@@ -191,14 +229,14 @@ async_sequential! {
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, 0),
|
||||
SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, 0),
|
||||
Err(TransactionError::TooLowFee),
|
||||
);
|
||||
|
||||
assert!(matches!(
|
||||
assert_eq!(
|
||||
SignableTransaction::new(inputs.clone(), &[(addr(), inputs[0].value() * 2)], None, None, FEE),
|
||||
Err(TransactionError::NotEnoughFunds { .. }),
|
||||
));
|
||||
Err(TransactionError::NotEnoughFunds),
|
||||
);
|
||||
|
||||
assert_eq!(
|
||||
SignableTransaction::new(inputs, &vec![(addr(), 1000); 10000], None, None, FEE),
|
||||
@@ -223,19 +261,20 @@ async_sequential! {
|
||||
|
||||
// Declare payments, change, fee
|
||||
let payments = [
|
||||
(p2tr_script_buf(key).unwrap(), 1005),
|
||||
(p2tr_script_buf(offset_key).unwrap(), 1007)
|
||||
(Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap()), 1005),
|
||||
(Address::<NetworkChecked>::new(Network::Regtest, address_payload(offset_key).unwrap()), 1007)
|
||||
];
|
||||
|
||||
let change_offset = scanner.register_offset(Scalar::random(&mut OsRng)).unwrap();
|
||||
let change_key = key + (ProjectivePoint::GENERATOR * change_offset);
|
||||
let change_addr = p2tr_script_buf(change_key).unwrap();
|
||||
let change_addr =
|
||||
Address::<NetworkChecked>::new(Network::Regtest, address_payload(change_key).unwrap());
|
||||
|
||||
// Create and sign the TX
|
||||
let tx = SignableTransaction::new(
|
||||
vec![output.clone(), offset_output.clone()],
|
||||
&payments,
|
||||
Some(change_addr.clone()),
|
||||
Some(&change_addr),
|
||||
None,
|
||||
FEE
|
||||
).unwrap();
|
||||
@@ -248,7 +287,7 @@ async_sequential! {
|
||||
// Ensure we can scan it
|
||||
let outputs = scanner.scan_transaction(&tx);
|
||||
for (o, output) in outputs.iter().enumerate() {
|
||||
assert_eq!(output.outpoint(), &OutPoint::new(tx.compute_txid(), u32::try_from(o).unwrap()));
|
||||
assert_eq!(output.outpoint(), &OutPoint::new(tx.txid(), u32::try_from(o).unwrap()));
|
||||
assert_eq!(&ReceivedOutput::read::<&[u8]>(&mut output.serialize().as_ref()).unwrap(), output);
|
||||
}
|
||||
|
||||
@@ -260,13 +299,13 @@ async_sequential! {
|
||||
for ((output, scanned), payment) in tx.output.iter().zip(outputs.iter()).zip(payments.iter()) {
|
||||
assert_eq!(
|
||||
output,
|
||||
&TxOut { script_pubkey: payment.0.clone(), value: Amount::from_sat(payment.1) },
|
||||
&TxOut { script_pubkey: payment.0.script_pubkey(), value: Amount::from_sat(payment.1) },
|
||||
);
|
||||
assert_eq!(scanned.value(), payment.1 );
|
||||
}
|
||||
|
||||
// Make sure the change is correct
|
||||
assert_eq!(needed_fee, u64::try_from(tx.vsize()).unwrap() * FEE);
|
||||
assert_eq!(needed_fee, u64::from(tx.weight()) * FEE);
|
||||
let input_value = output.value() + offset_output.value();
|
||||
let output_value = tx.output.iter().map(|output| output.value.to_sat()).sum::<u64>();
|
||||
assert_eq!(input_value - output_value, needed_fee);
|
||||
@@ -275,13 +314,13 @@ async_sequential! {
|
||||
input_value - payments.iter().map(|payment| payment.1).sum::<u64>() - needed_fee;
|
||||
assert_eq!(
|
||||
tx.output[2],
|
||||
TxOut { script_pubkey: change_addr, value: Amount::from_sat(change_amount) },
|
||||
TxOut { script_pubkey: change_addr.script_pubkey(), value: Amount::from_sat(change_amount) },
|
||||
);
|
||||
|
||||
// This also tests send_raw_transaction and get_transaction, which the RPC test can't
|
||||
// effectively test
|
||||
rpc.send_raw_transaction(&tx).await.unwrap();
|
||||
let mut hash = *tx.compute_txid().as_raw_hash().as_byte_array();
|
||||
let mut hash = *tx.txid().as_raw_hash().as_byte_array();
|
||||
hash.reverse();
|
||||
assert_eq!(tx, rpc.get_transaction(&hash).await.unwrap());
|
||||
assert_eq!(expected_id, hash);
|
||||
@@ -305,7 +344,7 @@ async_sequential! {
|
||||
&SignableTransaction::new(
|
||||
vec![output],
|
||||
&[],
|
||||
Some(p2tr_script_buf(key).unwrap()),
|
||||
Some(&Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())),
|
||||
Some(data.clone()),
|
||||
FEE
|
||||
).unwrap()
|
||||
7
coins/ethereum/.gitignore
vendored
Normal file
7
coins/ethereum/.gitignore
vendored
Normal file
@@ -0,0 +1,7 @@
|
||||
# Solidity build outputs
|
||||
cache
|
||||
artifacts
|
||||
|
||||
# Auto-generated ABI files
|
||||
src/abi/schnorr.rs
|
||||
src/abi/router.rs
|
||||
45
coins/ethereum/Cargo.toml
Normal file
45
coins/ethereum/Cargo.toml
Normal file
@@ -0,0 +1,45 @@
|
||||
[package]
|
||||
name = "ethereum-serai"
|
||||
version = "0.1.0"
|
||||
description = "An Ethereum library supporting Schnorr signing and on-chain verification"
|
||||
license = "AGPL-3.0-only"
|
||||
repository = "https://github.com/serai-dex/serai/tree/develop/coins/ethereum"
|
||||
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Elizabeth Binks <elizabethjbinks@gmail.com>"]
|
||||
edition = "2021"
|
||||
publish = false
|
||||
rust-version = "1.74"
|
||||
|
||||
[package.metadata.docs.rs]
|
||||
all-features = true
|
||||
rustdoc-args = ["--cfg", "docsrs"]
|
||||
|
||||
[lints]
|
||||
workspace = true
|
||||
|
||||
[dependencies]
|
||||
thiserror = { version = "1", default-features = false }
|
||||
eyre = { version = "0.6", default-features = false }
|
||||
|
||||
sha3 = { version = "0.10", default-features = false, features = ["std"] }
|
||||
|
||||
group = { version = "0.13", default-features = false }
|
||||
k256 = { version = "^0.13.1", default-features = false, features = ["std", "ecdsa"] }
|
||||
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["secp256k1", "tests"] }
|
||||
|
||||
ethers-core = { version = "2", default-features = false }
|
||||
ethers-providers = { version = "2", default-features = false }
|
||||
ethers-contract = { version = "2", default-features = false, features = ["abigen", "providers"] }
|
||||
|
||||
[build-dependencies]
|
||||
ethers-contract = { version = "2", default-features = false, features = ["abigen", "providers"] }
|
||||
|
||||
[dev-dependencies]
|
||||
rand_core = { version = "0.6", default-features = false, features = ["std"] }
|
||||
|
||||
hex = { version = "0.4", default-features = false, features = ["std"] }
|
||||
serde = { version = "1", default-features = false, features = ["std"] }
|
||||
serde_json = { version = "1", default-features = false, features = ["std"] }
|
||||
|
||||
sha2 = { version = "0.10", default-features = false, features = ["std"] }
|
||||
|
||||
tokio = { version = "1", features = ["macros"] }
|
||||
@@ -1,6 +1,6 @@
|
||||
AGPL-3.0-only license
|
||||
|
||||
Copyright (c) 2023-2025 Luke Parker
|
||||
Copyright (c) 2022-2023 Luke Parker
|
||||
|
||||
This program is free software: you can redistribute it and/or modify
|
||||
it under the terms of the GNU Affero General Public License Version 3 as
|
||||
9
coins/ethereum/README.md
Normal file
9
coins/ethereum/README.md
Normal file
@@ -0,0 +1,9 @@
|
||||
# Ethereum
|
||||
|
||||
This package contains Ethereum-related functionality, specifically deploying and
|
||||
interacting with Serai contracts.
|
||||
|
||||
### Dependencies
|
||||
|
||||
- solc
|
||||
- [Foundry](https://github.com/foundry-rs/foundry)
|
||||
42
coins/ethereum/build.rs
Normal file
42
coins/ethereum/build.rs
Normal file
@@ -0,0 +1,42 @@
|
||||
use std::process::Command;
|
||||
|
||||
use ethers_contract::Abigen;
|
||||
|
||||
fn main() {
|
||||
println!("cargo:rerun-if-changed=contracts/*");
|
||||
println!("cargo:rerun-if-changed=artifacts/*");
|
||||
|
||||
for line in String::from_utf8(Command::new("solc").args(["--version"]).output().unwrap().stdout)
|
||||
.unwrap()
|
||||
.lines()
|
||||
{
|
||||
if let Some(version) = line.strip_prefix("Version: ") {
|
||||
let version = version.split('+').next().unwrap();
|
||||
assert_eq!(version, "0.8.25");
|
||||
}
|
||||
}
|
||||
|
||||
#[rustfmt::skip]
|
||||
let args = [
|
||||
"--base-path", ".",
|
||||
"-o", "./artifacts", "--overwrite",
|
||||
"--bin", "--abi",
|
||||
"--optimize",
|
||||
"./contracts/Schnorr.sol", "./contracts/Router.sol",
|
||||
];
|
||||
assert!(Command::new("solc").args(args).status().unwrap().success());
|
||||
|
||||
Abigen::new("Schnorr", "./artifacts/Schnorr.abi")
|
||||
.unwrap()
|
||||
.generate()
|
||||
.unwrap()
|
||||
.write_to_file("./src/abi/schnorr.rs")
|
||||
.unwrap();
|
||||
|
||||
Abigen::new("Router", "./artifacts/Router.abi")
|
||||
.unwrap()
|
||||
.generate()
|
||||
.unwrap()
|
||||
.write_to_file("./src/abi/router.rs")
|
||||
.unwrap();
|
||||
}
|
||||
90
coins/ethereum/contracts/Router.sol
Normal file
90
coins/ethereum/contracts/Router.sol
Normal file
@@ -0,0 +1,90 @@
|
||||
// SPDX-License-Identifier: AGPLv3
|
||||
pragma solidity ^0.8.0;
|
||||
|
||||
import "./Schnorr.sol";
|
||||
|
||||
contract Router is Schnorr {
|
||||
// Contract initializer
|
||||
// TODO: Replace with a MuSig of the genesis validators
|
||||
address public initializer;
|
||||
|
||||
// Nonce is incremented for each batch of transactions executed
|
||||
uint256 public nonce;
|
||||
|
||||
// fixed parity for the public keys used in this contract
|
||||
uint8 constant public KEY_PARITY = 27;
|
||||
|
||||
// current public key's x-coordinate
|
||||
// note: this key must always use the fixed parity defined above
|
||||
bytes32 public seraiKey;
|
||||
|
||||
struct OutInstruction {
|
||||
address to;
|
||||
uint256 value;
|
||||
bytes data;
|
||||
}
|
||||
|
||||
struct Signature {
|
||||
bytes32 c;
|
||||
bytes32 s;
|
||||
}
|
||||
|
||||
// success is a uint256 representing a bitfield of transaction successes
|
||||
event Executed(uint256 nonce, bytes32 batch, uint256 success);
|
||||
|
||||
// error types
|
||||
error NotInitializer();
|
||||
error AlreadyInitialized();
|
||||
error InvalidKey();
|
||||
error TooManyTransactions();
|
||||
|
||||
constructor() {
|
||||
initializer = msg.sender;
|
||||
}
|
||||
|
||||
// initSeraiKey can be called by the contract initializer to set the first
|
||||
// public key, only if the public key has yet to be set.
|
||||
function initSeraiKey(bytes32 _seraiKey) external {
|
||||
if (msg.sender != initializer) revert NotInitializer();
|
||||
if (seraiKey != 0) revert AlreadyInitialized();
|
||||
if (_seraiKey == bytes32(0)) revert InvalidKey();
|
||||
seraiKey = _seraiKey;
|
||||
}
|
||||
|
||||
// updateSeraiKey validates the given Schnorr signature against the current public key,
|
||||
// and if successful, updates the contract's public key to the given one.
|
||||
function updateSeraiKey(
|
||||
bytes32 _seraiKey,
|
||||
Signature memory sig
|
||||
) public {
|
||||
if (_seraiKey == bytes32(0)) revert InvalidKey();
|
||||
bytes32 message = keccak256(abi.encodePacked("updateSeraiKey", _seraiKey));
|
||||
if (!verify(KEY_PARITY, seraiKey, message, sig.c, sig.s)) revert InvalidSignature();
|
||||
seraiKey = _seraiKey;
|
||||
}
|
||||
|
||||
// execute accepts a list of transactions to execute as well as a Schnorr signature.
|
||||
// if signature verification passes, the given transactions are executed.
|
||||
// if signature verification fails, this function will revert.
|
||||
function execute(
|
||||
OutInstruction[] calldata transactions,
|
||||
Signature memory sig
|
||||
) public {
|
||||
if (transactions.length > 256) revert TooManyTransactions();
|
||||
|
||||
bytes32 message = keccak256(abi.encode("execute", nonce, transactions));
|
||||
// This prevents re-entrancy from causing double spends yet does allow
|
||||
// out-of-order execution via re-entrancy
|
||||
nonce++;
|
||||
if (!verify(KEY_PARITY, seraiKey, message, sig.c, sig.s)) revert InvalidSignature();
|
||||
|
||||
uint256 successes;
|
||||
for(uint256 i = 0; i < transactions.length; i++) {
|
||||
(bool success, ) = transactions[i].to.call{value: transactions[i].value, gas: 200_000}(transactions[i].data);
|
||||
assembly {
|
||||
successes := or(successes, shl(i, success))
|
||||
}
|
||||
}
|
||||
emit Executed(nonce, message, successes);
|
||||
}
|
||||
}
|
||||
39
coins/ethereum/contracts/Schnorr.sol
Normal file
39
coins/ethereum/contracts/Schnorr.sol
Normal file
@@ -0,0 +1,39 @@
|
||||
// SPDX-License-Identifier: AGPLv3
|
||||
pragma solidity ^0.8.0;
|
||||
|
||||
// see https://github.com/noot/schnorr-verify for implementation details
|
||||
contract Schnorr {
|
||||
// secp256k1 group order
|
||||
uint256 constant public Q =
|
||||
0xFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEBAAEDCE6AF48A03BBFD25E8CD0364141;
|
||||
|
||||
error InvalidSOrA();
|
||||
error InvalidSignature();
|
||||
|
||||
// parity := public key y-coord parity (27 or 28)
|
||||
// px := public key x-coord
|
||||
// message := 32-byte hash of the message
|
||||
// c := schnorr signature challenge
|
||||
// s := schnorr signature
|
||||
function verify(
|
||||
uint8 parity,
|
||||
bytes32 px,
|
||||
bytes32 message,
|
||||
bytes32 c,
|
||||
bytes32 s
|
||||
) public view returns (bool) {
|
||||
// ecrecover = (m, v, r, s);
|
||||
bytes32 sa = bytes32(Q - mulmod(uint256(s), uint256(px), Q));
|
||||
bytes32 ca = bytes32(Q - mulmod(uint256(c), uint256(px), Q));
|
||||
|
||||
if (sa == 0) revert InvalidSOrA();
|
||||
// the ecrecover precompile implementation checks that the `r` and `s`
|
||||
// inputs are non-zero (in this case, `px` and `ca`), thus we don't need to
|
||||
// check if they're zero.
|
||||
address R = ecrecover(sa, parity, px, ca);
|
||||
if (R == address(0)) revert InvalidSignature();
|
||||
return c == keccak256(
|
||||
abi.encodePacked(R, uint8(parity), px, block.chainid, message)
|
||||
);
|
||||
}
|
||||
}
|
||||
6
coins/ethereum/src/abi/mod.rs
Normal file
6
coins/ethereum/src/abi/mod.rs
Normal file
@@ -0,0 +1,6 @@
|
||||
#[rustfmt::skip]
|
||||
#[allow(clippy::all)]
|
||||
pub(crate) mod schnorr;
|
||||
#[rustfmt::skip]
|
||||
#[allow(clippy::all)]
|
||||
pub(crate) mod router;
|
||||
91
coins/ethereum/src/crypto.rs
Normal file
91
coins/ethereum/src/crypto.rs
Normal file
@@ -0,0 +1,91 @@
|
||||
use sha3::{Digest, Keccak256};
|
||||
|
||||
use group::ff::PrimeField;
|
||||
use k256::{
|
||||
elliptic_curve::{
|
||||
bigint::ArrayEncoding, ops::Reduce, point::AffineCoordinates, sec1::ToEncodedPoint,
|
||||
},
|
||||
ProjectivePoint, Scalar, U256,
|
||||
};
|
||||
|
||||
use frost::{
|
||||
algorithm::{Hram, SchnorrSignature},
|
||||
curve::Secp256k1,
|
||||
};
|
||||
|
||||
pub(crate) fn keccak256(data: &[u8]) -> [u8; 32] {
|
||||
Keccak256::digest(data).into()
|
||||
}
|
||||
|
||||
pub(crate) fn address(point: &ProjectivePoint) -> [u8; 20] {
|
||||
let encoded_point = point.to_encoded_point(false);
|
||||
// Last 20 bytes of the hash of the concatenated x and y coordinates
|
||||
// We obtain the concatenated x and y coordinates via the uncompressed encoding of the point
|
||||
keccak256(&encoded_point.as_ref()[1 .. 65])[12 ..].try_into().unwrap()
|
||||
}
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
pub struct PublicKey {
|
||||
pub A: ProjectivePoint,
|
||||
pub px: Scalar,
|
||||
pub parity: u8,
|
||||
}
|
||||
|
||||
impl PublicKey {
|
||||
#[allow(non_snake_case)]
|
||||
pub fn new(A: ProjectivePoint) -> Option<PublicKey> {
|
||||
let affine = A.to_affine();
|
||||
let parity = u8::from(bool::from(affine.y_is_odd())) + 27;
|
||||
if parity != 27 {
|
||||
None?;
|
||||
}
|
||||
|
||||
let x_coord = affine.x();
|
||||
let x_coord_scalar = <Scalar as Reduce<U256>>::reduce_bytes(&x_coord);
|
||||
// Return None if a reduction would occur
|
||||
if x_coord_scalar.to_repr() != x_coord {
|
||||
None?;
|
||||
}
|
||||
|
||||
Some(PublicKey { A, px: x_coord_scalar, parity })
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Default)]
|
||||
pub struct EthereumHram {}
|
||||
impl Hram<Secp256k1> for EthereumHram {
|
||||
#[allow(non_snake_case)]
|
||||
fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar {
|
||||
let a_encoded_point = A.to_encoded_point(true);
|
||||
let mut a_encoded = a_encoded_point.as_ref().to_owned();
|
||||
a_encoded[0] += 25; // Ethereum uses 27/28 for point parity
|
||||
assert!((a_encoded[0] == 27) || (a_encoded[0] == 28));
|
||||
let mut data = address(R).to_vec();
|
||||
data.append(&mut a_encoded);
|
||||
data.extend(m);
|
||||
Scalar::reduce(U256::from_be_slice(&keccak256(&data)))
|
||||
}
|
||||
}
|
||||
|
||||
pub struct Signature {
|
||||
pub(crate) c: Scalar,
|
||||
pub(crate) s: Scalar,
|
||||
}
|
||||
impl Signature {
|
||||
pub fn new(
|
||||
public_key: &PublicKey,
|
||||
chain_id: U256,
|
||||
m: &[u8],
|
||||
signature: SchnorrSignature<Secp256k1>,
|
||||
) -> Option<Signature> {
|
||||
let c = EthereumHram::hram(
|
||||
&signature.R,
|
||||
&public_key.A,
|
||||
&[chain_id.to_be_byte_array().as_slice(), &keccak256(m)].concat(),
|
||||
);
|
||||
if !signature.verify(public_key.A, c) {
|
||||
None?;
|
||||
}
|
||||
Some(Signature { c, s: signature.s })
|
||||
}
|
||||
}
|
||||
16
coins/ethereum/src/lib.rs
Normal file
16
coins/ethereum/src/lib.rs
Normal file
@@ -0,0 +1,16 @@
|
||||
use thiserror::Error;
|
||||
|
||||
pub mod crypto;
|
||||
|
||||
pub(crate) mod abi;
|
||||
pub mod schnorr;
|
||||
pub mod router;
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests;
|
||||
|
||||
#[derive(Error, Debug)]
|
||||
pub enum Error {
|
||||
#[error("failed to verify Schnorr signature")]
|
||||
InvalidSignature,
|
||||
}
|
||||
30
coins/ethereum/src/router.rs
Normal file
30
coins/ethereum/src/router.rs
Normal file
@@ -0,0 +1,30 @@
|
||||
pub use crate::abi::router::*;
|
||||
|
||||
/*
|
||||
use crate::crypto::{ProcessedSignature, PublicKey};
|
||||
use ethers::{contract::ContractFactory, prelude::*, solc::artifacts::contract::ContractBytecode};
|
||||
use eyre::Result;
|
||||
use std::{convert::From, fs::File, sync::Arc};
|
||||
|
||||
pub async fn router_update_public_key<M: Middleware + 'static>(
|
||||
contract: &Router<M>,
|
||||
public_key: &PublicKey,
|
||||
signature: &ProcessedSignature,
|
||||
) -> std::result::Result<Option<TransactionReceipt>, eyre::ErrReport> {
|
||||
let tx = contract.update_public_key(public_key.px.to_bytes().into(), signature.into());
|
||||
let pending_tx = tx.send().await?;
|
||||
let receipt = pending_tx.await?;
|
||||
Ok(receipt)
|
||||
}
|
||||
|
||||
pub async fn router_execute<M: Middleware + 'static>(
|
||||
contract: &Router<M>,
|
||||
txs: Vec<Rtransaction>,
|
||||
signature: &ProcessedSignature,
|
||||
) -> std::result::Result<Option<TransactionReceipt>, eyre::ErrReport> {
|
||||
let tx = contract.execute(txs, signature.into()).send();
|
||||
let pending_tx = tx.send().await?;
|
||||
let receipt = pending_tx.await?;
|
||||
Ok(receipt)
|
||||
}
|
||||
*/
|
||||
34
coins/ethereum/src/schnorr.rs
Normal file
34
coins/ethereum/src/schnorr.rs
Normal file
@@ -0,0 +1,34 @@
|
||||
use eyre::{eyre, Result};
|
||||
|
||||
use group::ff::PrimeField;
|
||||
|
||||
use ethers_providers::{Provider, Http};
|
||||
|
||||
use crate::{
|
||||
Error,
|
||||
crypto::{keccak256, PublicKey, Signature},
|
||||
};
|
||||
pub use crate::abi::schnorr::*;
|
||||
|
||||
pub async fn call_verify(
|
||||
contract: &Schnorr<Provider<Http>>,
|
||||
public_key: &PublicKey,
|
||||
message: &[u8],
|
||||
signature: &Signature,
|
||||
) -> Result<()> {
|
||||
if contract
|
||||
.verify(
|
||||
public_key.parity,
|
||||
public_key.px.to_repr().into(),
|
||||
keccak256(message),
|
||||
signature.c.to_repr().into(),
|
||||
signature.s.to_repr().into(),
|
||||
)
|
||||
.call()
|
||||
.await?
|
||||
{
|
||||
Ok(())
|
||||
} else {
|
||||
Err(eyre!(Error::InvalidSignature))
|
||||
}
|
||||
}
|
||||
132
coins/ethereum/src/tests/crypto.rs
Normal file
132
coins/ethereum/src/tests/crypto.rs
Normal file
@@ -0,0 +1,132 @@
|
||||
use rand_core::OsRng;
|
||||
|
||||
use sha2::Sha256;
|
||||
use sha3::{Digest, Keccak256};
|
||||
|
||||
use group::Group;
|
||||
use k256::{
|
||||
ecdsa::{hazmat::SignPrimitive, signature::DigestVerifier, SigningKey, VerifyingKey},
|
||||
elliptic_curve::{bigint::ArrayEncoding, ops::Reduce, point::DecompressPoint},
|
||||
U256, Scalar, AffinePoint, ProjectivePoint,
|
||||
};
|
||||
|
||||
use frost::{
|
||||
curve::Secp256k1,
|
||||
algorithm::{Hram, IetfSchnorr},
|
||||
tests::{algorithm_machines, sign},
|
||||
};
|
||||
|
||||
use crate::{crypto::*, tests::key_gen};
|
||||
|
||||
pub fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||
Scalar::reduce(U256::from_be_slice(&keccak256(data)))
|
||||
}
|
||||
|
||||
pub(crate) fn ecrecover(message: Scalar, v: u8, r: Scalar, s: Scalar) -> Option<[u8; 20]> {
|
||||
if r.is_zero().into() || s.is_zero().into() || !((v == 27) || (v == 28)) {
|
||||
return None;
|
||||
}
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
let R = AffinePoint::decompress(&r.to_bytes(), (v - 27).into());
|
||||
#[allow(non_snake_case)]
|
||||
if let Some(R) = Option::<AffinePoint>::from(R) {
|
||||
#[allow(non_snake_case)]
|
||||
let R = ProjectivePoint::from(R);
|
||||
|
||||
let r = r.invert().unwrap();
|
||||
let u1 = ProjectivePoint::GENERATOR * (-message * r);
|
||||
let u2 = R * (s * r);
|
||||
let key: ProjectivePoint = u1 + u2;
|
||||
if !bool::from(key.is_identity()) {
|
||||
return Some(address(&key));
|
||||
}
|
||||
}
|
||||
|
||||
None
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_ecrecover() {
|
||||
let private = SigningKey::random(&mut OsRng);
|
||||
let public = VerifyingKey::from(&private);
|
||||
|
||||
// Sign the signature
|
||||
const MESSAGE: &[u8] = b"Hello, World!";
|
||||
let (sig, recovery_id) = private
|
||||
.as_nonzero_scalar()
|
||||
.try_sign_prehashed_rfc6979::<Sha256>(&Keccak256::digest(MESSAGE), b"")
|
||||
.unwrap();
|
||||
|
||||
// Sanity check the signature verifies
|
||||
#[allow(clippy::unit_cmp)] // Intended to assert this wasn't changed to Result<bool>
|
||||
{
|
||||
assert_eq!(public.verify_digest(Keccak256::new_with_prefix(MESSAGE), &sig).unwrap(), ());
|
||||
}
|
||||
|
||||
// Perform the ecrecover
|
||||
assert_eq!(
|
||||
ecrecover(
|
||||
hash_to_scalar(MESSAGE),
|
||||
u8::from(recovery_id.unwrap().is_y_odd()) + 27,
|
||||
*sig.r(),
|
||||
*sig.s()
|
||||
)
|
||||
.unwrap(),
|
||||
address(&ProjectivePoint::from(public.as_affine()))
|
||||
);
|
||||
}
|
||||
|
||||
// Run the sign test with the EthereumHram
|
||||
#[test]
|
||||
fn test_signing() {
|
||||
let (keys, _) = key_gen();
|
||||
|
||||
const MESSAGE: &[u8] = b"Hello, World!";
|
||||
|
||||
let algo = IetfSchnorr::<Secp256k1, EthereumHram>::ietf();
|
||||
let _sig =
|
||||
sign(&mut OsRng, &algo, keys.clone(), algorithm_machines(&mut OsRng, &algo, &keys), MESSAGE);
|
||||
}
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
pub fn preprocess_signature_for_ecrecover(
|
||||
R: ProjectivePoint,
|
||||
public_key: &PublicKey,
|
||||
chain_id: U256,
|
||||
m: &[u8],
|
||||
s: Scalar,
|
||||
) -> (u8, Scalar, Scalar) {
|
||||
let c = EthereumHram::hram(
|
||||
&R,
|
||||
&public_key.A,
|
||||
&[chain_id.to_be_byte_array().as_slice(), &keccak256(m)].concat(),
|
||||
);
|
||||
let sa = -(s * public_key.px);
|
||||
let ca = -(c * public_key.px);
|
||||
(public_key.parity, sa, ca)
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_ecrecover_hack() {
|
||||
let (keys, public_key) = key_gen();
|
||||
|
||||
const MESSAGE: &[u8] = b"Hello, World!";
|
||||
let hashed_message = keccak256(MESSAGE);
|
||||
let chain_id = U256::ONE;
|
||||
let full_message = &[chain_id.to_be_byte_array().as_slice(), &hashed_message].concat();
|
||||
|
||||
let algo = IetfSchnorr::<Secp256k1, EthereumHram>::ietf();
|
||||
let sig = sign(
|
||||
&mut OsRng,
|
||||
&algo,
|
||||
keys.clone(),
|
||||
algorithm_machines(&mut OsRng, &algo, &keys),
|
||||
full_message,
|
||||
);
|
||||
|
||||
let (parity, sa, ca) =
|
||||
preprocess_signature_for_ecrecover(sig.R, &public_key, chain_id, MESSAGE, sig.s);
|
||||
let q = ecrecover(sa, parity, public_key.px, ca).unwrap();
|
||||
assert_eq!(q, address(&sig.R));
|
||||
}
|
||||
92
coins/ethereum/src/tests/mod.rs
Normal file
92
coins/ethereum/src/tests/mod.rs
Normal file
@@ -0,0 +1,92 @@
|
||||
use std::{sync::Arc, time::Duration, fs::File, collections::HashMap};
|
||||
|
||||
use rand_core::OsRng;
|
||||
|
||||
use group::ff::PrimeField;
|
||||
use k256::{Scalar, ProjectivePoint};
|
||||
use frost::{curve::Secp256k1, Participant, ThresholdKeys, tests::key_gen as frost_key_gen};
|
||||
|
||||
use ethers_core::{
|
||||
types::{H160, Signature as EthersSignature},
|
||||
abi::Abi,
|
||||
};
|
||||
use ethers_contract::ContractFactory;
|
||||
use ethers_providers::{Middleware, Provider, Http};
|
||||
|
||||
use crate::crypto::PublicKey;
|
||||
|
||||
mod crypto;
|
||||
mod schnorr;
|
||||
mod router;
|
||||
|
||||
pub fn key_gen() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, PublicKey) {
|
||||
let mut keys = frost_key_gen::<_, Secp256k1>(&mut OsRng);
|
||||
let mut group_key = keys[&Participant::new(1).unwrap()].group_key();
|
||||
|
||||
let mut offset = Scalar::ZERO;
|
||||
while PublicKey::new(group_key).is_none() {
|
||||
offset += Scalar::ONE;
|
||||
group_key += ProjectivePoint::GENERATOR;
|
||||
}
|
||||
for keys in keys.values_mut() {
|
||||
*keys = keys.offset(offset);
|
||||
}
|
||||
let public_key = PublicKey::new(group_key).unwrap();
|
||||
|
||||
(keys, public_key)
|
||||
}
|
||||
|
||||
// TODO: Replace with a contract deployment from an unknown account, so the environment solely has
|
||||
// to fund the deployer, not create/pass a wallet
|
||||
// TODO: Deterministic deployments across chains
|
||||
pub async fn deploy_contract(
|
||||
chain_id: u32,
|
||||
client: Arc<Provider<Http>>,
|
||||
wallet: &k256::ecdsa::SigningKey,
|
||||
name: &str,
|
||||
) -> eyre::Result<H160> {
|
||||
let abi: Abi =
|
||||
serde_json::from_reader(File::open(format!("./artifacts/{name}.abi")).unwrap()).unwrap();
|
||||
|
||||
let hex_bin_buf = std::fs::read_to_string(format!("./artifacts/{name}.bin")).unwrap();
|
||||
let hex_bin =
|
||||
if let Some(stripped) = hex_bin_buf.strip_prefix("0x") { stripped } else { &hex_bin_buf };
|
||||
let bin = hex::decode(hex_bin).unwrap();
|
||||
let factory = ContractFactory::new(abi, bin.into(), client.clone());
|
||||
|
||||
let mut deployment_tx = factory.deploy(())?.tx;
|
||||
deployment_tx.set_chain_id(chain_id);
|
||||
deployment_tx.set_gas(1_000_000);
|
||||
let (max_fee_per_gas, max_priority_fee_per_gas) = client.estimate_eip1559_fees(None).await?;
|
||||
deployment_tx.as_eip1559_mut().unwrap().max_fee_per_gas = Some(max_fee_per_gas);
|
||||
deployment_tx.as_eip1559_mut().unwrap().max_priority_fee_per_gas = Some(max_priority_fee_per_gas);
|
||||
|
||||
let sig_hash = deployment_tx.sighash();
|
||||
let (sig, rid) = wallet.sign_prehash_recoverable(sig_hash.as_ref()).unwrap();
|
||||
|
||||
// EIP-155 v
|
||||
let mut v = u64::from(rid.to_byte());
|
||||
assert!((v == 0) || (v == 1));
|
||||
v += u64::from((chain_id * 2) + 35);
|
||||
|
||||
let r = sig.r().to_repr();
|
||||
let r_ref: &[u8] = r.as_ref();
|
||||
let s = sig.s().to_repr();
|
||||
let s_ref: &[u8] = s.as_ref();
|
||||
let deployment_tx =
|
||||
deployment_tx.rlp_signed(&EthersSignature { r: r_ref.into(), s: s_ref.into(), v });
|
||||
|
||||
let pending_tx = client.send_raw_transaction(deployment_tx).await?;
|
||||
|
||||
let mut receipt;
|
||||
while {
|
||||
receipt = client.get_transaction_receipt(pending_tx.tx_hash()).await?;
|
||||
receipt.is_none()
|
||||
} {
|
||||
tokio::time::sleep(Duration::from_secs(6)).await;
|
||||
}
|
||||
let receipt = receipt.unwrap();
|
||||
assert!(receipt.status == Some(1.into()));
|
||||
|
||||
Ok(receipt.contract_address.unwrap())
|
||||
}
|
||||
109
coins/ethereum/src/tests/router.rs
Normal file
109
coins/ethereum/src/tests/router.rs
Normal file
@@ -0,0 +1,109 @@
|
||||
use std::{convert::TryFrom, sync::Arc, collections::HashMap};
|
||||
|
||||
use rand_core::OsRng;
|
||||
|
||||
use group::ff::PrimeField;
|
||||
use frost::{
|
||||
curve::Secp256k1,
|
||||
Participant, ThresholdKeys,
|
||||
algorithm::IetfSchnorr,
|
||||
tests::{algorithm_machines, sign},
|
||||
};
|
||||
|
||||
use ethers_core::{
|
||||
types::{H160, U256, Bytes},
|
||||
abi::AbiEncode,
|
||||
utils::{Anvil, AnvilInstance},
|
||||
};
|
||||
use ethers_providers::{Middleware, Provider, Http};
|
||||
|
||||
use crate::{
|
||||
crypto::{keccak256, PublicKey, EthereumHram, Signature},
|
||||
router::{self, *},
|
||||
tests::{key_gen, deploy_contract},
|
||||
};
|
||||
|
||||
async fn setup_test() -> (
|
||||
u32,
|
||||
AnvilInstance,
|
||||
Router<Provider<Http>>,
|
||||
HashMap<Participant, ThresholdKeys<Secp256k1>>,
|
||||
PublicKey,
|
||||
) {
|
||||
let anvil = Anvil::new().spawn();
|
||||
|
||||
let provider = Provider::<Http>::try_from(anvil.endpoint()).unwrap();
|
||||
let chain_id = provider.get_chainid().await.unwrap().as_u32();
|
||||
let wallet = anvil.keys()[0].clone().into();
|
||||
let client = Arc::new(provider);
|
||||
|
||||
let contract_address =
|
||||
deploy_contract(chain_id, client.clone(), &wallet, "Router").await.unwrap();
|
||||
let contract = Router::new(contract_address, client.clone());
|
||||
|
||||
let (keys, public_key) = key_gen();
|
||||
|
||||
// Set the key to the threshold keys
|
||||
let tx = contract.init_serai_key(public_key.px.to_repr().into()).gas(100_000);
|
||||
let pending_tx = tx.send().await.unwrap();
|
||||
let receipt = pending_tx.await.unwrap().unwrap();
|
||||
assert!(receipt.status == Some(1.into()));
|
||||
|
||||
(chain_id, anvil, contract, keys, public_key)
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn test_deploy_contract() {
|
||||
setup_test().await;
|
||||
}
|
||||
|
||||
pub fn hash_and_sign(
|
||||
keys: &HashMap<Participant, ThresholdKeys<Secp256k1>>,
|
||||
public_key: &PublicKey,
|
||||
chain_id: U256,
|
||||
message: &[u8],
|
||||
) -> Signature {
|
||||
let hashed_message = keccak256(message);
|
||||
|
||||
let mut chain_id_bytes = [0; 32];
|
||||
chain_id.to_big_endian(&mut chain_id_bytes);
|
||||
let full_message = &[chain_id_bytes.as_slice(), &hashed_message].concat();
|
||||
|
||||
let algo = IetfSchnorr::<Secp256k1, EthereumHram>::ietf();
|
||||
let sig = sign(
|
||||
&mut OsRng,
|
||||
&algo,
|
||||
keys.clone(),
|
||||
algorithm_machines(&mut OsRng, &algo, keys),
|
||||
full_message,
|
||||
);
|
||||
|
||||
Signature::new(public_key, k256::U256::from_words(chain_id.0), message, sig).unwrap()
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn test_router_execute() {
|
||||
let (chain_id, _anvil, contract, keys, public_key) = setup_test().await;
|
||||
|
||||
let to = H160([0u8; 20]);
|
||||
let value = U256([0u64; 4]);
|
||||
let data = Bytes::from([0]);
|
||||
let tx = OutInstruction { to, value, data: data.clone() };
|
||||
|
||||
let nonce_call = contract.nonce();
|
||||
let nonce = nonce_call.call().await.unwrap();
|
||||
|
||||
let encoded =
|
||||
("execute".to_string(), nonce, vec![router::OutInstruction { to, value, data }]).encode();
|
||||
let sig = hash_and_sign(&keys, &public_key, chain_id.into(), &encoded);
|
||||
|
||||
let tx = contract
|
||||
.execute(vec![tx], router::Signature { c: sig.c.to_repr().into(), s: sig.s.to_repr().into() })
|
||||
.gas(300_000);
|
||||
let pending_tx = tx.send().await.unwrap();
|
||||
let receipt = dbg!(pending_tx.await.unwrap().unwrap());
|
||||
assert!(receipt.status == Some(1.into()));
|
||||
|
||||
println!("gas used: {:?}", receipt.cumulative_gas_used);
|
||||
println!("logs: {:?}", receipt.logs);
|
||||
}
|
||||
67
coins/ethereum/src/tests/schnorr.rs
Normal file
67
coins/ethereum/src/tests/schnorr.rs
Normal file
@@ -0,0 +1,67 @@
|
||||
use std::{convert::TryFrom, sync::Arc};
|
||||
|
||||
use rand_core::OsRng;
|
||||
|
||||
use ::k256::{elliptic_curve::bigint::ArrayEncoding, U256, Scalar};
|
||||
|
||||
use ethers_core::utils::{keccak256, Anvil, AnvilInstance};
|
||||
use ethers_providers::{Middleware, Provider, Http};
|
||||
|
||||
use frost::{
|
||||
curve::Secp256k1,
|
||||
algorithm::IetfSchnorr,
|
||||
tests::{algorithm_machines, sign},
|
||||
};
|
||||
|
||||
use crate::{
|
||||
crypto::*,
|
||||
schnorr::*,
|
||||
tests::{key_gen, deploy_contract},
|
||||
};
|
||||
|
||||
async fn setup_test() -> (u32, AnvilInstance, Schnorr<Provider<Http>>) {
|
||||
let anvil = Anvil::new().spawn();
|
||||
|
||||
let provider = Provider::<Http>::try_from(anvil.endpoint()).unwrap();
|
||||
let chain_id = provider.get_chainid().await.unwrap().as_u32();
|
||||
let wallet = anvil.keys()[0].clone().into();
|
||||
let client = Arc::new(provider);
|
||||
|
||||
let contract_address =
|
||||
deploy_contract(chain_id, client.clone(), &wallet, "Schnorr").await.unwrap();
|
||||
let contract = Schnorr::new(contract_address, client.clone());
|
||||
(chain_id, anvil, contract)
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn test_deploy_contract() {
|
||||
setup_test().await;
|
||||
}
|
||||
|
||||
#[tokio::test]
|
||||
async fn test_ecrecover_hack() {
|
||||
let (chain_id, _anvil, contract) = setup_test().await;
|
||||
let chain_id = U256::from(chain_id);
|
||||
|
||||
let (keys, public_key) = key_gen();
|
||||
|
||||
const MESSAGE: &[u8] = b"Hello, World!";
|
||||
let hashed_message = keccak256(MESSAGE);
|
||||
let full_message = &[chain_id.to_be_byte_array().as_slice(), &hashed_message].concat();
|
||||
|
||||
let algo = IetfSchnorr::<Secp256k1, EthereumHram>::ietf();
|
||||
let sig = sign(
|
||||
&mut OsRng,
|
||||
&algo,
|
||||
keys.clone(),
|
||||
algorithm_machines(&mut OsRng, &algo, &keys),
|
||||
full_message,
|
||||
);
|
||||
let sig = Signature::new(&public_key, chain_id, MESSAGE, sig).unwrap();
|
||||
|
||||
call_verify(&contract, &public_key, MESSAGE, &sig).await.unwrap();
|
||||
// Test an invalid signature fails
|
||||
let mut sig = sig;
|
||||
sig.s += Scalar::ONE;
|
||||
assert!(call_verify(&contract, &public_key, MESSAGE, &sig).await.is_err());
|
||||
}
|
||||
113
coins/monero/Cargo.toml
Normal file
113
coins/monero/Cargo.toml
Normal file
@@ -0,0 +1,113 @@
|
||||
[package]
|
||||
name = "monero-serai"
|
||||
version = "0.1.4-alpha"
|
||||
description = "A modern Monero transaction library"
|
||||
license = "MIT"
|
||||
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero"
|
||||
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||
edition = "2021"
|
||||
rust-version = "1.74"
|
||||
|
||||
[package.metadata.docs.rs]
|
||||
all-features = true
|
||||
rustdoc-args = ["--cfg", "docsrs"]
|
||||
|
||||
[lints]
|
||||
workspace = true
|
||||
|
||||
[dependencies]
|
||||
std-shims = { path = "../../common/std-shims", version = "^0.1.1", default-features = false }
|
||||
|
||||
async-trait = { version = "0.1", default-features = false }
|
||||
thiserror = { version = "1", default-features = false, optional = true }
|
||||
|
||||
zeroize = { version = "^1.5", default-features = false, features = ["zeroize_derive"] }
|
||||
subtle = { version = "^2.4", default-features = false }
|
||||
|
||||
rand_core = { version = "0.6", default-features = false }
|
||||
# Used to send transactions
|
||||
rand = { version = "0.8", default-features = false }
|
||||
rand_chacha = { version = "0.3", default-features = false }
|
||||
# Used to select decoys
|
||||
rand_distr = { version = "0.4", default-features = false }
|
||||
|
||||
sha3 = { version = "0.10", default-features = false }
|
||||
pbkdf2 = { version = "0.12", features = ["simple"], default-features = false }
|
||||
|
||||
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
|
||||
|
||||
# Used for the hash to curve, along with the more complicated proofs
|
||||
group = { version = "0.13", default-features = false }
|
||||
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||
multiexp = { path = "../../crypto/multiexp", version = "0.4", default-features = false, features = ["batch"] }
|
||||
|
||||
# Needed for multisig
|
||||
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
|
||||
dleq = { path = "../../crypto/dleq", version = "0.4", default-features = false, features = ["serialize"], optional = true }
|
||||
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["ed25519"], optional = true }
|
||||
|
||||
monero-generators = { path = "generators", version = "0.4", default-features = false }
|
||||
|
||||
async-lock = { version = "3", default-features = false, optional = true }
|
||||
|
||||
hex-literal = "0.4"
|
||||
hex = { version = "0.4", default-features = false, features = ["alloc"] }
|
||||
serde = { version = "1", default-features = false, features = ["derive", "alloc"] }
|
||||
serde_json = { version = "1", default-features = false, features = ["alloc"] }
|
||||
|
||||
base58-monero = { version = "2", default-features = false, features = ["check"] }
|
||||
|
||||
# Used for the provided HTTP RPC
|
||||
digest_auth = { version = "0.3", default-features = false, optional = true }
|
||||
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls"], optional = true }
|
||||
tokio = { version = "1", default-features = false, optional = true }
|
||||
|
||||
[build-dependencies]
|
||||
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||
monero-generators = { path = "generators", version = "0.4", default-features = false }
|
||||
|
||||
[dev-dependencies]
|
||||
tokio = { version = "1", features = ["sync", "macros"] }
|
||||
|
||||
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
||||
|
||||
[features]
|
||||
std = [
|
||||
"std-shims/std",
|
||||
|
||||
"thiserror",
|
||||
|
||||
"zeroize/std",
|
||||
"subtle/std",
|
||||
|
||||
"rand_core/std",
|
||||
"rand/std",
|
||||
"rand_chacha/std",
|
||||
"rand_distr/std",
|
||||
|
||||
"sha3/std",
|
||||
"pbkdf2/std",
|
||||
|
||||
"multiexp/std",
|
||||
|
||||
"transcript/std",
|
||||
"dleq/std",
|
||||
|
||||
"monero-generators/std",
|
||||
|
||||
"async-lock?/std",
|
||||
|
||||
"hex/std",
|
||||
"serde/std",
|
||||
"serde_json/std",
|
||||
|
||||
"base58-monero/std",
|
||||
]
|
||||
|
||||
cache-distribution = ["async-lock"]
|
||||
http-rpc = ["digest_auth", "simple-request", "tokio"]
|
||||
multisig = ["transcript", "frost", "dleq", "std"]
|
||||
binaries = ["tokio/rt-multi-thread", "tokio/macros", "http-rpc"]
|
||||
experimental = []
|
||||
|
||||
default = ["std", "http-rpc"]
|
||||
@@ -1,6 +1,6 @@
|
||||
MIT License
|
||||
|
||||
Copyright (c) 2024-2025 Luke Parker
|
||||
Copyright (c) 2022-2023 Luke Parker
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software and associated documentation files (the "Software"), to deal
|
||||
49
coins/monero/README.md
Normal file
49
coins/monero/README.md
Normal file
@@ -0,0 +1,49 @@
|
||||
# monero-serai
|
||||
|
||||
A modern Monero transaction library intended for usage in wallets. It prides
|
||||
itself on accuracy, correctness, and removing common pit falls developers may
|
||||
face.
|
||||
|
||||
monero-serai also offers the following features:
|
||||
|
||||
- Featured Addresses
|
||||
- A FROST-based multisig orders of magnitude more performant than Monero's
|
||||
|
||||
### Purpose and support
|
||||
|
||||
monero-serai was written for Serai, a decentralized exchange aiming to support
|
||||
Monero. Despite this, monero-serai is intended to be a widely usable library,
|
||||
accurate to Monero. monero-serai guarantees the functionality needed for Serai,
|
||||
yet will not deprive functionality from other users.
|
||||
|
||||
Various legacy transaction formats are not currently implemented, yet we are
|
||||
willing to add support for them. There aren't active development efforts around
|
||||
them however.
|
||||
|
||||
### Caveats
|
||||
|
||||
This library DOES attempt to do the following:
|
||||
|
||||
- Create on-chain transactions identical to how wallet2 would (unless told not
|
||||
to)
|
||||
- Not be detectable as monero-serai when scanning outputs
|
||||
- Not reveal spent outputs to the connected RPC node
|
||||
|
||||
This library DOES NOT attempt to do the following:
|
||||
|
||||
- Have identical RPC behavior when creating transactions
|
||||
- Be a wallet
|
||||
|
||||
This means that monero-serai shouldn't be fingerprintable on-chain. It also
|
||||
shouldn't be fingerprintable if a targeted attack occurs to detect if the
|
||||
receiving wallet is monero-serai or wallet2. It also should be generally safe
|
||||
for usage with remote nodes.
|
||||
|
||||
It won't hide from remote nodes it's monero-serai however, potentially
|
||||
allowing a remote node to profile you. The implications of this are left to the
|
||||
user to consider.
|
||||
|
||||
It also won't act as a wallet, just as a transaction library. wallet2 has
|
||||
several *non-transaction-level* policies, such as always attempting to use two
|
||||
inputs to create transactions. These are considered out of scope to
|
||||
monero-serai.
|
||||
67
coins/monero/build.rs
Normal file
67
coins/monero/build.rs
Normal file
@@ -0,0 +1,67 @@
|
||||
use std::{
|
||||
io::Write,
|
||||
env,
|
||||
path::Path,
|
||||
fs::{File, remove_file},
|
||||
};
|
||||
|
||||
use dalek_ff_group::EdwardsPoint;
|
||||
|
||||
use monero_generators::bulletproofs_generators;
|
||||
|
||||
fn serialize(generators_string: &mut String, points: &[EdwardsPoint]) {
|
||||
for generator in points {
|
||||
generators_string.extend(
|
||||
format!(
|
||||
"
|
||||
dalek_ff_group::EdwardsPoint(
|
||||
curve25519_dalek::edwards::CompressedEdwardsY({:?}).decompress().unwrap()
|
||||
),
|
||||
",
|
||||
generator.compress().to_bytes()
|
||||
)
|
||||
.chars(),
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
fn generators(prefix: &'static str, path: &str) {
|
||||
let generators = bulletproofs_generators(prefix.as_bytes());
|
||||
#[allow(non_snake_case)]
|
||||
let mut G_str = String::new();
|
||||
serialize(&mut G_str, &generators.G);
|
||||
#[allow(non_snake_case)]
|
||||
let mut H_str = String::new();
|
||||
serialize(&mut H_str, &generators.H);
|
||||
|
||||
let path = Path::new(&env::var("OUT_DIR").unwrap()).join(path);
|
||||
let _ = remove_file(&path);
|
||||
File::create(&path)
|
||||
.unwrap()
|
||||
.write_all(
|
||||
format!(
|
||||
"
|
||||
pub(crate) static GENERATORS_CELL: OnceLock<Generators> = OnceLock::new();
|
||||
pub fn GENERATORS() -> &'static Generators {{
|
||||
GENERATORS_CELL.get_or_init(|| Generators {{
|
||||
G: vec![
|
||||
{G_str}
|
||||
],
|
||||
H: vec![
|
||||
{H_str}
|
||||
],
|
||||
}})
|
||||
}}
|
||||
",
|
||||
)
|
||||
.as_bytes(),
|
||||
)
|
||||
.unwrap();
|
||||
}
|
||||
|
||||
fn main() {
|
||||
println!("cargo:rerun-if-changed=build.rs");
|
||||
|
||||
generators("bulletproof", "generators.rs");
|
||||
generators("bulletproof_plus", "generators_plus.rs");
|
||||
}
|
||||
34
coins/monero/generators/Cargo.toml
Normal file
34
coins/monero/generators/Cargo.toml
Normal file
@@ -0,0 +1,34 @@
|
||||
[package]
|
||||
name = "monero-generators"
|
||||
version = "0.4.0"
|
||||
description = "Monero's hash_to_point and generators"
|
||||
license = "MIT"
|
||||
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero/generators"
|
||||
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||
edition = "2021"
|
||||
|
||||
[package.metadata.docs.rs]
|
||||
all-features = true
|
||||
rustdoc-args = ["--cfg", "docsrs"]
|
||||
|
||||
[lints]
|
||||
workspace = true
|
||||
|
||||
[dependencies]
|
||||
std-shims = { path = "../../../common/std-shims", version = "^0.1.1", default-features = false }
|
||||
|
||||
subtle = { version = "^2.4", default-features = false }
|
||||
|
||||
sha3 = { version = "0.10", default-features = false }
|
||||
|
||||
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
|
||||
|
||||
group = { version = "0.13", default-features = false }
|
||||
dalek-ff-group = { path = "../../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||
|
||||
[dev-dependencies]
|
||||
hex = "0.4"
|
||||
|
||||
[features]
|
||||
std = ["std-shims/std", "subtle/std", "sha3/std", "dalek-ff-group/std"]
|
||||
default = ["std"]
|
||||
@@ -1,6 +1,6 @@
|
||||
MIT License
|
||||
|
||||
Copyright (c) 2021-2025 Luke Parker
|
||||
Copyright (c) 2022-2023 Luke Parker
|
||||
|
||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
of this software and associated documentation files (the "Software"), to deal
|
||||
7
coins/monero/generators/README.md
Normal file
7
coins/monero/generators/README.md
Normal file
@@ -0,0 +1,7 @@
|
||||
# Monero Generators
|
||||
|
||||
Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
|
||||
An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
|
||||
`hash_to_point` here, is included, as needed to generate generators.
|
||||
|
||||
This library is usable under no-std when the `std` feature is disabled.
|
||||
60
coins/monero/generators/src/hash_to_point.rs
Normal file
60
coins/monero/generators/src/hash_to_point.rs
Normal file
@@ -0,0 +1,60 @@
|
||||
use subtle::ConditionallySelectable;
|
||||
|
||||
use curve25519_dalek::edwards::{EdwardsPoint, CompressedEdwardsY};
|
||||
|
||||
use group::ff::{Field, PrimeField};
|
||||
use dalek_ff_group::FieldElement;
|
||||
|
||||
use crate::hash;
|
||||
|
||||
/// Decompress canonically encoded ed25519 point
|
||||
/// It does not check if the point is in the prime order subgroup
|
||||
pub fn decompress_point(bytes: [u8; 32]) -> Option<EdwardsPoint> {
|
||||
CompressedEdwardsY(bytes)
|
||||
.decompress()
|
||||
// Ban points which are either unreduced or -0
|
||||
.filter(|point| point.compress().to_bytes() == bytes)
|
||||
}
|
||||
|
||||
/// Monero's hash to point function, as named `hash_to_ec`.
|
||||
pub fn hash_to_point(bytes: [u8; 32]) -> EdwardsPoint {
|
||||
#[allow(non_snake_case)]
|
||||
let A = FieldElement::from(486662u64);
|
||||
|
||||
let v = FieldElement::from_square(hash(&bytes)).double();
|
||||
let w = v + FieldElement::ONE;
|
||||
let x = w.square() + (-A.square() * v);
|
||||
|
||||
// This isn't the complete X, yet its initial value
|
||||
// We don't calculate the full X, and instead solely calculate Y, letting dalek reconstruct X
|
||||
// While inefficient, it solves API boundaries and reduces the amount of work done here
|
||||
#[allow(non_snake_case)]
|
||||
let X = {
|
||||
let u = w;
|
||||
let v = x;
|
||||
let v3 = v * v * v;
|
||||
let uv3 = u * v3;
|
||||
let v7 = v3 * v3 * v;
|
||||
let uv7 = u * v7;
|
||||
uv3 * uv7.pow((-FieldElement::from(5u8)) * FieldElement::from(8u8).invert().unwrap())
|
||||
};
|
||||
let x = X.square() * x;
|
||||
|
||||
let y = w - x;
|
||||
let non_zero_0 = !y.is_zero();
|
||||
let y_if_non_zero_0 = w + x;
|
||||
let sign = non_zero_0 & (!y_if_non_zero_0.is_zero());
|
||||
|
||||
let mut z = -A;
|
||||
z *= FieldElement::conditional_select(&v, &FieldElement::from(1u8), sign);
|
||||
#[allow(non_snake_case)]
|
||||
let Z = z + w;
|
||||
#[allow(non_snake_case)]
|
||||
let mut Y = z - w;
|
||||
|
||||
Y *= Z.invert().unwrap();
|
||||
let mut bytes = Y.to_repr();
|
||||
bytes[31] |= sign.unwrap_u8() << 7;
|
||||
|
||||
decompress_point(bytes).unwrap().mul_by_cofactor()
|
||||
}
|
||||
79
coins/monero/generators/src/lib.rs
Normal file
79
coins/monero/generators/src/lib.rs
Normal file
@@ -0,0 +1,79 @@
|
||||
//! Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
|
||||
//!
|
||||
//! An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
|
||||
//! `hash_to_point` here, is included, as needed to generate generators.
|
||||
|
||||
#![cfg_attr(not(feature = "std"), no_std)]
|
||||
|
||||
use std_shims::{sync::OnceLock, vec::Vec};
|
||||
|
||||
use sha3::{Digest, Keccak256};
|
||||
|
||||
use curve25519_dalek::edwards::{EdwardsPoint as DalekPoint};
|
||||
|
||||
use group::{Group, GroupEncoding};
|
||||
use dalek_ff_group::EdwardsPoint;
|
||||
|
||||
mod varint;
|
||||
use varint::write_varint;
|
||||
|
||||
mod hash_to_point;
|
||||
pub use hash_to_point::{hash_to_point, decompress_point};
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests;
|
||||
|
||||
fn hash(data: &[u8]) -> [u8; 32] {
|
||||
Keccak256::digest(data).into()
|
||||
}
|
||||
|
||||
static H_CELL: OnceLock<DalekPoint> = OnceLock::new();
|
||||
/// Monero's alternate generator `H`, used for amounts in Pedersen commitments.
|
||||
#[allow(non_snake_case)]
|
||||
pub fn H() -> DalekPoint {
|
||||
*H_CELL.get_or_init(|| {
|
||||
decompress_point(hash(&EdwardsPoint::generator().to_bytes())).unwrap().mul_by_cofactor()
|
||||
})
|
||||
}
|
||||
|
||||
static H_POW_2_CELL: OnceLock<[DalekPoint; 64]> = OnceLock::new();
|
||||
/// Monero's alternate generator `H`, multiplied by 2**i for i in 1 ..= 64.
|
||||
#[allow(non_snake_case)]
|
||||
pub fn H_pow_2() -> &'static [DalekPoint; 64] {
|
||||
H_POW_2_CELL.get_or_init(|| {
|
||||
let mut res = [H(); 64];
|
||||
for i in 1 .. 64 {
|
||||
res[i] = res[i - 1] + res[i - 1];
|
||||
}
|
||||
res
|
||||
})
|
||||
}
|
||||
|
||||
const MAX_M: usize = 16;
|
||||
const N: usize = 64;
|
||||
const MAX_MN: usize = MAX_M * N;
|
||||
|
||||
/// Container struct for Bulletproofs(+) generators.
|
||||
#[allow(non_snake_case)]
|
||||
pub struct Generators {
|
||||
pub G: Vec<EdwardsPoint>,
|
||||
pub H: Vec<EdwardsPoint>,
|
||||
}
|
||||
|
||||
/// Generate generators as needed for Bulletproofs(+), as Monero does.
|
||||
pub fn bulletproofs_generators(dst: &'static [u8]) -> Generators {
|
||||
let mut res = Generators { G: Vec::with_capacity(MAX_MN), H: Vec::with_capacity(MAX_MN) };
|
||||
for i in 0 .. MAX_MN {
|
||||
let i = 2 * i;
|
||||
|
||||
let mut even = H().compress().to_bytes().to_vec();
|
||||
even.extend(dst);
|
||||
let mut odd = even.clone();
|
||||
|
||||
write_varint(&i.try_into().unwrap(), &mut even).unwrap();
|
||||
write_varint(&(i + 1).try_into().unwrap(), &mut odd).unwrap();
|
||||
res.H.push(EdwardsPoint(hash_to_point(hash(&even))));
|
||||
res.G.push(EdwardsPoint(hash_to_point(hash(&odd))));
|
||||
}
|
||||
res
|
||||
}
|
||||
38
coins/monero/generators/src/tests/hash_to_point.rs
Normal file
38
coins/monero/generators/src/tests/hash_to_point.rs
Normal file
@@ -0,0 +1,38 @@
|
||||
use crate::{decompress_point, hash_to_point};
|
||||
|
||||
#[test]
|
||||
fn crypto_tests() {
|
||||
// tests.txt file copied from monero repo
|
||||
// https://github.com/monero-project/monero/
|
||||
// blob/ac02af92867590ca80b2779a7bbeafa99ff94dcb/tests/crypto/tests.txt
|
||||
let reader = include_str!("./tests.txt");
|
||||
|
||||
for line in reader.lines() {
|
||||
let mut words = line.split_whitespace();
|
||||
let command = words.next().unwrap();
|
||||
|
||||
match command {
|
||||
"check_key" => {
|
||||
let key = words.next().unwrap();
|
||||
let expected = match words.next().unwrap() {
|
||||
"true" => true,
|
||||
"false" => false,
|
||||
_ => unreachable!("invalid result"),
|
||||
};
|
||||
|
||||
let actual = decompress_point(hex::decode(key).unwrap().try_into().unwrap());
|
||||
|
||||
assert_eq!(actual.is_some(), expected);
|
||||
}
|
||||
"hash_to_ec" => {
|
||||
let bytes = words.next().unwrap();
|
||||
let expected = words.next().unwrap();
|
||||
|
||||
let actual = hash_to_point(hex::decode(bytes).unwrap().try_into().unwrap());
|
||||
|
||||
assert_eq!(hex::encode(actual.compress().to_bytes()), expected);
|
||||
}
|
||||
_ => unreachable!("unknown command"),
|
||||
}
|
||||
}
|
||||
}
|
||||
1
coins/monero/generators/src/tests/mod.rs
Normal file
1
coins/monero/generators/src/tests/mod.rs
Normal file
@@ -0,0 +1 @@
|
||||
mod hash_to_point;
|
||||
628
coins/monero/generators/src/tests/tests.txt
Normal file
628
coins/monero/generators/src/tests/tests.txt
Normal file
@@ -0,0 +1,628 @@
|
||||
check_key c2cb3cf3840aa9893e00ec77093d3d44dba7da840b51c48462072d58d8efd183 false
|
||||
check_key bd85a61bae0c101d826cbed54b1290f941d26e70607a07fc6f0ad611eb8f70a6 true
|
||||
check_key 328f81cad4eba24ab2bad7c0e56b1e2e7346e625bcb06ae649aef3ffa0b8bef3 false
|
||||
check_key 6016a5463b9e5a58c3410d3f892b76278883473c3f0b69459172d3de49e85abe true
|
||||
check_key 4c71282b2add07cdc6898a2622553f1ca4eb851e5cb121181628be5f3814c5b1 false
|
||||
check_key 69393c25c3b50e177f81f20f852dd604e768eb30052e23108b3cfa1a73f2736e true
|
||||
check_key 3d5a89b676cb84c2be3428d20a660dc6a37cae13912e127888a5132e8bac2163 true
|
||||
check_key 78cd665deb28cebc6208f307734c56fccdf5fa7e2933fadfcdd2b6246e9ae95c false
|
||||
check_key e03b2414e260580f86ee294cd4c636a5b153e617f704e81dad248fbf715b2ee4 true
|
||||
check_key 28c3503ce82d7cdc8e0d96c4553bcf0352bbcfc73925495dbe541e7e1df105fc false
|
||||
check_key 06855c3c3e0d03fec354059bda319b39916bdc10b6581e3f41b335ee7b014fd5 false
|
||||
check_key 556381485df0d7d5a268ab5ecfb2984b060acc63471183fcf538bf273b0c0cb5 true
|
||||
check_key c7f76d82ac64b1e7fdc32761ff00d6f0f7ada4cf223aa5a11187e3a02e1d5319 true
|
||||
check_key cfa85d8bdb6f633fcf031adee3a299ac42eeb6bd707744049f652f6322f5aa47 true
|
||||
check_key 91e9b63ced2b08979fee713365464cc3417c4f238f9bdd3396efbb3c58e195ee true
|
||||
check_key 7b56e76fe94bd30b3b2f2c4ba5fe4c504821753a8965eb1cbcf8896e2d6aba19 true
|
||||
check_key 7338df494bc416cf5edcc02069e067f39cb269ce67bd9faba956021ce3b3de3a false
|
||||
check_key f9a1f27b1618342a558379f4815fa5039a8fe9d98a09f45c1af857ba99231dc1 false
|
||||
check_key b2a1f37718180d4448a7fcb5f788048b1a7132dde1cfd25f0b9b01776a21c687 true
|
||||
check_key 0d3a0f9443a8b24510ad1e76a8117cca03bce416edfe35e3c2a2c2712454f8dc false
|
||||
check_key d8d3d806a76f120c4027dc9c9d741ad32e06861b9cfbc4ce39289c04e251bb3c false
|
||||
check_key 1e9e3ba7bc536cd113606842835d1f05b4b9e65875742f3a35bfb2d63164b5d5 true
|
||||
check_key 5c52d0087997a2cdf1d01ed0560d94b4bfd328cb741cb9a8d46ff50374b35a57 true
|
||||
check_key bb669d4d7ffc4b91a14defedcdbd96b330108b01adc63aa685e2165284c0033b false
|
||||
check_key d2709ae751a0a6fd796c98456fa95a7b64b75a3434f1caa3496eeaf5c14109b4 true
|
||||
check_key e0c238cba781684e655b10a7d4af04ab7ff2e7022182d7ed2279d6adf36b3e7a false
|
||||
check_key 34ebb4bf871572cee5c6935716fab8c8ec28feef4f039763d8f039b84a50bf4c false
|
||||
check_key 4730d4f38ec3f3b83e32e6335d2506df4ee39858848842c5a0184417fcc639e4 true
|
||||
check_key d42cf7fdf5e17e0a8a7f88505a2b7a3d297113bd93d3c20fa87e11509ec905a2 true
|
||||
check_key b757c95059cefabb0080d3a8ebca82e46efecfd29881be3121857f9d915e388c false
|
||||
check_key bbe777aaf04d02b96c0632f4b1c6f35f1c7bcbc5f22af192f92c077709a2b50b false
|
||||
check_key 73518522aabd28566f858c33fccb34b7a4de0e283f6f783f625604ee647afad9 true
|
||||
check_key f230622c4a8f6e516590466bd10f86b64fbef61695f6a054d37604e0b024d5af false
|
||||
check_key bc6b9a8379fd6c369f7c3bd9ddce58db6b78f27a41d798bb865c3920824d0943 false
|
||||
check_key 45a4f87c25898cd6be105fa1602b85c4d862782adaac8b85c996c4a2bcd8af47 true
|
||||
check_key eb4ad3561d21c4311affbd7cc2c7ff5fd509f72f88ba67dc097a75c31fdbd990 false
|
||||
check_key 2f34f4630c09a23b7ecc19f02b4190a26df69e07e13de8069ae5ff80d23762fc true
|
||||
check_key 2ea4e4fb5085eb5c8adee0d5ab7d35c67d74d343bd816cd13924536cffc2527c true
|
||||
check_key 5d35467ee6705a0d35818aa9ae94e4603c3e5500bfc4cf4c4f77a7160a597aa6 true
|
||||
check_key 8ff42bc76796e20c99b6e879369bd4b46a256db1366416291de9166e39d5a093 true
|
||||
check_key 0262ba718850df6c621e8a24cd9e4831c047e38818a89e15c7a06a489a4558e1 false
|
||||
check_key 58b29b2ba238b534b08fb46f05f430e61cb77dc251b0bb50afec1b6061fd9247 false
|
||||
check_key 153170e3dc2b0e1b368fc0d0e31053e872f094cdace9a2846367f0d9245a109b false
|
||||
check_key 40419d309d07522d493bb047ca9b5fb6c401aae226eefae6fd395f5bb9114200 true
|
||||
check_key 713068818d256ef69c78cd6082492013fbd48de3c9e7e076415dd0a692994504 true
|
||||
check_key a7218ee08e50781b0c87312d5e0031467e863c10081668e3792d96cbcee4e474 true
|
||||
check_key 356ce516b00e674ef1729c75b0a68090e7265cef675bbf32bf809495b67e9342 false
|
||||
check_key 52a5c053293675e3efd2c585047002ea6d77931cbf38f541b9070d319dc0d237 false
|
||||
check_key 77c0080bf157e069b18c4c604cc9505c5ec6f0f9930e087592d70507ca1b5534 false
|
||||
check_key e733bc41f880a4cfb1ca6f397916504130807289cacfca10b15f5b8d058ed1bf false
|
||||
check_key c4f1d3c884908a574ecea8be10e02277de35ef84a1d10f105f2be996f285161f true
|
||||
check_key aed677f7f69e146aa0863606ac580fc0bbdc22a88c4b4386abaa4bdfff66bcc9 false
|
||||
check_key 6ad0edf59769599af8caa986f502afc67aecbebb8107aaf5e7d3ae51d5cf8dd8 false
|
||||
check_key 64a0a70e99be1f775c222ee9cd6f1bee6f632cb9417899af398ff9aff70661c6 true
|
||||
check_key c63afaa03bb5c4ed7bc77aac175dbfb73f904440b2e3056a65850ac1bd261332 false
|
||||
check_key a4e89cd2471c26951513b1cfbdcf053a86575e095af52495276aa56ede8ce344 false
|
||||
check_key 2ce935d97f7c3ddb973de685d20f58ee39938fe557216328045ec2b83f3132be true
|
||||
check_key 3e3d38b1fca93c1559ac030d586616354c668aa76245a09e3fa6de55ac730973 true
|
||||
check_key 8b81b9681f76a4254007fd07ed1ded25fc675973ccb23afd06074805194733a4 false
|
||||
check_key 26d1c15dfc371489439e29bcef2afcf7ed01fac24960fdc2e7c20847a8067588 true
|
||||
check_key 85c1199b5a4591fc4cc36d23660648c1b9cfbb0e9c47199fa3eea33299a3dcec false
|
||||
check_key 60830ba5449c1f04ac54675dfc7cac7510106c4b7549852551f8fe65971123e2 false
|
||||
check_key 3e43c28c024597b3b836e4bc16905047cbf6e841b80e0b8cd6a325049070c2a5 false
|
||||
check_key 474792c16a0032343a6f28f4cb564747c3b1ea0b6a6b9a42f7c71d7cc3dd3b44 true
|
||||
check_key c8ec5e67cb5786673085191881950a3ca20dde88f46851b01dd91c695cfbad16 true
|
||||
check_key 861c4b24b24a87b8559e0bb665f84dcc506c147a909f335ae4573b92299f042f false
|
||||
check_key 2c9e0fe3e4983d79f86c8c36928528f1bc90d94352ce427032cdef6906d84d0b true
|
||||
check_key 9293742822c2dff63fdc1bf6645c864fd527cea2ddba6d4f3048d202fc340c9a true
|
||||
check_key 3956422ad380ef19cb9fe360ef09cc7aaec7163eea4114392a7a0b2e2671914e true
|
||||
check_key 5ae8e72cadda85e525922fec11bd53a261cf26ee230fe85a1187f831b1b2c258 false
|
||||
check_key 973feca43a0baf450c30ace5dc19015e19400f0898316e28d9f3c631da31f99a true
|
||||
check_key dd946c91a2077f45c5c16939e53859d9beabaf065e7b1b993d5e5cd385f8716e true
|
||||
check_key b3928f2d67e47f6bd6da81f72e64908d8ff391af5689f0202c4c6fec7666ffe8 true
|
||||
check_key 313382e82083697d7f9d256c3b3800b099b56c3ef33cacdccbd40a65622e25fc false
|
||||
check_key 7d65380c12144802d39ed9306eed79fe165854273700437c0b4b50559800c058 true
|
||||
check_key 4db5c20a49422fd27739c9ca80e2271a8a125dfcead22cb8f035d0e1b7b163be true
|
||||
check_key dd76a9f565ef0e44d1531349ec4c5f7c3c387c2f5823e693b4952f4b0b70808c true
|
||||
check_key 66430bf628eae23918c3ed17b42138db1f98c24819e55fc4a07452d0c85603eb true
|
||||
check_key 9f0b677830c3f089c27daf724bb10be848537f8285de83ab0292d35afb617f77 false
|
||||
check_key cbf98287391fb00b1e68ad64e9fb10198025864c099b8b9334d840457e673874 true
|
||||
check_key a42552e9446e49a83aed9e3370506671216b2d1471392293b8fc2b81c81a73ee false
|
||||
check_key fb3de55ac81a923d506a514602d65d004ec9d13e8b47e82d73af06da73006673 false
|
||||
check_key e17abb78e58a4b72ff4ad7387b290f2811be880b394b8bcaae7748ac09930169 false
|
||||
check_key 9ffbda7ace69753761cdb5eb01f75433efa5cdb6a4f1b664874182c6a95adcba true
|
||||
check_key 507123c979179ea0a3f7f67fb485f71c8636ec4ec70aa47b92f3c707e7541a54 false
|
||||
check_key f1d0b156571994ef578c61cb6545d34f834eb30e4357539a5633c862d4dffa91 false
|
||||
check_key 3de62311ec14f9ee95828c190b2dc3f03059d6119e8dfccb7323efc640e07c75 false
|
||||
check_key 5e50bb48bc9f6dd11d52c1f0d10d8ae5674d7a4af89cbbce178dafc8a562e5fe false
|
||||
check_key 20b2c16497be101995391ceefb979814b0ea76f1ed5b6987985bcdcd17b36a81 false
|
||||
check_key d63bff73b914ce791c840e99bfae0d47afdb99c2375e33c8f149d0df03d97873 false
|
||||
check_key 3f24b3d94b5ddd244e4c4e67a6d9f533f0396ca30454aa0ca799f21328b81d47 true
|
||||
check_key 6a44c016f09225a6d2e830290719d33eb29b53b553eea7737ed3a6e297b2e7d2 true
|
||||
check_key ff0f34df0c76c207b8340be2009db72f730c69c2bbfeea2013105eaccf1d1f8e true
|
||||
check_key 4baf559869fe4e915e219c3c8d9a2330fc91e542a5a2a7311d4d59fee996f807 true
|
||||
check_key 1632207dfef26e97d13b0d0035ea9468fc5a8a89b0990fce77bb143c9d7f3b67 true
|
||||
check_key fcb3dee3993d1a47630f29410903dd03706bd5e81c5802e6f1b9095cbdb404d3 true
|
||||
check_key fb527092b9809e3d27d7588c7ef89915a769b99c1e03e7f72bbead9ed837daae false
|
||||
check_key 902b118d27d40ab9cbd55edd375801ce302cdb59e09c8659a3ea1401918d8bba false
|
||||
check_key 4d6fbf25ca51e263a700f1abf84f758dde3d11b632e908b3093d64fe2e70ea0a true
|
||||
check_key f4c3211ec70affc1c9a94a6589460ee8360dad5f8c679152f16994038532e3fc true
|
||||
check_key c2b3d73ac14956d7fdf12fa92235af1bb09e1566a6a6ffd0025682c750abdd69 false
|
||||
check_key b7e68c12207d2e2104fb2ca224829b6fccc1c0e2154e8a931e3c837a945f4430 false
|
||||
check_key 56ca0ca227708f1099bda1463db9559541c8c11ffad7b3d95c717471f25a01bf true
|
||||
check_key 3eef3a46833e4d851671182a682e344e36bea7211a001f3b8af1093a9c83f1b2 true
|
||||
check_key bd1f4a4f26cab7c1cbc0e17049b90854d6d28d2d55181e1b5f7a8045fcdfa06e true
|
||||
check_key 8537b01c87e7c184d9555e8d93363dcd9b60a8acc94cd3e41eb7525fd3e1d35a false
|
||||
check_key 68ace49179d549bad391d98ab2cc8afee65f98ce14955c3c1b16e850fabec231 true
|
||||
check_key f9922f8a660e7c3e4f3735a817d18b72f59166a0be2d99795f953cf233a27e24 true
|
||||
check_key 036b6be3da26e80508d5a5a6a5999a1fe0db1ac4e9ade8f1ea2eaf2ea9b1a70e true
|
||||
check_key 5e595e886ce16b5ea31f53bcb619f16c8437276618c595739fece6339731feb0 false
|
||||
check_key 4ee2cebae3476ed2eeb7efef9d20958538b3642f938403302682a04115c0f8ed false
|
||||
check_key 519eedbd0da8676063ce7d5a605b3fc27afeecded857afa24b894ad248c87b5d false
|
||||
check_key ce2b627c0accf4a3105796680c37792b30c6337d2d4fea11678282455ff82ff7 false
|
||||
check_key aa26ed99071a8416215e8e7ded784aa7c2b303aab67e66f7539905d7e922eb4d false
|
||||
check_key 435ae49c9ca26758aa103bdcca8d51393b1906fe27a61c5245361e554f335ec2 true
|
||||
check_key 42568af395bd30024f6ccc95205c0e11a6ad1a7ee100f0ec46fcdf0af88e91fb false
|
||||
check_key 0b4a78d1fde56181445f04ca4780f0725daa9c375b496fab6c037d6b2c2275db true
|
||||
check_key 2f82d2a3c8ce801e1ad334f9e074a4fbf76ffac4080a7331dc1359c2b4f674a4 false
|
||||
check_key 24297d8832d733ed052dd102d4c40e813f702006f325644ccf0cb2c31f77953f false
|
||||
check_key 5231a53f6bea7c75b273bde4a9f673044ed87796f20e0909978f29d98fc8d4f0 true
|
||||
check_key 94b5affcf78be5cf62765c32a0794bc06b4900e8a47ddba0e166ec20cec05935 true
|
||||
check_key c14b4d846ea52ffbbb36aa62f059453af3cfae306280dada185d2d385ef8f317 true
|
||||
check_key cceb34fddf01a6182deb79c6000a998742d4800d23d1d8472e3f43cd61f94508 true
|
||||
check_key 1faffa33407fba1634d4136cf9447896776c16293b033c6794f06774b514744c true
|
||||
check_key faaac98f644a2b77fb09ba0ebf5fcddf3ff55f6604c0e9e77f0278063e25113a true
|
||||
check_key 09e8525b00bea395978279ca979247a76f38f86dce4465eb76c140a7f904c109 true
|
||||
check_key 2d797fc725e7fb6d3b412694e7386040effe4823cdf01f6ec7edea4bc0e77e20 false
|
||||
check_key bbb74dabee651a65f46bca472df6a8a749cc4ba5ca35078df5f6d27a772f922a false
|
||||
check_key 77513ca00f3866607c3eff5c2c011beffa775c0022c5a4e7de1120a27e6687fd true
|
||||
check_key 10064c14ace2a998fc2843eeeb62884fe3f7ab331ca70613d6a978f44d9868eb false
|
||||
check_key 026ae84beb5e54c62629a7b63702e85044e38cadfc9a1fcabee6099ba185005c false
|
||||
check_key aef91536292b7ba34a3e787fb019523c2fa7a0d56fca069cc82ccb6b02a45b14 false
|
||||
check_key 147bb1a82c623c722540feaad82b7adf4b85c6ec0cbcef3ca52906f3e85617ac true
|
||||
check_key fc9fb281a0847d58dc9340ef35ef02f7d20671142f12bdd1bfb324ab61d03911 false
|
||||
check_key b739801b9455ac617ca4a7190e2806669f638d4b2f9288171afb55e1542c8d71 false
|
||||
check_key 494cc1e2ee997eb1eb051f83c4c89968116714ddf74e460d4fa1c6e7c72e3eb3 true
|
||||
check_key ed2fbdf2b727ed9284db90ec900a942224787a880bc41d95c4bc4cf136260fd7 true
|
||||
check_key 02843d3e6fc6835ad03983670a592361a26948eb3e31648d572416a944d4909e true
|
||||
check_key c14fea556a7e1b6b6c3d4e2e38a4e7e95d834220ff0140d3f7f561a34e460801 true
|
||||
check_key 5f8f82a35452d0b0d09ffb40a1154641916c31e161ad1a6ab8cfddc2004efdf6 false
|
||||
check_key 7b93d72429fab07b49956007eba335bb8c5629fbf9e7a601eaa030f196934a56 true
|
||||
check_key 6a63ed96d2e46c2874beaf82344065d94b1e5c04406997f94caf4ccd97cfbab9 false
|
||||
check_key c915f409e1e0f776d1f440aa6969cfec97559ef864b07d8c0d7c1163871b4603 true
|
||||
check_key d06bc33630fc94303c2c369481308f805f5ce53c40141160aa4a1f072967617e false
|
||||
check_key 1aafb14ca15043c2589bcd32c7c5f29479216a1980e127e9536729faf1c40266 true
|
||||
check_key 58c115624a20f4b0c152ccd048c54a28a938556863ab8521b154d3165d3649cd false
|
||||
check_key 9001ba086e8aa8a67e128f36d700cc641071556306db7ec9b8ac12a6256b27b7 false
|
||||
check_key 898c468541634fb0def11f82c781341fce0def7b15695af4e642e397218c730c true
|
||||
check_key 47ea6539e65b7b611b0e1ae9ee170adf7c31581ca9f78796d8ebbcc5cd74b712 false
|
||||
check_key 0c60952a64eeac446652f5d3c136fd36966cf66310c15ee6ab2ecbf981461257 false
|
||||
check_key 682264c4686dc7736b6e46bdc8ab231239bc5dac3f5cb9681a1e97a527945e8e true
|
||||
check_key 276006845ca0ea4238b231434e20ad8b8b2a36876effbe1d1e3ffb1f14973397 true
|
||||
check_key eecd3a49e55e32446f86c045dce123ef6fe2e5c57db1d850644b3c56ec689fce true
|
||||
check_key a4dced63589118db3d5aebf6b5670e71250f07485ca4bb6dddf9cce3e4c227a1 false
|
||||
check_key b8ade608ba43d55db7ab481da88b74a9be513fca651c03e04d30cc79f50e0276 false
|
||||
check_key 0d91de88d007a03fe782f904808b036ff63dec6b73ce080c55231afd4ed261c3 true
|
||||
check_key 87c59becb52dd16501edadbb0e06b0406d69541c4d46115351e79951a8dd9c28 true
|
||||
check_key 9aee723be2265171fe10a86d1d3e9cf5a4e46178e859db83f86d1c6db104a247 false
|
||||
check_key 509d34ae5bf56db011845b8cdf0cc7729ed602fce765e9564cb433b4d4421a43 false
|
||||
check_key 06e766d9a6640558767c2aab29f73199130bfdc07fd858a73e6ae8e7b7ba23ba false
|
||||
check_key 801c4fe5ab3e7cf13f7aa2ca3bc57cc8eba587d21f8bc4cd40b1e98db7aec8d9 false
|
||||
check_key d85ad63aeb7d2faa22e5c9b87cd27f45b01e6d0fdc4c3ddf105584ac0a021465 false
|
||||
check_key a7ca13051eb2baeb5befa5e236e482e0bb71803ad06a6eae3ae48742393329d2 true
|
||||
check_key 5a9ba3ec20f116173d933bf5cf35c320ed3751432f3ab453e4a6c51c1d243257 false
|
||||
check_key a4091add8a6710c03285a422d6e67863a48b818f61c62e989b1e9b2ace240a87 false
|
||||
check_key bdee0c6442e6808f25bb18e21b19032cf93a55a5f5c6426fba2227a41c748684 true
|
||||
check_key d4aeb6cdad9667ec3b65c7fbc5bfd1b82bba1939c6bb448a86e40aec42be5f25 false
|
||||
check_key 73525b30a77f1212f7e339ec11f48c453e476f3669e6e70bebabc2fe9e37c160 true
|
||||
check_key 45501f2dc4d0a3131f9e0fe37a51c14869ab610abd8bf0158111617924953629 false
|
||||
check_key 07d0e4c592aa3676adf81cca31a95d50c8c269d995a78cde27b2a9a7a93083a6 false
|
||||
check_key a1797d6178c18add443d22fdbf45ca5e49ead2f78b70bdf1500f570ee90adca5 true
|
||||
check_key 0961e82e6e7855d7b7bf96777e14ae729f91c5bbd20f805bd7daac5ccbec4bab false
|
||||
check_key 57f5ba0ad36e997a4fb585cd2fc81b9cc5418db702c4d1e366639bb432d37c73 true
|
||||
check_key 82b005be61580856841e042ee8be74ae4ca66bb6733478e81ca1e56213de5c05 false
|
||||
check_key d7733dcae1874c93e9a2bd46385f720801f913744d60479930dad7d56c767cdc false
|
||||
check_key b8b8b698609ac3f1bd8f4965151b43b362e6c5e3d1c1feae312c1d43976d59ab true
|
||||
check_key 4bba7815a9a1b86a5b80b17ac0b514e2faa7a24024f269b330e5b7032ae8c04e true
|
||||
check_key 0f70da8f8266b58acda259935ef1a947c923f8698622c5503520ff31162e877b false
|
||||
check_key 233eaa3db80f314c6c895d1328a658a9175158fa2483ed216670c288a04b27bc false
|
||||
check_key a889f124fabfd7a1e2d176f485be0cbd8b3eeaafeee4f40e99e2a56befb665be true
|
||||
check_key 2b7b8abc198b11cf7efa21bc63ec436f790fe1f9b8c044440f183ab291af61d6 true
|
||||
check_key 2491804714f7938cf501fb2adf07597b4899b919cabbaab49518b8f8767fdc6a true
|
||||
check_key 52744a54fcb00dc930a5d7c2bc866cbfc1e75dd38b38021fd792bb0ca9f43164 true
|
||||
check_key e42cbf70b81ba318419104dffbb0cdc3b7e7d4698e422206b753a4e2e6fc69bb false
|
||||
check_key 2faff73e4fed62965f3dbf2e6446b5fea0364666cc8c9450b6ed63bbb6f5f0e7 true
|
||||
check_key 8b963928d75be661c3c18ddd4f4d1f37ebc095ce1edc13fe8b23784c8f416dfd false
|
||||
check_key b1162f952808434e4d2562ffda98bd311613d655d8cf85dc86e0a6c59f7158bc true
|
||||
check_key 5a69adcd9e4f5b0020467e968d85877cb3aa04fa86088d4499b57ca65a665836 true
|
||||
check_key 61ab47da432c829d0bc9d4fdb59520b135428eec665ad509678188b81c7adf49 false
|
||||
check_key 154bb547f22f65a87c0c3f56294f5791d04a3c14c8125d256aeed8ec54c4a06e true
|
||||
check_key 0a78197861c30fd3547b5f2eabd96d3ac22ac0632f03b7afd9d5d2bfc2db352f true
|
||||
check_key 8bdeadcca1f1f8a4a67b01ed2f10ef31aba7b034e8d1df3a69fe9aebf32454e0 false
|
||||
check_key f4b17dfca559be7d5cea500ac01e834624fed9befae3af746b39073d5f63190d true
|
||||
check_key 622c52821e16ddc63b58f3ec2b959fe8c6ea6b1a596d9a58fd81178963f41c01 true
|
||||
check_key 07bedd5d55c937ef5e23a56c6e58f31adb91224d985285d7fef39ede3a9efb17 false
|
||||
check_key 5179bf3b7458648e57dc20f003c6bbfd55e8cd7c0a6e90df6ef8e8183b46f99d true
|
||||
check_key 683c80c3f304f10fdd53a84813b5c25b1627ebd14eb29b258b41cd14396ef41f true
|
||||
check_key c266244ed597c438170875fe7874f81258a830105ca1108131e6b8fea95eb8ba true
|
||||
check_key 0c1cdc693df29c2d1e66b2ce3747e34a30287d5eb6c302495634ec856593fe8e true
|
||||
check_key 28950f508f6a0d4c20ab5e4d55b80565a6a539092e72b7eb0ed9fa5017ecef88 false
|
||||
check_key 8328a2a5fcfc4433b1c283539a8943e6eb8cc16c59f29dedc3af2c77cfd56f25 true
|
||||
check_key 5d0f82319676d4d3636ff5dc2a38ea5ec8aeaac4835fdcab983ab35d76b7967b false
|
||||
check_key cafcc75e94a014115f25c23aaae86e67352f928f468d4312b92240ff0f3a4481 false
|
||||
check_key 3e5fdd8072574218f389d018e959669e8ca4ef20b114ea7dce7bfb32339f9f42 true
|
||||
check_key 591763e3390a78ccb529ceea3d3a97165878b179ad2edaa166fd3c78ec69d391 true
|
||||
check_key 7a0a196935bf79dc2b1c3050e8f2bf0665f7773fc07511b828ec1c4b1451d317 false
|
||||
check_key 9cf0c034162131fbaa94a608f58546d0acbcc2e67b62a0b2be2ce75fc8c25b9a false
|
||||
check_key e3840846e3d32644d45654b96def09a5d6968caca9048c13fcaab7ae8851c316 false
|
||||
check_key a4e330253739af588d70fbda23543f6df7d76d894a486d169e5fedf7ed32d2e2 false
|
||||
check_key cfb41db7091223865f7ecbdda92b9a6fb08887827831451de5bcb3165395d95d true
|
||||
check_key 3d10bd023cef8ae30229fdbfa7446a3c218423d00f330857ff6adde080749015 false
|
||||
check_key 4403b53b8d4112bb1727bb8b5fd63d1f79f107705ffe17867704e70a61875328 false
|
||||
check_key 121ef0813a9f76b7a9c045058557c5072de6a102f06a9b103ead6af079420c29 true
|
||||
check_key 386204cf473caf3854351dda55844a41162eb9ce4740e1e31cfef037b41bc56e false
|
||||
check_key eb5872300dc658161df469364283e4658f37f6a1349976f8973bd6b5d1d57a39 true
|
||||
check_key b8f32188f0fc62eeb38a561ff7b7f3c94440e6d366a05ef7636958bc97834d02 false
|
||||
check_key a817f129a8292df79eef8531736fdebb2e985304653e7ef286574d0703b40fb4 false
|
||||
check_key 2c06595bc103447b9c20a71cd358c704cb43b0b34c23fb768e6730ac9494f39e true
|
||||
check_key dd84bc4c366ced4f65c50c26beb8a9bc26c88b7d4a77effbb0f7af1b28e25734 false
|
||||
check_key 76b4d33810eed637f90d49a530ac5415df97cafdac6f17eda1ba7eb9a14e5886 true
|
||||
check_key 926ce5161c4c92d90ec4efc58e5f449a2c385766c42d2e60af16b7362097aef5 false
|
||||
check_key 20c661f1e95e94a745eb9ec7a4fa719eff2f64052968e448d4734f90952aefee false
|
||||
check_key 671b50abbd119c756010416e15fcdcc9a8e92eed0f67cbca240c3a9154db55c0 false
|
||||
check_key df7aeee8458433e5c68253b8ef006a1c74ce3aef8951056f1fa918a8eb855213 false
|
||||
check_key 70c81a38b92849cf547e3d5a6570d78e5228d4eaf9c8fdd15959edc9eb750daf false
|
||||
check_key 55a512100b72d4ae0cfc16c75566fcaa3a7bb9116840db1559c71fd0e961cc36 false
|
||||
check_key dbfbec4d0d2433a794ad40dc0aea965b6582875805c9a7351b47377403296acd true
|
||||
check_key 0a7fe09eb9342214f98b38964f72ae3c787c19e5d7e256af9216f108f88b00a3 true
|
||||
check_key a82e54681475f53ced9730ee9e3a607e341014d9403f5a42f3dbdbe8fc52e842 true
|
||||
check_key 4d1f90059f7895a3f89abf16162e8d69b399c417f515ccb43b83144bbe8105f6 true
|
||||
check_key 94e5c5b8486b1f2ff4e98ddf3b9295787eb252ba9b408ca4d7724595861da834 false
|
||||
check_key d16e3e8dfa6d33d1d2db21c651006ccddbf4ce2e556594de5a22ae433e774ae6 false
|
||||
check_key a1b203ec5e36098a3af08d6077068fec57eab3a754cbb5f8192983f37191c2df false
|
||||
check_key 5378bb3ec8b4e49849bd7477356ed86f40757dd1ea3cee1e5183c7e7be4c3406 false
|
||||
check_key 541a4162edeb57130295441dc1cb604072d7323b6c7dffa02ea5e4fed1d2ee9e true
|
||||
check_key d8e86e189edcc4b5c262c26004691edd7bd909090997f886b00ed4b6af64d547 false
|
||||
check_key 18a8731d1983d1df2ce2703b4c85e7357b6356634ac1412e6c2ac33ad35f8364 false
|
||||
check_key b21212eac1eb11e811022514c5041233c4a07083a5b20acd7d632a938dc627de true
|
||||
check_key 50efcfac1a55e9829d89334513d6d921abeb237594174015d154512054e4f9d1 true
|
||||
check_key 9c44e8bcba31ddb4e67808422e42062540742ebd73439da0ba7837bf26649ec4 true
|
||||
check_key b068a4f90d5bd78fd350daa129de35e5297b0ad6be9c85c7a6f129e3760a1482 false
|
||||
check_key e9df93932f0096fcf2055564457c6dc685051673a4a6cd87779924be5c4abead true
|
||||
check_key eddab2fc52dac8ed12914d1eb5b0da9978662c4d35b388d64ddf8f065606acaf true
|
||||
check_key 54d3e6b3f2143d9083b4c98e4c22d98f99d274228050b2dc11695bf86631e89f true
|
||||
check_key 6da1d5ef1827de8bbf886623561b058032e196d17f983cbc52199b31b2acc75b true
|
||||
check_key e2a2df18e2235ebd743c9714e334f415d4ca4baf7ad1b335fb45021353d5117f true
|
||||
check_key f34cb7d6e861c8bfe6e15ac19de68e74ccc9b345a7b751a10a5c7f85a99dfeb6 false
|
||||
check_key f36e2f5967eb56244f9e4981a831f4d19c805e31983662641fe384e68176604a true
|
||||
check_key c7e2dc9e8aa6f9c23d379e0f5e3057a69b931b886bbb74ded9f660c06d457463 true
|
||||
check_key b97324364941e06f2ab4f5153a368f9b07c524a89e246720099042ad9e8c1c5b false
|
||||
check_key eff75c70d425f5bba0eef426e116a4697e54feefac870660d9cf24c685078d75 false
|
||||
check_key 161f3cd1a5873788755437e399136bcbf51ff5534700b3a8064f822995a15d24 false
|
||||
check_key 63d6d3d2c21e88b06c9ff856809572024d86c85d85d6d62a52105c0672d92e66 false
|
||||
check_key 1dc19b610b293de602f43dca6c204ce304702e6dc15d2a9337da55961bd26834 false
|
||||
check_key 28a16d02405f509e1cfef5236c0c5f73c3bcadcd23c8eff377253941f82769db true
|
||||
check_key 682d9cc3b65d149b8c2e54d6e20101e12b7cf96be90c9458e7a69699ec0c8ed7 false
|
||||
check_key 0000000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0000000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0100000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0100000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 0200000000000000000000000000000000000000000000000000000000000000 false
|
||||
check_key 0200000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 0300000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0300000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0400000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0400000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0500000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0500000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0600000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0600000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0700000000000000000000000000000000000000000000000000000000000000 false
|
||||
check_key 0700000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 0800000000000000000000000000000000000000000000000000000000000000 false
|
||||
check_key 0800000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 0900000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0900000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0a00000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0a00000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0b00000000000000000000000000000000000000000000000000000000000000 false
|
||||
check_key 0b00000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 0c00000000000000000000000000000000000000000000000000000000000000 false
|
||||
check_key 0c00000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 0d00000000000000000000000000000000000000000000000000000000000000 false
|
||||
check_key 0d00000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 0e00000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0e00000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 0f00000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 0f00000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 1000000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 1000000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 1100000000000000000000000000000000000000000000000000000000000000 false
|
||||
check_key 1100000000000000000000000000000000000000000000000000000000000080 false
|
||||
check_key 1200000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 1200000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key 1300000000000000000000000000000000000000000000000000000000000000 true
|
||||
check_key 1300000000000000000000000000000000000000000000000000000000000080 true
|
||||
check_key daffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key daffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key dbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key dbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key dcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key dcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key ddffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key ddffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key deffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key deffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key dfffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key dfffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key e0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key e0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key e1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key e1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key e2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key e2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key e3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key e3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key e4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key e4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key e5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key e5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key e6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key e6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key e7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key e7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key e8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key e8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key e9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key e9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key eaffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key eaffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||
check_key ebffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key ebffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key ecffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||
check_key ecffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key edffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key edffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key eeffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key eeffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key efffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key efffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key f9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key f9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key faffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key faffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key fbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key fbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key fcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key fcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key fdffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key fdffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key feffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key feffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
check_key ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||
check_key ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||
hash_to_ec da66e9ba613919dec28ef367a125bb310d6d83fb9052e71034164b6dc4f392d0 52b3f38753b4e13b74624862e253072cf12f745d43fcfafbe8c217701a6e5875
|
||||
hash_to_ec a7fbdeeccb597c2d5fdaf2ea2e10cbfcd26b5740903e7f6d46bcbf9a90384fc6 f055ba2d0d9828ce2e203d9896bfda494d7830e7e3a27fa27d5eaa825a79a19c
|
||||
hash_to_ec ed6e6579368caba2cc4851672972e949c0ee586fee4d6d6a9476d4a908f64070 da3ceda9a2ef6316bf9272566e6dffd785ac71f57855c0202f422bbb86af4ec0
|
||||
hash_to_ec 9ae78e5620f1c4e6b29d03da006869465b3b16dae87ab0a51f4e1b74bc8aa48b 72d8720da66f797f55fbb7fa538af0b4a4f5930c8289c991472c37dc5ec16853
|
||||
hash_to_ec ab49eb4834d24db7f479753217b763f70604ecb79ed37e6c788528720f424e5b 45914ba926a1a22c8146459c7f050a51ef5f560f5b74bae436b93a379866e6b8
|
||||
hash_to_ec 5b79158ef2341180b8327b976efddbf364620b7e88d2e0707fa56f3b902c34b3 eac991dcbba39cb3bd166906ab48e2c3c3f4cd289a05e1c188486d348ede7c2e
|
||||
hash_to_ec f21daa7896c81d3a7a2e9df721035d3c3902fe546c9d739d0c334ed894fb1d21 a6bedc5ffcc867d0c13a88a03360c8c83a9e4ddf339851bd3768c53a124378ec
|
||||
hash_to_ec 3dae79aaca1abe6aecea7b0d38646c6b013d40053c7cdde2bed094497d925d2b 1a442546a35860a4ab697a36b158ded8e001bbfe20aef1c63e2840e87485c613
|
||||
hash_to_ec 3d219463a55c24ac6f55706a6e46ade3fcd1edc87bade7b967129372036aca63 b252922ab64e32968735b8ade861445aa8dc02b763bd249bff121d10829f7c52
|
||||
hash_to_ec bc5db69aced2b3197398eaf7cf60fd782379874b5ca27cb21bd23692c3c885cc ae072a43f78a0f29dc9822ae5e70865bbd151236a6d7fe4ae3e8f8961e19b0e5
|
||||
hash_to_ec 98a6ed760b225976f8ada0579540e35da643089656695b5d0b8c7265a37e2342 6a99dbfa8ead6228910498cc3ff3fb18cb8627c5735e4b8657da846c16d2dcad
|
||||
hash_to_ec e9cdc9fd9425a4a2389a5d60f76a2d839f0afbf66330f079a88fe23d73eae930 8aa518d091928668f3ca40e71e14b2698f6cae097b8120d7f6ae9afba8fd3d60
|
||||
hash_to_ec a50c026c0af2f9f9884c2e9b8464724ac83bef546fec2c86b7de0880980d24fb b07433f8df39da2453a1e13fd413123a158feae602d822b724d42ef6c8e443bf
|
||||
hash_to_ec bf180e20d160fa23ccfa6993febe22b920160efc5a9614245f1a3a360076e87a 9d6454ff69779ce978ea5fb3be88576dc8feaedf151e93b70065f92505f2e800
|
||||
hash_to_ec b2b64dfeb1d58c6afbf5a56d8c0c42012175ebb4b7df30f26a67b66be8c34614 0523b22e7f220c939b604a15780abc5816709b91b81d9ee1541d44bd2586bbd8
|
||||
hash_to_ec 463fc877f4279740020d10652c950f088ebdebeae34aa7a366c92c9c8773f63a daa5fa72e70c4d3af407b8f2f3364708029b2d4863bbdde54bd67bd08db0fcad
|
||||
hash_to_ec 721842f3809982e7b96a806ae1f162d98ae6911d476307ad1e4f24522fd26f55 4397c300a8cfcb42e7cc310bc975dc975ec2d191eaa7e0462998eb2830c34126
|
||||
hash_to_ec 384da8d9b83972af8cbefc2da5efc744037c8ef40efa4b3bacc3238a6232963d 3c80f107e6868f73ef600ab9229a3f4bbe24f4adce52e6ab3a66d5d510e0670d
|
||||
hash_to_ec e26f8adef5b6fe5bb01466bff0455ca23fda07e200133697b3b6430ca3332bde e262a58bcc1f8baf1980e00d5d40ba00803690174d14fb4c0f608429ce3df773
|
||||
hash_to_ec 6e275b4ea4f085a5d3151aa08cf16a8c60b078e70be7ce5dac75b5d7b0eebe7c cb21b5a7744b4fcdc92ead4be0b04bcb9145e7bb4b06eff3bb2f0fe429b85108
|
||||
hash_to_ec a0dde4561ad9daa796d9cd8a3c34fd41687cee76d128bf2e2252466e3ef3b068 79a2eb06bb7647f5d0aae5da7cf2e2b2d2ce890f25f2b1f81bfc5fef8c87a7d3
|
||||
hash_to_ec dbaf63830e037b4c329969d1d85e58cb6c4f56014fd08eb38219bd20031ae27c 079c93ae27cd98075a487fd3f7457ad2fb57cdf12ec8651fedd944d765d07549
|
||||
hash_to_ec 1e87ba8a9acf96948bc199ae55c83ab3277be152c6d0b1d68a07955768d81171 5c6339f834116791f9ea22fcc3970346aaeddacf13fbd0a7d4005fbd469492ca
|
||||
hash_to_ec 5a544088e63ddf5b9f444ed75a75bc9315c4c50439522f06b4823ecaf5e8a08d e95ca0730d57c6469be3a0f3c94382f8490257e2e546de86c650bdbc6482eaee
|
||||
hash_to_ec e4e06d92ebb036a5e4bb547dbaa43fd70db3929eef2702649455c86d7e59aa46 e26210ff8ee28e24ef2613df40aa8a874b5e3c1d07ae14acc59220615aa334dc
|
||||
hash_to_ec 5793b8b32dcc0f204501647f2976493c4f8f1fa5132315226f99f29a5a6fdfce 656e390086906d99852c9696e831f62cb56fc8f85f9a5c936c327f23c7faf4fe
|
||||
hash_to_ec 84f56fa4d7f12e0efd48b1f7c81c15d6e3843ebb419f4a27ec97028d4f9da19e 0cbd4f0cd288e1e071cce800877de6aef97b63fff867424a4f2b2bab25602608
|
||||
hash_to_ec 242683ddf0a9fc55f6585de3aa64ea17c9c544896ff7677cd82c98f833bdf2ca 38c36d52314549213df7c7201ab7749a4724cbea92812f583bb48cabc20816ad
|
||||
hash_to_ec a93ee320dc030aa382168c2eb6d75fce6e5a63a81f15632d514c6de8a7cfa5ee bd0a2facaa95bc95215a94be21996e46f789ee8beb38e75a1173b75fc686c505
|
||||
hash_to_ec e36136601d84475d25c3f14efe030363d646658937a8a8a19a812d5e6deb5944 2fb93d78fae299c9f6b22346acfb829796ee7a47ec71db5456d8201bec6c35a3
|
||||
hash_to_ec ba4b67d3d387c66baa4a32ec8b1db7681087e85076e71bab10036388c3aeb011 cc01329ce56f963bf444a124751c45b2c779ccb6dea16ca05251baca246b5401
|
||||
hash_to_ec 3fbc91896a2585154d6f7094c5ab9c487e29a27951c226eec1235f618e44946b 7d983acbb901bf5497d0708392e5e742ec8c8036cbb0d03403e9929da8cc85a7
|
||||
hash_to_ec a2da289fed650e9901f69a5f33535eb47c6bd07798633cbf6c00ce3172df76ac dca8a4d30ec2d657fefd0dba9c1c5fd45a79f665048b3cf72ac2c3b7363da1ac
|
||||
hash_to_ec 99025d2d493f768e273ed66cacd3a5b392761e6bd158ca09c8fba84631ea1534 7ef5af79ab155ab7e1770a47fcd7f194aca43d79ec6e303c7ce18c6a20279b04
|
||||
hash_to_ec 3cf1d01d0b70fb31f2a2f979c1bae812381430f474247d0b018167f2a2cd9a9f 7c53d799ec938a21bb305a6b5ca0a7a355fa9a68b01d289c4f22b36ce3738f95
|
||||
hash_to_ec 639c421b49636b2a1f8416c5d6e64425fe51e3b52584c265502379189895668e 0b47216ae5e6e03667143a6cf8894d9d73e3152c64fb455631d81a424410e871
|
||||
hash_to_ec 4ccf2c973348b7cc4b14f846f9bfcdcb959b7429accf6dede96248946841d990 7fd41f5b97ba42ed03947dd953f8e69770c92cc34b16236edad7ab3c78cbbb2e
|
||||
hash_to_ec f76ae09fff537f8919fd1a43ff9b8922b6a77e9e30791c82cf2c4b8acb51363e 8e2c6bf86461ad2c230c496ee3896da33c11cc020fd4c70faa3645b329049234
|
||||
hash_to_ec 98932da7450f15db6c1eef78359904915c31c2aa7572366ec8855180edb81e3a 86180adddfac0b4d1fb41d58e98445dde1da605b380d392e9386bd445f1d821c
|
||||
hash_to_ec ab26a1660988ec7aba91fc01f7aa9a157bbc12927f5b197062b922a5c0c7f8dd 2c44a43eda0d0aad055f18333e761f2f2ec11c585ec7339081c19266af918e4f
|
||||
hash_to_ec 4465d0c1b4930cc718252efd87d11d04162d2a321b9b850c4a19a6acdfca24f4 b03806287d804188a4d679a0ecee66f399d7bdc3bd1494f9b2b0772bbb5a034f
|
||||
hash_to_ec 0f2a7867864ed00e5c40082df0a0b031c89fa5f978d9beb2fde75153f51cfb75 5c471e1b118ef9d76c93aec70e0578f46e8db1d55affd447c1f64c0ad9a5caa5
|
||||
hash_to_ec 5c2808c07d8175f332cae050ce13bec4254870d76abff68faf34b0b8d3ad5000 eeff1d9a5aa428b7aecc575e63dde17294072eb246568493e1ed88ce5c95b779
|
||||
hash_to_ec 36300a21601fad00d00da45e27b36c11923b857f97e50303bd01f21998eaef95 b33b077871e6f5dad8ff6bc621c1b6dedcf700777d996c8c02d73f7297108b7e
|
||||
hash_to_ec 9e1afb76d6c480816d2cedd7f2ab08a36c309efaa3764dcdb51bad6049683805 4cd96ba7b543b1a224b8670bf20b3733e3910711d32456d3e58e920215788adf
|
||||
hash_to_ec 685f152704664495459b76c81567a4b571e8b307dd0e3c9b08ee95651a006047 80dd6b637580cb3be76025867f1525852b65a7a66066993fda3af7eb187dc1a5
|
||||
hash_to_ec 0b216444391a1163c14f7b27f9135e9747978c0e426dce1fa65c657f3e9146be 021259695a6854a4a03e8c74d09ab9630a401bfca06172a733fe122f01af90b4
|
||||
hash_to_ec cfcb35e98f71226c3558eaa9cf620db5ae207ece081ab13ddea4b1f122850a5a 46763d2742e2cdffe80bb3d056f4d3a1565aa83f19aab0a1f89e54ad81ae0814
|
||||
hash_to_ec 07e7292da8cdcdb58ee30c3fa16f1d609e9b3b1110dd6fa9b2cc18f4103a1c12 fe949ca251ac66f13a8925ae624a09cdbf6696d3c110442338d37700536e8ec7
|
||||
hash_to_ec 813bc7e3749e658190cf2a4e358bc07a6671f262e2c4eef9f44c66066a72e6a7 6b92fbda984bd0e6f4af7a5e04c2b66b6f0f9d197a9694362a8556e5b7439f8a
|
||||
hash_to_ec 89c50a1e5497156e0fae20d99f5e33e330362b962c9ca00eaf084fe91aaec71d ef36cb75eb95fb761a8fa8c376e9c4447bcd61421250f7a711bd289e6ed78a9b
|
||||
hash_to_ec d9bd9ff2dd807eb25de7c5de865dbc43cce2466389cedbc92b90aab0eb014f81 30104771ff961cd1861cd053689feab888c57b8a4a2e3989646ea7dea40f3c04
|
||||
hash_to_ec b8c837501b6ca3e118db9848717c847c062bf0ebeca5a7c211726c1426878af5 19a1e204b4a32ce9cccf5d96a541eb76a78789dceaf4fe69964e58ff96c29b63
|
||||
hash_to_ec 84376c5350a42c07ac9f96e8d5c35a8c7f62c639a1834b09e4331b5962ecace8 ba1e4437d5048bd1294eadc502092eafc470b99fde82649e84a52225e68e88f2
|
||||
hash_to_ec a3345e4a4cfc369bf0e7d11f49aed0d2a6ded00e3ff8c7605db9a919cf730640 0d318705c16e943c0fdcde134aaf6e4ccce9f3d9161d001861656fc7ea77a0b1
|
||||
hash_to_ec 3c994dfb9c71e4f401e65fd552dc9f49885f88b8b3588e24e1d2e9b8870ffab1 984157de5d7c2c4b43b2bffea171809165d7bb442baea88e83b27f839ebdb939
|
||||
hash_to_ec 153674c1c1b18a646f564af77c5bd7de452dc3f3e1e2326bfe9c57745b69ec5c e9a4a1e225ae472d1b3168c99f8ba1943ad2ed84ef29598f3f96314f22db9ef2
|
||||
hash_to_ec 2d46a705d4fe5d8b5a1f4e9ef46d9e06467450eb357b6d39faa000995314e871 b9d1aec540bf6a9c0e1b325ab87d4fbe66b1df48986dde3cb62e66e136eba107
|
||||
hash_to_ec 6764c3767f16ec8faecc62f9f76735f76b11d7556aeb61066aeaeaad4fc9042f 3a5c68fb94b023488fb5940e07d1005e7c18328e7a84f673ccd536c07560a57b
|
||||
hash_to_ec c99c6ee5804d4b13a445bc03eaa07a6ef5bcb2fff0f71678dd3bd66b822f8be8 a9e1ce91deed4136e6e53e143d1c0af106abde9d77c066c78ebbf5d227f9dde0
|
||||
hash_to_ec 3009182e1efac085c7eba24a7d9ef28ace98ebafa72211e73a41c935c37e6768 e55431a4c89d38bd95f8092cdf6e44d164ad5855677aba17ec262abc8c217c86
|
||||
hash_to_ec e7153acd114a7636a207be0b67fa86fee56dd318f2808a81e35dd13d4251b2d0 ff2b98d257e4d4ff7379e8871441ca7d26e73f78f3f5afcf421d78c9799ba677
|
||||
hash_to_ec 6378586744b721c5003976e3e18351c49cd28154c821bc45338892e5efedd197 3d765fb7bb4e165a3fa6ea00b5b5e22250f3861f0db0099626d9a9020443dda2
|
||||
hash_to_ec 5be49aba389b7e3ad6def3ba3c7dbec0a11a3c36fc9d441130ef370b8a8d29c2 2d61faf38062dc98ae1aaafec05e90a925c9769df5b8b8f7090d9e91b2a11151
|
||||
hash_to_ec f7bc382178d38e1b9a1a995bd8347c1283d8a2e8d150379faa53fd125e903d2b 544c815da65c3c5994b0ac7d6455578d03a2bc7cf558b788bcdb3430e231635a
|
||||
hash_to_ec c28b5c4b6662eebb3ec358600644849ebeb59d827ed589c161d900ca18715fa8 a2d64db3c0e0353c257aadf9abc12ac779654d364f348b9f8e429aa7571203db
|
||||
hash_to_ec 3a4792e5df9b2416a785739b9cf4e0d68aef600fa756a399cc949dd1fff5033a 4b54591bd79c30640b700dfb7f20158f692f467b6af70bd8a4e739c14a66c86a
|
||||
hash_to_ec 002e70f25e1ceaf35cc14b2c6975a4c777b284a695550541e6f5424b962c19f5 73987e9342e338eb57a7a9e03bd33144db37c1091e952a10bd243c5bb295c18a
|
||||
hash_to_ec 7eb671319f212c9cae0975571b6af109124724ba182937a9066546c92bdeff0c 49b46da3be0df1d141d2a323d5af82202afa2947a95b9f3df47722337f0d5798
|
||||
hash_to_ec ca093712559c8edd5c51689e2ddcb8641c2960e5d9c8b03a44926bb798a0c8dc b9ef9cf0f8e4a3d123db565afafb1102338bfb75498444ac0a25c5ed70d615da
|
||||
hash_to_ec cfea0a08a72777ff3aa7be0d8934587fa4127cd49a1a938232815dc3fd8b23ac b4de604b3d712f1ef578195fb0e53c865d41e2dfe425202c6cfe6f10e4404eb5
|
||||
hash_to_ec aa0122ae258d6db21a26a31c0c92d8a0e3fdb46594aed41d561e069687dedcd6 5247eaec346de1c6cddf0ab04c12cd1d85cdb6d3a2fba2a5f9a5fe461abef5eb
|
||||
hash_to_ec b3941734f4d3ba34ccaf03c4c737ac5a1e036eb74309300ce44d73aca24fef08 535938985c936e3780c61fe29a4121d6cb89a05080b6c2147031ea0c2b5b9829
|
||||
hash_to_ec 8c2ee1041a2743b30dcbf413cc9232099b9268f82a5a21a09b63e7aff750882f 6ad0d4b3a65b522dfad0e9ac814b1fb939bc4910bd780943c72f57f362754cca
|
||||
hash_to_ec 4b6829a2a2d46c8f0d0c23db0f735fcf976524bf39ccb623b919dd3b28ad5193 2e0097d7f92993bc45ba06baf4ca63d64899d86760adc4eb5eeefb4a78561050
|
||||
hash_to_ec 9c1407cb6bba11e7b4c1d274d772f074f410d6fe9a1ee7a22cddf379257877d9 692261c7d6a9a7031c67d033f6d82a68ef3c27bd51a5666e55972238769821cd
|
||||
hash_to_ec 638c42e4997abf8a4a9bffd040e31bd695d590cde8afbd7efd16ffdbae63bf66 793024c8ce196a2419f761dde8734734af6bd9eb772b30cc78f2cb89598dce97
|
||||
hash_to_ec 1fb60d79600de151a1cf8a2334deb5828632cbd91cb5b3d45ae06e08187ae23d ff2542cde5bc2562e69471a31cfc3d0c26e2f6ccc1891a633b07a3968e42521c
|
||||
hash_to_ec d2fdbbae4e38a1b734151c3df52540feb2d3ff74edfef2f740e49a5c363406ee 344c83ba6ff4e38b257077623d298d2f2b52002645021241bc9389f81b29ad12
|
||||
hash_to_ec 836c27a6ddfe1a24aba3d6022dff6dfe970f142d8b4ac6afb8efcba5a051942f b8af481d33726b3f875268282d621e4c63f891a09f920b8f2f49080f3a507387
|
||||
hash_to_ec 46281153ddcdf2e79d459693b6fe318c1969538dd59a750b790bfff6e9481abf 8eaf534919ab6573ba4e0fbde0e370ae01eae0763335177aa429f61c4295e9d4
|
||||
hash_to_ec d57b789e050bf3db462b79a997dac76aa048d4be05f133c66edee56afd3dbe66 0c5a294cb2cbb6d9d1c0a1d57d938278f674867f612ed89dcbe4533449f1a131
|
||||
hash_to_ec 548d524d03ac22da18ff4201ce8dbee83ad9af54ee4e26791d26ed2ab8f9bfc7 c6609d9e7d9fd982dec8a166ff4fb6f7d195b413aad2df85f73d555349134f3b
|
||||
hash_to_ec cc920690422e307357f573b87a6e0e65f432c6ec12a604eb718b66ba18897a56 6f11c466d1c72fccd81e51d9bda03b6e8d6a395e1d931b2a84e392dc9a3efa18
|
||||
hash_to_ec c7fb8a51f5fcd8824fc0875d4eb57ab4917cb97090a6e2288f852f2bb449edd9 45543fea6eed461016e48598b521f18ff70178afea18032b188deea3e56052fc
|
||||
hash_to_ec c681bb1b829e24b1c52cb890036b89f0029d261c6a15e5b2c684ee7dfe91e746 263006fe2c6b08f1ab29cdf442472c298e2faf225bbf5c32399d3745cd3904bd
|
||||
hash_to_ec e06411c542312fdd305e17e46be14c63bab5836dc8751da06164b1ae22d4e20f 901871be7a7ff5aecade2acff869846f3c50de69307ac155f2aa3a74d5472ef2
|
||||
hash_to_ec 9c725a2acb80fa712f9781da510e5163b1b30f4e1c064c26b5185e537f0614ea 02420d49257846eb39fddd196d3171679f6be21d9adac667786b65a6e90f57b1
|
||||
hash_to_ec 22792772820feafa85c5cb3fa8f876105251bef08617d389619697f47dff54f2 a3ad444e7811693687f3925e7c315ae55d08d9f4b0a29876bc2a891ab941c1c3
|
||||
hash_to_ec 0587b790121395d0f4f39093d10b4817f58a1e80621a24eea22b3c127d6ac5a2 86c417c695c64c7becaad0d59ddbb2bca4cb2b409a21253d680aac1a08617095
|
||||
hash_to_ec fa0b5f28399bef0cd87bfe6b8a2b69e9c5506fb4bacd22deba8049615a5db526 ede0ea240036ff75d075258a053f3ce5d6f77925d358dbe33c06509fc9b12111
|
||||
hash_to_ec 62a3274fc0bed109d5057b865c2ba6b6a5a417cb90a3425674102fcd457ede2d ff7e46751bb4dcd1e800a8feab7cf6771f42dc0cfed7084c23b8a5d255a6f34e
|
||||
hash_to_ec a6fcd4aecaaaf281563b9b7cd6fbc7b1829654f644f4165942669a2ef632b2bf 28f136be0eb957a5b36f8ec294399c9f73ad3a3c9bb953ad191758ced554a233
|
||||
hash_to_ec 01baa4c06d6676c9b286cda76ed949fd80a408b3309500ba84a5bb7e3dce58e2 a943d1afa2efce284740e7db21ea02db70b124808be2ff80cbf9b9cb96c7b73e
|
||||
hash_to_ec dd9aff9c006ba514cef8fae665657bc9813fe2715467cf479643ea4c4e365d6d 68de2f7d49de4004286ce0989a06a686b15d0f463a02ffd448a18914e1ddf713
|
||||
hash_to_ec 3df3513d5e539161761ce7992ab9935f649bc934bed0da3c5e1095344b733bb9 e9c2dd747d7b2482474325943cd850102b8093164678362c7621993a790e2a8a
|
||||
hash_to_ec 7680cfb244dc8ef37c671fff176be1a3dad00e5d283f93145d0cbee74cca2df4 a0fd8c3cca16a130eaa5864cbe8152b7adfbf09e8cf72244b2fc8364c3b20bf4
|
||||
hash_to_ec 8a547c38bd6b219ea0d612d4a155eba9c56034a1405dcf4b608de787f37e0fd8 76bf0dc40fd0a5508c5e091d8bb7eccfa28b331e72c6a0d4ac0e05a3d651850b
|
||||
hash_to_ec dd93901621f58465e9791012afa76908f1e80ad80e52b809dc7fc32bb004f0a8 09a0b7ecfe8058b1e9ee01c9b523826867ca97a32efad29ac8ceebca67a4ea00
|
||||
hash_to_ec b643010220f1f4ee6c7565f6e1b3dc84c18274ede363ac36b6af3707e69a1542 233c9ff8de59e5f96c2f91892a71d9d93fa7316319f30d1615f10ac1e01f9285
|
||||
hash_to_ec c2637b2299dfc1fd7e953e39a582bafd19e6e7fff3642978eb092b900dbfea80 339587ba1c05e2cba44196a4be1fd218b772199e2c61c3c0ff21dcd54b570c43
|
||||
hash_to_ec 1f36d3a7e7c468eb000937de138809e381ad2e23414cbbaac49b7f33533ed486 7e5b0a96051c77237a027a79764c2763487af88121c7774645e97827fb744888
|
||||
hash_to_ec 8c142a55f60b2edbe03335b7f90aa2bd63e567048a65d61c70cb28779c5200af d3d6d5563b3d81c8c91cf9806bb13b2850fb7c162c610fd2f5b83c464add8182
|
||||
hash_to_ec 99e7b98293c9de1f81aff1376485a990014b8b176521b2a68cdbde6300190398 119cbc01a1d9b9fb4759031d3a70685aebea0f01bc5ee082ce824265fd21b3b4
|
||||
hash_to_ec 9753bd38be072b51490290be6207ca4545e3541bdf194e0850ae0a9f9e64b8ba 1ad3aa759863153606fa6570f0e1290baded4c8c1f2ba0f67c1911bfc8ccd7a0
|
||||
hash_to_ec 322703864ceee19b7f17cec2a822f310f0c4da3ff98b0be61a6fd30ac4db649c 89d9e7a5947e1cde874e4030de278070aae363063cd3592ce5411821474f0816
|
||||
hash_to_ec c1acd01e1e535fad273a8b757d981470f43dd7d95af732901fbba16b6e245761 57e80445248111150da5e63c706b4abbf3eef2cc508bd0347ff6b81e8c59f5bc
|
||||
hash_to_ec 492473559f181bbe78f60215bc6d3a5168435ea2fc0a508372d6f5ca126e9767 df3965f137cf6f60c56ebd7c8f246281fd6dc92ce23a37e9f846f8452c884e01
|
||||
hash_to_ec afa9d6e0e2fb972ee806beb450c2c0165e58234b0676a4ec0ca19b6e710d7c35 669a57e69dd2845a5e50ed8e5d8423ac9ae792a43c7738554d6c5e765a7b088a
|
||||
hash_to_ec 094de050bdadef3b7dbaeeca29381c667e63e71220970149d97b95db8f4db61b 0cf5d03530c5e97850d0964c6a394de9cde1e8e498f8c0e173c518242c07f99a
|
||||
hash_to_ec 2ce583724bc699ad800b33176a1d983512fe3cb3afa65d99224b23dae223efb7 e1548fd563c75ae5b5366dbab4cb73c54e7d5e087c9e5453125ff8fbe6c83a5c
|
||||
hash_to_ec 8064974b976ff5ef6adaade6196ab69cda6970cd74f7f5899181805f691ad970 98ae63c47331a4ac433cb2f17230c525982d89d21e2838515a36ec5744ec2d15
|
||||
hash_to_ec 384911047de609c6ae8438c745897357989363885cef2381a8a00a090cf04a58 4692ec3a0a03263620841c108538d584322fdd24d221a74bf1e1f407f83828af
|
||||
hash_to_ec 0e1b1ced5ae997ef9c10b72cfc6d8c36d7433c01fc04f4083447f87243282528 6ee443ab0637702b7340bd4a908b9e2e63df0cc423c409fb320eb3f383118b80
|
||||
hash_to_ec 5a7aea70c85c040af6ff3384bcaa63ec45c015b55b44fffa37ab982a00dc57c5 2df2e20137cefd166c767646ecd2e386d28f405aebe43d739aa55beba04ed407
|
||||
hash_to_ec 3e878a3567487f20f7c98ea0488a40b87f1ba99e50bbfe9f00a423f927cbd898 697c7e60e4bf8c429ba7ac22b11a4b248d7465fc6abe597ec6d1e1c973330688
|
||||
hash_to_ec c0bb08350d8a4bb6bf8745f6440e9bd254653102a81c79d6528da2810da758e4 396a872ac9147a69b27223bf4ec4198345b26576b3690f233b832395f2598235
|
||||
hash_to_ec 6c3026a9284053a4ddb754818f9ae306ffa96eb7003bd03826eeccc9a0cf656e bef73da51d3ba9972a33d1afb7d263094b66ab6dbe3988161b08c17f8c69c2d5
|
||||
hash_to_ec f80b7d8f5a80d321af3a42130db199d9edcb8f5a82507d8bfca6d002d65458b6 aa59c167ea60ee024421bfbd00adbb3cbfc20e16bd3c9b172a6bef4d47ca7f57
|
||||
hash_to_ec bc0ffc24615aa02fafef447f17e7b776489cd2cc909f71e8344e01cad9f1610d 5c4195cc8dc3518143f06a9c228ae59ec9a6425a8fab89bfc638ad997cf35220
|
||||
hash_to_ec b15fad558737229f8816fcba8fbef805bd420c03e392d118c69bdf01890c4924 f5810477e37554728837f097e1b170d1d8c95351c7fff8abbbfc624e1a50c1b9
|
||||
hash_to_ec ec8c1f10d8e9da9cf0d57c4a1f2c402771bed7970109f3cf21ad32111f1f198f a697e0a3f09827b0cf3a4ffb6386388feda80d30ffffcbd54443dafcba162b28
|
||||
hash_to_ec a989647bf0d70fdb7533b8c303a2a07f5e42e26a45ffc4e48cff5ba88643a201 450fd73e636f94d0d232600dd39031386b0e2ecde4105124fc451341da9803db
|
||||
hash_to_ec 7159971b03c365480d91d625a0fadc8e3a632c518acf0dbec87dd659da70e168 377bc43c038ac46cf6565aa0a6d6bf39968c0c1142755dba3141eeebf0acdf5d
|
||||
hash_to_ec e39089a64fedac4b2c25e36312b33f79d02bf75a883f450f910915b8560a3b06 77efa7db1be020e77596f550de45626824a8268095d56a0991696b211cb329cc
|
||||
hash_to_ec 2056b3c6347611bb0929dad00ec932a4d9bec0f06b2d57f17e01ffa1528a719e b6072c2be2ce928e8cbbb87e8eb7e06975c0f93b309dd3b6a29edaad2b56f99b
|
||||
hash_to_ec 2c026793146e81b889fc741d62e06c341ce263560d57cd46d0376f5b29174489 8f1f64b67762aa784969e954c196a2c6610addc3604aa3291eb0b80304dfe9ef
|
||||
hash_to_ec be6026d6704379c489fa7749832b58bdb1a9685a5ffb68c438537f2f76e0011f 0072569a4090a9ad383a205bb092196c9de871c22506e3bb63d6b9d1b2357c96
|
||||
hash_to_ec f4db802d5c6b7d7b53663b03d988b4cd0c7cad6c26612c5307754a93ebdc9710 f21bc9be4cb28761f6fe1d0a555ad5e9748375a2e9faea25a1df75cc8d273e18
|
||||
hash_to_ec c27d79a564c56b00956a55090481e85fbc837fd5fb5e8311ecb436e300c07e3a 1b1891e6abec74621501450cd68bb1eeaa5b2fffff4ec441a55d1235ff3a0842
|
||||
hash_to_ec a1e2f93c717cad32af386efa624198973df5a710963dd19d4c3ac40032a3a286 69c60571e3f9f63d2bfb359386ae3b8cd9e49a2e9127753002866e85c0443573
|
||||
hash_to_ec 76920d7b1763474bc94a16433c3c28241a9acdee3ff2b2cb0e6757ba415310aa c1b409169f102b696fc7fa1aa9c48631e58e08b5132b6aadf43407627bb1b499
|
||||
hash_to_ec 57ac654b29fa227c181fff2121491fcb283af6cbe932c8199c946862c0e90cb2 a204e8d327ea93b0b1bd74a78ffc370b20cea6455e209f2bc258114baa16d728
|
||||
hash_to_ec 88e66cfaef6432b759c50efce885097d1752252b479dac5ed822fa6c85d56427 6fb84790d3749a5c1088209ee3823848d9c19bf1524215c44031143dd8080d70
|
||||
hash_to_ec c1e55da929c4f8f793696fc77ff4e1c317c34852d98403bfd15dd388ee7df0df 2f41e76f15c5b480665bd84067e3b543b85ce6de02be9da7a550b5e1ead94d34
|
||||
hash_to_ec 29e9ace5aa3c5a572b13f4b62b738a764d90c8c293ccb062ad798acbab7c5ef4 bce791aba1edc2a66079628fd838799489ab16b0a475ce7fe62e24cc56fe131c
|
||||
hash_to_ec f25b2340689dadacaa9a0ef08aee8447d80b982e8a1ea42cf0500a1b9d85b37d f7f53aa117e6772a9abc452b3931b0a99405ac45147e7c550ac9fcf7ffe377b5
|
||||
hash_to_ec 0cb6c47fc8478063b33f5aed615a05bcc84d782c497b6cc8e76ec1fa11edbfdb 7a0b58b03147e7c9be1d98de49ead2ce738d0071b0af8ca03cc92ceb26fc2246
|
||||
hash_to_ec 7bd7287d7c4b596fe46fe57a6982c959653487bea843a77dd47d40986200d576 343084618c58284c64a5ff076f891be64885dc2ac73fa1567f7b39fde6b91542
|
||||
hash_to_ec e4984bf330708152254fb18ecef12d546afd24898a3cf00fba866957b6ee1b82 c70e88b061656181fbd6ff12aca578fb66de5553c756ea4698a248b177185bc6
|
||||
hash_to_ec cefd6c3cb9754ea632d6aea140af017de5ea12e5184f868936b74d9aa349d603 4b476502a8a483aadd50667f262f95351901628dd3a2aac1a5a41c4ea03f1647
|
||||
hash_to_ec da5d0f33344ee7f3345204badf183491b9452b84bccc907602c7bad43e5cf43e 9561b9e61241625e028361494d4fa5cd78df4c7219fa64c8fede6d8421b8904a
|
||||
hash_to_ec d6f0a4f8c770a1274a76fd7ae4e5faf7779249263e1aaecc6f815cf376f5c302 cd5c55820be10f0d38feb81363ede3716a9168601a0dd1ce3109aab81367d698
|
||||
hash_to_ec b6bf32491d12a41c275d8518fc534d9a0d17aade509e7e8b8409a95c86167307 4aae534abbd67a9a8f2974154606c0e9be8932e920c7a5e931b46a92859acf82
|
||||
hash_to_ec 0f930beaad041f9cefd867bc194027dd651fb3c9bda5944ececdba8a7136b6d3 521708f8149891b418d0920369569a9d578029c78f8e41c68a0bb68d3ad5df60
|
||||
hash_to_ec 49b1fe0f97be74b81e0b047027b3e9f726fa5e90a67dafa877309397291c06c5 0852e59dfae5ec32cce606c119376597bce5cd4d04879d329f74e3ec66414cd3
|
||||
hash_to_ec 4d57647d03f2cfbd4782fcc933e0683b52d35fc8d37283e6c7de522ddfa7e698 cbeb9ebfbbc49ec81fac3b7b063fecac1bb40ea686d3ffb08f82b291715cd87f
|
||||
hash_to_ec 4ea3238c06fc9346c7421ff85bc0244b893860b94bc437378472814d09b2e99f a1fbae941adc344031bbdf53385dfdc012311490a4eb5e9a2749a21b27ce917a
|
||||
hash_to_ec 0cd3609f5c78b318cb853d189b73b1ee2d00edd4e5fce2812027daa3fcb1fed1 0c7a7241b16e3c47d41f5abbf205797bd4b63fc425a7120cb2a4bf324e08ae74
|
||||
hash_to_ec d74ab71428e36943c9868f70d3243469babd27988a1666a06f499a5741a52e3e 65b7c259f3b4547c082b2a7669b2b363668c4d87ac14e80471317b03b34e5216
|
||||
hash_to_ec f6b151998365e7d69bcbce383dd2e8b5bf93b8b72f029ff942588208c1619591 6ce840ce5dfbca238665c1e6eddb8b045aa85c69b5976fc55ab57e66d3d0a791
|
||||
hash_to_ec 207751de234b2bd7ec20bdd8326210c23aa68f04875c94ad7e256a96520f25d6 fc8f79ab3af317c38bfb88f40fb84422995a0479cfa6b03fa6df7f4e5f2813fb
|
||||
hash_to_ec 62291e2873f38c0a234b77d1964205f3f91905c261d3c06f81051a9b0cb787cb 076d1d767457518e6777cb3bd4df22c8a19eb617e4bbccd1b0bd37522d6597a5
|
||||
hash_to_ec 4b060df2d2854036751d00190ee821cb0066d256d4172539fdfa6fbd1cdfe1f9 59866e927c69e7de5df00dc46c0d2a1ddf799d901128ff040cebb8fd61b95da4
|
||||
hash_to_ec ac8daf73f9c609bb36bce4fdeec1e50be5f22de38c3904fabcf758f0fc180bc7 7d8dc4e956363b652468a5fecafd7c08d48a2297e93b8edcb38e595fdd5a1fde
|
||||
hash_to_ec fef7b6563fd27f3aab1d659806b26b8f2ec38bc8feefad50288383c001d1c20f e6e42547f12df431439d45103d2c5a583248f44554a98a3a433cf8c38b11805d
|
||||
hash_to_ec 40a3d6871c76ecc6bb7b28324478733e196cc11d062dd4c9265cf31be5cf5a97 8c55a3811c241a020b1be202a58d5defbc4c8945d73b132570b47dd7c019ccf0
|
||||
hash_to_ec 0cd71e7e562b2b47f4bc8640caf20e69d3a62f10231b4c7a372c9691cff9ac3c fb8e4e3de479b3bf1f4f13b4ed5507df1e80bd9250567b9d021b03339d6e7197
|
||||
hash_to_ec 40a4e62800a99b7a26e0b507ffb29592e5bdba25284dc473048f24b27d25b40a 90ae131d29ee4a71cd764ab26f1ca4e6d09a40db98f8692b345c3a0e130dc860
|
||||
hash_to_ec 1ddf35193cf52860bfe3e41060a7f44281241c6ae49cd541d24c1aca679b7501 3b4f50013895c522776ced456329c4e727de03575f6b99ae7d238a9f70862121
|
||||
hash_to_ec 014e0fa8ce9d5df262b9a1765725fde354a855de8aef3fc23684e05dd1ba8d34 3857f57776a3cb68721bcb7f1533a5f9fb416a1dc8824d719399b63a142d24de
|
||||
hash_to_ec 09987979b0e98d1d5355df8a8698b8f54d3a037d12745c0a4317fe519c3df9cc 32a181e2b754aeced214c73ac459c97d99e63317be3eb923344c64a396173bca
|
||||
hash_to_ec 51e9e8ec4413e92dbaaba067824c32b018487a8d16412ed310507b4741e18eed 0356b209156b4993fd5d5630308298429a1b0021c19bedecb7719ac607cfa644
|
||||
hash_to_ec 14d91313dfe46e353310e6a4a23ee15d7a4e1f431700a444be8520e6043d08d9 6f345f4018b5d178d9f61894d9f46ac09ff639483727b0d113943507cee88cfd
|
||||
hash_to_ec 0d5af9ace87382acfffb9ab1a34b6e921881aa015d4f6d9c73171b2b0a97600d a8dbf36c85bebe6a7b3733e70cd3cd9ed0eb282ca470f344e5fcf9fe959f2e6e
|
||||
hash_to_ec 996690caac7328b19d20ed28eb0003d675b1a9ff79055ab530e3bf170eb22a94 14340d7d935cffce74b8b2f325c9d92ce0238b51807ef2c1512935bb843194ce
|
||||
hash_to_ec ad839c4b4c278c8ebe16ff137a558255a1f74646aa87c6cd99e994c7bb97ce8a d4f2da327ffded913b50577be0e583db2b237b5ca74da648e9b985c247073b76
|
||||
hash_to_ec 26fc2eeeee983e1300d72362fdff42edf08038e4eee277a6e2dbd1bd8c9d6560 3468b8269728c2c0bfc2e53b1575415124798bc0f59b60ea2f14967fc0ca19ce
|
||||
hash_to_ec db33cecaf4ee6f0ceba338cc5fabfb7462cd952a9c9007357ff3f0ca8336f8bc 0bab38f58686d0ff770f770a297971510bc83e2ff2dfead34823d1c4d67f11af
|
||||
hash_to_ec a0ee84b3c646526fb8787d26dcd9b7fe9dc713c8a6c1a4ea640465a9f36a64df 4d7a638f6759d3ec45339cd1300e1239cca5f0f658ca3cd29bc9bdb32f44faf0
|
||||
hash_to_ec 6a702e7899fcf3988e2b6b55654c22e54f43d3fa29de19177bdff5b2295fe27f 145d5748d6054fb586568e276f6925aef593a5b9c8249ad3dbef510af99b4307
|
||||
hash_to_ec 30ce0fd4f1fac8b62d613b8ee4a66deef6eb7094bd8466531050b837460f6971 f3aa850d593ba7cef01389f7e1916e57617f1d75cd42f64ce8f5f272384b148c
|
||||
hash_to_ec 3aa31d4ad7046ad13d83eb11c9a6e90eb8483a374a77a9a7b2a7cc0978fefa76 2fe0827dc080d9c1e7ec475a78aa7ae3c86d1a35f4c3f25f4a1f7299cacf018a
|
||||
hash_to_ec 8562a5a91e763b98014523ebb6e49120979098f89c31df1fde9eb3a49a15b20f ae223bf85e2009a9daf5fd8a14685e2e1e625fc88818b2fd437dd7e109a48f59
|
||||
hash_to_ec ccf9c313a47b8dbf7ce42c94b785818bc24134d95b6d22acc53c1ec2be29cf27 3e79fce6fe5aa14251b6560df4b76e811d7739eec097f27052c4403a283be71d
|
||||
hash_to_ec d1e33cd6f8918618d5fb6d67ad8de939db8beaec4f115551eac64479b739b773 613fffcbe1bf48bb2d7bfd64fd97790a06025f8f2429edddb9ac145707847ecf
|
||||
hash_to_ec 81eaeced34dd44e448d5dafa5715225e4956c90911c964a96ff7aa5b86b969bc 8f81177495d120a1357380164d677509b167f2958eb8b962b616c3951d426d8c
|
||||
hash_to_ec 2bc001a29f8eab1c7377de69957ba365fb5bdaf9c2c220889709af920dfe27d3 9bcb3010038f366fa4c280eed6e914a23bfc402594d0b83d0e66730a465a565b
|
||||
hash_to_ec 6feeb703c05e86c58d9fc5623f1af8657ecd1e75a14d18c4eedb642a8a393d16 6544628ba67ed0e14854961739c4d467fcf49d6361e39d32ea73dabeae51e6c3
|
||||
hash_to_ec e8ff145a7c26897f2c1639edd333a5412f87752f110079f581ccdc87fcce208c d4b5a6e06069c7e012e32119f8eda08ff04a8dfa784e1cf1bced455a4d41d905
|
||||
hash_to_ec 80488131dcb2018527908dbf8cdf4b823ef0806dc1d360f4da671004ef7ff74d 9984a79d9fd4f317768b442161116eef84e2ca49e938642b268fd64312d59a27
|
||||
hash_to_ec d8c4ca60446849a784d1462aa26a3b93073ff6841cb2da3ef52ab9785b00b1fd da5ec1562e7de2382d35728312f4eea3608d4dba775c1c108de510e1ce97d059
|
||||
hash_to_ec 68645728dfc6b9358dfb426493238ba38f24a2f46a3e89edb47d212549939cb7 d3253aa7235113dcc1b577d3bb80be34f528398815a653dbdbacbcbdfd5887a1
|
||||
hash_to_ec 4e8eb97ba2d1046e1b42e67530a61441e31c84e5e5e448d8e8dbe75d104eaccb de94f73e83222aa0e39b559d4fef70387b0815b9b2f6beff5da67262d8f0eb3e
|
||||
hash_to_ec 104ff03122ffdf59b22b8c0fe3d8f2ef67d02328e4d5181916d3d2a92f9a0bb7 1517ccf69c0328327e1cf581f16944ff66bc91c37e1cd68a99525415e00b7c9f
|
||||
hash_to_ec 80f23aae7356ae9a2f9f7504495a731214d26f870fb7df68fdc00b233494156f 7aef046b0a70f84e8d239aa95e192b5a3fffa0fae5090c91273e8996beca9e38
|
||||
hash_to_ec 2424b33235955a737ebddbf1c6c59cd8778af74da3bd3e658447666a2ab2f557 d19e2be8d482950fbdae429618da7a9daedb8c5944dea19cd1b6b274e792231b
|
||||
hash_to_ec 0adc839d2b8f099e4341a4763b074c06318d6bcbd1ec558d20a9820c4a426463 cea5da12a84e5c20011726d9224a9930bec30f9571762dd7ca857b86bd37d056
|
||||
hash_to_ec 46c84d53951f1ba23c46a23d5d96bf019c559aa5d2d79e4535cfcdb36f38ce25 2a913a01a6f7dd78a43cdd5354d1160d9a5f0d824c489a892c80eba798a77567
|
||||
hash_to_ec 99bdaaf68555ccdc93d97c3a0fb4c126a1aa8b1202194a1a753401a6cae21055 1f645efe173577a092f2d847cc966e28ba3b36397fe84c96dfa4724ed4fcfdf9
|
||||
hash_to_ec c540ff78f1e063ad26ffa69febb8818c9f2a325072c566091ad816e40fe39af4 de7a762262c91ab4beccc0713233cb91163aec43e34de0dbcfad0c431e8a9722
|
||||
hash_to_ec de8b1ff8978cd5e02681521542b7b6c3c2f8f4602065059f83594809d04e3dda 290601e75207085bff3e016746e55a80310a76dea9ef566c24181079c76da11c
|
||||
hash_to_ec d555994c8a022e52602d2a8bdd01fc1bfa6b9ab6734ff72a1bd5f937de4627f8 5f6794e874f48c4b362d0a24207374c2d274e28de86351afc6ddb95d8cc2fd62
|
||||
hash_to_ec 19db72f703fe6f1b73f21b6ba133ae6b111ae8cc496d3aa32e02411e34c0d8d7 42f159f43d2d62b8cf8a47d5f1340c5cf070e9860fc60de647c55d50fe9f5607
|
||||
hash_to_ec 23a87a258c2a5d1353aa2d5946f9e5749b92f85e3c58e1d177c3b6c3dcac809c e5685016f79d5e87d1fecb3e2a0fe64e4875f7accd2f6649d7f6b16317549cb1
|
||||
hash_to_ec 43e1738d7d1b5b565f5fc78e81480f7edf9a4dc18f104fc4be95135b98931b17 650f5b682e45f2d0c5d5e8bcfd9e0cda7d9071b55ecbfaf5e3b59941cd7479f2
|
||||
hash_to_ec a9d644de0804edf62dee613efa2547e510990a9b7a987ebe55ec74c23873a878 52ad329f88499a4f110e6a6cba1f820012d8db6ccb8f6495ab1e3eb5a24786e1
|
||||
hash_to_ec 11f2b5d89a0350d7c8727becf0f4dd19bd90f8c94ff207132ab13282dd9b94e6 b798a47bb98dc2a8f99deaf64d27638e33a0d504c5d2fbee477a2bc9b89e2838
|
||||
hash_to_ec 5e206e3190b3b715d125f1a11fff424fb33e36e534c99ddde2a3517068b7dcc4 2738e9571c96b2ddf93cb5f4a72b1ea78d3731d9555b830494513c0683c950ca
|
||||
hash_to_ec efc3d65a43d4f10795c7265a76671348f80173e0f507c812f7ae76793b99c529 cf4434d18ce8167b51f117fe930860143c46e1739a8db1fba73b6b0de830d707
|
||||
hash_to_ec 81f00469788aad6631cf75b585ae06d43ec81c20479925a2009afac9687dff60 c335b5889b36ba4b4175bb0d986807e8eedb6f6b7329b70b922e2ab729c4202a
|
||||
hash_to_ec 9ef5ff329b525ee8f5c3ac38e1dba7cb19985617341d356707c67ff273aed02d bef9f9e051ba0e24d1fdf72099cf43ecdd250d047fb329855b5372d5c422db9e
|
||||
hash_to_ec 3fa1401bd63132cf8b385c0fa65f0715ba1fe6161e41d59f8033ae2b22f63fa1 8289a1cb3c2dae48879bb8913fafe2d196cc2fdab5f2a77607910efd33eae6df
|
||||
hash_to_ec 6559836fd0081fa38a3f8d8408b564e5698b9797cf5e15f7f12a7d2c84511989 28d405a6687d2ecc90c1c66bf0454d58f3fa38835743075e1db58c658e15a104
|
||||
hash_to_ec 8e0882d45f0e4c2fb2839d3be86ff699d4b2242f5b25ac5a3c2f65297c7d2032 2771fdcf9135a62007adb5f0004d8222f0e42f819c81710aa4dc3ab2042bebf3
|
||||
hash_to_ec 1d91dc4dd9bd82646029d13aca1af96830c1d8a0400ddebeb14b00c93501c039 7792c62e897f32cbc9c4229f0d28f7882ceeae120329a1cd35f76a75ac704e93
|
||||
hash_to_ec 09527f9052acbbdd7676cbbd9534780865f04a27aaadad2b7d4f1dac68883cf0 b934220cde1327f2dc6af67bcb4124bf424d5084ef4da945e4daad1717cd0bb8
|
||||
hash_to_ec 2362e1abe73e64cdd2ca7f6c5ea9f467213747dd3f2b7c6e5df9cb21e03307d7 676b7122b96564358bbaaf77e3a5a4db1767e4f9a50f6ddd1c69df4566755af9
|
||||
hash_to_ec 26c2dd2356e9b6c68a415b25f91d18614dc8500c66f346d28489da543ee75a94 0f4fd7086acd68eb7c9fa2410e2ecf18e34654eb44e979bc03ce436e992d5feb
|
||||
hash_to_ec 422dc0a09d6a45a8e0b563eeb6a5ee84b08abd3a8cb34ff93f77ba3b163f4042 631f1b412ff5a0fccbe53a02b4a3deaa93a0418ed9874df401eb698ef75d7441
|
||||
hash_to_ec ceecdf46f57ef3f36ff30a1a3579b609340282d1b26ab5ddef2f53514e91bab1 9bc6f981fe98d14a2fc5b01a8134b6d35e123ec9ab8a3f303e0a5abb28150e2e
|
||||
hash_to_ec 024a9e6e0d73f28aa6207fb1e02ce86d444d2d46f8211e8aaab54f459db91a5a 5fb0c1d2c3b30f399102104ea1874099fa83110b3d9c1fcfffb2981c98bf8cdf
|
||||
hash_to_ec 5b8e45e269c9ccac4c68e532a72b29346d218f4606f37a14064826a62050e3a8 c7be46a871b77fc05ce891d24bd6bd54d9775b7ef573c6bc2d92b67f3604c1d1
|
||||
hash_to_ec 9a6593a385c266389eef14237874b97bdcd1823c3199311667d4853c2d12aa81 9f55ee9d94102d2b9c5670f30586cf9823bf205b4d4fe088c323e87c4e10f26f
|
||||
hash_to_ec 27377e2811598c3569b92990865d39b72c7a5533e1be30f77330863187c11875 abd82bc726f2710a8b87e4c1cf5a069f0ae800de614468d3ff35639983020197
|
||||
hash_to_ec 7cacfaa135fb7d568b8dce8ea9136498b1b28c6d1020af45d376288d78d411f0 229fccd49744c0692508af329224553d21561ee6062b2b8a21f080f73da5bd97
|
||||
hash_to_ec 52abd90a5542d6496b8dec9567b020f30058e29458d64f2d4f3ad6f3bfc1a5a0 874e82ced7cf77577b3374087fb08a2300b7f403de628310c26bdb3be869d309
|
||||
hash_to_ec 5c8eebe9d12309187afa8d0d5191de3fdb84e5a05485d7cd62e8804ce7fdc0bc 12b7537643488aa8b9dcc4bae040cd491f8b466163b7988157b0502fb6c9177f
|
||||
hash_to_ec 6ca3dd5c7a21a6bf65d6eefbe20a66e9b1d6b64196344be0c075f47aea48e3aa 5e1d0705ee24675238293b73ab1d98359119d4b328275be2460cc6ee4d19cc88
|
||||
hash_to_ec d7e6cd0d39b4308c2a5ee547c4569c8bb3887e49cedece62d218d7c3c5277797 793dc4397112dfd9a8f4e061f457eb6d6fbb1d7a58c40bad5f16002c64914186
|
||||
hash_to_ec 9cb6de8ba967cca0f0f861c6e20546f8958446595c01c28dae7ba6cfa09d6b14 ba1a2f7502b58fee3499c20e35fa01bb932e7a7c4a925dc04fbf5d90f33cfb5e
|
||||
hash_to_ec 8ef9c7366733a1edcd116238cdbd177d61222d5c3e05b30ef6b85014cbcb6b79 8fc89664722947164ac9b77086aed319897612068f56ecd57f47029f14671603
|
||||
hash_to_ec 7f317a34e4fb7de9f69cb107ffc0e57fd9f5c85b85ccb5319d05cebfc169924a 4b71c42339c73db7d710cd63f374d478a6c13bdc352cff40e967282268965ba7
|
||||
hash_to_ec 15beef8d9687b92918a903b01d594859db4e7128263c8db0cae9d423ff962c1e cd75e6323952f6ac88f138f391b69f38c46d70b7eda61f9e431725b6f1d514a5
|
||||
hash_to_ec 7a1c04c9af8fc6649833fe81e96f0199fcfe94959256cbe1490075fc5be0904e 0368270cd979439ae0a9552a5d6c9f959e4247fcf920d9e071464582e79c04b1
|
||||
hash_to_ec c854c583d338615f85f69061e0fa9c9d7c5bbbfe562e8774fef3be556fe8bb63 061620171d7320f64bee98414ff7200a1f481521d202fb281cab06be73b80402
|
||||
hash_to_ec 0fb8af5aba05ad2503edf1cfad5a451da088e7e974772057cd991a4e0601a3eb d3cbc20384a4420143fcce2cb763b0c15bec4f3267d1bdad3c34c1ee6b790f5e
|
||||
hash_to_ec 9a251cf59e84a9da5630642f9671c732440caa8fcf4c92446a7e5f5ef99da46c 9b9679086a433f2077f40bcd4c7545fb5cc87e7dbb8bba468d53cb04a74361a0
|
||||
hash_to_ec 8c632e357cef00e0911eb566f8cc809136b3f5ac1e82d183e4d645cef89fa155 5e06b0f4f278fa1ccb5431866e0b35171cdb814e2e82b9189ce01d8d8a1b2408
|
||||
hash_to_ec 4aa4c31463475086a5d96b3ff550340567ab3b4a86fa3f01cfe9be18bc4dcb54 76a2916cfc093f27992e1f07b50f431d61d58e255507e208cd29ea4d3bc56623
|
||||
hash_to_ec 1d33d9aadb949346e3c78d065a0f5262374524f4cb97a7390c8cdaede7ca6578 9ad2f757f499359903031adea6126c577469c4e834a2959e3ac08ee74b13783c
|
||||
hash_to_ec d9217b9a070df20c4d2f0db42ff0bb36bfba9f51b0b6df8fdfe150405dce4934 65a843c522b4b8ec081a696a0d2dd8dfdfea45db201de7a5889a1446c6dff8c7
|
||||
hash_to_ec b665b2ca8a285e44ba84e785533b56496a5319730dbb95bc14d3bdfece7544dc 8a804cd13457497b0a29eeca2cecfaa858766ec1d270a0e0c6785b43fd49b824
|
||||
hash_to_ec 43b5cbcc21b3404bca97fa9a661940fe64d40f3ca569310e50b1bb0173c4d5ee 6c12fffb540d536060bb8b96cf635c1b2cbaa4d875a8d2fb0bf79a690363df19
|
||||
hash_to_ec 11c58f20562c00dec5bb4456be07cd98186837e9af38d50d45f5e7b6f0f9000d cee76b567586f66dadd38c01213bfc1a17d38e96a495efb4c26063dc498ba209
|
||||
hash_to_ec b069a980b51d8e030262db0b30069e660f4a3f6f8075d1790c153ba12b879f8b 262391b00bdee71d1d827b2cfe50b46c29e265934dc91959bd369aca0cc6444e
|
||||
hash_to_ec 75274bfd79bf33eb2f9ab046d34528af9a71811e7e3d55c20eb049c81ac692d8 cb93c850e36896fe6626e97c53652af6736ec3ba0641c7765d0cca2bad2352de
|
||||
hash_to_ec 5cdb6a24d9736a00f197d9707949fedc5405f367744fe8c83b7cff650302b589 8b4ac03123fab9275dcf340345a1b11fba48ef106d410ba2e0e6f6457037a419
|
||||
hash_to_ec 07fdc85f809f95a07b59b084402bf91c512ebbe05c7657d6ba27a9e7e121e3e2 61182b3def063630e11de648a278032bcb75949f3a24ef5a133da87830ae5c4e
|
||||
hash_to_ec a4188ca634cbb796f9927822e343d7b267e0a609c1a0ffa4dcf3726b9ffcc8a2 a911e4899fda28fd6337d708d34553ac5e810ee4938f6f7d9d6e521cab069edb
|
||||
hash_to_ec 3c128ec5c955ea189a5789df2c892e94193a534a9d5801b8f75df870bc492a69 59eef5ee9df0f681df5b5c67ead1f06b059a8a843837b67f20cce15779608170
|
||||
hash_to_ec 51a4cc7ec4a14a98c0731e9de7f3ce0779123222d95455e940f2014a23729ec8 105863ccda076af7290d1bf9ec828651dc5811159839044d23f1c3e31a11c5e2
|
||||
hash_to_ec 1b901a31acbb7807c3309facdc7d04bc3b5a4aa714e6e346bd1c6ad4634e6534 01b3c0000b6c6b471c67c6ab3f9c7a500beaea5edb5c8f2b34df91b69ff67f21
|
||||
hash_to_ec d2f2c8d79cfa2e7cb2db80568ba62ca0576741acfbe5e2baa0d9b3c424a7c84d 7df9d9088022bd1ce6814d6f8051eef27a650ee38e789b184da2691efd27139d
|
||||
hash_to_ec 04dcb7644fdfc12d8e34d6e57d7769db939b4a149ed2b81aa51a74ee90babe19 6cff0ab2dd3b32ba1bd1a78e3661722f3f10003a01ce83e430970557decedb2c
|
||||
hash_to_ec 222798c6841eeaa07e7b7e29686942d7c7f9afc38d09360c8e1f52f2b7debd12 133e3a04ec82aa9b8dbbec18cadbafff446d1270bf7c6f3f97ddd3906dae2468
|
||||
hash_to_ec 4f7277c3ef247a0689b486ad965f969c433fc63e95d7310e789c4708418ccabc 7e0f2c984dd3cffb35458938c95fe92acf2e697aed060b0e3377c7a07e53c494
|
||||
hash_to_ec 359b4d6709413243ae2c5409ea02714a9f8961bbbb64a91e81daf01e18c981bf eab69af2cb7f113ad6a27035c0399853d10bd0b99291fad37794d100f7530431
|
||||
hash_to_ec 6cea3c6a9eb38f60329537170aa4db8dbb869af2040061e53b10c267daf6568c da9a97f4fa96bd05dade5e2704a6a633ba4dbe5080a1e831cda888e9d4f86615
|
||||
hash_to_ec 3dddecb954ef0209bcf61fd5b46b6c94f2384ef281c48a20ffee74f90788172d af9899c31f944617af54712f93d1a2b4944e48867f480d0d1aec61f3b713e32d
|
||||
hash_to_ec 9605247462f50bdf7ff57fe966abbefe8b6efa0b65b5116252f0ec723717013f fc8f10904d42a74e09310ccf63db31a90f1dab88b278f15e3364a2356810f7e9
|
||||
hash_to_ec a005143c4d299933f866db41d0a0b8c67264f5d4ea840dd243cb10c3526bc077 928df1fe9404ffa9c1f4a1c8b2d43ab9b81c5615c8330d2dc2074ac66d4d5200
|
||||
hash_to_ec f45ce88065c34a163f8e77b6fb583502ed0eb1f490f63f76065a9d97e214e3a9 41bd6784270af4154f2f24f118617e2d7f5b7771a409f08b0f2b7bbcb5e3d666
|
||||
hash_to_ec 7b40ac30ed02b12ff592a5479c80cf5a7673abfdd4dd38810e40e63275bc2eed 6c6bf5961d83851c9728801093d9af04e5a693bc6cbad237b9ac4b0ed580a771
|
||||
hash_to_ec 9f985005794d3052a63361413a9820d2ce903198d6d5195b3f20a68f146c6d5c 88bcac53ba5b1c5b44730a24b4cc2cd782298fc70dc9d777b577a2b33b256449
|
||||
hash_to_ec 31b8e37d01fd5669de4ebf78889d749bc44ffe997186ace56f1fb3e60b8742d2 776366b44170efb130a5045597db5675c6c0b56f3def84863c6b6358aa8dcf40
|
||||
16
coins/monero/generators/src/varint.rs
Normal file
16
coins/monero/generators/src/varint.rs
Normal file
@@ -0,0 +1,16 @@
|
||||
use std_shims::io::{self, Write};
|
||||
|
||||
const VARINT_CONTINUATION_MASK: u8 = 0b1000_0000;
|
||||
pub(crate) fn write_varint<W: Write>(varint: &u64, w: &mut W) -> io::Result<()> {
|
||||
let mut varint = *varint;
|
||||
while {
|
||||
let mut b = u8::try_from(varint & u64::from(!VARINT_CONTINUATION_MASK)).unwrap();
|
||||
varint >>= 7;
|
||||
if varint != 0 {
|
||||
b |= VARINT_CONTINUATION_MASK;
|
||||
}
|
||||
w.write_all(&[b])?;
|
||||
varint != 0
|
||||
} {}
|
||||
Ok(())
|
||||
}
|
||||
321
coins/monero/src/bin/reserialize_chain.rs
Normal file
321
coins/monero/src/bin/reserialize_chain.rs
Normal file
@@ -0,0 +1,321 @@
|
||||
#[cfg(feature = "binaries")]
|
||||
mod binaries {
|
||||
pub(crate) use std::sync::Arc;
|
||||
|
||||
pub(crate) use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
||||
|
||||
pub(crate) use multiexp::BatchVerifier;
|
||||
|
||||
pub(crate) use serde::Deserialize;
|
||||
pub(crate) use serde_json::json;
|
||||
|
||||
pub(crate) use monero_serai::{
|
||||
Commitment,
|
||||
ringct::RctPrunable,
|
||||
transaction::{Input, Transaction},
|
||||
block::Block,
|
||||
rpc::{RpcError, Rpc, HttpRpc},
|
||||
};
|
||||
|
||||
pub(crate) use monero_generators::decompress_point;
|
||||
|
||||
pub(crate) use tokio::task::JoinHandle;
|
||||
|
||||
pub(crate) async fn check_block(rpc: Arc<Rpc<HttpRpc>>, block_i: usize) {
|
||||
let hash = loop {
|
||||
match rpc.get_block_hash(block_i).await {
|
||||
Ok(hash) => break hash,
|
||||
Err(RpcError::ConnectionError(e)) => {
|
||||
println!("get_block_hash ConnectionError: {e}");
|
||||
continue;
|
||||
}
|
||||
Err(e) => panic!("couldn't get block {block_i}'s hash: {e:?}"),
|
||||
}
|
||||
};
|
||||
|
||||
// TODO: Grab the JSON to also check it was deserialized correctly
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct BlockResponse {
|
||||
blob: String,
|
||||
}
|
||||
let res: BlockResponse = loop {
|
||||
match rpc.json_rpc_call("get_block", Some(json!({ "hash": hex::encode(hash) }))).await {
|
||||
Ok(res) => break res,
|
||||
Err(RpcError::ConnectionError(e)) => {
|
||||
println!("get_block ConnectionError: {e}");
|
||||
continue;
|
||||
}
|
||||
Err(e) => panic!("couldn't get block {block_i} via block.hash(): {e:?}"),
|
||||
}
|
||||
};
|
||||
|
||||
let blob = hex::decode(res.blob).expect("node returned non-hex block");
|
||||
let block = Block::read(&mut blob.as_slice())
|
||||
.unwrap_or_else(|e| panic!("couldn't deserialize block {block_i}: {e}"));
|
||||
assert_eq!(block.hash(), hash, "hash differs");
|
||||
assert_eq!(block.serialize(), blob, "serialization differs");
|
||||
|
||||
let txs_len = 1 + block.txs.len();
|
||||
|
||||
if !block.txs.is_empty() {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct TransactionResponse {
|
||||
tx_hash: String,
|
||||
as_hex: String,
|
||||
}
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct TransactionsResponse {
|
||||
#[serde(default)]
|
||||
missed_tx: Vec<String>,
|
||||
txs: Vec<TransactionResponse>,
|
||||
}
|
||||
|
||||
let mut hashes_hex = block.txs.iter().map(hex::encode).collect::<Vec<_>>();
|
||||
let mut all_txs = vec![];
|
||||
while !hashes_hex.is_empty() {
|
||||
let txs: TransactionsResponse = loop {
|
||||
match rpc
|
||||
.rpc_call(
|
||||
"get_transactions",
|
||||
Some(json!({
|
||||
"txs_hashes": hashes_hex.drain(.. hashes_hex.len().min(100)).collect::<Vec<_>>(),
|
||||
})),
|
||||
)
|
||||
.await
|
||||
{
|
||||
Ok(txs) => break txs,
|
||||
Err(RpcError::ConnectionError(e)) => {
|
||||
println!("get_transactions ConnectionError: {e}");
|
||||
continue;
|
||||
}
|
||||
Err(e) => panic!("couldn't call get_transactions: {e:?}"),
|
||||
}
|
||||
};
|
||||
assert!(txs.missed_tx.is_empty());
|
||||
all_txs.extend(txs.txs);
|
||||
}
|
||||
|
||||
let mut batch = BatchVerifier::new(block.txs.len());
|
||||
for (tx_hash, tx_res) in block.txs.into_iter().zip(all_txs) {
|
||||
assert_eq!(
|
||||
tx_res.tx_hash,
|
||||
hex::encode(tx_hash),
|
||||
"node returned a transaction with different hash"
|
||||
);
|
||||
|
||||
let tx = Transaction::read(
|
||||
&mut hex::decode(&tx_res.as_hex).expect("node returned non-hex transaction").as_slice(),
|
||||
)
|
||||
.expect("couldn't deserialize transaction");
|
||||
|
||||
assert_eq!(
|
||||
hex::encode(tx.serialize()),
|
||||
tx_res.as_hex,
|
||||
"Transaction serialization was different"
|
||||
);
|
||||
assert_eq!(tx.hash(), tx_hash, "Transaction hash was different");
|
||||
|
||||
if matches!(tx.rct_signatures.prunable, RctPrunable::Null) {
|
||||
assert_eq!(tx.prefix.version, 1);
|
||||
assert!(!tx.signatures.is_empty());
|
||||
continue;
|
||||
}
|
||||
|
||||
let sig_hash = tx.signature_hash();
|
||||
// Verify all proofs we support proving for
|
||||
// This is due to having debug_asserts calling verify within their proving, and CLSAG
|
||||
// multisig explicitly calling verify as part of its signing process
|
||||
// Accordingly, making sure our signature_hash algorithm is correct is great, and further
|
||||
// making sure the verification functions are valid is appreciated
|
||||
match tx.rct_signatures.prunable {
|
||||
RctPrunable::Null |
|
||||
RctPrunable::AggregateMlsagBorromean { .. } |
|
||||
RctPrunable::MlsagBorromean { .. } => {}
|
||||
RctPrunable::MlsagBulletproofs { bulletproofs, .. } => {
|
||||
assert!(bulletproofs.batch_verify(
|
||||
&mut rand_core::OsRng,
|
||||
&mut batch,
|
||||
(),
|
||||
&tx.rct_signatures.base.commitments
|
||||
));
|
||||
}
|
||||
RctPrunable::Clsag { bulletproofs, clsags, pseudo_outs } => {
|
||||
assert!(bulletproofs.batch_verify(
|
||||
&mut rand_core::OsRng,
|
||||
&mut batch,
|
||||
(),
|
||||
&tx.rct_signatures.base.commitments
|
||||
));
|
||||
|
||||
for (i, clsag) in clsags.into_iter().enumerate() {
|
||||
let (amount, key_offsets, image) = match &tx.prefix.inputs[i] {
|
||||
Input::Gen(_) => panic!("Input::Gen"),
|
||||
Input::ToKey { amount, key_offsets, key_image } => (amount, key_offsets, key_image),
|
||||
};
|
||||
|
||||
let mut running_sum = 0;
|
||||
let mut actual_indexes = vec![];
|
||||
for offset in key_offsets {
|
||||
running_sum += offset;
|
||||
actual_indexes.push(running_sum);
|
||||
}
|
||||
|
||||
async fn get_outs(
|
||||
rpc: &Rpc<HttpRpc>,
|
||||
amount: u64,
|
||||
indexes: &[u64],
|
||||
) -> Vec<[EdwardsPoint; 2]> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct Out {
|
||||
key: String,
|
||||
mask: String,
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct Outs {
|
||||
outs: Vec<Out>,
|
||||
}
|
||||
|
||||
let outs: Outs = loop {
|
||||
match rpc
|
||||
.rpc_call(
|
||||
"get_outs",
|
||||
Some(json!({
|
||||
"get_txid": true,
|
||||
"outputs": indexes.iter().map(|o| json!({
|
||||
"amount": amount,
|
||||
"index": o
|
||||
})).collect::<Vec<_>>()
|
||||
})),
|
||||
)
|
||||
.await
|
||||
{
|
||||
Ok(outs) => break outs,
|
||||
Err(RpcError::ConnectionError(e)) => {
|
||||
println!("get_outs ConnectionError: {e}");
|
||||
continue;
|
||||
}
|
||||
Err(e) => panic!("couldn't connect to RPC to get outs: {e:?}"),
|
||||
}
|
||||
};
|
||||
|
||||
let rpc_point = |point: &str| {
|
||||
decompress_point(
|
||||
hex::decode(point)
|
||||
.expect("invalid hex for ring member")
|
||||
.try_into()
|
||||
.expect("invalid point len for ring member"),
|
||||
)
|
||||
.expect("invalid point for ring member")
|
||||
};
|
||||
|
||||
outs
|
||||
.outs
|
||||
.iter()
|
||||
.map(|out| {
|
||||
let mask = rpc_point(&out.mask);
|
||||
if amount != 0 {
|
||||
assert_eq!(mask, Commitment::new(Scalar::from(1u8), amount).calculate());
|
||||
}
|
||||
[rpc_point(&out.key), mask]
|
||||
})
|
||||
.collect()
|
||||
}
|
||||
|
||||
clsag
|
||||
.verify(
|
||||
&get_outs(&rpc, amount.unwrap_or(0), &actual_indexes).await,
|
||||
image,
|
||||
&pseudo_outs[i],
|
||||
&sig_hash,
|
||||
)
|
||||
.unwrap();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
assert!(batch.verify_vartime());
|
||||
}
|
||||
|
||||
println!("Deserialized, hashed, and reserialized {block_i} with {txs_len} TXs");
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(feature = "binaries")]
|
||||
#[tokio::main]
|
||||
async fn main() {
|
||||
use binaries::*;
|
||||
|
||||
let args = std::env::args().collect::<Vec<String>>();
|
||||
|
||||
// Read start block as the first arg
|
||||
let mut block_i = args[1].parse::<usize>().expect("invalid start block");
|
||||
|
||||
// How many blocks to work on at once
|
||||
let async_parallelism: usize =
|
||||
args.get(2).unwrap_or(&"8".to_string()).parse::<usize>().expect("invalid parallelism argument");
|
||||
|
||||
// Read further args as RPC URLs
|
||||
let default_nodes = vec![
|
||||
"http://xmr-node.cakewallet.com:18081".to_string(),
|
||||
"https://node.sethforprivacy.com".to_string(),
|
||||
];
|
||||
let mut specified_nodes = vec![];
|
||||
{
|
||||
let mut i = 0;
|
||||
loop {
|
||||
let Some(node) = args.get(3 + i) else { break };
|
||||
specified_nodes.push(node.clone());
|
||||
i += 1;
|
||||
}
|
||||
}
|
||||
let nodes = if specified_nodes.is_empty() { default_nodes } else { specified_nodes };
|
||||
|
||||
let rpc = |url: String| async move {
|
||||
HttpRpc::new(url.clone())
|
||||
.await
|
||||
.unwrap_or_else(|_| panic!("couldn't create HttpRpc connected to {url}"))
|
||||
};
|
||||
let main_rpc = rpc(nodes[0].clone()).await;
|
||||
let mut rpcs = vec![];
|
||||
for i in 0 .. async_parallelism {
|
||||
rpcs.push(Arc::new(rpc(nodes[i % nodes.len()].clone()).await));
|
||||
}
|
||||
|
||||
let mut rpc_i = 0;
|
||||
let mut handles: Vec<JoinHandle<()>> = vec![];
|
||||
let mut height = 0;
|
||||
loop {
|
||||
let new_height = main_rpc.get_height().await.expect("couldn't call get_height");
|
||||
if new_height == height {
|
||||
break;
|
||||
}
|
||||
height = new_height;
|
||||
|
||||
while block_i < height {
|
||||
if handles.len() >= async_parallelism {
|
||||
// Guarantee one handle is complete
|
||||
handles.swap_remove(0).await.unwrap();
|
||||
|
||||
// Remove all of the finished handles
|
||||
let mut i = 0;
|
||||
while i < handles.len() {
|
||||
if handles[i].is_finished() {
|
||||
handles.swap_remove(i).await.unwrap();
|
||||
continue;
|
||||
}
|
||||
i += 1;
|
||||
}
|
||||
}
|
||||
|
||||
handles.push(tokio::spawn(check_block(rpcs[rpc_i].clone(), block_i)));
|
||||
rpc_i = (rpc_i + 1) % rpcs.len();
|
||||
block_i += 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(not(feature = "binaries"))]
|
||||
fn main() {
|
||||
panic!("To run binaries, please build with `--feature binaries`.");
|
||||
}
|
||||
130
coins/monero/src/block.rs
Normal file
130
coins/monero/src/block.rs
Normal file
@@ -0,0 +1,130 @@
|
||||
use std_shims::{
|
||||
vec::Vec,
|
||||
io::{self, Read, Write},
|
||||
};
|
||||
|
||||
use crate::{
|
||||
hash,
|
||||
merkle::merkle_root,
|
||||
serialize::*,
|
||||
transaction::{Input, Transaction},
|
||||
};
|
||||
|
||||
const CORRECT_BLOCK_HASH_202612: [u8; 32] =
|
||||
hex_literal::hex!("426d16cff04c71f8b16340b722dc4010a2dd3831c22041431f772547ba6e331a");
|
||||
const EXISTING_BLOCK_HASH_202612: [u8; 32] =
|
||||
hex_literal::hex!("bbd604d2ba11ba27935e006ed39c9bfdd99b76bf4a50654bc1e1e61217962698");
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct BlockHeader {
|
||||
pub major_version: u8,
|
||||
pub minor_version: u8,
|
||||
pub timestamp: u64,
|
||||
pub previous: [u8; 32],
|
||||
pub nonce: u32,
|
||||
}
|
||||
|
||||
impl BlockHeader {
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
write_varint(&self.major_version, w)?;
|
||||
write_varint(&self.minor_version, w)?;
|
||||
write_varint(&self.timestamp, w)?;
|
||||
w.write_all(&self.previous)?;
|
||||
w.write_all(&self.nonce.to_le_bytes())
|
||||
}
|
||||
|
||||
pub fn serialize(&self) -> Vec<u8> {
|
||||
let mut serialized = vec![];
|
||||
self.write(&mut serialized).unwrap();
|
||||
serialized
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(r: &mut R) -> io::Result<BlockHeader> {
|
||||
Ok(BlockHeader {
|
||||
major_version: read_varint(r)?,
|
||||
minor_version: read_varint(r)?,
|
||||
timestamp: read_varint(r)?,
|
||||
previous: read_bytes(r)?,
|
||||
nonce: read_bytes(r).map(u32::from_le_bytes)?,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct Block {
|
||||
pub header: BlockHeader,
|
||||
pub miner_tx: Transaction,
|
||||
pub txs: Vec<[u8; 32]>,
|
||||
}
|
||||
|
||||
impl Block {
|
||||
pub fn number(&self) -> Option<u64> {
|
||||
match self.miner_tx.prefix.inputs.first() {
|
||||
Some(Input::Gen(number)) => Some(*number),
|
||||
_ => None,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
self.header.write(w)?;
|
||||
self.miner_tx.write(w)?;
|
||||
write_varint(&self.txs.len(), w)?;
|
||||
for tx in &self.txs {
|
||||
w.write_all(tx)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn tx_merkle_root(&self) -> [u8; 32] {
|
||||
merkle_root(self.miner_tx.hash(), &self.txs)
|
||||
}
|
||||
|
||||
/// Serialize the block as required for the proof of work hash.
|
||||
///
|
||||
/// This is distinct from the serialization required for the block hash. To get the block hash,
|
||||
/// use the [`Block::hash`] function.
|
||||
pub fn serialize_hashable(&self) -> Vec<u8> {
|
||||
let mut blob = self.header.serialize();
|
||||
blob.extend_from_slice(&self.tx_merkle_root());
|
||||
write_varint(&(1 + u64::try_from(self.txs.len()).unwrap()), &mut blob).unwrap();
|
||||
|
||||
blob
|
||||
}
|
||||
|
||||
pub fn hash(&self) -> [u8; 32] {
|
||||
let mut hashable = self.serialize_hashable();
|
||||
// Monero pre-appends a VarInt of the block hashing blobs length before getting the block hash
|
||||
// but doesn't do this when getting the proof of work hash :)
|
||||
let mut hashing_blob = Vec::with_capacity(8 + hashable.len());
|
||||
write_varint(&u64::try_from(hashable.len()).unwrap(), &mut hashing_blob).unwrap();
|
||||
hashing_blob.append(&mut hashable);
|
||||
|
||||
let hash = hash(&hashing_blob);
|
||||
if hash == CORRECT_BLOCK_HASH_202612 {
|
||||
return EXISTING_BLOCK_HASH_202612;
|
||||
};
|
||||
|
||||
hash
|
||||
}
|
||||
|
||||
pub fn serialize(&self) -> Vec<u8> {
|
||||
let mut serialized = vec![];
|
||||
self.write(&mut serialized).unwrap();
|
||||
serialized
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(r: &mut R) -> io::Result<Block> {
|
||||
let header = BlockHeader::read(r)?;
|
||||
|
||||
let miner_tx = Transaction::read(r)?;
|
||||
if !matches!(miner_tx.prefix.inputs.as_slice(), &[Input::Gen(_)]) {
|
||||
Err(io::Error::other("Miner transaction has incorrect input type."))?;
|
||||
}
|
||||
|
||||
Ok(Block {
|
||||
header,
|
||||
miner_tx,
|
||||
txs: (0_usize .. read_varint(r)?).map(|_| read_bytes(r)).collect::<Result<_, _>>()?,
|
||||
})
|
||||
}
|
||||
}
|
||||
229
coins/monero/src/lib.rs
Normal file
229
coins/monero/src/lib.rs
Normal file
@@ -0,0 +1,229 @@
|
||||
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
|
||||
#![doc = include_str!("../README.md")]
|
||||
#![cfg_attr(not(feature = "std"), no_std)]
|
||||
|
||||
#[cfg(not(feature = "std"))]
|
||||
#[macro_use]
|
||||
extern crate alloc;
|
||||
|
||||
use std_shims::{sync::OnceLock, io};
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||
|
||||
use sha3::{Digest, Keccak256};
|
||||
|
||||
use curve25519_dalek::{constants::ED25519_BASEPOINT_TABLE, scalar::Scalar, edwards::EdwardsPoint};
|
||||
|
||||
pub use monero_generators::{H, decompress_point};
|
||||
|
||||
mod merkle;
|
||||
|
||||
mod serialize;
|
||||
use serialize::{read_byte, read_u16};
|
||||
|
||||
/// UnreducedScalar struct with functionality for recovering incorrectly reduced scalars.
|
||||
mod unreduced_scalar;
|
||||
|
||||
/// Ring Signature structs and functionality.
|
||||
pub mod ring_signatures;
|
||||
|
||||
/// RingCT structs and functionality.
|
||||
pub mod ringct;
|
||||
use ringct::RctType;
|
||||
|
||||
/// Transaction structs.
|
||||
pub mod transaction;
|
||||
/// Block structs.
|
||||
pub mod block;
|
||||
|
||||
/// Monero daemon RPC interface.
|
||||
pub mod rpc;
|
||||
/// Wallet functionality, enabling scanning and sending transactions.
|
||||
pub mod wallet;
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests;
|
||||
|
||||
pub const DEFAULT_LOCK_WINDOW: usize = 10;
|
||||
pub const COINBASE_LOCK_WINDOW: usize = 60;
|
||||
pub const BLOCK_TIME: usize = 120;
|
||||
|
||||
static INV_EIGHT_CELL: OnceLock<Scalar> = OnceLock::new();
|
||||
#[allow(non_snake_case)]
|
||||
pub(crate) fn INV_EIGHT() -> Scalar {
|
||||
*INV_EIGHT_CELL.get_or_init(|| Scalar::from(8u8).invert())
|
||||
}
|
||||
|
||||
/// Monero protocol version.
|
||||
///
|
||||
/// v15 is omitted as v15 was simply v14 and v16 being active at the same time, with regards to the
|
||||
/// transactions supported. Accordingly, v16 should be used during v15.
|
||||
#[derive(Clone, Copy, PartialEq, Eq, Debug, Zeroize)]
|
||||
#[allow(non_camel_case_types)]
|
||||
pub enum Protocol {
|
||||
v14,
|
||||
v16,
|
||||
Custom {
|
||||
ring_len: usize,
|
||||
bp_plus: bool,
|
||||
optimal_rct_type: RctType,
|
||||
view_tags: bool,
|
||||
v16_fee: bool,
|
||||
},
|
||||
}
|
||||
|
||||
impl Protocol {
|
||||
/// Amount of ring members under this protocol version.
|
||||
pub fn ring_len(&self) -> usize {
|
||||
match self {
|
||||
Protocol::v14 => 11,
|
||||
Protocol::v16 => 16,
|
||||
Protocol::Custom { ring_len, .. } => *ring_len,
|
||||
}
|
||||
}
|
||||
|
||||
/// Whether or not the specified version uses Bulletproofs or Bulletproofs+.
|
||||
///
|
||||
/// This method will likely be reworked when versions not using Bulletproofs at all are added.
|
||||
pub fn bp_plus(&self) -> bool {
|
||||
match self {
|
||||
Protocol::v14 => false,
|
||||
Protocol::v16 => true,
|
||||
Protocol::Custom { bp_plus, .. } => *bp_plus,
|
||||
}
|
||||
}
|
||||
|
||||
// TODO: Make this an Option when we support pre-RCT protocols
|
||||
pub fn optimal_rct_type(&self) -> RctType {
|
||||
match self {
|
||||
Protocol::v14 => RctType::Clsag,
|
||||
Protocol::v16 => RctType::BulletproofsPlus,
|
||||
Protocol::Custom { optimal_rct_type, .. } => *optimal_rct_type,
|
||||
}
|
||||
}
|
||||
|
||||
/// Whether or not the specified version uses view tags.
|
||||
pub fn view_tags(&self) -> bool {
|
||||
match self {
|
||||
Protocol::v14 => false,
|
||||
Protocol::v16 => true,
|
||||
Protocol::Custom { view_tags, .. } => *view_tags,
|
||||
}
|
||||
}
|
||||
|
||||
/// Whether or not the specified version uses the fee algorithm from Monero
|
||||
/// hard fork version 16 (released in v18 binaries).
|
||||
pub fn v16_fee(&self) -> bool {
|
||||
match self {
|
||||
Protocol::v14 => false,
|
||||
Protocol::v16 => true,
|
||||
Protocol::Custom { v16_fee, .. } => *v16_fee,
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn write<W: io::Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
match self {
|
||||
Protocol::v14 => w.write_all(&[0, 14]),
|
||||
Protocol::v16 => w.write_all(&[0, 16]),
|
||||
Protocol::Custom { ring_len, bp_plus, optimal_rct_type, view_tags, v16_fee } => {
|
||||
// Custom, version 0
|
||||
w.write_all(&[1, 0])?;
|
||||
w.write_all(&u16::try_from(*ring_len).unwrap().to_le_bytes())?;
|
||||
w.write_all(&[u8::from(*bp_plus)])?;
|
||||
w.write_all(&[optimal_rct_type.to_byte()])?;
|
||||
w.write_all(&[u8::from(*view_tags)])?;
|
||||
w.write_all(&[u8::from(*v16_fee)])
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn read<R: io::Read>(r: &mut R) -> io::Result<Protocol> {
|
||||
Ok(match read_byte(r)? {
|
||||
// Monero protocol
|
||||
0 => match read_byte(r)? {
|
||||
14 => Protocol::v14,
|
||||
16 => Protocol::v16,
|
||||
_ => Err(io::Error::other("unrecognized monero protocol"))?,
|
||||
},
|
||||
// Custom
|
||||
1 => match read_byte(r)? {
|
||||
0 => Protocol::Custom {
|
||||
ring_len: read_u16(r)?.into(),
|
||||
bp_plus: match read_byte(r)? {
|
||||
0 => false,
|
||||
1 => true,
|
||||
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||
},
|
||||
optimal_rct_type: RctType::from_byte(read_byte(r)?)
|
||||
.ok_or_else(|| io::Error::other("invalid RctType serialization"))?,
|
||||
view_tags: match read_byte(r)? {
|
||||
0 => false,
|
||||
1 => true,
|
||||
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||
},
|
||||
v16_fee: match read_byte(r)? {
|
||||
0 => false,
|
||||
1 => true,
|
||||
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||
},
|
||||
},
|
||||
_ => Err(io::Error::other("unrecognized custom protocol serialization"))?,
|
||||
},
|
||||
_ => Err(io::Error::other("unrecognized protocol serialization"))?,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
/// Transparent structure representing a Pedersen commitment's contents.
|
||||
#[allow(non_snake_case)]
|
||||
#[derive(Clone, PartialEq, Eq, Zeroize, ZeroizeOnDrop)]
|
||||
pub struct Commitment {
|
||||
pub mask: Scalar,
|
||||
pub amount: u64,
|
||||
}
|
||||
|
||||
impl core::fmt::Debug for Commitment {
|
||||
fn fmt(&self, fmt: &mut core::fmt::Formatter<'_>) -> Result<(), core::fmt::Error> {
|
||||
fmt.debug_struct("Commitment").field("amount", &self.amount).finish_non_exhaustive()
|
||||
}
|
||||
}
|
||||
|
||||
impl Commitment {
|
||||
/// A commitment to zero, defined with a mask of 1 (as to not be the identity).
|
||||
pub fn zero() -> Commitment {
|
||||
Commitment { mask: Scalar::ONE, amount: 0 }
|
||||
}
|
||||
|
||||
pub fn new(mask: Scalar, amount: u64) -> Commitment {
|
||||
Commitment { mask, amount }
|
||||
}
|
||||
|
||||
/// Calculate a Pedersen commitment, as a point, from the transparent structure.
|
||||
pub fn calculate(&self) -> EdwardsPoint {
|
||||
(&self.mask * ED25519_BASEPOINT_TABLE) + (Scalar::from(self.amount) * H())
|
||||
}
|
||||
}
|
||||
|
||||
/// Support generating a random scalar using a modern rand, as dalek's is notoriously dated.
|
||||
pub fn random_scalar<R: RngCore + CryptoRng>(rng: &mut R) -> Scalar {
|
||||
let mut r = [0; 64];
|
||||
rng.fill_bytes(&mut r);
|
||||
Scalar::from_bytes_mod_order_wide(&r)
|
||||
}
|
||||
|
||||
pub(crate) fn hash(data: &[u8]) -> [u8; 32] {
|
||||
Keccak256::digest(data).into()
|
||||
}
|
||||
|
||||
/// Hash the provided data to a scalar via keccak256(data) % l.
|
||||
pub fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||
let scalar = Scalar::from_bytes_mod_order(hash(data));
|
||||
// Monero will explicitly error in this case
|
||||
// This library acknowledges its practical impossibility of it occurring, and doesn't bother to
|
||||
// code in logic to handle it. That said, if it ever occurs, something must happen in order to
|
||||
// not generate/verify a proof we believe to be valid when it isn't
|
||||
assert!(scalar != Scalar::ZERO, "ZERO HASH: {data:?}");
|
||||
scalar
|
||||
}
|
||||
55
coins/monero/src/merkle.rs
Normal file
55
coins/monero/src/merkle.rs
Normal file
@@ -0,0 +1,55 @@
|
||||
use std_shims::vec::Vec;
|
||||
|
||||
use crate::hash;
|
||||
|
||||
pub(crate) fn merkle_root(root: [u8; 32], leafs: &[[u8; 32]]) -> [u8; 32] {
|
||||
match leafs.len() {
|
||||
0 => root,
|
||||
1 => hash(&[root, leafs[0]].concat()),
|
||||
_ => {
|
||||
let mut hashes = Vec::with_capacity(1 + leafs.len());
|
||||
hashes.push(root);
|
||||
hashes.extend(leafs);
|
||||
|
||||
// Monero preprocess this so the length is a power of 2
|
||||
let mut high_pow_2 = 4; // 4 is the lowest value this can be
|
||||
while high_pow_2 < hashes.len() {
|
||||
high_pow_2 *= 2;
|
||||
}
|
||||
let low_pow_2 = high_pow_2 / 2;
|
||||
|
||||
// Merge right-most hashes until we're at the low_pow_2
|
||||
{
|
||||
let overage = hashes.len() - low_pow_2;
|
||||
let mut rightmost = hashes.drain((low_pow_2 - overage) ..);
|
||||
// This is true since we took overage from beneath and above low_pow_2, taking twice as
|
||||
// many elements as overage
|
||||
debug_assert_eq!(rightmost.len() % 2, 0);
|
||||
|
||||
let mut paired_hashes = Vec::with_capacity(overage);
|
||||
while let Some(left) = rightmost.next() {
|
||||
let right = rightmost.next().unwrap();
|
||||
paired_hashes.push(hash(&[left.as_ref(), &right].concat()));
|
||||
}
|
||||
drop(rightmost);
|
||||
|
||||
hashes.extend(paired_hashes);
|
||||
assert_eq!(hashes.len(), low_pow_2);
|
||||
}
|
||||
|
||||
// Do a traditional pairing off
|
||||
let mut new_hashes = Vec::with_capacity(hashes.len() / 2);
|
||||
while hashes.len() > 1 {
|
||||
let mut i = 0;
|
||||
while i < hashes.len() {
|
||||
new_hashes.push(hash(&[hashes[i], hashes[i + 1]].concat()));
|
||||
i += 2;
|
||||
}
|
||||
|
||||
hashes = new_hashes;
|
||||
new_hashes = Vec::with_capacity(hashes.len() / 2);
|
||||
}
|
||||
hashes[0]
|
||||
}
|
||||
}
|
||||
}
|
||||
72
coins/monero/src/ring_signatures.rs
Normal file
72
coins/monero/src/ring_signatures.rs
Normal file
@@ -0,0 +1,72 @@
|
||||
use std_shims::{
|
||||
io::{self, *},
|
||||
vec::Vec,
|
||||
};
|
||||
|
||||
use zeroize::Zeroize;
|
||||
|
||||
use curve25519_dalek::{EdwardsPoint, Scalar};
|
||||
|
||||
use monero_generators::hash_to_point;
|
||||
|
||||
use crate::{serialize::*, hash_to_scalar};
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub struct Signature {
|
||||
c: Scalar,
|
||||
r: Scalar,
|
||||
}
|
||||
|
||||
impl Signature {
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
write_scalar(&self.c, w)?;
|
||||
write_scalar(&self.r, w)?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(r: &mut R) -> io::Result<Signature> {
|
||||
Ok(Signature { c: read_scalar(r)?, r: read_scalar(r)? })
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub struct RingSignature {
|
||||
sigs: Vec<Signature>,
|
||||
}
|
||||
|
||||
impl RingSignature {
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
for sig in &self.sigs {
|
||||
sig.write(w)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(members: usize, r: &mut R) -> io::Result<RingSignature> {
|
||||
Ok(RingSignature { sigs: read_raw_vec(Signature::read, members, r)? })
|
||||
}
|
||||
|
||||
pub fn verify(&self, msg: &[u8; 32], ring: &[EdwardsPoint], key_image: &EdwardsPoint) -> bool {
|
||||
if ring.len() != self.sigs.len() {
|
||||
return false;
|
||||
}
|
||||
|
||||
let mut buf = Vec::with_capacity(32 + (32 * 2 * ring.len()));
|
||||
buf.extend_from_slice(msg);
|
||||
|
||||
let mut sum = Scalar::ZERO;
|
||||
|
||||
for (ring_member, sig) in ring.iter().zip(&self.sigs) {
|
||||
#[allow(non_snake_case)]
|
||||
let Li = EdwardsPoint::vartime_double_scalar_mul_basepoint(&sig.c, ring_member, &sig.r);
|
||||
buf.extend_from_slice(Li.compress().as_bytes());
|
||||
#[allow(non_snake_case)]
|
||||
let Ri = (sig.r * hash_to_point(ring_member.compress().to_bytes())) + (sig.c * key_image);
|
||||
buf.extend_from_slice(Ri.compress().as_bytes());
|
||||
|
||||
sum += sig.c;
|
||||
}
|
||||
|
||||
sum == hash_to_scalar(&buf)
|
||||
}
|
||||
}
|
||||
97
coins/monero/src/ringct/borromean.rs
Normal file
97
coins/monero/src/ringct/borromean.rs
Normal file
@@ -0,0 +1,97 @@
|
||||
use core::fmt::Debug;
|
||||
use std_shims::io::{self, Read, Write};
|
||||
|
||||
use curve25519_dalek::{traits::Identity, Scalar, EdwardsPoint};
|
||||
|
||||
use monero_generators::H_pow_2;
|
||||
|
||||
use crate::{hash_to_scalar, unreduced_scalar::UnreducedScalar, serialize::*};
|
||||
|
||||
/// 64 Borromean ring signatures.
|
||||
///
|
||||
/// s0 and s1 are stored as `UnreducedScalar`s due to Monero not requiring they were reduced.
|
||||
/// `UnreducedScalar` preserves their original byte encoding and implements a custom reduction
|
||||
/// algorithm which was in use.
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct BorromeanSignatures {
|
||||
pub s0: [UnreducedScalar; 64],
|
||||
pub s1: [UnreducedScalar; 64],
|
||||
pub ee: Scalar,
|
||||
}
|
||||
|
||||
impl BorromeanSignatures {
|
||||
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanSignatures> {
|
||||
Ok(BorromeanSignatures {
|
||||
s0: read_array(UnreducedScalar::read, r)?,
|
||||
s1: read_array(UnreducedScalar::read, r)?,
|
||||
ee: read_scalar(r)?,
|
||||
})
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
for s0 in &self.s0 {
|
||||
s0.write(w)?;
|
||||
}
|
||||
for s1 in &self.s1 {
|
||||
s1.write(w)?;
|
||||
}
|
||||
write_scalar(&self.ee, w)
|
||||
}
|
||||
|
||||
fn verify(&self, keys_a: &[EdwardsPoint], keys_b: &[EdwardsPoint]) -> bool {
|
||||
let mut transcript = [0; 2048];
|
||||
|
||||
for i in 0 .. 64 {
|
||||
#[allow(non_snake_case)]
|
||||
let LL = EdwardsPoint::vartime_double_scalar_mul_basepoint(
|
||||
&self.ee,
|
||||
&keys_a[i],
|
||||
&self.s0[i].recover_monero_slide_scalar(),
|
||||
);
|
||||
#[allow(non_snake_case)]
|
||||
let LV = EdwardsPoint::vartime_double_scalar_mul_basepoint(
|
||||
&hash_to_scalar(LL.compress().as_bytes()),
|
||||
&keys_b[i],
|
||||
&self.s1[i].recover_monero_slide_scalar(),
|
||||
);
|
||||
transcript[(i * 32) .. ((i + 1) * 32)].copy_from_slice(LV.compress().as_bytes());
|
||||
}
|
||||
|
||||
hash_to_scalar(&transcript) == self.ee
|
||||
}
|
||||
}
|
||||
|
||||
/// A range proof premised on Borromean ring signatures.
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct BorromeanRange {
|
||||
pub sigs: BorromeanSignatures,
|
||||
pub bit_commitments: [EdwardsPoint; 64],
|
||||
}
|
||||
|
||||
impl BorromeanRange {
|
||||
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanRange> {
|
||||
Ok(BorromeanRange {
|
||||
sigs: BorromeanSignatures::read(r)?,
|
||||
bit_commitments: read_array(read_point, r)?,
|
||||
})
|
||||
}
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
self.sigs.write(w)?;
|
||||
write_raw_vec(write_point, &self.bit_commitments, w)
|
||||
}
|
||||
|
||||
pub fn verify(&self, commitment: &EdwardsPoint) -> bool {
|
||||
if &self.bit_commitments.iter().sum::<EdwardsPoint>() != commitment {
|
||||
return false;
|
||||
}
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
let H_pow_2 = H_pow_2();
|
||||
let mut commitments_sub_one = [EdwardsPoint::identity(); 64];
|
||||
for i in 0 .. 64 {
|
||||
commitments_sub_one[i] = self.bit_commitments[i] - H_pow_2[i];
|
||||
}
|
||||
|
||||
self.sigs.verify(&self.bit_commitments, &commitments_sub_one)
|
||||
}
|
||||
}
|
||||
151
coins/monero/src/ringct/bulletproofs/core.rs
Normal file
151
coins/monero/src/ringct/bulletproofs/core.rs
Normal file
@@ -0,0 +1,151 @@
|
||||
use std_shims::{vec::Vec, sync::OnceLock};
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use subtle::{Choice, ConditionallySelectable};
|
||||
|
||||
use curve25519_dalek::edwards::EdwardsPoint as DalekPoint;
|
||||
|
||||
use group::{ff::Field, Group};
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
|
||||
use multiexp::multiexp as multiexp_const;
|
||||
|
||||
pub(crate) use monero_generators::Generators;
|
||||
|
||||
use crate::{INV_EIGHT as DALEK_INV_EIGHT, H as DALEK_H, Commitment, hash_to_scalar as dalek_hash};
|
||||
pub(crate) use crate::ringct::bulletproofs::scalar_vector::*;
|
||||
|
||||
#[inline]
|
||||
pub(crate) fn INV_EIGHT() -> Scalar {
|
||||
Scalar(DALEK_INV_EIGHT())
|
||||
}
|
||||
|
||||
#[inline]
|
||||
pub(crate) fn H() -> EdwardsPoint {
|
||||
EdwardsPoint(DALEK_H())
|
||||
}
|
||||
|
||||
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||
Scalar(dalek_hash(data))
|
||||
}
|
||||
|
||||
// Components common between variants
|
||||
pub(crate) const MAX_M: usize = 16;
|
||||
pub(crate) const LOG_N: usize = 6; // 2 << 6 == N
|
||||
pub(crate) const N: usize = 64;
|
||||
|
||||
pub(crate) fn prove_multiexp(pairs: &[(Scalar, EdwardsPoint)]) -> EdwardsPoint {
|
||||
multiexp_const(pairs) * INV_EIGHT()
|
||||
}
|
||||
|
||||
pub(crate) fn vector_exponent(
|
||||
generators: &Generators,
|
||||
a: &ScalarVector,
|
||||
b: &ScalarVector,
|
||||
) -> EdwardsPoint {
|
||||
debug_assert_eq!(a.len(), b.len());
|
||||
(a * &generators.G[.. a.len()]) + (b * &generators.H[.. b.len()])
|
||||
}
|
||||
|
||||
pub(crate) fn hash_cache(cache: &mut Scalar, mash: &[[u8; 32]]) -> Scalar {
|
||||
let slice =
|
||||
&[cache.to_bytes().as_ref(), mash.iter().copied().flatten().collect::<Vec<_>>().as_ref()]
|
||||
.concat();
|
||||
*cache = hash_to_scalar(slice);
|
||||
*cache
|
||||
}
|
||||
|
||||
pub(crate) fn MN(outputs: usize) -> (usize, usize, usize) {
|
||||
let mut logM = 0;
|
||||
let mut M;
|
||||
while {
|
||||
M = 1 << logM;
|
||||
(M <= MAX_M) && (M < outputs)
|
||||
} {
|
||||
logM += 1;
|
||||
}
|
||||
|
||||
(logM + LOG_N, M, M * N)
|
||||
}
|
||||
|
||||
pub(crate) fn bit_decompose(commitments: &[Commitment]) -> (ScalarVector, ScalarVector) {
|
||||
let (_, M, MN) = MN(commitments.len());
|
||||
|
||||
let sv = commitments.iter().map(|c| Scalar::from(c.amount)).collect::<Vec<_>>();
|
||||
let mut aL = ScalarVector::new(MN);
|
||||
let mut aR = ScalarVector::new(MN);
|
||||
|
||||
for j in 0 .. M {
|
||||
for i in (0 .. N).rev() {
|
||||
let bit =
|
||||
if j < sv.len() { Choice::from((sv[j][i / 8] >> (i % 8)) & 1) } else { Choice::from(0) };
|
||||
aL.0[(j * N) + i] = Scalar::conditional_select(&Scalar::ZERO, &Scalar::ONE, bit);
|
||||
aR.0[(j * N) + i] = Scalar::conditional_select(&-Scalar::ONE, &Scalar::ZERO, bit);
|
||||
}
|
||||
}
|
||||
|
||||
(aL, aR)
|
||||
}
|
||||
|
||||
pub(crate) fn hash_commitments<C: IntoIterator<Item = DalekPoint>>(
|
||||
commitments: C,
|
||||
) -> (Scalar, Vec<EdwardsPoint>) {
|
||||
let V = commitments.into_iter().map(|c| EdwardsPoint(c) * INV_EIGHT()).collect::<Vec<_>>();
|
||||
(hash_to_scalar(&V.iter().flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>()), V)
|
||||
}
|
||||
|
||||
pub(crate) fn alpha_rho<R: RngCore + CryptoRng>(
|
||||
rng: &mut R,
|
||||
generators: &Generators,
|
||||
aL: &ScalarVector,
|
||||
aR: &ScalarVector,
|
||||
) -> (Scalar, EdwardsPoint) {
|
||||
let ar = Scalar::random(rng);
|
||||
(ar, (vector_exponent(generators, aL, aR) + (EdwardsPoint::generator() * ar)) * INV_EIGHT())
|
||||
}
|
||||
|
||||
pub(crate) fn LR_statements(
|
||||
a: &ScalarVector,
|
||||
G_i: &[EdwardsPoint],
|
||||
b: &ScalarVector,
|
||||
H_i: &[EdwardsPoint],
|
||||
cL: Scalar,
|
||||
U: EdwardsPoint,
|
||||
) -> Vec<(Scalar, EdwardsPoint)> {
|
||||
let mut res = a
|
||||
.0
|
||||
.iter()
|
||||
.copied()
|
||||
.zip(G_i.iter().copied())
|
||||
.chain(b.0.iter().copied().zip(H_i.iter().copied()))
|
||||
.collect::<Vec<_>>();
|
||||
res.push((cL, U));
|
||||
res
|
||||
}
|
||||
|
||||
static TWO_N_CELL: OnceLock<ScalarVector> = OnceLock::new();
|
||||
pub(crate) fn TWO_N() -> &'static ScalarVector {
|
||||
TWO_N_CELL.get_or_init(|| ScalarVector::powers(Scalar::from(2u8), N))
|
||||
}
|
||||
|
||||
pub(crate) fn challenge_products(w: &[Scalar], winv: &[Scalar]) -> Vec<Scalar> {
|
||||
let mut products = vec![Scalar::ZERO; 1 << w.len()];
|
||||
products[0] = winv[0];
|
||||
products[1] = w[0];
|
||||
for j in 1 .. w.len() {
|
||||
let mut slots = (1 << (j + 1)) - 1;
|
||||
while slots > 0 {
|
||||
products[slots] = products[slots / 2] * w[j];
|
||||
products[slots - 1] = products[slots / 2] * winv[j];
|
||||
slots = slots.saturating_sub(2);
|
||||
}
|
||||
}
|
||||
|
||||
// Sanity check as if the above failed to populate, it'd be critical
|
||||
for w in &products {
|
||||
debug_assert!(!bool::from(w.is_zero()));
|
||||
}
|
||||
|
||||
products
|
||||
}
|
||||
229
coins/monero/src/ringct/bulletproofs/mod.rs
Normal file
229
coins/monero/src/ringct/bulletproofs/mod.rs
Normal file
@@ -0,0 +1,229 @@
|
||||
#![allow(non_snake_case)]
|
||||
|
||||
use std_shims::{
|
||||
vec::Vec,
|
||||
io::{self, Read, Write},
|
||||
};
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use zeroize::{Zeroize, Zeroizing};
|
||||
|
||||
use curve25519_dalek::edwards::EdwardsPoint;
|
||||
use multiexp::BatchVerifier;
|
||||
|
||||
use crate::{Commitment, wallet::TransactionError, serialize::*};
|
||||
|
||||
pub(crate) mod scalar_vector;
|
||||
pub(crate) mod core;
|
||||
use self::core::LOG_N;
|
||||
|
||||
pub(crate) mod original;
|
||||
use self::original::OriginalStruct;
|
||||
|
||||
pub(crate) mod plus;
|
||||
use self::plus::*;
|
||||
|
||||
pub(crate) const MAX_OUTPUTS: usize = self::core::MAX_M;
|
||||
|
||||
/// Bulletproofs enum, supporting the original and plus formulations.
|
||||
#[allow(clippy::large_enum_variant)]
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub enum Bulletproofs {
|
||||
Original(OriginalStruct),
|
||||
Plus(AggregateRangeProof),
|
||||
}
|
||||
|
||||
impl Bulletproofs {
|
||||
fn bp_fields(plus: bool) -> usize {
|
||||
if plus {
|
||||
6
|
||||
} else {
|
||||
9
|
||||
}
|
||||
}
|
||||
|
||||
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
|
||||
// src/cryptonote_basic/cryptonote_format_utils.cpp#L106-L124
|
||||
pub(crate) fn calculate_bp_clawback(plus: bool, n_outputs: usize) -> (usize, usize) {
|
||||
#[allow(non_snake_case)]
|
||||
let mut LR_len = 0;
|
||||
let mut n_padded_outputs = 1;
|
||||
while n_padded_outputs < n_outputs {
|
||||
LR_len += 1;
|
||||
n_padded_outputs = 1 << LR_len;
|
||||
}
|
||||
LR_len += LOG_N;
|
||||
|
||||
let mut bp_clawback = 0;
|
||||
if n_padded_outputs > 2 {
|
||||
let fields = Bulletproofs::bp_fields(plus);
|
||||
let base = ((fields + (2 * (LOG_N + 1))) * 32) / 2;
|
||||
let size = (fields + (2 * LR_len)) * 32;
|
||||
bp_clawback = ((base * n_padded_outputs) - size) * 4 / 5;
|
||||
}
|
||||
|
||||
(bp_clawback, LR_len)
|
||||
}
|
||||
|
||||
pub(crate) fn fee_weight(plus: bool, outputs: usize) -> usize {
|
||||
#[allow(non_snake_case)]
|
||||
let (bp_clawback, LR_len) = Bulletproofs::calculate_bp_clawback(plus, outputs);
|
||||
32 * (Bulletproofs::bp_fields(plus) + (2 * LR_len)) + 2 + bp_clawback
|
||||
}
|
||||
|
||||
/// Prove the list of commitments are within [0 .. 2^64).
|
||||
pub fn prove<R: RngCore + CryptoRng>(
|
||||
rng: &mut R,
|
||||
outputs: &[Commitment],
|
||||
plus: bool,
|
||||
) -> Result<Bulletproofs, TransactionError> {
|
||||
if outputs.is_empty() {
|
||||
Err(TransactionError::NoOutputs)?;
|
||||
}
|
||||
if outputs.len() > MAX_OUTPUTS {
|
||||
Err(TransactionError::TooManyOutputs)?;
|
||||
}
|
||||
Ok(if !plus {
|
||||
Bulletproofs::Original(OriginalStruct::prove(rng, outputs))
|
||||
} else {
|
||||
use dalek_ff_group::EdwardsPoint as DfgPoint;
|
||||
Bulletproofs::Plus(
|
||||
AggregateRangeStatement::new(outputs.iter().map(|com| DfgPoint(com.calculate())).collect())
|
||||
.unwrap()
|
||||
.prove(rng, &Zeroizing::new(AggregateRangeWitness::new(outputs).unwrap()))
|
||||
.unwrap(),
|
||||
)
|
||||
})
|
||||
}
|
||||
|
||||
/// Verify the given Bulletproofs.
|
||||
#[must_use]
|
||||
pub fn verify<R: RngCore + CryptoRng>(&self, rng: &mut R, commitments: &[EdwardsPoint]) -> bool {
|
||||
match self {
|
||||
Bulletproofs::Original(bp) => bp.verify(rng, commitments),
|
||||
Bulletproofs::Plus(bp) => {
|
||||
let mut verifier = BatchVerifier::new(1);
|
||||
// If this commitment is torsioned (which is allowed), this won't be a well-formed
|
||||
// dfg::EdwardsPoint (expected to be of prime-order)
|
||||
// The actual BP+ impl will perform a torsion clear though, making this safe
|
||||
// TODO: Have AggregateRangeStatement take in dalek EdwardsPoint for clarity on this
|
||||
let Some(statement) = AggregateRangeStatement::new(
|
||||
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
|
||||
) else {
|
||||
return false;
|
||||
};
|
||||
if !statement.verify(rng, &mut verifier, (), bp.clone()) {
|
||||
return false;
|
||||
}
|
||||
verifier.verify_vartime()
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Accumulate the verification for the given Bulletproofs into the specified BatchVerifier.
|
||||
/// Returns false if the Bulletproofs aren't sane, without mutating the BatchVerifier.
|
||||
/// Returns true if the Bulletproofs are sane, regardless of their validity.
|
||||
#[must_use]
|
||||
pub fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||
&self,
|
||||
rng: &mut R,
|
||||
verifier: &mut BatchVerifier<ID, dalek_ff_group::EdwardsPoint>,
|
||||
id: ID,
|
||||
commitments: &[EdwardsPoint],
|
||||
) -> bool {
|
||||
match self {
|
||||
Bulletproofs::Original(bp) => bp.batch_verify(rng, verifier, id, commitments),
|
||||
Bulletproofs::Plus(bp) => {
|
||||
let Some(statement) = AggregateRangeStatement::new(
|
||||
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
|
||||
) else {
|
||||
return false;
|
||||
};
|
||||
statement.verify(rng, verifier, id, bp.clone())
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn write_core<W: Write, F: Fn(&[EdwardsPoint], &mut W) -> io::Result<()>>(
|
||||
&self,
|
||||
w: &mut W,
|
||||
specific_write_vec: F,
|
||||
) -> io::Result<()> {
|
||||
match self {
|
||||
Bulletproofs::Original(bp) => {
|
||||
write_point(&bp.A, w)?;
|
||||
write_point(&bp.S, w)?;
|
||||
write_point(&bp.T1, w)?;
|
||||
write_point(&bp.T2, w)?;
|
||||
write_scalar(&bp.taux, w)?;
|
||||
write_scalar(&bp.mu, w)?;
|
||||
specific_write_vec(&bp.L, w)?;
|
||||
specific_write_vec(&bp.R, w)?;
|
||||
write_scalar(&bp.a, w)?;
|
||||
write_scalar(&bp.b, w)?;
|
||||
write_scalar(&bp.t, w)
|
||||
}
|
||||
|
||||
Bulletproofs::Plus(bp) => {
|
||||
write_point(&bp.A.0, w)?;
|
||||
write_point(&bp.wip.A.0, w)?;
|
||||
write_point(&bp.wip.B.0, w)?;
|
||||
write_scalar(&bp.wip.r_answer.0, w)?;
|
||||
write_scalar(&bp.wip.s_answer.0, w)?;
|
||||
write_scalar(&bp.wip.delta_answer.0, w)?;
|
||||
specific_write_vec(&bp.wip.L.iter().copied().map(|L| L.0).collect::<Vec<_>>(), w)?;
|
||||
specific_write_vec(&bp.wip.R.iter().copied().map(|R| R.0).collect::<Vec<_>>(), w)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn signature_write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
self.write_core(w, |points, w| write_raw_vec(write_point, points, w))
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
self.write_core(w, |points, w| write_vec(write_point, points, w))
|
||||
}
|
||||
|
||||
pub fn serialize(&self) -> Vec<u8> {
|
||||
let mut serialized = vec![];
|
||||
self.write(&mut serialized).unwrap();
|
||||
serialized
|
||||
}
|
||||
|
||||
/// Read Bulletproofs.
|
||||
pub fn read<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
|
||||
Ok(Bulletproofs::Original(OriginalStruct {
|
||||
A: read_point(r)?,
|
||||
S: read_point(r)?,
|
||||
T1: read_point(r)?,
|
||||
T2: read_point(r)?,
|
||||
taux: read_scalar(r)?,
|
||||
mu: read_scalar(r)?,
|
||||
L: read_vec(read_point, r)?,
|
||||
R: read_vec(read_point, r)?,
|
||||
a: read_scalar(r)?,
|
||||
b: read_scalar(r)?,
|
||||
t: read_scalar(r)?,
|
||||
}))
|
||||
}
|
||||
|
||||
/// Read Bulletproofs+.
|
||||
pub fn read_plus<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
|
||||
use dalek_ff_group::{Scalar as DfgScalar, EdwardsPoint as DfgPoint};
|
||||
|
||||
Ok(Bulletproofs::Plus(AggregateRangeProof {
|
||||
A: DfgPoint(read_point(r)?),
|
||||
wip: WipProof {
|
||||
A: DfgPoint(read_point(r)?),
|
||||
B: DfgPoint(read_point(r)?),
|
||||
r_answer: DfgScalar(read_scalar(r)?),
|
||||
s_answer: DfgScalar(read_scalar(r)?),
|
||||
delta_answer: DfgScalar(read_scalar(r)?),
|
||||
L: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
|
||||
R: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
|
||||
},
|
||||
}))
|
||||
}
|
||||
}
|
||||
322
coins/monero/src/ringct/bulletproofs/original.rs
Normal file
322
coins/monero/src/ringct/bulletproofs/original.rs
Normal file
@@ -0,0 +1,322 @@
|
||||
use std_shims::{vec::Vec, sync::OnceLock};
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use zeroize::Zeroize;
|
||||
|
||||
use curve25519_dalek::{scalar::Scalar as DalekScalar, edwards::EdwardsPoint as DalekPoint};
|
||||
|
||||
use group::{ff::Field, Group};
|
||||
use dalek_ff_group::{ED25519_BASEPOINT_POINT as G, Scalar, EdwardsPoint};
|
||||
|
||||
use multiexp::{BatchVerifier, multiexp};
|
||||
|
||||
use crate::{Commitment, ringct::bulletproofs::core::*};
|
||||
|
||||
include!(concat!(env!("OUT_DIR"), "/generators.rs"));
|
||||
|
||||
static IP12_CELL: OnceLock<Scalar> = OnceLock::new();
|
||||
pub(crate) fn IP12() -> Scalar {
|
||||
*IP12_CELL.get_or_init(|| ScalarVector(vec![Scalar::ONE; N]).inner_product(TWO_N()))
|
||||
}
|
||||
|
||||
pub(crate) fn hadamard_fold(
|
||||
l: &[EdwardsPoint],
|
||||
r: &[EdwardsPoint],
|
||||
a: Scalar,
|
||||
b: Scalar,
|
||||
) -> Vec<EdwardsPoint> {
|
||||
let mut res = Vec::with_capacity(l.len() / 2);
|
||||
for i in 0 .. l.len() {
|
||||
res.push(multiexp(&[(a, l[i]), (b, r[i])]));
|
||||
}
|
||||
res
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct OriginalStruct {
|
||||
pub(crate) A: DalekPoint,
|
||||
pub(crate) S: DalekPoint,
|
||||
pub(crate) T1: DalekPoint,
|
||||
pub(crate) T2: DalekPoint,
|
||||
pub(crate) taux: DalekScalar,
|
||||
pub(crate) mu: DalekScalar,
|
||||
pub(crate) L: Vec<DalekPoint>,
|
||||
pub(crate) R: Vec<DalekPoint>,
|
||||
pub(crate) a: DalekScalar,
|
||||
pub(crate) b: DalekScalar,
|
||||
pub(crate) t: DalekScalar,
|
||||
}
|
||||
|
||||
impl OriginalStruct {
|
||||
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||
rng: &mut R,
|
||||
commitments: &[Commitment],
|
||||
) -> OriginalStruct {
|
||||
let (logMN, M, MN) = MN(commitments.len());
|
||||
|
||||
let (aL, aR) = bit_decompose(commitments);
|
||||
let commitments_points = commitments.iter().map(Commitment::calculate).collect::<Vec<_>>();
|
||||
let (mut cache, _) = hash_commitments(commitments_points.clone());
|
||||
|
||||
let (sL, sR) =
|
||||
ScalarVector((0 .. (MN * 2)).map(|_| Scalar::random(&mut *rng)).collect::<Vec<_>>()).split();
|
||||
|
||||
let generators = GENERATORS();
|
||||
let (mut alpha, A) = alpha_rho(&mut *rng, generators, &aL, &aR);
|
||||
let (mut rho, S) = alpha_rho(&mut *rng, generators, &sL, &sR);
|
||||
|
||||
let y = hash_cache(&mut cache, &[A.compress().to_bytes(), S.compress().to_bytes()]);
|
||||
let mut cache = hash_to_scalar(&y.to_bytes());
|
||||
let z = cache;
|
||||
|
||||
let l0 = aL - z;
|
||||
let l1 = sL;
|
||||
|
||||
let mut zero_twos = Vec::with_capacity(MN);
|
||||
let zpow = ScalarVector::powers(z, M + 2);
|
||||
for j in 0 .. M {
|
||||
for i in 0 .. N {
|
||||
zero_twos.push(zpow[j + 2] * TWO_N()[i]);
|
||||
}
|
||||
}
|
||||
|
||||
let yMN = ScalarVector::powers(y, MN);
|
||||
let r0 = ((aR + z) * &yMN) + &ScalarVector(zero_twos);
|
||||
let r1 = yMN * &sR;
|
||||
|
||||
let (T1, T2, x, mut taux) = {
|
||||
let t1 = l0.clone().inner_product(&r1) + r0.clone().inner_product(&l1);
|
||||
let t2 = l1.clone().inner_product(&r1);
|
||||
|
||||
let mut tau1 = Scalar::random(&mut *rng);
|
||||
let mut tau2 = Scalar::random(&mut *rng);
|
||||
|
||||
let T1 = prove_multiexp(&[(t1, H()), (tau1, EdwardsPoint::generator())]);
|
||||
let T2 = prove_multiexp(&[(t2, H()), (tau2, EdwardsPoint::generator())]);
|
||||
|
||||
let x =
|
||||
hash_cache(&mut cache, &[z.to_bytes(), T1.compress().to_bytes(), T2.compress().to_bytes()]);
|
||||
|
||||
let taux = (tau2 * (x * x)) + (tau1 * x);
|
||||
|
||||
tau1.zeroize();
|
||||
tau2.zeroize();
|
||||
(T1, T2, x, taux)
|
||||
};
|
||||
|
||||
let mu = (x * rho) + alpha;
|
||||
alpha.zeroize();
|
||||
rho.zeroize();
|
||||
|
||||
for (i, gamma) in commitments.iter().map(|c| Scalar(c.mask)).enumerate() {
|
||||
taux += zpow[i + 2] * gamma;
|
||||
}
|
||||
|
||||
let l = l0 + &(l1 * x);
|
||||
let r = r0 + &(r1 * x);
|
||||
|
||||
let t = l.clone().inner_product(&r);
|
||||
|
||||
let x_ip =
|
||||
hash_cache(&mut cache, &[x.to_bytes(), taux.to_bytes(), mu.to_bytes(), t.to_bytes()]);
|
||||
|
||||
let mut a = l;
|
||||
let mut b = r;
|
||||
|
||||
let yinv = y.invert().unwrap();
|
||||
let yinvpow = ScalarVector::powers(yinv, MN);
|
||||
|
||||
let mut G_proof = generators.G[.. a.len()].to_vec();
|
||||
let mut H_proof = generators.H[.. a.len()].to_vec();
|
||||
H_proof.iter_mut().zip(yinvpow.0.iter()).for_each(|(this_H, yinvpow)| *this_H *= yinvpow);
|
||||
let U = H() * x_ip;
|
||||
|
||||
let mut L = Vec::with_capacity(logMN);
|
||||
let mut R = Vec::with_capacity(logMN);
|
||||
|
||||
while a.len() != 1 {
|
||||
let (aL, aR) = a.split();
|
||||
let (bL, bR) = b.split();
|
||||
|
||||
let cL = aL.clone().inner_product(&bR);
|
||||
let cR = aR.clone().inner_product(&bL);
|
||||
|
||||
let (G_L, G_R) = G_proof.split_at(aL.len());
|
||||
let (H_L, H_R) = H_proof.split_at(aL.len());
|
||||
|
||||
let L_i = prove_multiexp(&LR_statements(&aL, G_R, &bR, H_L, cL, U));
|
||||
let R_i = prove_multiexp(&LR_statements(&aR, G_L, &bL, H_R, cR, U));
|
||||
L.push(L_i);
|
||||
R.push(R_i);
|
||||
|
||||
let w = hash_cache(&mut cache, &[L_i.compress().to_bytes(), R_i.compress().to_bytes()]);
|
||||
let winv = w.invert().unwrap();
|
||||
|
||||
a = (aL * w) + &(aR * winv);
|
||||
b = (bL * winv) + &(bR * w);
|
||||
|
||||
if a.len() != 1 {
|
||||
G_proof = hadamard_fold(G_L, G_R, winv, w);
|
||||
H_proof = hadamard_fold(H_L, H_R, w, winv);
|
||||
}
|
||||
}
|
||||
|
||||
let res = OriginalStruct {
|
||||
A: *A,
|
||||
S: *S,
|
||||
T1: *T1,
|
||||
T2: *T2,
|
||||
taux: *taux,
|
||||
mu: *mu,
|
||||
L: L.drain(..).map(|L| *L).collect(),
|
||||
R: R.drain(..).map(|R| *R).collect(),
|
||||
a: *a[0],
|
||||
b: *b[0],
|
||||
t: *t,
|
||||
};
|
||||
debug_assert!(res.verify(rng, &commitments_points));
|
||||
res
|
||||
}
|
||||
|
||||
#[must_use]
|
||||
fn verify_core<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||
&self,
|
||||
rng: &mut R,
|
||||
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
|
||||
id: ID,
|
||||
commitments: &[DalekPoint],
|
||||
) -> bool {
|
||||
// Verify commitments are valid
|
||||
if commitments.is_empty() || (commitments.len() > MAX_M) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Verify L and R are properly sized
|
||||
if self.L.len() != self.R.len() {
|
||||
return false;
|
||||
}
|
||||
|
||||
let (logMN, M, MN) = MN(commitments.len());
|
||||
if self.L.len() != logMN {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Rebuild all challenges
|
||||
let (mut cache, commitments) = hash_commitments(commitments.iter().copied());
|
||||
let y = hash_cache(&mut cache, &[self.A.compress().to_bytes(), self.S.compress().to_bytes()]);
|
||||
|
||||
let z = hash_to_scalar(&y.to_bytes());
|
||||
cache = z;
|
||||
|
||||
let x = hash_cache(
|
||||
&mut cache,
|
||||
&[z.to_bytes(), self.T1.compress().to_bytes(), self.T2.compress().to_bytes()],
|
||||
);
|
||||
|
||||
let x_ip = hash_cache(
|
||||
&mut cache,
|
||||
&[x.to_bytes(), self.taux.to_bytes(), self.mu.to_bytes(), self.t.to_bytes()],
|
||||
);
|
||||
|
||||
let mut w = Vec::with_capacity(logMN);
|
||||
let mut winv = Vec::with_capacity(logMN);
|
||||
for (L, R) in self.L.iter().zip(&self.R) {
|
||||
w.push(hash_cache(&mut cache, &[L.compress().to_bytes(), R.compress().to_bytes()]));
|
||||
winv.push(cache.invert().unwrap());
|
||||
}
|
||||
|
||||
// Convert the proof from * INV_EIGHT to its actual form
|
||||
let normalize = |point: &DalekPoint| EdwardsPoint(point.mul_by_cofactor());
|
||||
|
||||
let L = self.L.iter().map(normalize).collect::<Vec<_>>();
|
||||
let R = self.R.iter().map(normalize).collect::<Vec<_>>();
|
||||
let T1 = normalize(&self.T1);
|
||||
let T2 = normalize(&self.T2);
|
||||
let A = normalize(&self.A);
|
||||
let S = normalize(&self.S);
|
||||
|
||||
let commitments = commitments.iter().map(EdwardsPoint::mul_by_cofactor).collect::<Vec<_>>();
|
||||
|
||||
// Verify it
|
||||
let mut proof = Vec::with_capacity(4 + commitments.len());
|
||||
|
||||
let zpow = ScalarVector::powers(z, M + 3);
|
||||
let ip1y = ScalarVector::powers(y, M * N).sum();
|
||||
let mut k = -(zpow[2] * ip1y);
|
||||
for j in 1 ..= M {
|
||||
k -= zpow[j + 2] * IP12();
|
||||
}
|
||||
let y1 = Scalar(self.t) - ((z * ip1y) + k);
|
||||
proof.push((-y1, H()));
|
||||
|
||||
proof.push((-Scalar(self.taux), G));
|
||||
|
||||
for (j, commitment) in commitments.iter().enumerate() {
|
||||
proof.push((zpow[j + 2], *commitment));
|
||||
}
|
||||
|
||||
proof.push((x, T1));
|
||||
proof.push((x * x, T2));
|
||||
verifier.queue(&mut *rng, id, proof);
|
||||
|
||||
proof = Vec::with_capacity(4 + (2 * (MN + logMN)));
|
||||
let z3 = (Scalar(self.t) - (Scalar(self.a) * Scalar(self.b))) * x_ip;
|
||||
proof.push((z3, H()));
|
||||
proof.push((-Scalar(self.mu), G));
|
||||
|
||||
proof.push((Scalar::ONE, A));
|
||||
proof.push((x, S));
|
||||
|
||||
{
|
||||
let ypow = ScalarVector::powers(y, MN);
|
||||
let yinv = y.invert().unwrap();
|
||||
let yinvpow = ScalarVector::powers(yinv, MN);
|
||||
|
||||
let w_cache = challenge_products(&w, &winv);
|
||||
|
||||
let generators = GENERATORS();
|
||||
for i in 0 .. MN {
|
||||
let g = (Scalar(self.a) * w_cache[i]) + z;
|
||||
proof.push((-g, generators.G[i]));
|
||||
|
||||
let mut h = Scalar(self.b) * yinvpow[i] * w_cache[(!i) & (MN - 1)];
|
||||
h -= ((zpow[(i / N) + 2] * TWO_N()[i % N]) + (z * ypow[i])) * yinvpow[i];
|
||||
proof.push((-h, generators.H[i]));
|
||||
}
|
||||
}
|
||||
|
||||
for i in 0 .. logMN {
|
||||
proof.push((w[i] * w[i], L[i]));
|
||||
proof.push((winv[i] * winv[i], R[i]));
|
||||
}
|
||||
verifier.queue(rng, id, proof);
|
||||
|
||||
true
|
||||
}
|
||||
|
||||
#[must_use]
|
||||
pub(crate) fn verify<R: RngCore + CryptoRng>(
|
||||
&self,
|
||||
rng: &mut R,
|
||||
commitments: &[DalekPoint],
|
||||
) -> bool {
|
||||
let mut verifier = BatchVerifier::new(1);
|
||||
if self.verify_core(rng, &mut verifier, (), commitments) {
|
||||
verifier.verify_vartime()
|
||||
} else {
|
||||
false
|
||||
}
|
||||
}
|
||||
|
||||
#[must_use]
|
||||
pub(crate) fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||
&self,
|
||||
rng: &mut R,
|
||||
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
|
||||
id: ID,
|
||||
commitments: &[DalekPoint],
|
||||
) -> bool {
|
||||
self.verify_core(rng, verifier, id, commitments)
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,257 @@
|
||||
use std_shims::vec::Vec;
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
|
||||
|
||||
use multiexp::{multiexp, multiexp_vartime, BatchVerifier};
|
||||
use group::{
|
||||
ff::{Field, PrimeField},
|
||||
Group, GroupEncoding,
|
||||
};
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
|
||||
use crate::{
|
||||
Commitment,
|
||||
ringct::{
|
||||
bulletproofs::core::{MAX_M, N},
|
||||
bulletproofs::plus::{
|
||||
ScalarVector, PointVector, GeneratorsList, Generators,
|
||||
transcript::*,
|
||||
weighted_inner_product::{WipStatement, WipWitness, WipProof},
|
||||
padded_pow_of_2, u64_decompose,
|
||||
},
|
||||
},
|
||||
};
|
||||
|
||||
// Figure 3
|
||||
#[derive(Clone, Debug)]
|
||||
pub(crate) struct AggregateRangeStatement {
|
||||
generators: Generators,
|
||||
V: Vec<EdwardsPoint>,
|
||||
}
|
||||
|
||||
impl Zeroize for AggregateRangeStatement {
|
||||
fn zeroize(&mut self) {
|
||||
self.V.zeroize();
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
||||
pub(crate) struct AggregateRangeWitness {
|
||||
values: Vec<u64>,
|
||||
gammas: Vec<Scalar>,
|
||||
}
|
||||
|
||||
impl AggregateRangeWitness {
|
||||
pub(crate) fn new(commitments: &[Commitment]) -> Option<Self> {
|
||||
if commitments.is_empty() || (commitments.len() > MAX_M) {
|
||||
return None;
|
||||
}
|
||||
|
||||
let mut values = Vec::with_capacity(commitments.len());
|
||||
let mut gammas = Vec::with_capacity(commitments.len());
|
||||
for commitment in commitments {
|
||||
values.push(commitment.amount);
|
||||
gammas.push(Scalar(commitment.mask));
|
||||
}
|
||||
Some(AggregateRangeWitness { values, gammas })
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub struct AggregateRangeProof {
|
||||
pub(crate) A: EdwardsPoint,
|
||||
pub(crate) wip: WipProof,
|
||||
}
|
||||
|
||||
impl AggregateRangeStatement {
|
||||
pub(crate) fn new(V: Vec<EdwardsPoint>) -> Option<Self> {
|
||||
if V.is_empty() || (V.len() > MAX_M) {
|
||||
return None;
|
||||
}
|
||||
|
||||
Some(Self { generators: Generators::new(), V })
|
||||
}
|
||||
|
||||
fn transcript_A(transcript: &mut Scalar, A: EdwardsPoint) -> (Scalar, Scalar) {
|
||||
let y = hash_to_scalar(&[transcript.to_repr().as_ref(), A.to_bytes().as_ref()].concat());
|
||||
let z = hash_to_scalar(y.to_bytes().as_ref());
|
||||
*transcript = z;
|
||||
(y, z)
|
||||
}
|
||||
|
||||
fn d_j(j: usize, m: usize) -> ScalarVector {
|
||||
let mut d_j = Vec::with_capacity(m * N);
|
||||
for _ in 0 .. (j - 1) * N {
|
||||
d_j.push(Scalar::ZERO);
|
||||
}
|
||||
d_j.append(&mut ScalarVector::powers(Scalar::from(2u8), N).0);
|
||||
for _ in 0 .. (m - j) * N {
|
||||
d_j.push(Scalar::ZERO);
|
||||
}
|
||||
ScalarVector(d_j)
|
||||
}
|
||||
|
||||
fn compute_A_hat(
|
||||
mut V: PointVector,
|
||||
generators: &Generators,
|
||||
transcript: &mut Scalar,
|
||||
mut A: EdwardsPoint,
|
||||
) -> (Scalar, ScalarVector, Scalar, Scalar, ScalarVector, EdwardsPoint) {
|
||||
let (y, z) = Self::transcript_A(transcript, A);
|
||||
A = A.mul_by_cofactor();
|
||||
|
||||
while V.len() < padded_pow_of_2(V.len()) {
|
||||
V.0.push(EdwardsPoint::identity());
|
||||
}
|
||||
let mn = V.len() * N;
|
||||
|
||||
let mut z_pow = Vec::with_capacity(V.len());
|
||||
|
||||
let mut d = ScalarVector::new(mn);
|
||||
for j in 1 ..= V.len() {
|
||||
z_pow.push(z.pow(Scalar::from(2 * u64::try_from(j).unwrap()))); // TODO: Optimize this
|
||||
d = d + &(Self::d_j(j, V.len()) * (z_pow[j - 1]));
|
||||
}
|
||||
|
||||
let mut ascending_y = ScalarVector(vec![y]);
|
||||
for i in 1 .. d.len() {
|
||||
ascending_y.0.push(ascending_y[i - 1] * y);
|
||||
}
|
||||
let y_pows = ascending_y.clone().sum();
|
||||
|
||||
let mut descending_y = ascending_y.clone();
|
||||
descending_y.0.reverse();
|
||||
|
||||
let d_descending_y = d.clone() * &descending_y;
|
||||
let d_descending_y_plus_z = d_descending_y + z;
|
||||
|
||||
let y_mn_plus_one = descending_y[0] * y;
|
||||
|
||||
let mut commitment_accum = EdwardsPoint::identity();
|
||||
for (j, commitment) in V.0.iter().enumerate() {
|
||||
commitment_accum += *commitment * z_pow[j];
|
||||
}
|
||||
|
||||
let neg_z = -z;
|
||||
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 2);
|
||||
for (i, d_y_z) in d_descending_y_plus_z.0.iter().enumerate() {
|
||||
A_terms.push((neg_z, generators.generator(GeneratorsList::GBold1, i)));
|
||||
A_terms.push((*d_y_z, generators.generator(GeneratorsList::HBold1, i)));
|
||||
}
|
||||
A_terms.push((y_mn_plus_one, commitment_accum));
|
||||
A_terms.push((
|
||||
((y_pows * z) - (d.sum() * y_mn_plus_one * z) - (y_pows * z.square())),
|
||||
Generators::g(),
|
||||
));
|
||||
|
||||
(
|
||||
y,
|
||||
d_descending_y_plus_z,
|
||||
y_mn_plus_one,
|
||||
z,
|
||||
ScalarVector(z_pow),
|
||||
A + multiexp_vartime(&A_terms),
|
||||
)
|
||||
}
|
||||
|
||||
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||
self,
|
||||
rng: &mut R,
|
||||
witness: &AggregateRangeWitness,
|
||||
) -> Option<AggregateRangeProof> {
|
||||
// Check for consistency with the witness
|
||||
if self.V.len() != witness.values.len() {
|
||||
return None;
|
||||
}
|
||||
for (commitment, (value, gamma)) in
|
||||
self.V.iter().zip(witness.values.iter().zip(witness.gammas.iter()))
|
||||
{
|
||||
if Commitment::new(**gamma, *value).calculate() != **commitment {
|
||||
return None;
|
||||
}
|
||||
}
|
||||
|
||||
let Self { generators, V } = self;
|
||||
// Monero expects all of these points to be torsion-free
|
||||
// Generally, for Bulletproofs, it sends points * INV_EIGHT and then performs a torsion clear
|
||||
// by multiplying by 8
|
||||
// This also restores the original value due to the preprocessing
|
||||
// Commitments aren't transmitted INV_EIGHT though, so this multiplies by INV_EIGHT to enable
|
||||
// clearing its cofactor without mutating the value
|
||||
// For some reason, these values are transcripted * INV_EIGHT, not as transmitted
|
||||
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
|
||||
let mut transcript = initial_transcript(V.iter());
|
||||
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
|
||||
|
||||
// Pad V
|
||||
while V.len() < padded_pow_of_2(V.len()) {
|
||||
V.push(EdwardsPoint::identity());
|
||||
}
|
||||
|
||||
let generators = generators.reduce(V.len() * N);
|
||||
|
||||
let mut d_js = Vec::with_capacity(V.len());
|
||||
let mut a_l = ScalarVector(Vec::with_capacity(V.len() * N));
|
||||
for j in 1 ..= V.len() {
|
||||
d_js.push(Self::d_j(j, V.len()));
|
||||
a_l.0.append(&mut u64_decompose(*witness.values.get(j - 1).unwrap_or(&0)).0);
|
||||
}
|
||||
|
||||
let a_r = a_l.clone() - Scalar::ONE;
|
||||
|
||||
let alpha = Scalar::random(&mut *rng);
|
||||
|
||||
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 1);
|
||||
for (i, a_l) in a_l.0.iter().enumerate() {
|
||||
A_terms.push((*a_l, generators.generator(GeneratorsList::GBold1, i)));
|
||||
}
|
||||
for (i, a_r) in a_r.0.iter().enumerate() {
|
||||
A_terms.push((*a_r, generators.generator(GeneratorsList::HBold1, i)));
|
||||
}
|
||||
A_terms.push((alpha, Generators::h()));
|
||||
let mut A = multiexp(&A_terms);
|
||||
A_terms.zeroize();
|
||||
|
||||
// Multiply by INV_EIGHT per earlier commentary
|
||||
A.0 *= crate::INV_EIGHT();
|
||||
|
||||
let (y, d_descending_y_plus_z, y_mn_plus_one, z, z_pow, A_hat) =
|
||||
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, A);
|
||||
|
||||
let a_l = a_l - z;
|
||||
let a_r = a_r + &d_descending_y_plus_z;
|
||||
let mut alpha = alpha;
|
||||
for j in 1 ..= witness.gammas.len() {
|
||||
alpha += z_pow[j - 1] * witness.gammas[j - 1] * y_mn_plus_one;
|
||||
}
|
||||
|
||||
Some(AggregateRangeProof {
|
||||
A,
|
||||
wip: WipStatement::new(generators, A_hat, y)
|
||||
.prove(rng, transcript, &Zeroizing::new(WipWitness::new(a_l, a_r, alpha).unwrap()))
|
||||
.unwrap(),
|
||||
})
|
||||
}
|
||||
|
||||
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||
self,
|
||||
rng: &mut R,
|
||||
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
|
||||
id: Id,
|
||||
proof: AggregateRangeProof,
|
||||
) -> bool {
|
||||
let Self { generators, V } = self;
|
||||
|
||||
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
|
||||
let mut transcript = initial_transcript(V.iter());
|
||||
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
|
||||
|
||||
let generators = generators.reduce(V.len() * N);
|
||||
|
||||
let (y, _, _, _, _, A_hat) =
|
||||
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, proof.A);
|
||||
WipStatement::new(generators, A_hat, y).verify(rng, verifier, id, transcript, proof.wip)
|
||||
}
|
||||
}
|
||||
85
coins/monero/src/ringct/bulletproofs/plus/mod.rs
Normal file
85
coins/monero/src/ringct/bulletproofs/plus/mod.rs
Normal file
@@ -0,0 +1,85 @@
|
||||
#![allow(non_snake_case)]
|
||||
|
||||
use group::Group;
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
|
||||
pub(crate) use crate::ringct::bulletproofs::scalar_vector::ScalarVector;
|
||||
mod point_vector;
|
||||
pub(crate) use point_vector::PointVector;
|
||||
|
||||
pub(crate) mod transcript;
|
||||
pub(crate) mod weighted_inner_product;
|
||||
pub(crate) use weighted_inner_product::*;
|
||||
pub(crate) mod aggregate_range_proof;
|
||||
pub(crate) use aggregate_range_proof::*;
|
||||
|
||||
pub(crate) fn padded_pow_of_2(i: usize) -> usize {
|
||||
let mut next_pow_of_2 = 1;
|
||||
while next_pow_of_2 < i {
|
||||
next_pow_of_2 <<= 1;
|
||||
}
|
||||
next_pow_of_2
|
||||
}
|
||||
|
||||
#[derive(Clone, Copy, PartialEq, Eq, Hash, Debug)]
|
||||
pub(crate) enum GeneratorsList {
|
||||
GBold1,
|
||||
HBold1,
|
||||
}
|
||||
|
||||
// TODO: Table these
|
||||
#[derive(Clone, Debug)]
|
||||
pub(crate) struct Generators {
|
||||
g_bold1: &'static [EdwardsPoint],
|
||||
h_bold1: &'static [EdwardsPoint],
|
||||
}
|
||||
|
||||
mod generators {
|
||||
use std_shims::sync::OnceLock;
|
||||
use monero_generators::Generators;
|
||||
include!(concat!(env!("OUT_DIR"), "/generators_plus.rs"));
|
||||
}
|
||||
|
||||
impl Generators {
|
||||
#[allow(clippy::new_without_default)]
|
||||
pub(crate) fn new() -> Self {
|
||||
let gens = generators::GENERATORS();
|
||||
Generators { g_bold1: &gens.G, h_bold1: &gens.H }
|
||||
}
|
||||
|
||||
pub(crate) fn len(&self) -> usize {
|
||||
self.g_bold1.len()
|
||||
}
|
||||
|
||||
pub(crate) fn g() -> EdwardsPoint {
|
||||
dalek_ff_group::EdwardsPoint(crate::H())
|
||||
}
|
||||
|
||||
pub(crate) fn h() -> EdwardsPoint {
|
||||
EdwardsPoint::generator()
|
||||
}
|
||||
|
||||
pub(crate) fn generator(&self, list: GeneratorsList, i: usize) -> EdwardsPoint {
|
||||
match list {
|
||||
GeneratorsList::GBold1 => self.g_bold1[i],
|
||||
GeneratorsList::HBold1 => self.h_bold1[i],
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn reduce(&self, generators: usize) -> Self {
|
||||
// Round to the nearest power of 2
|
||||
let generators = padded_pow_of_2(generators);
|
||||
assert!(generators <= self.g_bold1.len());
|
||||
|
||||
Generators { g_bold1: &self.g_bold1[.. generators], h_bold1: &self.h_bold1[.. generators] }
|
||||
}
|
||||
}
|
||||
|
||||
// Returns the little-endian decomposition.
|
||||
fn u64_decompose(value: u64) -> ScalarVector {
|
||||
let mut bits = ScalarVector::new(64);
|
||||
for bit in 0 .. 64 {
|
||||
bits[bit] = Scalar::from((value >> bit) & 1);
|
||||
}
|
||||
bits
|
||||
}
|
||||
50
coins/monero/src/ringct/bulletproofs/plus/point_vector.rs
Normal file
50
coins/monero/src/ringct/bulletproofs/plus/point_vector.rs
Normal file
@@ -0,0 +1,50 @@
|
||||
use core::ops::{Index, IndexMut};
|
||||
use std_shims::vec::Vec;
|
||||
|
||||
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||
|
||||
use dalek_ff_group::EdwardsPoint;
|
||||
|
||||
#[cfg(test)]
|
||||
use multiexp::multiexp;
|
||||
#[cfg(test)]
|
||||
use crate::ringct::bulletproofs::plus::ScalarVector;
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
||||
pub(crate) struct PointVector(pub(crate) Vec<EdwardsPoint>);
|
||||
|
||||
impl Index<usize> for PointVector {
|
||||
type Output = EdwardsPoint;
|
||||
fn index(&self, index: usize) -> &EdwardsPoint {
|
||||
&self.0[index]
|
||||
}
|
||||
}
|
||||
|
||||
impl IndexMut<usize> for PointVector {
|
||||
fn index_mut(&mut self, index: usize) -> &mut EdwardsPoint {
|
||||
&mut self.0[index]
|
||||
}
|
||||
}
|
||||
|
||||
impl PointVector {
|
||||
#[cfg(test)]
|
||||
pub(crate) fn multiexp(&self, vector: &ScalarVector) -> EdwardsPoint {
|
||||
debug_assert_eq!(self.len(), vector.len());
|
||||
let mut res = Vec::with_capacity(self.len());
|
||||
for (point, scalar) in self.0.iter().copied().zip(vector.0.iter().copied()) {
|
||||
res.push((scalar, point));
|
||||
}
|
||||
multiexp(&res)
|
||||
}
|
||||
|
||||
pub(crate) fn len(&self) -> usize {
|
||||
self.0.len()
|
||||
}
|
||||
|
||||
pub(crate) fn split(mut self) -> (Self, Self) {
|
||||
debug_assert!(self.len() > 1);
|
||||
let r = self.0.split_off(self.0.len() / 2);
|
||||
debug_assert_eq!(self.len(), r.len());
|
||||
(self, PointVector(r))
|
||||
}
|
||||
}
|
||||
24
coins/monero/src/ringct/bulletproofs/plus/transcript.rs
Normal file
24
coins/monero/src/ringct/bulletproofs/plus/transcript.rs
Normal file
@@ -0,0 +1,24 @@
|
||||
use std_shims::{sync::OnceLock, vec::Vec};
|
||||
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
|
||||
use monero_generators::{hash_to_point as raw_hash_to_point};
|
||||
use crate::{hash, hash_to_scalar as dalek_hash};
|
||||
|
||||
// Monero starts BP+ transcripts with the following constant.
|
||||
static TRANSCRIPT_CELL: OnceLock<[u8; 32]> = OnceLock::new();
|
||||
pub(crate) fn TRANSCRIPT() -> [u8; 32] {
|
||||
// Why this uses a hash_to_point is completely unknown.
|
||||
*TRANSCRIPT_CELL
|
||||
.get_or_init(|| raw_hash_to_point(hash(b"bulletproof_plus_transcript")).compress().to_bytes())
|
||||
}
|
||||
|
||||
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||
Scalar(dalek_hash(data))
|
||||
}
|
||||
|
||||
pub(crate) fn initial_transcript(commitments: core::slice::Iter<'_, EdwardsPoint>) -> Scalar {
|
||||
let commitments_hash =
|
||||
hash_to_scalar(&commitments.flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>());
|
||||
hash_to_scalar(&[TRANSCRIPT().as_ref(), &commitments_hash.to_bytes()].concat())
|
||||
}
|
||||
@@ -0,0 +1,444 @@
|
||||
use std_shims::vec::Vec;
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||
|
||||
use multiexp::{BatchVerifier, multiexp, multiexp_vartime};
|
||||
use group::{
|
||||
ff::{Field, PrimeField},
|
||||
GroupEncoding,
|
||||
};
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
|
||||
use crate::ringct::bulletproofs::plus::{
|
||||
ScalarVector, PointVector, GeneratorsList, Generators, padded_pow_of_2, transcript::*,
|
||||
};
|
||||
|
||||
// Figure 1
|
||||
#[derive(Clone, Debug)]
|
||||
pub(crate) struct WipStatement {
|
||||
generators: Generators,
|
||||
P: EdwardsPoint,
|
||||
y: ScalarVector,
|
||||
}
|
||||
|
||||
impl Zeroize for WipStatement {
|
||||
fn zeroize(&mut self) {
|
||||
self.P.zeroize();
|
||||
self.y.zeroize();
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
||||
pub(crate) struct WipWitness {
|
||||
a: ScalarVector,
|
||||
b: ScalarVector,
|
||||
alpha: Scalar,
|
||||
}
|
||||
|
||||
impl WipWitness {
|
||||
pub(crate) fn new(mut a: ScalarVector, mut b: ScalarVector, alpha: Scalar) -> Option<Self> {
|
||||
if a.0.is_empty() || (a.len() != b.len()) {
|
||||
return None;
|
||||
}
|
||||
|
||||
// Pad to the nearest power of 2
|
||||
let missing = padded_pow_of_2(a.len()) - a.len();
|
||||
a.0.reserve(missing);
|
||||
b.0.reserve(missing);
|
||||
for _ in 0 .. missing {
|
||||
a.0.push(Scalar::ZERO);
|
||||
b.0.push(Scalar::ZERO);
|
||||
}
|
||||
|
||||
Some(Self { a, b, alpha })
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub(crate) struct WipProof {
|
||||
pub(crate) L: Vec<EdwardsPoint>,
|
||||
pub(crate) R: Vec<EdwardsPoint>,
|
||||
pub(crate) A: EdwardsPoint,
|
||||
pub(crate) B: EdwardsPoint,
|
||||
pub(crate) r_answer: Scalar,
|
||||
pub(crate) s_answer: Scalar,
|
||||
pub(crate) delta_answer: Scalar,
|
||||
}
|
||||
|
||||
impl WipStatement {
|
||||
pub(crate) fn new(generators: Generators, P: EdwardsPoint, y: Scalar) -> Self {
|
||||
debug_assert_eq!(generators.len(), padded_pow_of_2(generators.len()));
|
||||
|
||||
// y ** n
|
||||
let mut y_vec = ScalarVector::new(generators.len());
|
||||
y_vec[0] = y;
|
||||
for i in 1 .. y_vec.len() {
|
||||
y_vec[i] = y_vec[i - 1] * y;
|
||||
}
|
||||
|
||||
Self { generators, P, y: y_vec }
|
||||
}
|
||||
|
||||
fn transcript_L_R(transcript: &mut Scalar, L: EdwardsPoint, R: EdwardsPoint) -> Scalar {
|
||||
let e = hash_to_scalar(
|
||||
&[transcript.to_repr().as_ref(), L.to_bytes().as_ref(), R.to_bytes().as_ref()].concat(),
|
||||
);
|
||||
*transcript = e;
|
||||
e
|
||||
}
|
||||
|
||||
fn transcript_A_B(transcript: &mut Scalar, A: EdwardsPoint, B: EdwardsPoint) -> Scalar {
|
||||
let e = hash_to_scalar(
|
||||
&[transcript.to_repr().as_ref(), A.to_bytes().as_ref(), B.to_bytes().as_ref()].concat(),
|
||||
);
|
||||
*transcript = e;
|
||||
e
|
||||
}
|
||||
|
||||
// Prover's variant of the shared code block to calculate G/H/P when n > 1
|
||||
// Returns each permutation of G/H since the prover needs to do operation on each permutation
|
||||
// P is dropped as it's unused in the prover's path
|
||||
// TODO: It'd still probably be faster to keep in terms of the original generators, both between
|
||||
// the reduced amount of group operations and the potential tabling of the generators under
|
||||
// multiexp
|
||||
#[allow(clippy::too_many_arguments)]
|
||||
fn next_G_H(
|
||||
transcript: &mut Scalar,
|
||||
mut g_bold1: PointVector,
|
||||
mut g_bold2: PointVector,
|
||||
mut h_bold1: PointVector,
|
||||
mut h_bold2: PointVector,
|
||||
L: EdwardsPoint,
|
||||
R: EdwardsPoint,
|
||||
y_inv_n_hat: Scalar,
|
||||
) -> (Scalar, Scalar, Scalar, Scalar, PointVector, PointVector) {
|
||||
debug_assert_eq!(g_bold1.len(), g_bold2.len());
|
||||
debug_assert_eq!(h_bold1.len(), h_bold2.len());
|
||||
debug_assert_eq!(g_bold1.len(), h_bold1.len());
|
||||
|
||||
let e = Self::transcript_L_R(transcript, L, R);
|
||||
let inv_e = e.invert().unwrap();
|
||||
|
||||
// This vartime is safe as all of these arguments are public
|
||||
let mut new_g_bold = Vec::with_capacity(g_bold1.len());
|
||||
let e_y_inv = e * y_inv_n_hat;
|
||||
for g_bold in g_bold1.0.drain(..).zip(g_bold2.0.drain(..)) {
|
||||
new_g_bold.push(multiexp_vartime(&[(inv_e, g_bold.0), (e_y_inv, g_bold.1)]));
|
||||
}
|
||||
|
||||
let mut new_h_bold = Vec::with_capacity(h_bold1.len());
|
||||
for h_bold in h_bold1.0.drain(..).zip(h_bold2.0.drain(..)) {
|
||||
new_h_bold.push(multiexp_vartime(&[(e, h_bold.0), (inv_e, h_bold.1)]));
|
||||
}
|
||||
|
||||
let e_square = e.square();
|
||||
let inv_e_square = inv_e.square();
|
||||
|
||||
(e, inv_e, e_square, inv_e_square, PointVector(new_g_bold), PointVector(new_h_bold))
|
||||
}
|
||||
|
||||
/*
|
||||
This has room for optimization worth investigating further. It currently takes
|
||||
an iterative approach. It can be optimized further via divide and conquer.
|
||||
|
||||
Assume there are 4 challenges.
|
||||
|
||||
Iterative approach (current):
|
||||
1. Do the optimal multiplications across challenge column 0 and 1.
|
||||
2. Do the optimal multiplications across that result and column 2.
|
||||
3. Do the optimal multiplications across that result and column 3.
|
||||
|
||||
Divide and conquer (worth investigating further):
|
||||
1. Do the optimal multiplications across challenge column 0 and 1.
|
||||
2. Do the optimal multiplications across challenge column 2 and 3.
|
||||
3. Multiply both results together.
|
||||
|
||||
When there are 4 challenges (n=16), the iterative approach does 28 multiplications
|
||||
versus divide and conquer's 24.
|
||||
*/
|
||||
fn challenge_products(challenges: &[(Scalar, Scalar)]) -> Vec<Scalar> {
|
||||
let mut products = vec![Scalar::ONE; 1 << challenges.len()];
|
||||
|
||||
if !challenges.is_empty() {
|
||||
products[0] = challenges[0].1;
|
||||
products[1] = challenges[0].0;
|
||||
|
||||
for (j, challenge) in challenges.iter().enumerate().skip(1) {
|
||||
let mut slots = (1 << (j + 1)) - 1;
|
||||
while slots > 0 {
|
||||
products[slots] = products[slots / 2] * challenge.0;
|
||||
products[slots - 1] = products[slots / 2] * challenge.1;
|
||||
|
||||
slots = slots.saturating_sub(2);
|
||||
}
|
||||
}
|
||||
|
||||
// Sanity check since if the above failed to populate, it'd be critical
|
||||
for product in &products {
|
||||
debug_assert!(!bool::from(product.is_zero()));
|
||||
}
|
||||
}
|
||||
|
||||
products
|
||||
}
|
||||
|
||||
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||
self,
|
||||
rng: &mut R,
|
||||
mut transcript: Scalar,
|
||||
witness: &WipWitness,
|
||||
) -> Option<WipProof> {
|
||||
let WipStatement { generators, P, mut y } = self;
|
||||
#[cfg(not(debug_assertions))]
|
||||
let _ = P;
|
||||
|
||||
if generators.len() != witness.a.len() {
|
||||
return None;
|
||||
}
|
||||
let (g, h) = (Generators::g(), Generators::h());
|
||||
let mut g_bold = vec![];
|
||||
let mut h_bold = vec![];
|
||||
for i in 0 .. generators.len() {
|
||||
g_bold.push(generators.generator(GeneratorsList::GBold1, i));
|
||||
h_bold.push(generators.generator(GeneratorsList::HBold1, i));
|
||||
}
|
||||
let mut g_bold = PointVector(g_bold);
|
||||
let mut h_bold = PointVector(h_bold);
|
||||
|
||||
// Check P has the expected relationship
|
||||
#[cfg(debug_assertions)]
|
||||
{
|
||||
let mut P_terms = witness
|
||||
.a
|
||||
.0
|
||||
.iter()
|
||||
.copied()
|
||||
.zip(g_bold.0.iter().copied())
|
||||
.chain(witness.b.0.iter().copied().zip(h_bold.0.iter().copied()))
|
||||
.collect::<Vec<_>>();
|
||||
P_terms.push((witness.a.clone().weighted_inner_product(&witness.b, &y), g));
|
||||
P_terms.push((witness.alpha, h));
|
||||
debug_assert_eq!(multiexp(&P_terms), P);
|
||||
P_terms.zeroize();
|
||||
}
|
||||
|
||||
let mut a = witness.a.clone();
|
||||
let mut b = witness.b.clone();
|
||||
let mut alpha = witness.alpha;
|
||||
|
||||
// From here on, g_bold.len() is used as n
|
||||
debug_assert_eq!(g_bold.len(), a.len());
|
||||
|
||||
let mut L_vec = vec![];
|
||||
let mut R_vec = vec![];
|
||||
|
||||
// else n > 1 case from figure 1
|
||||
while g_bold.len() > 1 {
|
||||
let (a1, a2) = a.clone().split();
|
||||
let (b1, b2) = b.clone().split();
|
||||
let (g_bold1, g_bold2) = g_bold.split();
|
||||
let (h_bold1, h_bold2) = h_bold.split();
|
||||
|
||||
let n_hat = g_bold1.len();
|
||||
debug_assert_eq!(a1.len(), n_hat);
|
||||
debug_assert_eq!(a2.len(), n_hat);
|
||||
debug_assert_eq!(b1.len(), n_hat);
|
||||
debug_assert_eq!(b2.len(), n_hat);
|
||||
debug_assert_eq!(g_bold1.len(), n_hat);
|
||||
debug_assert_eq!(g_bold2.len(), n_hat);
|
||||
debug_assert_eq!(h_bold1.len(), n_hat);
|
||||
debug_assert_eq!(h_bold2.len(), n_hat);
|
||||
|
||||
let y_n_hat = y[n_hat - 1];
|
||||
y.0.truncate(n_hat);
|
||||
|
||||
let d_l = Scalar::random(&mut *rng);
|
||||
let d_r = Scalar::random(&mut *rng);
|
||||
|
||||
let c_l = a1.clone().weighted_inner_product(&b2, &y);
|
||||
let c_r = (a2.clone() * y_n_hat).weighted_inner_product(&b1, &y);
|
||||
|
||||
// TODO: Calculate these with a batch inversion
|
||||
let y_inv_n_hat = y_n_hat.invert().unwrap();
|
||||
|
||||
let mut L_terms = (a1.clone() * y_inv_n_hat)
|
||||
.0
|
||||
.drain(..)
|
||||
.zip(g_bold2.0.iter().copied())
|
||||
.chain(b2.0.iter().copied().zip(h_bold1.0.iter().copied()))
|
||||
.collect::<Vec<_>>();
|
||||
L_terms.push((c_l, g));
|
||||
L_terms.push((d_l, h));
|
||||
let L = multiexp(&L_terms) * Scalar(crate::INV_EIGHT());
|
||||
L_vec.push(L);
|
||||
L_terms.zeroize();
|
||||
|
||||
let mut R_terms = (a2.clone() * y_n_hat)
|
||||
.0
|
||||
.drain(..)
|
||||
.zip(g_bold1.0.iter().copied())
|
||||
.chain(b1.0.iter().copied().zip(h_bold2.0.iter().copied()))
|
||||
.collect::<Vec<_>>();
|
||||
R_terms.push((c_r, g));
|
||||
R_terms.push((d_r, h));
|
||||
let R = multiexp(&R_terms) * Scalar(crate::INV_EIGHT());
|
||||
R_vec.push(R);
|
||||
R_terms.zeroize();
|
||||
|
||||
let (e, inv_e, e_square, inv_e_square);
|
||||
(e, inv_e, e_square, inv_e_square, g_bold, h_bold) =
|
||||
Self::next_G_H(&mut transcript, g_bold1, g_bold2, h_bold1, h_bold2, L, R, y_inv_n_hat);
|
||||
|
||||
a = (a1 * e) + &(a2 * (y_n_hat * inv_e));
|
||||
b = (b1 * inv_e) + &(b2 * e);
|
||||
alpha += (d_l * e_square) + (d_r * inv_e_square);
|
||||
|
||||
debug_assert_eq!(g_bold.len(), a.len());
|
||||
debug_assert_eq!(g_bold.len(), h_bold.len());
|
||||
debug_assert_eq!(g_bold.len(), b.len());
|
||||
}
|
||||
|
||||
// n == 1 case from figure 1
|
||||
debug_assert_eq!(g_bold.len(), 1);
|
||||
debug_assert_eq!(h_bold.len(), 1);
|
||||
|
||||
debug_assert_eq!(a.len(), 1);
|
||||
debug_assert_eq!(b.len(), 1);
|
||||
|
||||
let r = Scalar::random(&mut *rng);
|
||||
let s = Scalar::random(&mut *rng);
|
||||
let delta = Scalar::random(&mut *rng);
|
||||
let eta = Scalar::random(&mut *rng);
|
||||
|
||||
let ry = r * y[0];
|
||||
|
||||
let mut A_terms =
|
||||
vec![(r, g_bold[0]), (s, h_bold[0]), ((ry * b[0]) + (s * y[0] * a[0]), g), (delta, h)];
|
||||
let A = multiexp(&A_terms) * Scalar(crate::INV_EIGHT());
|
||||
A_terms.zeroize();
|
||||
|
||||
let mut B_terms = vec![(ry * s, g), (eta, h)];
|
||||
let B = multiexp(&B_terms) * Scalar(crate::INV_EIGHT());
|
||||
B_terms.zeroize();
|
||||
|
||||
let e = Self::transcript_A_B(&mut transcript, A, B);
|
||||
|
||||
let r_answer = r + (a[0] * e);
|
||||
let s_answer = s + (b[0] * e);
|
||||
let delta_answer = eta + (delta * e) + (alpha * e.square());
|
||||
|
||||
Some(WipProof { L: L_vec, R: R_vec, A, B, r_answer, s_answer, delta_answer })
|
||||
}
|
||||
|
||||
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||
self,
|
||||
rng: &mut R,
|
||||
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
|
||||
id: Id,
|
||||
mut transcript: Scalar,
|
||||
mut proof: WipProof,
|
||||
) -> bool {
|
||||
let WipStatement { generators, P, y } = self;
|
||||
|
||||
let (g, h) = (Generators::g(), Generators::h());
|
||||
|
||||
// Verify the L/R lengths
|
||||
{
|
||||
let mut lr_len = 0;
|
||||
while (1 << lr_len) < generators.len() {
|
||||
lr_len += 1;
|
||||
}
|
||||
if (proof.L.len() != lr_len) ||
|
||||
(proof.R.len() != lr_len) ||
|
||||
(generators.len() != (1 << lr_len))
|
||||
{
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
let inv_y = {
|
||||
let inv_y = y[0].invert().unwrap();
|
||||
let mut res = Vec::with_capacity(y.len());
|
||||
res.push(inv_y);
|
||||
while res.len() < y.len() {
|
||||
res.push(inv_y * res.last().unwrap());
|
||||
}
|
||||
res
|
||||
};
|
||||
|
||||
let mut P_terms = vec![(Scalar::ONE, P)];
|
||||
P_terms.reserve(6 + (2 * generators.len()) + proof.L.len());
|
||||
|
||||
let mut challenges = Vec::with_capacity(proof.L.len());
|
||||
let product_cache = {
|
||||
let mut es = Vec::with_capacity(proof.L.len());
|
||||
for (L, R) in proof.L.iter_mut().zip(proof.R.iter_mut()) {
|
||||
es.push(Self::transcript_L_R(&mut transcript, *L, *R));
|
||||
*L = L.mul_by_cofactor();
|
||||
*R = R.mul_by_cofactor();
|
||||
}
|
||||
|
||||
let mut inv_es = es.clone();
|
||||
let mut scratch = vec![Scalar::ZERO; es.len()];
|
||||
group::ff::BatchInverter::invert_with_external_scratch(&mut inv_es, &mut scratch);
|
||||
drop(scratch);
|
||||
|
||||
debug_assert_eq!(es.len(), inv_es.len());
|
||||
debug_assert_eq!(es.len(), proof.L.len());
|
||||
debug_assert_eq!(es.len(), proof.R.len());
|
||||
for ((e, inv_e), (L, R)) in
|
||||
es.drain(..).zip(inv_es.drain(..)).zip(proof.L.iter().zip(proof.R.iter()))
|
||||
{
|
||||
debug_assert_eq!(e.invert().unwrap(), inv_e);
|
||||
|
||||
challenges.push((e, inv_e));
|
||||
|
||||
let e_square = e.square();
|
||||
let inv_e_square = inv_e.square();
|
||||
P_terms.push((e_square, *L));
|
||||
P_terms.push((inv_e_square, *R));
|
||||
}
|
||||
|
||||
Self::challenge_products(&challenges)
|
||||
};
|
||||
|
||||
let e = Self::transcript_A_B(&mut transcript, proof.A, proof.B);
|
||||
proof.A = proof.A.mul_by_cofactor();
|
||||
proof.B = proof.B.mul_by_cofactor();
|
||||
let neg_e_square = -e.square();
|
||||
|
||||
let mut multiexp = P_terms;
|
||||
multiexp.reserve(4 + (2 * generators.len()));
|
||||
for (scalar, _) in &mut multiexp {
|
||||
*scalar *= neg_e_square;
|
||||
}
|
||||
|
||||
let re = proof.r_answer * e;
|
||||
for i in 0 .. generators.len() {
|
||||
let mut scalar = product_cache[i] * re;
|
||||
if i > 0 {
|
||||
scalar *= inv_y[i - 1];
|
||||
}
|
||||
multiexp.push((scalar, generators.generator(GeneratorsList::GBold1, i)));
|
||||
}
|
||||
|
||||
let se = proof.s_answer * e;
|
||||
for i in 0 .. generators.len() {
|
||||
multiexp.push((
|
||||
se * product_cache[product_cache.len() - 1 - i],
|
||||
generators.generator(GeneratorsList::HBold1, i),
|
||||
));
|
||||
}
|
||||
|
||||
multiexp.push((-e, proof.A));
|
||||
multiexp.push((proof.r_answer * y[0] * proof.s_answer, g));
|
||||
multiexp.push((proof.delta_answer, h));
|
||||
multiexp.push((-Scalar::ONE, proof.B));
|
||||
|
||||
verifier.queue(rng, id, multiexp);
|
||||
|
||||
true
|
||||
}
|
||||
}
|
||||
138
coins/monero/src/ringct/bulletproofs/scalar_vector.rs
Normal file
138
coins/monero/src/ringct/bulletproofs/scalar_vector.rs
Normal file
@@ -0,0 +1,138 @@
|
||||
use core::{
|
||||
borrow::Borrow,
|
||||
ops::{Index, IndexMut, Add, Sub, Mul},
|
||||
};
|
||||
use std_shims::vec::Vec;
|
||||
|
||||
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||
|
||||
use group::ff::Field;
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
use multiexp::multiexp;
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
||||
pub(crate) struct ScalarVector(pub(crate) Vec<Scalar>);
|
||||
|
||||
impl Index<usize> for ScalarVector {
|
||||
type Output = Scalar;
|
||||
fn index(&self, index: usize) -> &Scalar {
|
||||
&self.0[index]
|
||||
}
|
||||
}
|
||||
impl IndexMut<usize> for ScalarVector {
|
||||
fn index_mut(&mut self, index: usize) -> &mut Scalar {
|
||||
&mut self.0[index]
|
||||
}
|
||||
}
|
||||
|
||||
impl<S: Borrow<Scalar>> Add<S> for ScalarVector {
|
||||
type Output = ScalarVector;
|
||||
fn add(mut self, scalar: S) -> ScalarVector {
|
||||
for s in &mut self.0 {
|
||||
*s += scalar.borrow();
|
||||
}
|
||||
self
|
||||
}
|
||||
}
|
||||
impl<S: Borrow<Scalar>> Sub<S> for ScalarVector {
|
||||
type Output = ScalarVector;
|
||||
fn sub(mut self, scalar: S) -> ScalarVector {
|
||||
for s in &mut self.0 {
|
||||
*s -= scalar.borrow();
|
||||
}
|
||||
self
|
||||
}
|
||||
}
|
||||
impl<S: Borrow<Scalar>> Mul<S> for ScalarVector {
|
||||
type Output = ScalarVector;
|
||||
fn mul(mut self, scalar: S) -> ScalarVector {
|
||||
for s in &mut self.0 {
|
||||
*s *= scalar.borrow();
|
||||
}
|
||||
self
|
||||
}
|
||||
}
|
||||
|
||||
impl Add<&ScalarVector> for ScalarVector {
|
||||
type Output = ScalarVector;
|
||||
fn add(mut self, other: &ScalarVector) -> ScalarVector {
|
||||
debug_assert_eq!(self.len(), other.len());
|
||||
for (s, o) in self.0.iter_mut().zip(other.0.iter()) {
|
||||
*s += o;
|
||||
}
|
||||
self
|
||||
}
|
||||
}
|
||||
impl Sub<&ScalarVector> for ScalarVector {
|
||||
type Output = ScalarVector;
|
||||
fn sub(mut self, other: &ScalarVector) -> ScalarVector {
|
||||
debug_assert_eq!(self.len(), other.len());
|
||||
for (s, o) in self.0.iter_mut().zip(other.0.iter()) {
|
||||
*s -= o;
|
||||
}
|
||||
self
|
||||
}
|
||||
}
|
||||
impl Mul<&ScalarVector> for ScalarVector {
|
||||
type Output = ScalarVector;
|
||||
fn mul(mut self, other: &ScalarVector) -> ScalarVector {
|
||||
debug_assert_eq!(self.len(), other.len());
|
||||
for (s, o) in self.0.iter_mut().zip(other.0.iter()) {
|
||||
*s *= o;
|
||||
}
|
||||
self
|
||||
}
|
||||
}
|
||||
|
||||
impl Mul<&[EdwardsPoint]> for &ScalarVector {
|
||||
type Output = EdwardsPoint;
|
||||
fn mul(self, b: &[EdwardsPoint]) -> EdwardsPoint {
|
||||
debug_assert_eq!(self.len(), b.len());
|
||||
let mut multiexp_args = self.0.iter().copied().zip(b.iter().copied()).collect::<Vec<_>>();
|
||||
let res = multiexp(&multiexp_args);
|
||||
multiexp_args.zeroize();
|
||||
res
|
||||
}
|
||||
}
|
||||
|
||||
impl ScalarVector {
|
||||
pub(crate) fn new(len: usize) -> Self {
|
||||
ScalarVector(vec![Scalar::ZERO; len])
|
||||
}
|
||||
|
||||
pub(crate) fn powers(x: Scalar, len: usize) -> Self {
|
||||
debug_assert!(len != 0);
|
||||
|
||||
let mut res = Vec::with_capacity(len);
|
||||
res.push(Scalar::ONE);
|
||||
res.push(x);
|
||||
for i in 2 .. len {
|
||||
res.push(res[i - 1] * x);
|
||||
}
|
||||
res.truncate(len);
|
||||
ScalarVector(res)
|
||||
}
|
||||
|
||||
pub(crate) fn len(&self) -> usize {
|
||||
self.0.len()
|
||||
}
|
||||
|
||||
pub(crate) fn sum(mut self) -> Scalar {
|
||||
self.0.drain(..).sum()
|
||||
}
|
||||
|
||||
pub(crate) fn inner_product(self, vector: &Self) -> Scalar {
|
||||
(self * vector).sum()
|
||||
}
|
||||
|
||||
pub(crate) fn weighted_inner_product(self, vector: &Self, y: &Self) -> Scalar {
|
||||
(self * vector * y).sum()
|
||||
}
|
||||
|
||||
pub(crate) fn split(mut self) -> (Self, Self) {
|
||||
debug_assert!(self.len() > 1);
|
||||
let r = self.0.split_off(self.0.len() / 2);
|
||||
debug_assert_eq!(self.len(), r.len());
|
||||
(self, ScalarVector(r))
|
||||
}
|
||||
}
|
||||
324
coins/monero/src/ringct/clsag/mod.rs
Normal file
324
coins/monero/src/ringct/clsag/mod.rs
Normal file
@@ -0,0 +1,324 @@
|
||||
#![allow(non_snake_case)]
|
||||
|
||||
use core::ops::Deref;
|
||||
use std_shims::{
|
||||
vec::Vec,
|
||||
io::{self, Read, Write},
|
||||
};
|
||||
|
||||
use rand_core::{RngCore, CryptoRng};
|
||||
|
||||
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
|
||||
use subtle::{ConstantTimeEq, Choice, CtOption};
|
||||
|
||||
use curve25519_dalek::{
|
||||
constants::ED25519_BASEPOINT_TABLE,
|
||||
scalar::Scalar,
|
||||
traits::{IsIdentity, VartimePrecomputedMultiscalarMul},
|
||||
edwards::{EdwardsPoint, VartimeEdwardsPrecomputation},
|
||||
};
|
||||
|
||||
use crate::{
|
||||
INV_EIGHT, Commitment, random_scalar, hash_to_scalar, wallet::decoys::Decoys,
|
||||
ringct::hash_to_point, serialize::*,
|
||||
};
|
||||
|
||||
#[cfg(feature = "multisig")]
|
||||
mod multisig;
|
||||
#[cfg(feature = "multisig")]
|
||||
pub use multisig::{ClsagDetails, ClsagAddendum, ClsagMultisig};
|
||||
#[cfg(feature = "multisig")]
|
||||
pub(crate) use multisig::add_key_image_share;
|
||||
|
||||
/// Errors returned when CLSAG signing fails.
|
||||
#[derive(Clone, Copy, PartialEq, Eq, Debug)]
|
||||
#[cfg_attr(feature = "std", derive(thiserror::Error))]
|
||||
pub enum ClsagError {
|
||||
#[cfg_attr(feature = "std", error("internal error ({0})"))]
|
||||
InternalError(&'static str),
|
||||
#[cfg_attr(feature = "std", error("invalid ring"))]
|
||||
InvalidRing,
|
||||
#[cfg_attr(feature = "std", error("invalid ring member (member {0}, ring size {1})"))]
|
||||
InvalidRingMember(u8, u8),
|
||||
#[cfg_attr(feature = "std", error("invalid commitment"))]
|
||||
InvalidCommitment,
|
||||
#[cfg_attr(feature = "std", error("invalid key image"))]
|
||||
InvalidImage,
|
||||
#[cfg_attr(feature = "std", error("invalid D"))]
|
||||
InvalidD,
|
||||
#[cfg_attr(feature = "std", error("invalid s"))]
|
||||
InvalidS,
|
||||
#[cfg_attr(feature = "std", error("invalid c1"))]
|
||||
InvalidC1,
|
||||
}
|
||||
|
||||
/// Input being signed for.
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
||||
pub struct ClsagInput {
|
||||
// The actual commitment for the true spend
|
||||
pub(crate) commitment: Commitment,
|
||||
// True spend index, offsets, and ring
|
||||
pub(crate) decoys: Decoys,
|
||||
}
|
||||
|
||||
impl ClsagInput {
|
||||
pub fn new(commitment: Commitment, decoys: Decoys) -> Result<ClsagInput, ClsagError> {
|
||||
let n = decoys.len();
|
||||
if n > u8::MAX.into() {
|
||||
Err(ClsagError::InternalError("max ring size in this library is u8 max"))?;
|
||||
}
|
||||
let n = u8::try_from(n).unwrap();
|
||||
if decoys.i >= n {
|
||||
Err(ClsagError::InvalidRingMember(decoys.i, n))?;
|
||||
}
|
||||
|
||||
// Validate the commitment matches
|
||||
if decoys.ring[usize::from(decoys.i)][1] != commitment.calculate() {
|
||||
Err(ClsagError::InvalidCommitment)?;
|
||||
}
|
||||
|
||||
Ok(ClsagInput { commitment, decoys })
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(clippy::large_enum_variant)]
|
||||
enum Mode {
|
||||
Sign(usize, EdwardsPoint, EdwardsPoint),
|
||||
Verify(Scalar),
|
||||
}
|
||||
|
||||
// Core of the CLSAG algorithm, applicable to both sign and verify with minimal differences
|
||||
// Said differences are covered via the above Mode
|
||||
fn core(
|
||||
ring: &[[EdwardsPoint; 2]],
|
||||
I: &EdwardsPoint,
|
||||
pseudo_out: &EdwardsPoint,
|
||||
msg: &[u8; 32],
|
||||
D: &EdwardsPoint,
|
||||
s: &[Scalar],
|
||||
A_c1: &Mode,
|
||||
) -> ((EdwardsPoint, Scalar, Scalar), Scalar) {
|
||||
let n = ring.len();
|
||||
|
||||
let images_precomp = VartimeEdwardsPrecomputation::new([I, D]);
|
||||
let D = D * INV_EIGHT();
|
||||
|
||||
// Generate the transcript
|
||||
// Instead of generating multiple, a single transcript is created and then edited as needed
|
||||
const PREFIX: &[u8] = b"CLSAG_";
|
||||
#[rustfmt::skip]
|
||||
const AGG_0: &[u8] = b"agg_0";
|
||||
#[rustfmt::skip]
|
||||
const ROUND: &[u8] = b"round";
|
||||
const PREFIX_AGG_0_LEN: usize = PREFIX.len() + AGG_0.len();
|
||||
|
||||
let mut to_hash = Vec::with_capacity(((2 * n) + 5) * 32);
|
||||
to_hash.extend(PREFIX);
|
||||
to_hash.extend(AGG_0);
|
||||
to_hash.extend([0; 32 - PREFIX_AGG_0_LEN]);
|
||||
|
||||
let mut P = Vec::with_capacity(n);
|
||||
for member in ring {
|
||||
P.push(member[0]);
|
||||
to_hash.extend(member[0].compress().to_bytes());
|
||||
}
|
||||
|
||||
let mut C = Vec::with_capacity(n);
|
||||
for member in ring {
|
||||
C.push(member[1] - pseudo_out);
|
||||
to_hash.extend(member[1].compress().to_bytes());
|
||||
}
|
||||
|
||||
to_hash.extend(I.compress().to_bytes());
|
||||
to_hash.extend(D.compress().to_bytes());
|
||||
to_hash.extend(pseudo_out.compress().to_bytes());
|
||||
// mu_P with agg_0
|
||||
let mu_P = hash_to_scalar(&to_hash);
|
||||
// mu_C with agg_1
|
||||
to_hash[PREFIX_AGG_0_LEN - 1] = b'1';
|
||||
let mu_C = hash_to_scalar(&to_hash);
|
||||
|
||||
// Truncate it for the round transcript, altering the DST as needed
|
||||
to_hash.truncate(((2 * n) + 1) * 32);
|
||||
for i in 0 .. ROUND.len() {
|
||||
to_hash[PREFIX.len() + i] = ROUND[i];
|
||||
}
|
||||
// Unfortunately, it's I D pseudo_out instead of pseudo_out I D, meaning this needs to be
|
||||
// truncated just to add it back
|
||||
to_hash.extend(pseudo_out.compress().to_bytes());
|
||||
to_hash.extend(msg);
|
||||
|
||||
// Configure the loop based on if we're signing or verifying
|
||||
let start;
|
||||
let end;
|
||||
let mut c;
|
||||
match A_c1 {
|
||||
Mode::Sign(r, A, AH) => {
|
||||
start = r + 1;
|
||||
end = r + n;
|
||||
to_hash.extend(A.compress().to_bytes());
|
||||
to_hash.extend(AH.compress().to_bytes());
|
||||
c = hash_to_scalar(&to_hash);
|
||||
}
|
||||
|
||||
Mode::Verify(c1) => {
|
||||
start = 0;
|
||||
end = n;
|
||||
c = *c1;
|
||||
}
|
||||
}
|
||||
|
||||
// Perform the core loop
|
||||
let mut c1 = CtOption::new(Scalar::ZERO, Choice::from(0));
|
||||
for i in (start .. end).map(|i| i % n) {
|
||||
// This will only execute once and shouldn't need to be constant time. Making it constant time
|
||||
// removes the risk of branch prediction creating timing differences depending on ring index
|
||||
// however
|
||||
c1 = c1.or_else(|| CtOption::new(c, i.ct_eq(&0)));
|
||||
|
||||
let c_p = mu_P * c;
|
||||
let c_c = mu_C * c;
|
||||
|
||||
let L = (&s[i] * ED25519_BASEPOINT_TABLE) + (c_p * P[i]) + (c_c * C[i]);
|
||||
let PH = hash_to_point(&P[i]);
|
||||
// Shouldn't be an issue as all of the variables in this vartime statement are public
|
||||
let R = (s[i] * PH) + images_precomp.vartime_multiscalar_mul([c_p, c_c]);
|
||||
|
||||
to_hash.truncate(((2 * n) + 3) * 32);
|
||||
to_hash.extend(L.compress().to_bytes());
|
||||
to_hash.extend(R.compress().to_bytes());
|
||||
c = hash_to_scalar(&to_hash);
|
||||
}
|
||||
|
||||
// This first tuple is needed to continue signing, the latter is the c to be tested/worked with
|
||||
((D, c * mu_P, c * mu_C), c1.unwrap_or(c))
|
||||
}
|
||||
|
||||
/// CLSAG signature, as used in Monero.
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct Clsag {
|
||||
pub D: EdwardsPoint,
|
||||
pub s: Vec<Scalar>,
|
||||
pub c1: Scalar,
|
||||
}
|
||||
|
||||
impl Clsag {
|
||||
// Sign core is the extension of core as needed for signing, yet is shared between single signer
|
||||
// and multisig, hence why it's still core
|
||||
pub(crate) fn sign_core<R: RngCore + CryptoRng>(
|
||||
rng: &mut R,
|
||||
I: &EdwardsPoint,
|
||||
input: &ClsagInput,
|
||||
mask: Scalar,
|
||||
msg: &[u8; 32],
|
||||
A: EdwardsPoint,
|
||||
AH: EdwardsPoint,
|
||||
) -> (Clsag, EdwardsPoint, Scalar, Scalar) {
|
||||
let r: usize = input.decoys.i.into();
|
||||
|
||||
let pseudo_out = Commitment::new(mask, input.commitment.amount).calculate();
|
||||
let z = input.commitment.mask - mask;
|
||||
|
||||
let H = hash_to_point(&input.decoys.ring[r][0]);
|
||||
let D = H * z;
|
||||
let mut s = Vec::with_capacity(input.decoys.ring.len());
|
||||
for _ in 0 .. input.decoys.ring.len() {
|
||||
s.push(random_scalar(rng));
|
||||
}
|
||||
let ((D, p, c), c1) =
|
||||
core(&input.decoys.ring, I, &pseudo_out, msg, &D, &s, &Mode::Sign(r, A, AH));
|
||||
|
||||
(Clsag { D, s, c1 }, pseudo_out, p, c * z)
|
||||
}
|
||||
|
||||
/// Generate CLSAG signatures for the given inputs.
|
||||
/// inputs is of the form (private key, key image, input).
|
||||
/// sum_outputs is for the sum of the outputs' commitment masks.
|
||||
pub fn sign<R: RngCore + CryptoRng>(
|
||||
rng: &mut R,
|
||||
mut inputs: Vec<(Zeroizing<Scalar>, EdwardsPoint, ClsagInput)>,
|
||||
sum_outputs: Scalar,
|
||||
msg: [u8; 32],
|
||||
) -> Vec<(Clsag, EdwardsPoint)> {
|
||||
let mut res = Vec::with_capacity(inputs.len());
|
||||
let mut sum_pseudo_outs = Scalar::ZERO;
|
||||
for i in 0 .. inputs.len() {
|
||||
let mut mask = random_scalar(rng);
|
||||
if i == (inputs.len() - 1) {
|
||||
mask = sum_outputs - sum_pseudo_outs;
|
||||
} else {
|
||||
sum_pseudo_outs += mask;
|
||||
}
|
||||
|
||||
let mut nonce = Zeroizing::new(random_scalar(rng));
|
||||
let (mut clsag, pseudo_out, p, c) = Clsag::sign_core(
|
||||
rng,
|
||||
&inputs[i].1,
|
||||
&inputs[i].2,
|
||||
mask,
|
||||
&msg,
|
||||
nonce.deref() * ED25519_BASEPOINT_TABLE,
|
||||
nonce.deref() *
|
||||
hash_to_point(&inputs[i].2.decoys.ring[usize::from(inputs[i].2.decoys.i)][0]),
|
||||
);
|
||||
clsag.s[usize::from(inputs[i].2.decoys.i)] =
|
||||
(-((p * inputs[i].0.deref()) + c)) + nonce.deref();
|
||||
inputs[i].0.zeroize();
|
||||
nonce.zeroize();
|
||||
|
||||
debug_assert!(clsag
|
||||
.verify(&inputs[i].2.decoys.ring, &inputs[i].1, &pseudo_out, &msg)
|
||||
.is_ok());
|
||||
|
||||
res.push((clsag, pseudo_out));
|
||||
}
|
||||
|
||||
res
|
||||
}
|
||||
|
||||
/// Verify the CLSAG signature against the given Transaction data.
|
||||
pub fn verify(
|
||||
&self,
|
||||
ring: &[[EdwardsPoint; 2]],
|
||||
I: &EdwardsPoint,
|
||||
pseudo_out: &EdwardsPoint,
|
||||
msg: &[u8; 32],
|
||||
) -> Result<(), ClsagError> {
|
||||
// Preliminary checks. s, c1, and points must also be encoded canonically, which isn't checked
|
||||
// here
|
||||
if ring.is_empty() {
|
||||
Err(ClsagError::InvalidRing)?;
|
||||
}
|
||||
if ring.len() != self.s.len() {
|
||||
Err(ClsagError::InvalidS)?;
|
||||
}
|
||||
if I.is_identity() {
|
||||
Err(ClsagError::InvalidImage)?;
|
||||
}
|
||||
|
||||
let D = self.D.mul_by_cofactor();
|
||||
if D.is_identity() {
|
||||
Err(ClsagError::InvalidD)?;
|
||||
}
|
||||
|
||||
let (_, c1) = core(ring, I, pseudo_out, msg, &D, &self.s, &Mode::Verify(self.c1));
|
||||
if c1 != self.c1 {
|
||||
Err(ClsagError::InvalidC1)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn fee_weight(ring_len: usize) -> usize {
|
||||
(ring_len * 32) + 32 + 32
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
write_raw_vec(write_scalar, &self.s, w)?;
|
||||
w.write_all(&self.c1.to_bytes())?;
|
||||
write_point(&self.D, w)
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(decoys: usize, r: &mut R) -> io::Result<Clsag> {
|
||||
Ok(Clsag { s: read_raw_vec(read_scalar, decoys, r)?, c1: read_scalar(r)?, D: read_point(r)? })
|
||||
}
|
||||
}
|
||||
305
coins/monero/src/ringct/clsag/multisig.rs
Normal file
305
coins/monero/src/ringct/clsag/multisig.rs
Normal file
@@ -0,0 +1,305 @@
|
||||
use core::{ops::Deref, fmt::Debug};
|
||||
use std_shims::io::{self, Read, Write};
|
||||
use std::sync::{Arc, RwLock};
|
||||
|
||||
use rand_core::{RngCore, CryptoRng, SeedableRng};
|
||||
use rand_chacha::ChaCha20Rng;
|
||||
|
||||
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
|
||||
|
||||
use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
||||
|
||||
use group::{ff::Field, Group, GroupEncoding};
|
||||
|
||||
use transcript::{Transcript, RecommendedTranscript};
|
||||
use dalek_ff_group as dfg;
|
||||
use dleq::DLEqProof;
|
||||
use frost::{
|
||||
dkg::lagrange,
|
||||
curve::Ed25519,
|
||||
Participant, FrostError, ThresholdKeys, ThresholdView,
|
||||
algorithm::{WriteAddendum, Algorithm},
|
||||
};
|
||||
|
||||
use crate::ringct::{
|
||||
hash_to_point,
|
||||
clsag::{ClsagInput, Clsag},
|
||||
};
|
||||
|
||||
fn dleq_transcript() -> RecommendedTranscript {
|
||||
RecommendedTranscript::new(b"monero_key_image_dleq")
|
||||
}
|
||||
|
||||
impl ClsagInput {
|
||||
fn transcript<T: Transcript>(&self, transcript: &mut T) {
|
||||
// Doesn't domain separate as this is considered part of the larger CLSAG proof
|
||||
|
||||
// Ring index
|
||||
transcript.append_message(b"real_spend", [self.decoys.i]);
|
||||
|
||||
// Ring
|
||||
for (i, pair) in self.decoys.ring.iter().enumerate() {
|
||||
// Doesn't include global output indexes as CLSAG doesn't care and won't be affected by it
|
||||
// They're just a unreliable reference to this data which will be included in the message
|
||||
// if in use
|
||||
transcript.append_message(b"member", [u8::try_from(i).expect("ring size exceeded 255")]);
|
||||
transcript.append_message(b"key", pair[0].compress().to_bytes());
|
||||
transcript.append_message(b"commitment", pair[1].compress().to_bytes())
|
||||
}
|
||||
|
||||
// Doesn't include the commitment's parts as the above ring + index includes the commitment
|
||||
// The only potential malleability would be if the G/H relationship is known breaking the
|
||||
// discrete log problem, which breaks everything already
|
||||
}
|
||||
}
|
||||
|
||||
/// CLSAG input and the mask to use for it.
|
||||
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
||||
pub struct ClsagDetails {
|
||||
input: ClsagInput,
|
||||
mask: Scalar,
|
||||
}
|
||||
|
||||
impl ClsagDetails {
|
||||
pub fn new(input: ClsagInput, mask: Scalar) -> ClsagDetails {
|
||||
ClsagDetails { input, mask }
|
||||
}
|
||||
}
|
||||
|
||||
/// Addendum produced during the FROST signing process with relevant data.
|
||||
#[derive(Clone, PartialEq, Eq, Zeroize, Debug)]
|
||||
pub struct ClsagAddendum {
|
||||
pub(crate) key_image: dfg::EdwardsPoint,
|
||||
dleq: DLEqProof<dfg::EdwardsPoint>,
|
||||
}
|
||||
|
||||
impl WriteAddendum for ClsagAddendum {
|
||||
fn write<W: Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||
writer.write_all(self.key_image.compress().to_bytes().as_ref())?;
|
||||
self.dleq.write(writer)
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
struct Interim {
|
||||
p: Scalar,
|
||||
c: Scalar,
|
||||
|
||||
clsag: Clsag,
|
||||
pseudo_out: EdwardsPoint,
|
||||
}
|
||||
|
||||
/// FROST algorithm for producing a CLSAG signature.
|
||||
#[allow(non_snake_case)]
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct ClsagMultisig {
|
||||
transcript: RecommendedTranscript,
|
||||
|
||||
pub(crate) H: EdwardsPoint,
|
||||
// Merged here as CLSAG needs it, passing it would be a mess, yet having it beforehand requires
|
||||
// an extra round
|
||||
image: EdwardsPoint,
|
||||
|
||||
details: Arc<RwLock<Option<ClsagDetails>>>,
|
||||
|
||||
msg: Option<[u8; 32]>,
|
||||
interim: Option<Interim>,
|
||||
}
|
||||
|
||||
impl ClsagMultisig {
|
||||
pub fn new(
|
||||
transcript: RecommendedTranscript,
|
||||
output_key: EdwardsPoint,
|
||||
details: Arc<RwLock<Option<ClsagDetails>>>,
|
||||
) -> ClsagMultisig {
|
||||
ClsagMultisig {
|
||||
transcript,
|
||||
|
||||
H: hash_to_point(&output_key),
|
||||
image: EdwardsPoint::identity(),
|
||||
|
||||
details,
|
||||
|
||||
msg: None,
|
||||
interim: None,
|
||||
}
|
||||
}
|
||||
|
||||
fn input(&self) -> ClsagInput {
|
||||
(*self.details.read().unwrap()).as_ref().unwrap().input.clone()
|
||||
}
|
||||
|
||||
fn mask(&self) -> Scalar {
|
||||
(*self.details.read().unwrap()).as_ref().unwrap().mask
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn add_key_image_share(
|
||||
image: &mut EdwardsPoint,
|
||||
generator: EdwardsPoint,
|
||||
offset: Scalar,
|
||||
included: &[Participant],
|
||||
participant: Participant,
|
||||
share: EdwardsPoint,
|
||||
) {
|
||||
if image.is_identity().into() {
|
||||
*image = generator * offset;
|
||||
}
|
||||
*image += share * lagrange::<dfg::Scalar>(participant, included).0;
|
||||
}
|
||||
|
||||
impl Algorithm<Ed25519> for ClsagMultisig {
|
||||
type Transcript = RecommendedTranscript;
|
||||
type Addendum = ClsagAddendum;
|
||||
type Signature = (Clsag, EdwardsPoint);
|
||||
|
||||
fn nonces(&self) -> Vec<Vec<dfg::EdwardsPoint>> {
|
||||
vec![vec![dfg::EdwardsPoint::generator(), dfg::EdwardsPoint(self.H)]]
|
||||
}
|
||||
|
||||
fn preprocess_addendum<R: RngCore + CryptoRng>(
|
||||
&mut self,
|
||||
rng: &mut R,
|
||||
keys: &ThresholdKeys<Ed25519>,
|
||||
) -> ClsagAddendum {
|
||||
ClsagAddendum {
|
||||
key_image: dfg::EdwardsPoint(self.H) * keys.secret_share().deref(),
|
||||
dleq: DLEqProof::prove(
|
||||
rng,
|
||||
// Doesn't take in a larger transcript object due to the usage of this
|
||||
// Every prover would immediately write their own DLEq proof, when they can only do so in
|
||||
// the proper order if they want to reach consensus
|
||||
// It'd be a poor API to have CLSAG define a new transcript solely to pass here, just to
|
||||
// try to merge later in some form, when it should instead just merge xH (as it does)
|
||||
&mut dleq_transcript(),
|
||||
&[dfg::EdwardsPoint::generator(), dfg::EdwardsPoint(self.H)],
|
||||
keys.secret_share(),
|
||||
),
|
||||
}
|
||||
}
|
||||
|
||||
fn read_addendum<R: Read>(&self, reader: &mut R) -> io::Result<ClsagAddendum> {
|
||||
let mut bytes = [0; 32];
|
||||
reader.read_exact(&mut bytes)?;
|
||||
// dfg ensures the point is torsion free
|
||||
let xH = Option::<dfg::EdwardsPoint>::from(dfg::EdwardsPoint::from_bytes(&bytes))
|
||||
.ok_or_else(|| io::Error::other("invalid key image"))?;
|
||||
// Ensure this is a canonical point
|
||||
if xH.to_bytes() != bytes {
|
||||
Err(io::Error::other("non-canonical key image"))?;
|
||||
}
|
||||
|
||||
Ok(ClsagAddendum { key_image: xH, dleq: DLEqProof::<dfg::EdwardsPoint>::read(reader)? })
|
||||
}
|
||||
|
||||
fn process_addendum(
|
||||
&mut self,
|
||||
view: &ThresholdView<Ed25519>,
|
||||
l: Participant,
|
||||
addendum: ClsagAddendum,
|
||||
) -> Result<(), FrostError> {
|
||||
// TODO: This check is faulty if two shares are additive inverses of each other
|
||||
if self.image.is_identity().into() {
|
||||
self.transcript.domain_separate(b"CLSAG");
|
||||
self.input().transcript(&mut self.transcript);
|
||||
self.transcript.append_message(b"mask", self.mask().to_bytes());
|
||||
}
|
||||
|
||||
self.transcript.append_message(b"participant", l.to_bytes());
|
||||
|
||||
addendum
|
||||
.dleq
|
||||
.verify(
|
||||
&mut dleq_transcript(),
|
||||
&[dfg::EdwardsPoint::generator(), dfg::EdwardsPoint(self.H)],
|
||||
&[view.original_verification_share(l), addendum.key_image],
|
||||
)
|
||||
.map_err(|_| FrostError::InvalidPreprocess(l))?;
|
||||
|
||||
self.transcript.append_message(b"key_image_share", addendum.key_image.compress().to_bytes());
|
||||
add_key_image_share(
|
||||
&mut self.image,
|
||||
self.H,
|
||||
view.offset().0,
|
||||
view.included(),
|
||||
l,
|
||||
addendum.key_image.0,
|
||||
);
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
fn transcript(&mut self) -> &mut Self::Transcript {
|
||||
&mut self.transcript
|
||||
}
|
||||
|
||||
fn sign_share(
|
||||
&mut self,
|
||||
view: &ThresholdView<Ed25519>,
|
||||
nonce_sums: &[Vec<dfg::EdwardsPoint>],
|
||||
nonces: Vec<Zeroizing<dfg::Scalar>>,
|
||||
msg: &[u8],
|
||||
) -> dfg::Scalar {
|
||||
// Use the transcript to get a seeded random number generator
|
||||
// The transcript contains private data, preventing passive adversaries from recreating this
|
||||
// process even if they have access to commitments (specifically, the ring index being signed
|
||||
// for, along with the mask which should not only require knowing the shared keys yet also the
|
||||
// input commitment masks)
|
||||
let mut rng = ChaCha20Rng::from_seed(self.transcript.rng_seed(b"decoy_responses"));
|
||||
|
||||
self.msg = Some(msg.try_into().expect("CLSAG message should be 32-bytes"));
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
let (clsag, pseudo_out, p, c) = Clsag::sign_core(
|
||||
&mut rng,
|
||||
&self.image,
|
||||
&self.input(),
|
||||
self.mask(),
|
||||
self.msg.as_ref().unwrap(),
|
||||
nonce_sums[0][0].0,
|
||||
nonce_sums[0][1].0,
|
||||
);
|
||||
self.interim = Some(Interim { p, c, clsag, pseudo_out });
|
||||
|
||||
(-(dfg::Scalar(p) * view.secret_share().deref())) + nonces[0].deref()
|
||||
}
|
||||
|
||||
#[must_use]
|
||||
fn verify(
|
||||
&self,
|
||||
_: dfg::EdwardsPoint,
|
||||
_: &[Vec<dfg::EdwardsPoint>],
|
||||
sum: dfg::Scalar,
|
||||
) -> Option<Self::Signature> {
|
||||
let interim = self.interim.as_ref().unwrap();
|
||||
let mut clsag = interim.clsag.clone();
|
||||
clsag.s[usize::from(self.input().decoys.i)] = sum.0 - interim.c;
|
||||
if clsag
|
||||
.verify(
|
||||
&self.input().decoys.ring,
|
||||
&self.image,
|
||||
&interim.pseudo_out,
|
||||
self.msg.as_ref().unwrap(),
|
||||
)
|
||||
.is_ok()
|
||||
{
|
||||
return Some((clsag, interim.pseudo_out));
|
||||
}
|
||||
None
|
||||
}
|
||||
|
||||
fn verify_share(
|
||||
&self,
|
||||
verification_share: dfg::EdwardsPoint,
|
||||
nonces: &[Vec<dfg::EdwardsPoint>],
|
||||
share: dfg::Scalar,
|
||||
) -> Result<Vec<(dfg::Scalar, dfg::EdwardsPoint)>, ()> {
|
||||
let interim = self.interim.as_ref().unwrap();
|
||||
Ok(vec![
|
||||
(share, dfg::EdwardsPoint::generator()),
|
||||
(dfg::Scalar(interim.p), verification_share),
|
||||
(-dfg::Scalar::ONE, nonces[0][0]),
|
||||
])
|
||||
}
|
||||
}
|
||||
8
coins/monero/src/ringct/hash_to_point.rs
Normal file
8
coins/monero/src/ringct/hash_to_point.rs
Normal file
@@ -0,0 +1,8 @@
|
||||
use curve25519_dalek::edwards::EdwardsPoint;
|
||||
|
||||
pub use monero_generators::{hash_to_point as raw_hash_to_point};
|
||||
|
||||
/// Monero's hash to point function, as named `ge_fromfe_frombytes_vartime`.
|
||||
pub fn hash_to_point(key: &EdwardsPoint) -> EdwardsPoint {
|
||||
raw_hash_to_point(key.compress().to_bytes())
|
||||
}
|
||||
216
coins/monero/src/ringct/mlsag.rs
Normal file
216
coins/monero/src/ringct/mlsag.rs
Normal file
@@ -0,0 +1,216 @@
|
||||
use std_shims::{
|
||||
vec::Vec,
|
||||
io::{self, Read, Write},
|
||||
};
|
||||
|
||||
use zeroize::Zeroize;
|
||||
|
||||
use curve25519_dalek::{traits::IsIdentity, Scalar, EdwardsPoint};
|
||||
|
||||
use monero_generators::H;
|
||||
|
||||
use crate::{hash_to_scalar, ringct::hash_to_point, serialize::*};
|
||||
|
||||
#[derive(Clone, Copy, PartialEq, Eq, Debug)]
|
||||
#[cfg_attr(feature = "std", derive(thiserror::Error))]
|
||||
pub enum MlsagError {
|
||||
#[cfg_attr(feature = "std", error("invalid ring"))]
|
||||
InvalidRing,
|
||||
#[cfg_attr(feature = "std", error("invalid amount of key images"))]
|
||||
InvalidAmountOfKeyImages,
|
||||
#[cfg_attr(feature = "std", error("invalid ss"))]
|
||||
InvalidSs,
|
||||
#[cfg_attr(feature = "std", error("key image was identity"))]
|
||||
IdentityKeyImage,
|
||||
#[cfg_attr(feature = "std", error("invalid ci"))]
|
||||
InvalidCi,
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub struct RingMatrix {
|
||||
matrix: Vec<Vec<EdwardsPoint>>,
|
||||
}
|
||||
|
||||
impl RingMatrix {
|
||||
pub fn new(matrix: Vec<Vec<EdwardsPoint>>) -> Result<Self, MlsagError> {
|
||||
// Monero requires that there is more than one ring member for MLSAG signatures:
|
||||
// https://github.com/monero-project/monero/blob/ac02af92867590ca80b2779a7bbeafa99ff94dcb/
|
||||
// src/ringct/rctSigs.cpp#L462
|
||||
if matrix.len() < 2 {
|
||||
Err(MlsagError::InvalidRing)?;
|
||||
}
|
||||
for member in &matrix {
|
||||
if member.is_empty() || (member.len() != matrix[0].len()) {
|
||||
Err(MlsagError::InvalidRing)?;
|
||||
}
|
||||
}
|
||||
|
||||
Ok(RingMatrix { matrix })
|
||||
}
|
||||
|
||||
/// Construct a ring matrix for an individual output.
|
||||
pub fn individual(
|
||||
ring: &[[EdwardsPoint; 2]],
|
||||
pseudo_out: EdwardsPoint,
|
||||
) -> Result<Self, MlsagError> {
|
||||
let mut matrix = Vec::with_capacity(ring.len());
|
||||
for ring_member in ring {
|
||||
matrix.push(vec![ring_member[0], ring_member[1] - pseudo_out]);
|
||||
}
|
||||
RingMatrix::new(matrix)
|
||||
}
|
||||
|
||||
pub fn iter(&self) -> impl Iterator<Item = &[EdwardsPoint]> {
|
||||
self.matrix.iter().map(AsRef::as_ref)
|
||||
}
|
||||
|
||||
/// Return the amount of members in the ring.
|
||||
pub fn members(&self) -> usize {
|
||||
self.matrix.len()
|
||||
}
|
||||
|
||||
/// Returns the length of a ring member.
|
||||
///
|
||||
/// A ring member is a vector of points for which the signer knows all of the discrete logarithms
|
||||
/// of.
|
||||
pub fn member_len(&self) -> usize {
|
||||
// this is safe to do as the constructors don't allow empty rings
|
||||
self.matrix[0].len()
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub struct Mlsag {
|
||||
pub ss: Vec<Vec<Scalar>>,
|
||||
pub cc: Scalar,
|
||||
}
|
||||
|
||||
impl Mlsag {
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
for ss in &self.ss {
|
||||
write_raw_vec(write_scalar, ss, w)?;
|
||||
}
|
||||
write_scalar(&self.cc, w)
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(mixins: usize, ss_2_elements: usize, r: &mut R) -> io::Result<Mlsag> {
|
||||
Ok(Mlsag {
|
||||
ss: (0 .. mixins)
|
||||
.map(|_| read_raw_vec(read_scalar, ss_2_elements, r))
|
||||
.collect::<Result<_, _>>()?,
|
||||
cc: read_scalar(r)?,
|
||||
})
|
||||
}
|
||||
|
||||
pub fn verify(
|
||||
&self,
|
||||
msg: &[u8; 32],
|
||||
ring: &RingMatrix,
|
||||
key_images: &[EdwardsPoint],
|
||||
) -> Result<(), MlsagError> {
|
||||
// Mlsag allows for layers to not need linkability, hence they don't need key images
|
||||
// Monero requires that there is always only 1 non-linkable layer - the amount commitments.
|
||||
if ring.member_len() != (key_images.len() + 1) {
|
||||
Err(MlsagError::InvalidAmountOfKeyImages)?;
|
||||
}
|
||||
|
||||
let mut buf = Vec::with_capacity(6 * 32);
|
||||
buf.extend_from_slice(msg);
|
||||
|
||||
let mut ci = self.cc;
|
||||
|
||||
// This is an iterator over the key images as options with an added entry of `None` at the
|
||||
// end for the non-linkable layer
|
||||
let key_images_iter = key_images.iter().map(|ki| Some(*ki)).chain(core::iter::once(None));
|
||||
|
||||
if ring.matrix.len() != self.ss.len() {
|
||||
Err(MlsagError::InvalidSs)?;
|
||||
}
|
||||
|
||||
for (ring_member, ss) in ring.iter().zip(&self.ss) {
|
||||
if ring_member.len() != ss.len() {
|
||||
Err(MlsagError::InvalidSs)?;
|
||||
}
|
||||
|
||||
for ((ring_member_entry, s), ki) in ring_member.iter().zip(ss).zip(key_images_iter.clone()) {
|
||||
#[allow(non_snake_case)]
|
||||
let L = EdwardsPoint::vartime_double_scalar_mul_basepoint(&ci, ring_member_entry, s);
|
||||
|
||||
buf.extend_from_slice(ring_member_entry.compress().as_bytes());
|
||||
buf.extend_from_slice(L.compress().as_bytes());
|
||||
|
||||
// Not all dimensions need to be linkable, e.g. commitments, and only linkable layers need
|
||||
// to have key images.
|
||||
if let Some(ki) = ki {
|
||||
if ki.is_identity() {
|
||||
Err(MlsagError::IdentityKeyImage)?;
|
||||
}
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
let R = (s * hash_to_point(ring_member_entry)) + (ci * ki);
|
||||
buf.extend_from_slice(R.compress().as_bytes());
|
||||
}
|
||||
}
|
||||
|
||||
ci = hash_to_scalar(&buf);
|
||||
// keep the msg in the buffer.
|
||||
buf.drain(msg.len() ..);
|
||||
}
|
||||
|
||||
if ci != self.cc {
|
||||
Err(MlsagError::InvalidCi)?
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
}
|
||||
|
||||
/// An aggregate ring matrix builder, usable to set up the ring matrix to prove/verify an aggregate
|
||||
/// MLSAG signature.
|
||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub struct AggregateRingMatrixBuilder {
|
||||
key_ring: Vec<Vec<EdwardsPoint>>,
|
||||
amounts_ring: Vec<EdwardsPoint>,
|
||||
sum_out: EdwardsPoint,
|
||||
}
|
||||
|
||||
impl AggregateRingMatrixBuilder {
|
||||
/// Create a new AggregateRingMatrixBuilder.
|
||||
///
|
||||
/// Takes in the transaction's outputs; commitments and fee.
|
||||
pub fn new(commitments: &[EdwardsPoint], fee: u64) -> Self {
|
||||
AggregateRingMatrixBuilder {
|
||||
key_ring: vec![],
|
||||
amounts_ring: vec![],
|
||||
sum_out: commitments.iter().sum::<EdwardsPoint>() + (H() * Scalar::from(fee)),
|
||||
}
|
||||
}
|
||||
|
||||
/// Push a ring of [output key, commitment] to the matrix.
|
||||
pub fn push_ring(&mut self, ring: &[[EdwardsPoint; 2]]) -> Result<(), MlsagError> {
|
||||
if self.key_ring.is_empty() {
|
||||
self.key_ring = vec![vec![]; ring.len()];
|
||||
// Now that we know the length of the ring, fill the `amounts_ring`.
|
||||
self.amounts_ring = vec![-self.sum_out; ring.len()];
|
||||
}
|
||||
|
||||
if (self.amounts_ring.len() != ring.len()) || ring.is_empty() {
|
||||
// All the rings in an aggregate matrix must be the same length.
|
||||
return Err(MlsagError::InvalidRing);
|
||||
}
|
||||
|
||||
for (i, ring_member) in ring.iter().enumerate() {
|
||||
self.key_ring[i].push(ring_member[0]);
|
||||
self.amounts_ring[i] += ring_member[1]
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
/// Build and return the [`RingMatrix`]
|
||||
pub fn build(mut self) -> Result<RingMatrix, MlsagError> {
|
||||
for (i, amount_commitment) in self.amounts_ring.drain(..).enumerate() {
|
||||
self.key_ring[i].push(amount_commitment);
|
||||
}
|
||||
RingMatrix::new(self.key_ring)
|
||||
}
|
||||
}
|
||||
400
coins/monero/src/ringct/mod.rs
Normal file
400
coins/monero/src/ringct/mod.rs
Normal file
@@ -0,0 +1,400 @@
|
||||
use core::ops::Deref;
|
||||
use std_shims::{
|
||||
vec::Vec,
|
||||
io::{self, Read, Write},
|
||||
};
|
||||
|
||||
use zeroize::{Zeroize, Zeroizing};
|
||||
|
||||
use curve25519_dalek::{constants::ED25519_BASEPOINT_TABLE, scalar::Scalar, edwards::EdwardsPoint};
|
||||
|
||||
pub(crate) mod hash_to_point;
|
||||
pub use hash_to_point::{raw_hash_to_point, hash_to_point};
|
||||
|
||||
/// MLSAG struct, along with verifying functionality.
|
||||
pub mod mlsag;
|
||||
/// CLSAG struct, along with signing and verifying functionality.
|
||||
pub mod clsag;
|
||||
/// BorromeanRange struct, along with verifying functionality.
|
||||
pub mod borromean;
|
||||
/// Bulletproofs(+) structs, along with proving and verifying functionality.
|
||||
pub mod bulletproofs;
|
||||
|
||||
use crate::{
|
||||
Protocol,
|
||||
serialize::*,
|
||||
ringct::{mlsag::Mlsag, clsag::Clsag, borromean::BorromeanRange, bulletproofs::Bulletproofs},
|
||||
};
|
||||
|
||||
/// Generate a key image for a given key. Defined as `x * hash_to_point(xG)`.
|
||||
pub fn generate_key_image(secret: &Zeroizing<Scalar>) -> EdwardsPoint {
|
||||
hash_to_point(&(ED25519_BASEPOINT_TABLE * secret.deref())) * secret.deref()
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub enum EncryptedAmount {
|
||||
Original { mask: [u8; 32], amount: [u8; 32] },
|
||||
Compact { amount: [u8; 8] },
|
||||
}
|
||||
|
||||
impl EncryptedAmount {
|
||||
pub fn read<R: Read>(compact: bool, r: &mut R) -> io::Result<EncryptedAmount> {
|
||||
Ok(if !compact {
|
||||
EncryptedAmount::Original { mask: read_bytes(r)?, amount: read_bytes(r)? }
|
||||
} else {
|
||||
EncryptedAmount::Compact { amount: read_bytes(r)? }
|
||||
})
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
match self {
|
||||
EncryptedAmount::Original { mask, amount } => {
|
||||
w.write_all(mask)?;
|
||||
w.write_all(amount)
|
||||
}
|
||||
EncryptedAmount::Compact { amount } => w.write_all(amount),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, Copy, PartialEq, Eq, Debug, Zeroize)]
|
||||
pub enum RctType {
|
||||
/// No RCT proofs.
|
||||
Null,
|
||||
/// One MLSAG for multiple inputs and Borromean range proofs (RCTTypeFull).
|
||||
MlsagAggregate,
|
||||
// One MLSAG for each input and a Borromean range proof (RCTTypeSimple).
|
||||
MlsagIndividual,
|
||||
// One MLSAG for each input and a Bulletproof (RCTTypeBulletproof).
|
||||
Bulletproofs,
|
||||
/// One MLSAG for each input and a Bulletproof, yet starting to use EncryptedAmount::Compact
|
||||
/// (RCTTypeBulletproof2).
|
||||
BulletproofsCompactAmount,
|
||||
/// One CLSAG for each input and a Bulletproof (RCTTypeCLSAG).
|
||||
Clsag,
|
||||
/// One CLSAG for each input and a Bulletproof+ (RCTTypeBulletproofPlus).
|
||||
BulletproofsPlus,
|
||||
}
|
||||
|
||||
impl RctType {
|
||||
pub fn to_byte(self) -> u8 {
|
||||
match self {
|
||||
RctType::Null => 0,
|
||||
RctType::MlsagAggregate => 1,
|
||||
RctType::MlsagIndividual => 2,
|
||||
RctType::Bulletproofs => 3,
|
||||
RctType::BulletproofsCompactAmount => 4,
|
||||
RctType::Clsag => 5,
|
||||
RctType::BulletproofsPlus => 6,
|
||||
}
|
||||
}
|
||||
|
||||
pub fn from_byte(byte: u8) -> Option<Self> {
|
||||
Some(match byte {
|
||||
0 => RctType::Null,
|
||||
1 => RctType::MlsagAggregate,
|
||||
2 => RctType::MlsagIndividual,
|
||||
3 => RctType::Bulletproofs,
|
||||
4 => RctType::BulletproofsCompactAmount,
|
||||
5 => RctType::Clsag,
|
||||
6 => RctType::BulletproofsPlus,
|
||||
_ => None?,
|
||||
})
|
||||
}
|
||||
|
||||
pub fn compact_encrypted_amounts(&self) -> bool {
|
||||
match self {
|
||||
RctType::Null |
|
||||
RctType::MlsagAggregate |
|
||||
RctType::MlsagIndividual |
|
||||
RctType::Bulletproofs => false,
|
||||
RctType::BulletproofsCompactAmount | RctType::Clsag | RctType::BulletproofsPlus => true,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct RctBase {
|
||||
pub fee: u64,
|
||||
pub pseudo_outs: Vec<EdwardsPoint>,
|
||||
pub encrypted_amounts: Vec<EncryptedAmount>,
|
||||
pub commitments: Vec<EdwardsPoint>,
|
||||
}
|
||||
|
||||
impl RctBase {
|
||||
pub(crate) fn fee_weight(outputs: usize, fee: u64) -> usize {
|
||||
// 1 byte for the RCT signature type
|
||||
1 + (outputs * (8 + 32)) + varint_len(fee)
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W, rct_type: RctType) -> io::Result<()> {
|
||||
w.write_all(&[rct_type.to_byte()])?;
|
||||
match rct_type {
|
||||
RctType::Null => Ok(()),
|
||||
_ => {
|
||||
write_varint(&self.fee, w)?;
|
||||
if rct_type == RctType::MlsagIndividual {
|
||||
write_raw_vec(write_point, &self.pseudo_outs, w)?;
|
||||
}
|
||||
for encrypted_amount in &self.encrypted_amounts {
|
||||
encrypted_amount.write(w)?;
|
||||
}
|
||||
write_raw_vec(write_point, &self.commitments, w)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(inputs: usize, outputs: usize, r: &mut R) -> io::Result<(RctBase, RctType)> {
|
||||
let rct_type =
|
||||
RctType::from_byte(read_byte(r)?).ok_or_else(|| io::Error::other("invalid RCT type"))?;
|
||||
|
||||
match rct_type {
|
||||
RctType::Null | RctType::MlsagAggregate | RctType::MlsagIndividual => {}
|
||||
RctType::Bulletproofs |
|
||||
RctType::BulletproofsCompactAmount |
|
||||
RctType::Clsag |
|
||||
RctType::BulletproofsPlus => {
|
||||
if outputs == 0 {
|
||||
// Because the Bulletproofs(+) layout must be canonical, there must be 1 Bulletproof if
|
||||
// Bulletproofs are in use
|
||||
// If there are Bulletproofs, there must be a matching amount of outputs, implicitly
|
||||
// banning 0 outputs
|
||||
// Since HF 12 (CLSAG being 13), a 2-output minimum has also been enforced
|
||||
Err(io::Error::other("RCT with Bulletproofs(+) had 0 outputs"))?;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
Ok((
|
||||
if rct_type == RctType::Null {
|
||||
RctBase { fee: 0, pseudo_outs: vec![], encrypted_amounts: vec![], commitments: vec![] }
|
||||
} else {
|
||||
RctBase {
|
||||
fee: read_varint(r)?,
|
||||
pseudo_outs: if rct_type == RctType::MlsagIndividual {
|
||||
read_raw_vec(read_point, inputs, r)?
|
||||
} else {
|
||||
vec![]
|
||||
},
|
||||
encrypted_amounts: (0 .. outputs)
|
||||
.map(|_| EncryptedAmount::read(rct_type.compact_encrypted_amounts(), r))
|
||||
.collect::<Result<_, _>>()?,
|
||||
commitments: read_raw_vec(read_point, outputs, r)?,
|
||||
}
|
||||
},
|
||||
rct_type,
|
||||
))
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub enum RctPrunable {
|
||||
Null,
|
||||
AggregateMlsagBorromean {
|
||||
borromean: Vec<BorromeanRange>,
|
||||
mlsag: Mlsag,
|
||||
},
|
||||
MlsagBorromean {
|
||||
borromean: Vec<BorromeanRange>,
|
||||
mlsags: Vec<Mlsag>,
|
||||
},
|
||||
MlsagBulletproofs {
|
||||
bulletproofs: Bulletproofs,
|
||||
mlsags: Vec<Mlsag>,
|
||||
pseudo_outs: Vec<EdwardsPoint>,
|
||||
},
|
||||
Clsag {
|
||||
bulletproofs: Bulletproofs,
|
||||
clsags: Vec<Clsag>,
|
||||
pseudo_outs: Vec<EdwardsPoint>,
|
||||
},
|
||||
}
|
||||
|
||||
impl RctPrunable {
|
||||
pub(crate) fn fee_weight(protocol: Protocol, inputs: usize, outputs: usize) -> usize {
|
||||
// 1 byte for number of BPs (technically a VarInt, yet there's always just zero or one)
|
||||
1 + Bulletproofs::fee_weight(protocol.bp_plus(), outputs) +
|
||||
(inputs * (Clsag::fee_weight(protocol.ring_len()) + 32))
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W, rct_type: RctType) -> io::Result<()> {
|
||||
match self {
|
||||
RctPrunable::Null => Ok(()),
|
||||
RctPrunable::AggregateMlsagBorromean { borromean, mlsag } => {
|
||||
write_raw_vec(BorromeanRange::write, borromean, w)?;
|
||||
mlsag.write(w)
|
||||
}
|
||||
RctPrunable::MlsagBorromean { borromean, mlsags } => {
|
||||
write_raw_vec(BorromeanRange::write, borromean, w)?;
|
||||
write_raw_vec(Mlsag::write, mlsags, w)
|
||||
}
|
||||
RctPrunable::MlsagBulletproofs { bulletproofs, mlsags, pseudo_outs } => {
|
||||
if rct_type == RctType::Bulletproofs {
|
||||
w.write_all(&1u32.to_le_bytes())?;
|
||||
} else {
|
||||
w.write_all(&[1])?;
|
||||
}
|
||||
bulletproofs.write(w)?;
|
||||
|
||||
write_raw_vec(Mlsag::write, mlsags, w)?;
|
||||
write_raw_vec(write_point, pseudo_outs, w)
|
||||
}
|
||||
RctPrunable::Clsag { bulletproofs, clsags, pseudo_outs } => {
|
||||
w.write_all(&[1])?;
|
||||
bulletproofs.write(w)?;
|
||||
|
||||
write_raw_vec(Clsag::write, clsags, w)?;
|
||||
write_raw_vec(write_point, pseudo_outs, w)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub fn serialize(&self, rct_type: RctType) -> Vec<u8> {
|
||||
let mut serialized = vec![];
|
||||
self.write(&mut serialized, rct_type).unwrap();
|
||||
serialized
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(
|
||||
rct_type: RctType,
|
||||
ring_length: usize,
|
||||
inputs: usize,
|
||||
outputs: usize,
|
||||
r: &mut R,
|
||||
) -> io::Result<RctPrunable> {
|
||||
// While we generally don't bother with misc consensus checks, this affects the safety of
|
||||
// the below defined rct_type function
|
||||
// The exact line preventing zero-input transactions is:
|
||||
// https://github.com/monero-project/monero/blob/00fd416a99686f0956361d1cd0337fe56e58d4a7/
|
||||
// src/ringct/rctSigs.cpp#L609
|
||||
// And then for RctNull, that's only allowed for miner TXs which require one input of
|
||||
// Input::Gen
|
||||
if inputs == 0 {
|
||||
Err(io::Error::other("transaction had no inputs"))?;
|
||||
}
|
||||
|
||||
Ok(match rct_type {
|
||||
RctType::Null => RctPrunable::Null,
|
||||
RctType::MlsagAggregate => RctPrunable::AggregateMlsagBorromean {
|
||||
borromean: read_raw_vec(BorromeanRange::read, outputs, r)?,
|
||||
mlsag: Mlsag::read(ring_length, inputs + 1, r)?,
|
||||
},
|
||||
RctType::MlsagIndividual => RctPrunable::MlsagBorromean {
|
||||
borromean: read_raw_vec(BorromeanRange::read, outputs, r)?,
|
||||
mlsags: (0 .. inputs).map(|_| Mlsag::read(ring_length, 2, r)).collect::<Result<_, _>>()?,
|
||||
},
|
||||
RctType::Bulletproofs | RctType::BulletproofsCompactAmount => {
|
||||
RctPrunable::MlsagBulletproofs {
|
||||
bulletproofs: {
|
||||
if (if rct_type == RctType::Bulletproofs {
|
||||
u64::from(read_u32(r)?)
|
||||
} else {
|
||||
read_varint(r)?
|
||||
}) != 1
|
||||
{
|
||||
Err(io::Error::other("n bulletproofs instead of one"))?;
|
||||
}
|
||||
Bulletproofs::read(r)?
|
||||
},
|
||||
mlsags: (0 .. inputs)
|
||||
.map(|_| Mlsag::read(ring_length, 2, r))
|
||||
.collect::<Result<_, _>>()?,
|
||||
pseudo_outs: read_raw_vec(read_point, inputs, r)?,
|
||||
}
|
||||
}
|
||||
RctType::Clsag | RctType::BulletproofsPlus => RctPrunable::Clsag {
|
||||
bulletproofs: {
|
||||
if read_varint::<_, u64>(r)? != 1 {
|
||||
Err(io::Error::other("n bulletproofs instead of one"))?;
|
||||
}
|
||||
(if rct_type == RctType::Clsag { Bulletproofs::read } else { Bulletproofs::read_plus })(
|
||||
r,
|
||||
)?
|
||||
},
|
||||
clsags: (0 .. inputs).map(|_| Clsag::read(ring_length, r)).collect::<Result<_, _>>()?,
|
||||
pseudo_outs: read_raw_vec(read_point, inputs, r)?,
|
||||
},
|
||||
})
|
||||
}
|
||||
|
||||
pub(crate) fn signature_write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
match self {
|
||||
RctPrunable::Null => panic!("Serializing RctPrunable::Null for a signature"),
|
||||
RctPrunable::AggregateMlsagBorromean { borromean, .. } |
|
||||
RctPrunable::MlsagBorromean { borromean, .. } => {
|
||||
borromean.iter().try_for_each(|rs| rs.write(w))
|
||||
}
|
||||
RctPrunable::MlsagBulletproofs { bulletproofs, .. } |
|
||||
RctPrunable::Clsag { bulletproofs, .. } => bulletproofs.signature_write(w),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
pub struct RctSignatures {
|
||||
pub base: RctBase,
|
||||
pub prunable: RctPrunable,
|
||||
}
|
||||
|
||||
impl RctSignatures {
|
||||
/// RctType for a given RctSignatures struct.
|
||||
pub fn rct_type(&self) -> RctType {
|
||||
match &self.prunable {
|
||||
RctPrunable::Null => RctType::Null,
|
||||
RctPrunable::AggregateMlsagBorromean { .. } => RctType::MlsagAggregate,
|
||||
RctPrunable::MlsagBorromean { .. } => RctType::MlsagIndividual,
|
||||
// RctBase ensures there's at least one output, making the following
|
||||
// inferences guaranteed/expects impossible on any valid RctSignatures
|
||||
RctPrunable::MlsagBulletproofs { .. } => {
|
||||
if matches!(
|
||||
self
|
||||
.base
|
||||
.encrypted_amounts
|
||||
.first()
|
||||
.expect("MLSAG with Bulletproofs didn't have any outputs"),
|
||||
EncryptedAmount::Original { .. }
|
||||
) {
|
||||
RctType::Bulletproofs
|
||||
} else {
|
||||
RctType::BulletproofsCompactAmount
|
||||
}
|
||||
}
|
||||
RctPrunable::Clsag { bulletproofs, .. } => {
|
||||
if matches!(bulletproofs, Bulletproofs::Original { .. }) {
|
||||
RctType::Clsag
|
||||
} else {
|
||||
RctType::BulletproofsPlus
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn fee_weight(protocol: Protocol, inputs: usize, outputs: usize, fee: u64) -> usize {
|
||||
RctBase::fee_weight(outputs, fee) + RctPrunable::fee_weight(protocol, inputs, outputs)
|
||||
}
|
||||
|
||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||
let rct_type = self.rct_type();
|
||||
self.base.write(w, rct_type)?;
|
||||
self.prunable.write(w, rct_type)
|
||||
}
|
||||
|
||||
pub fn serialize(&self) -> Vec<u8> {
|
||||
let mut serialized = vec![];
|
||||
self.write(&mut serialized).unwrap();
|
||||
serialized
|
||||
}
|
||||
|
||||
pub fn read<R: Read>(
|
||||
ring_length: usize,
|
||||
inputs: usize,
|
||||
outputs: usize,
|
||||
r: &mut R,
|
||||
) -> io::Result<RctSignatures> {
|
||||
let base = RctBase::read(inputs, outputs, r)?;
|
||||
Ok(RctSignatures {
|
||||
base: base.0,
|
||||
prunable: RctPrunable::read(base.1, ring_length, inputs, outputs, r)?,
|
||||
})
|
||||
}
|
||||
}
|
||||
286
coins/monero/src/rpc/http.rs
Normal file
286
coins/monero/src/rpc/http.rs
Normal file
@@ -0,0 +1,286 @@
|
||||
use std::{sync::Arc, io::Read, time::Duration};
|
||||
|
||||
use async_trait::async_trait;
|
||||
|
||||
use tokio::sync::Mutex;
|
||||
|
||||
use digest_auth::{WwwAuthenticateHeader, AuthContext};
|
||||
use simple_request::{
|
||||
hyper::{StatusCode, header::HeaderValue, Request},
|
||||
Response, Client,
|
||||
};
|
||||
|
||||
use crate::rpc::{RpcError, RpcConnection, Rpc};
|
||||
|
||||
const DEFAULT_TIMEOUT: Duration = Duration::from_secs(30);
|
||||
|
||||
#[derive(Clone, Debug)]
|
||||
enum Authentication {
|
||||
// If unauthenticated, use a single client
|
||||
Unauthenticated(Client),
|
||||
// If authenticated, use a single client which supports being locked and tracks its nonce
|
||||
// This ensures that if a nonce is requested, another caller doesn't make a request invalidating
|
||||
// it
|
||||
Authenticated {
|
||||
username: String,
|
||||
password: String,
|
||||
#[allow(clippy::type_complexity)]
|
||||
connection: Arc<Mutex<(Option<(WwwAuthenticateHeader, u64)>, Client)>>,
|
||||
},
|
||||
}
|
||||
|
||||
/// An HTTP(S) transport for the RPC.
|
||||
///
|
||||
/// Requires tokio.
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct HttpRpc {
|
||||
authentication: Authentication,
|
||||
url: String,
|
||||
request_timeout: Duration,
|
||||
}
|
||||
|
||||
impl HttpRpc {
|
||||
fn digest_auth_challenge(
|
||||
response: &Response,
|
||||
) -> Result<Option<(WwwAuthenticateHeader, u64)>, RpcError> {
|
||||
Ok(if let Some(header) = response.headers().get("www-authenticate") {
|
||||
Some((
|
||||
digest_auth::parse(header.to_str().map_err(|_| {
|
||||
RpcError::InvalidNode("www-authenticate header wasn't a string".to_string())
|
||||
})?)
|
||||
.map_err(|_| RpcError::InvalidNode("invalid digest-auth response".to_string()))?,
|
||||
0,
|
||||
))
|
||||
} else {
|
||||
None
|
||||
})
|
||||
}
|
||||
|
||||
/// Create a new HTTP(S) RPC connection.
|
||||
///
|
||||
/// A daemon requiring authentication can be used via including the username and password in the
|
||||
/// URL.
|
||||
pub async fn new(url: String) -> Result<Rpc<HttpRpc>, RpcError> {
|
||||
Self::with_custom_timeout(url, DEFAULT_TIMEOUT).await
|
||||
}
|
||||
|
||||
/// Create a new HTTP(S) RPC connection with a custom timeout.
|
||||
///
|
||||
/// A daemon requiring authentication can be used via including the username and password in the
|
||||
/// URL.
|
||||
pub async fn with_custom_timeout(
|
||||
mut url: String,
|
||||
request_timeout: Duration,
|
||||
) -> Result<Rpc<HttpRpc>, RpcError> {
|
||||
let authentication = if url.contains('@') {
|
||||
// Parse out the username and password
|
||||
let url_clone = url;
|
||||
let split_url = url_clone.split('@').collect::<Vec<_>>();
|
||||
if split_url.len() != 2 {
|
||||
Err(RpcError::ConnectionError("invalid amount of login specifications".to_string()))?;
|
||||
}
|
||||
let mut userpass = split_url[0];
|
||||
url = split_url[1].to_string();
|
||||
|
||||
// If there was additionally a protocol string, restore that to the daemon URL
|
||||
if userpass.contains("://") {
|
||||
let split_userpass = userpass.split("://").collect::<Vec<_>>();
|
||||
if split_userpass.len() != 2 {
|
||||
Err(RpcError::ConnectionError("invalid amount of protocol specifications".to_string()))?;
|
||||
}
|
||||
url = split_userpass[0].to_string() + "://" + &url;
|
||||
userpass = split_userpass[1];
|
||||
}
|
||||
|
||||
let split_userpass = userpass.split(':').collect::<Vec<_>>();
|
||||
if split_userpass.len() > 2 {
|
||||
Err(RpcError::ConnectionError("invalid amount of passwords".to_string()))?;
|
||||
}
|
||||
|
||||
let client = Client::without_connection_pool(&url)
|
||||
.map_err(|_| RpcError::ConnectionError("invalid URL".to_string()))?;
|
||||
// Obtain the initial challenge, which also somewhat validates this connection
|
||||
let challenge = Self::digest_auth_challenge(
|
||||
&client
|
||||
.request(
|
||||
Request::post(url.clone())
|
||||
.body(vec![].into())
|
||||
.map_err(|e| RpcError::ConnectionError(format!("couldn't make request: {e:?}")))?,
|
||||
)
|
||||
.await
|
||||
.map_err(|e| RpcError::ConnectionError(format!("{e:?}")))?,
|
||||
)?;
|
||||
Authentication::Authenticated {
|
||||
username: split_userpass[0].to_string(),
|
||||
password: (*split_userpass.get(1).unwrap_or(&"")).to_string(),
|
||||
connection: Arc::new(Mutex::new((challenge, client))),
|
||||
}
|
||||
} else {
|
||||
Authentication::Unauthenticated(Client::with_connection_pool())
|
||||
};
|
||||
|
||||
Ok(Rpc(HttpRpc { authentication, url, request_timeout }))
|
||||
}
|
||||
}
|
||||
|
||||
impl HttpRpc {
|
||||
async fn inner_post(&self, route: &str, body: Vec<u8>) -> Result<Vec<u8>, RpcError> {
|
||||
let request_fn = |uri| {
|
||||
Request::post(uri)
|
||||
.body(body.clone().into())
|
||||
.map_err(|e| RpcError::ConnectionError(format!("couldn't make request: {e:?}")))
|
||||
};
|
||||
|
||||
async fn body_from_response(response: Response<'_>) -> Result<Vec<u8>, RpcError> {
|
||||
/*
|
||||
let length = usize::try_from(
|
||||
response
|
||||
.headers()
|
||||
.get("content-length")
|
||||
.ok_or(RpcError::InvalidNode("no content-length header"))?
|
||||
.to_str()
|
||||
.map_err(|_| RpcError::InvalidNode("non-ascii content-length value"))?
|
||||
.parse::<u32>()
|
||||
.map_err(|_| RpcError::InvalidNode("non-u32 content-length value"))?,
|
||||
)
|
||||
.unwrap();
|
||||
// Only pre-allocate 1 MB so a malicious node which claims a content-length of 1 GB actually
|
||||
// has to send 1 GB of data to cause a 1 GB allocation
|
||||
let mut res = Vec::with_capacity(length.max(1024 * 1024));
|
||||
let mut body = response.into_body();
|
||||
while res.len() < length {
|
||||
let Some(data) = body.data().await else { break };
|
||||
res.extend(data.map_err(|e| RpcError::ConnectionError(format!("{e:?}")))?.as_ref());
|
||||
}
|
||||
*/
|
||||
|
||||
let mut res = Vec::with_capacity(128);
|
||||
response
|
||||
.body()
|
||||
.await
|
||||
.map_err(|e| RpcError::ConnectionError(format!("{e:?}")))?
|
||||
.read_to_end(&mut res)
|
||||
.unwrap();
|
||||
Ok(res)
|
||||
}
|
||||
|
||||
for attempt in 0 .. 2 {
|
||||
return Ok(match &self.authentication {
|
||||
Authentication::Unauthenticated(client) => {
|
||||
body_from_response(
|
||||
client
|
||||
.request(request_fn(self.url.clone() + "/" + route)?)
|
||||
.await
|
||||
.map_err(|e| RpcError::ConnectionError(format!("{e:?}")))?,
|
||||
)
|
||||
.await?
|
||||
}
|
||||
Authentication::Authenticated { username, password, connection } => {
|
||||
let mut connection_lock = connection.lock().await;
|
||||
|
||||
let mut request = request_fn("/".to_string() + route)?;
|
||||
|
||||
// If we don't have an auth challenge, obtain one
|
||||
if connection_lock.0.is_none() {
|
||||
connection_lock.0 = Self::digest_auth_challenge(
|
||||
&connection_lock
|
||||
.1
|
||||
.request(request)
|
||||
.await
|
||||
.map_err(|e| RpcError::ConnectionError(format!("{e:?}")))?,
|
||||
)?;
|
||||
request = request_fn("/".to_string() + route)?;
|
||||
}
|
||||
|
||||
// Insert the challenge response, if we have a challenge
|
||||
if let Some((challenge, cnonce)) = connection_lock.0.as_mut() {
|
||||
// Update the cnonce
|
||||
// Overflow isn't a concern as this is a u64
|
||||
*cnonce += 1;
|
||||
|
||||
let mut context = AuthContext::new_post::<_, _, _, &[u8]>(
|
||||
username,
|
||||
password,
|
||||
"/".to_string() + route,
|
||||
None,
|
||||
);
|
||||
context.set_custom_cnonce(hex::encode(cnonce.to_le_bytes()));
|
||||
|
||||
request.headers_mut().insert(
|
||||
"Authorization",
|
||||
HeaderValue::from_str(
|
||||
&challenge
|
||||
.respond(&context)
|
||||
.map_err(|_| {
|
||||
RpcError::InvalidNode("couldn't respond to digest-auth challenge".to_string())
|
||||
})?
|
||||
.to_header_string(),
|
||||
)
|
||||
.unwrap(),
|
||||
);
|
||||
}
|
||||
|
||||
let response = connection_lock
|
||||
.1
|
||||
.request(request)
|
||||
.await
|
||||
.map_err(|e| RpcError::ConnectionError(format!("{e:?}")));
|
||||
|
||||
let (error, is_stale) = match &response {
|
||||
Err(e) => (Some(e.clone()), false),
|
||||
Ok(response) => (
|
||||
None,
|
||||
if response.status() == StatusCode::UNAUTHORIZED {
|
||||
if let Some(header) = response.headers().get("www-authenticate") {
|
||||
header
|
||||
.to_str()
|
||||
.map_err(|_| {
|
||||
RpcError::InvalidNode("www-authenticate header wasn't a string".to_string())
|
||||
})?
|
||||
.contains("stale")
|
||||
} else {
|
||||
false
|
||||
}
|
||||
} else {
|
||||
false
|
||||
},
|
||||
),
|
||||
};
|
||||
|
||||
// If the connection entered an error state, drop the cached challenge as challenges are
|
||||
// per-connection
|
||||
// We don't need to create a new connection as simple-request will for us
|
||||
if error.is_some() || is_stale {
|
||||
connection_lock.0 = None;
|
||||
// If we're not already on our second attempt, move to the next loop iteration
|
||||
// (retrying all of this once)
|
||||
if attempt == 0 {
|
||||
continue;
|
||||
}
|
||||
if let Some(e) = error {
|
||||
Err(e)?
|
||||
} else {
|
||||
debug_assert!(is_stale);
|
||||
Err(RpcError::InvalidNode(
|
||||
"node claimed fresh connection had stale authentication".to_string(),
|
||||
))?
|
||||
}
|
||||
} else {
|
||||
body_from_response(response.unwrap()).await?
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
unreachable!()
|
||||
}
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
impl RpcConnection for HttpRpc {
|
||||
async fn post(&self, route: &str, body: Vec<u8>) -> Result<Vec<u8>, RpcError> {
|
||||
tokio::time::timeout(self.request_timeout, self.inner_post(route, body))
|
||||
.await
|
||||
.map_err(|e| RpcError::ConnectionError(format!("{e:?}")))?
|
||||
}
|
||||
}
|
||||
761
coins/monero/src/rpc/mod.rs
Normal file
761
coins/monero/src/rpc/mod.rs
Normal file
@@ -0,0 +1,761 @@
|
||||
use core::fmt::Debug;
|
||||
#[cfg(not(feature = "std"))]
|
||||
use alloc::boxed::Box;
|
||||
use std_shims::{
|
||||
vec::Vec,
|
||||
io,
|
||||
string::{String, ToString},
|
||||
};
|
||||
|
||||
use async_trait::async_trait;
|
||||
|
||||
use curve25519_dalek::edwards::EdwardsPoint;
|
||||
|
||||
use monero_generators::decompress_point;
|
||||
|
||||
use serde::{Serialize, Deserialize, de::DeserializeOwned};
|
||||
use serde_json::{Value, json};
|
||||
|
||||
use crate::{
|
||||
Protocol,
|
||||
serialize::*,
|
||||
transaction::{Input, Timelock, Transaction},
|
||||
block::Block,
|
||||
wallet::{FeePriority, Fee},
|
||||
};
|
||||
|
||||
#[cfg(feature = "http-rpc")]
|
||||
mod http;
|
||||
#[cfg(feature = "http-rpc")]
|
||||
pub use http::*;
|
||||
|
||||
// Number of blocks the fee estimate will be valid for
|
||||
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
|
||||
// src/wallet/wallet2.cpp#L121
|
||||
const GRACE_BLOCKS_FOR_FEE_ESTIMATE: u64 = 10;
|
||||
|
||||
#[derive(Deserialize, Debug)]
|
||||
pub struct EmptyResponse {}
|
||||
#[derive(Deserialize, Debug)]
|
||||
pub struct JsonRpcResponse<T> {
|
||||
result: T,
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct TransactionResponse {
|
||||
tx_hash: String,
|
||||
as_hex: String,
|
||||
pruned_as_hex: String,
|
||||
}
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct TransactionsResponse {
|
||||
#[serde(default)]
|
||||
missed_tx: Vec<String>,
|
||||
txs: Vec<TransactionResponse>,
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Debug)]
|
||||
pub struct OutputResponse {
|
||||
pub height: usize,
|
||||
pub unlocked: bool,
|
||||
key: String,
|
||||
mask: String,
|
||||
txid: String,
|
||||
}
|
||||
|
||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||
#[cfg_attr(feature = "std", derive(thiserror::Error))]
|
||||
pub enum RpcError {
|
||||
#[cfg_attr(feature = "std", error("internal error ({0})"))]
|
||||
InternalError(&'static str),
|
||||
#[cfg_attr(feature = "std", error("connection error ({0})"))]
|
||||
ConnectionError(String),
|
||||
#[cfg_attr(feature = "std", error("invalid node ({0})"))]
|
||||
InvalidNode(String),
|
||||
#[cfg_attr(feature = "std", error("unsupported protocol version ({0})"))]
|
||||
UnsupportedProtocol(usize),
|
||||
#[cfg_attr(feature = "std", error("transactions not found"))]
|
||||
TransactionsNotFound(Vec<[u8; 32]>),
|
||||
#[cfg_attr(feature = "std", error("invalid point ({0})"))]
|
||||
InvalidPoint(String),
|
||||
#[cfg_attr(feature = "std", error("pruned transaction"))]
|
||||
PrunedTransaction,
|
||||
#[cfg_attr(feature = "std", error("invalid transaction ({0:?})"))]
|
||||
InvalidTransaction([u8; 32]),
|
||||
#[cfg_attr(feature = "std", error("unexpected fee response"))]
|
||||
InvalidFee,
|
||||
#[cfg_attr(feature = "std", error("invalid priority"))]
|
||||
InvalidPriority,
|
||||
}
|
||||
|
||||
fn rpc_hex(value: &str) -> Result<Vec<u8>, RpcError> {
|
||||
hex::decode(value).map_err(|_| RpcError::InvalidNode("expected hex wasn't hex".to_string()))
|
||||
}
|
||||
|
||||
fn hash_hex(hash: &str) -> Result<[u8; 32], RpcError> {
|
||||
rpc_hex(hash)?.try_into().map_err(|_| RpcError::InvalidNode("hash wasn't 32-bytes".to_string()))
|
||||
}
|
||||
|
||||
fn rpc_point(point: &str) -> Result<EdwardsPoint, RpcError> {
|
||||
decompress_point(
|
||||
rpc_hex(point)?.try_into().map_err(|_| RpcError::InvalidPoint(point.to_string()))?,
|
||||
)
|
||||
.ok_or_else(|| RpcError::InvalidPoint(point.to_string()))
|
||||
}
|
||||
|
||||
// Read an EPEE VarInt, distinct from the VarInts used throughout the rest of the protocol
|
||||
fn read_epee_vi<R: io::Read>(reader: &mut R) -> io::Result<u64> {
|
||||
let vi_start = read_byte(reader)?;
|
||||
let len = match vi_start & 0b11 {
|
||||
0 => 1,
|
||||
1 => 2,
|
||||
2 => 4,
|
||||
3 => 8,
|
||||
_ => unreachable!(),
|
||||
};
|
||||
let mut vi = u64::from(vi_start >> 2);
|
||||
for i in 1 .. len {
|
||||
vi |= u64::from(read_byte(reader)?) << (((i - 1) * 8) + 6);
|
||||
}
|
||||
Ok(vi)
|
||||
}
|
||||
|
||||
#[async_trait]
|
||||
pub trait RpcConnection: Clone + Debug {
|
||||
/// Perform a POST request to the specified route with the specified body.
|
||||
///
|
||||
/// The implementor is left to handle anything such as authentication.
|
||||
async fn post(&self, route: &str, body: Vec<u8>) -> Result<Vec<u8>, RpcError>;
|
||||
}
|
||||
|
||||
// TODO: Make this provided methods for RpcConnection?
|
||||
#[derive(Clone, Debug)]
|
||||
pub struct Rpc<R: RpcConnection>(R);
|
||||
impl<R: RpcConnection> Rpc<R> {
|
||||
/// Perform a RPC call to the specified route with the provided parameters.
|
||||
///
|
||||
/// This is NOT a JSON-RPC call. They use a route of "json_rpc" and are available via
|
||||
/// `json_rpc_call`.
|
||||
pub async fn rpc_call<Params: Serialize + Debug, Response: DeserializeOwned + Debug>(
|
||||
&self,
|
||||
route: &str,
|
||||
params: Option<Params>,
|
||||
) -> Result<Response, RpcError> {
|
||||
let res = self
|
||||
.0
|
||||
.post(
|
||||
route,
|
||||
if let Some(params) = params {
|
||||
serde_json::to_string(¶ms).unwrap().into_bytes()
|
||||
} else {
|
||||
vec![]
|
||||
},
|
||||
)
|
||||
.await?;
|
||||
let res_str = std_shims::str::from_utf8(&res)
|
||||
.map_err(|_| RpcError::InvalidNode("response wasn't utf-8".to_string()))?;
|
||||
serde_json::from_str(res_str)
|
||||
.map_err(|_| RpcError::InvalidNode(format!("response wasn't json: {res_str}")))
|
||||
}
|
||||
|
||||
/// Perform a JSON-RPC call with the specified method with the provided parameters
|
||||
pub async fn json_rpc_call<Response: DeserializeOwned + Debug>(
|
||||
&self,
|
||||
method: &str,
|
||||
params: Option<Value>,
|
||||
) -> Result<Response, RpcError> {
|
||||
let mut req = json!({ "method": method });
|
||||
if let Some(params) = params {
|
||||
req.as_object_mut().unwrap().insert("params".into(), params);
|
||||
}
|
||||
Ok(self.rpc_call::<_, JsonRpcResponse<Response>>("json_rpc", Some(req)).await?.result)
|
||||
}
|
||||
|
||||
/// Perform a binary call to the specified route with the provided parameters.
|
||||
pub async fn bin_call(&self, route: &str, params: Vec<u8>) -> Result<Vec<u8>, RpcError> {
|
||||
self.0.post(route, params).await
|
||||
}
|
||||
|
||||
/// Get the active blockchain protocol version.
|
||||
pub async fn get_protocol(&self) -> Result<Protocol, RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct ProtocolResponse {
|
||||
major_version: usize,
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct LastHeaderResponse {
|
||||
block_header: ProtocolResponse,
|
||||
}
|
||||
|
||||
Ok(
|
||||
match self
|
||||
.json_rpc_call::<LastHeaderResponse>("get_last_block_header", None)
|
||||
.await?
|
||||
.block_header
|
||||
.major_version
|
||||
{
|
||||
13 | 14 => Protocol::v14,
|
||||
15 | 16 => Protocol::v16,
|
||||
protocol => Err(RpcError::UnsupportedProtocol(protocol))?,
|
||||
},
|
||||
)
|
||||
}
|
||||
|
||||
pub async fn get_height(&self) -> Result<usize, RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct HeightResponse {
|
||||
height: usize,
|
||||
}
|
||||
Ok(self.rpc_call::<Option<()>, HeightResponse>("get_height", None).await?.height)
|
||||
}
|
||||
|
||||
pub async fn get_transactions(&self, hashes: &[[u8; 32]]) -> Result<Vec<Transaction>, RpcError> {
|
||||
if hashes.is_empty() {
|
||||
return Ok(vec![]);
|
||||
}
|
||||
|
||||
let mut hashes_hex = hashes.iter().map(hex::encode).collect::<Vec<_>>();
|
||||
let mut all_txs = Vec::with_capacity(hashes.len());
|
||||
while !hashes_hex.is_empty() {
|
||||
// Monero errors if more than 100 is requested unless using a non-restricted RPC
|
||||
const TXS_PER_REQUEST: usize = 100;
|
||||
let this_count = TXS_PER_REQUEST.min(hashes_hex.len());
|
||||
|
||||
let txs: TransactionsResponse = self
|
||||
.rpc_call(
|
||||
"get_transactions",
|
||||
Some(json!({
|
||||
"txs_hashes": hashes_hex.drain(.. this_count).collect::<Vec<_>>(),
|
||||
})),
|
||||
)
|
||||
.await?;
|
||||
|
||||
if !txs.missed_tx.is_empty() {
|
||||
Err(RpcError::TransactionsNotFound(
|
||||
txs.missed_tx.iter().map(|hash| hash_hex(hash)).collect::<Result<_, _>>()?,
|
||||
))?;
|
||||
}
|
||||
|
||||
all_txs.extend(txs.txs);
|
||||
}
|
||||
|
||||
all_txs
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, res)| {
|
||||
let tx = Transaction::read::<&[u8]>(
|
||||
&mut rpc_hex(if !res.as_hex.is_empty() { &res.as_hex } else { &res.pruned_as_hex })?
|
||||
.as_ref(),
|
||||
)
|
||||
.map_err(|_| match hash_hex(&res.tx_hash) {
|
||||
Ok(hash) => RpcError::InvalidTransaction(hash),
|
||||
Err(err) => err,
|
||||
})?;
|
||||
|
||||
// https://github.com/monero-project/monero/issues/8311
|
||||
if res.as_hex.is_empty() {
|
||||
match tx.prefix.inputs.first() {
|
||||
Some(Input::Gen { .. }) => (),
|
||||
_ => Err(RpcError::PrunedTransaction)?,
|
||||
}
|
||||
}
|
||||
|
||||
// This does run a few keccak256 hashes, which is pointless if the node is trusted
|
||||
// In exchange, this provides resilience against invalid/malicious nodes
|
||||
if tx.hash() != hashes[i] {
|
||||
Err(RpcError::InvalidNode(
|
||||
"replied with transaction wasn't the requested transaction".to_string(),
|
||||
))?;
|
||||
}
|
||||
|
||||
Ok(tx)
|
||||
})
|
||||
.collect()
|
||||
}
|
||||
|
||||
pub async fn get_transaction(&self, tx: [u8; 32]) -> Result<Transaction, RpcError> {
|
||||
self.get_transactions(&[tx]).await.map(|mut txs| txs.swap_remove(0))
|
||||
}
|
||||
|
||||
/// Get the hash of a block from the node by the block's numbers.
|
||||
/// This function does not verify the returned block hash is actually for the number in question.
|
||||
pub async fn get_block_hash(&self, number: usize) -> Result<[u8; 32], RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct BlockHeaderResponse {
|
||||
hash: String,
|
||||
}
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct BlockHeaderByHeightResponse {
|
||||
block_header: BlockHeaderResponse,
|
||||
}
|
||||
|
||||
let header: BlockHeaderByHeightResponse =
|
||||
self.json_rpc_call("get_block_header_by_height", Some(json!({ "height": number }))).await?;
|
||||
hash_hex(&header.block_header.hash)
|
||||
}
|
||||
|
||||
/// Get a block from the node by its hash.
|
||||
/// This function does not verify the returned block actually has the hash in question.
|
||||
pub async fn get_block(&self, hash: [u8; 32]) -> Result<Block, RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct BlockResponse {
|
||||
blob: String,
|
||||
}
|
||||
|
||||
let res: BlockResponse =
|
||||
self.json_rpc_call("get_block", Some(json!({ "hash": hex::encode(hash) }))).await?;
|
||||
|
||||
let block = Block::read::<&[u8]>(&mut rpc_hex(&res.blob)?.as_ref())
|
||||
.map_err(|_| RpcError::InvalidNode("invalid block".to_string()))?;
|
||||
if block.hash() != hash {
|
||||
Err(RpcError::InvalidNode("different block than requested (hash)".to_string()))?;
|
||||
}
|
||||
Ok(block)
|
||||
}
|
||||
|
||||
pub async fn get_block_by_number(&self, number: usize) -> Result<Block, RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct BlockResponse {
|
||||
blob: String,
|
||||
}
|
||||
|
||||
let res: BlockResponse =
|
||||
self.json_rpc_call("get_block", Some(json!({ "height": number }))).await?;
|
||||
|
||||
let block = Block::read::<&[u8]>(&mut rpc_hex(&res.blob)?.as_ref())
|
||||
.map_err(|_| RpcError::InvalidNode("invalid block".to_string()))?;
|
||||
|
||||
// Make sure this is actually the block for this number
|
||||
match block.miner_tx.prefix.inputs.first() {
|
||||
Some(Input::Gen(actual)) => {
|
||||
if usize::try_from(*actual).unwrap() == number {
|
||||
Ok(block)
|
||||
} else {
|
||||
Err(RpcError::InvalidNode("different block than requested (number)".to_string()))
|
||||
}
|
||||
}
|
||||
_ => Err(RpcError::InvalidNode(
|
||||
"block's miner_tx didn't have an input of kind Input::Gen".to_string(),
|
||||
)),
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn get_block_transactions(&self, hash: [u8; 32]) -> Result<Vec<Transaction>, RpcError> {
|
||||
let block = self.get_block(hash).await?;
|
||||
let mut res = vec![block.miner_tx];
|
||||
res.extend(self.get_transactions(&block.txs).await?);
|
||||
Ok(res)
|
||||
}
|
||||
|
||||
pub async fn get_block_transactions_by_number(
|
||||
&self,
|
||||
number: usize,
|
||||
) -> Result<Vec<Transaction>, RpcError> {
|
||||
self.get_block_transactions(self.get_block_hash(number).await?).await
|
||||
}
|
||||
|
||||
/// Get the output indexes of the specified transaction.
|
||||
pub async fn get_o_indexes(&self, hash: [u8; 32]) -> Result<Vec<u64>, RpcError> {
|
||||
/*
|
||||
TODO: Use these when a suitable epee serde lib exists
|
||||
|
||||
#[derive(Serialize, Debug)]
|
||||
struct Request {
|
||||
txid: [u8; 32],
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct OIndexes {
|
||||
o_indexes: Vec<u64>,
|
||||
}
|
||||
*/
|
||||
|
||||
// Given the immaturity of Rust epee libraries, this is a homegrown one which is only validated
|
||||
// to work against this specific function
|
||||
|
||||
// Header for EPEE, an 8-byte magic and a version
|
||||
const EPEE_HEADER: &[u8] = b"\x01\x11\x01\x01\x01\x01\x02\x01\x01";
|
||||
|
||||
let mut request = EPEE_HEADER.to_vec();
|
||||
// Number of fields (shifted over 2 bits as the 2 LSBs are reserved for metadata)
|
||||
request.push(1 << 2);
|
||||
// Length of field name
|
||||
request.push(4);
|
||||
// Field name
|
||||
request.extend(b"txid");
|
||||
// Type of field
|
||||
request.push(10);
|
||||
// Length of string, since this byte array is technically a string
|
||||
request.push(32 << 2);
|
||||
// The "string"
|
||||
request.extend(hash);
|
||||
|
||||
let indexes_buf = self.bin_call("get_o_indexes.bin", request).await?;
|
||||
let mut indexes: &[u8] = indexes_buf.as_ref();
|
||||
|
||||
(|| {
|
||||
let mut res = None;
|
||||
let mut is_okay = false;
|
||||
|
||||
if read_bytes::<_, { EPEE_HEADER.len() }>(&mut indexes)? != EPEE_HEADER {
|
||||
Err(io::Error::other("invalid header"))?;
|
||||
}
|
||||
|
||||
let read_object = |reader: &mut &[u8]| -> io::Result<Vec<u64>> {
|
||||
let fields = read_byte(reader)? >> 2;
|
||||
|
||||
for _ in 0 .. fields {
|
||||
let name_len = read_byte(reader)?;
|
||||
let name = read_raw_vec(read_byte, name_len.into(), reader)?;
|
||||
|
||||
let type_with_array_flag = read_byte(reader)?;
|
||||
let kind = type_with_array_flag & (!0x80);
|
||||
|
||||
let iters = if type_with_array_flag != kind { read_epee_vi(reader)? } else { 1 };
|
||||
|
||||
if (&name == b"o_indexes") && (kind != 5) {
|
||||
Err(io::Error::other("o_indexes weren't u64s"))?;
|
||||
}
|
||||
|
||||
let f = match kind {
|
||||
// i64
|
||||
1 => |reader: &mut &[u8]| read_raw_vec(read_byte, 8, reader),
|
||||
// i32
|
||||
2 => |reader: &mut &[u8]| read_raw_vec(read_byte, 4, reader),
|
||||
// i16
|
||||
3 => |reader: &mut &[u8]| read_raw_vec(read_byte, 2, reader),
|
||||
// i8
|
||||
4 => |reader: &mut &[u8]| read_raw_vec(read_byte, 1, reader),
|
||||
// u64
|
||||
5 => |reader: &mut &[u8]| read_raw_vec(read_byte, 8, reader),
|
||||
// u32
|
||||
6 => |reader: &mut &[u8]| read_raw_vec(read_byte, 4, reader),
|
||||
// u16
|
||||
7 => |reader: &mut &[u8]| read_raw_vec(read_byte, 2, reader),
|
||||
// u8
|
||||
8 => |reader: &mut &[u8]| read_raw_vec(read_byte, 1, reader),
|
||||
// double
|
||||
9 => |reader: &mut &[u8]| read_raw_vec(read_byte, 8, reader),
|
||||
// string, or any collection of bytes
|
||||
10 => |reader: &mut &[u8]| {
|
||||
let len = read_epee_vi(reader)?;
|
||||
read_raw_vec(
|
||||
read_byte,
|
||||
len.try_into().map_err(|_| io::Error::other("u64 length exceeded usize"))?,
|
||||
reader,
|
||||
)
|
||||
},
|
||||
// bool
|
||||
11 => |reader: &mut &[u8]| read_raw_vec(read_byte, 1, reader),
|
||||
// object, errors here as it shouldn't be used on this call
|
||||
12 => {
|
||||
|_: &mut &[u8]| Err(io::Error::other("node used object in reply to get_o_indexes"))
|
||||
}
|
||||
// array, so far unused
|
||||
13 => |_: &mut &[u8]| Err(io::Error::other("node used the unused array type")),
|
||||
_ => |_: &mut &[u8]| Err(io::Error::other("node used an invalid type")),
|
||||
};
|
||||
|
||||
let mut bytes_res = vec![];
|
||||
for _ in 0 .. iters {
|
||||
bytes_res.push(f(reader)?);
|
||||
}
|
||||
|
||||
let mut actual_res = Vec::with_capacity(bytes_res.len());
|
||||
match name.as_slice() {
|
||||
b"o_indexes" => {
|
||||
for o_index in bytes_res {
|
||||
actual_res.push(u64::from_le_bytes(
|
||||
o_index
|
||||
.try_into()
|
||||
.map_err(|_| io::Error::other("node didn't provide 8 bytes for a u64"))?,
|
||||
));
|
||||
}
|
||||
res = Some(actual_res);
|
||||
}
|
||||
b"status" => {
|
||||
if bytes_res
|
||||
.first()
|
||||
.ok_or_else(|| io::Error::other("status wasn't a string"))?
|
||||
.as_slice() !=
|
||||
b"OK"
|
||||
{
|
||||
// TODO: Better handle non-OK responses
|
||||
Err(io::Error::other("response wasn't OK"))?;
|
||||
}
|
||||
is_okay = true;
|
||||
}
|
||||
_ => continue,
|
||||
}
|
||||
|
||||
if is_okay && res.is_some() {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
// Didn't return a response with a status
|
||||
// (if the status wasn't okay, we would've already errored)
|
||||
if !is_okay {
|
||||
Err(io::Error::other("response didn't contain a status"))?;
|
||||
}
|
||||
|
||||
// If the Vec was empty, it would've been omitted, hence the unwrap_or
|
||||
// TODO: Test against a 0-output TX, such as the ones found in block 202612
|
||||
Ok(res.unwrap_or(vec![]))
|
||||
};
|
||||
|
||||
read_object(&mut indexes)
|
||||
})()
|
||||
.map_err(|_| RpcError::InvalidNode("invalid binary response".to_string()))
|
||||
}
|
||||
|
||||
/// Get the output distribution, from the specified height to the specified height (both
|
||||
/// inclusive).
|
||||
pub async fn get_output_distribution(
|
||||
&self,
|
||||
from: usize,
|
||||
to: usize,
|
||||
) -> Result<Vec<u64>, RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct Distribution {
|
||||
distribution: Vec<u64>,
|
||||
}
|
||||
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct Distributions {
|
||||
distributions: Vec<Distribution>,
|
||||
}
|
||||
|
||||
let mut distributions: Distributions = self
|
||||
.json_rpc_call(
|
||||
"get_output_distribution",
|
||||
Some(json!({
|
||||
"binary": false,
|
||||
"amounts": [0],
|
||||
"cumulative": true,
|
||||
"from_height": from,
|
||||
"to_height": to,
|
||||
})),
|
||||
)
|
||||
.await?;
|
||||
|
||||
Ok(distributions.distributions.swap_remove(0).distribution)
|
||||
}
|
||||
|
||||
/// Get the specified outputs from the RingCT (zero-amount) pool
|
||||
pub async fn get_outs(&self, indexes: &[u64]) -> Result<Vec<OutputResponse>, RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct OutsResponse {
|
||||
status: String,
|
||||
outs: Vec<OutputResponse>,
|
||||
}
|
||||
|
||||
let res: OutsResponse = self
|
||||
.rpc_call(
|
||||
"get_outs",
|
||||
Some(json!({
|
||||
"get_txid": true,
|
||||
"outputs": indexes.iter().map(|o| json!({
|
||||
"amount": 0,
|
||||
"index": o
|
||||
})).collect::<Vec<_>>()
|
||||
})),
|
||||
)
|
||||
.await?;
|
||||
|
||||
if res.status != "OK" {
|
||||
Err(RpcError::InvalidNode("bad response to get_outs".to_string()))?;
|
||||
}
|
||||
|
||||
Ok(res.outs)
|
||||
}
|
||||
|
||||
/// Get the specified outputs from the RingCT (zero-amount) pool, but only return them if their
|
||||
/// timelock has been satisfied.
|
||||
///
|
||||
/// The timelock being satisfied is distinct from being free of the 10-block lock applied to all
|
||||
/// Monero transactions.
|
||||
pub async fn get_unlocked_outputs(
|
||||
&self,
|
||||
indexes: &[u64],
|
||||
height: usize,
|
||||
fingerprintable_canonical: bool,
|
||||
) -> Result<Vec<Option<[EdwardsPoint; 2]>>, RpcError> {
|
||||
let outs: Vec<OutputResponse> = self.get_outs(indexes).await?;
|
||||
|
||||
// Only need to fetch txs to do canonical check on timelock
|
||||
let txs = if fingerprintable_canonical {
|
||||
self
|
||||
.get_transactions(
|
||||
&outs.iter().map(|out| hash_hex(&out.txid)).collect::<Result<Vec<_>, _>>()?,
|
||||
)
|
||||
.await?
|
||||
} else {
|
||||
Vec::new()
|
||||
};
|
||||
|
||||
// TODO: https://github.com/serai-dex/serai/issues/104
|
||||
outs
|
||||
.iter()
|
||||
.enumerate()
|
||||
.map(|(i, out)| {
|
||||
// Allow keys to be invalid, though if they are, return None to trigger selection of a new
|
||||
// decoy
|
||||
// Only valid keys can be used in CLSAG proofs, hence the need for re-selection, yet
|
||||
// invalid keys may honestly exist on the blockchain
|
||||
// Only a recent hard fork checked output keys were valid points
|
||||
let Some(key) = decompress_point(
|
||||
rpc_hex(&out.key)?
|
||||
.try_into()
|
||||
.map_err(|_| RpcError::InvalidNode("non-32-byte point".to_string()))?,
|
||||
) else {
|
||||
return Ok(None);
|
||||
};
|
||||
Ok(Some([key, rpc_point(&out.mask)?]).filter(|_| {
|
||||
if fingerprintable_canonical {
|
||||
Timelock::Block(height) >= txs[i].prefix.timelock
|
||||
} else {
|
||||
out.unlocked
|
||||
}
|
||||
}))
|
||||
})
|
||||
.collect()
|
||||
}
|
||||
|
||||
async fn get_fee_v14(&self, priority: FeePriority) -> Result<Fee, RpcError> {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct FeeResponseV14 {
|
||||
status: String,
|
||||
fee: u64,
|
||||
quantization_mask: u64,
|
||||
}
|
||||
|
||||
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
|
||||
// src/wallet/wallet2.cpp#L7569-L7584
|
||||
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
|
||||
// src/wallet/wallet2.cpp#L7660-L7661
|
||||
let priority_idx =
|
||||
usize::try_from(if priority.fee_priority() == 0 { 1 } else { priority.fee_priority() - 1 })
|
||||
.map_err(|_| RpcError::InvalidPriority)?;
|
||||
let multipliers = [1, 5, 25, 1000];
|
||||
if priority_idx >= multipliers.len() {
|
||||
// though not an RPC error, it seems sensible to treat as such
|
||||
Err(RpcError::InvalidPriority)?;
|
||||
}
|
||||
let fee_multiplier = multipliers[priority_idx];
|
||||
|
||||
let res: FeeResponseV14 = self
|
||||
.json_rpc_call(
|
||||
"get_fee_estimate",
|
||||
Some(json!({ "grace_blocks": GRACE_BLOCKS_FOR_FEE_ESTIMATE })),
|
||||
)
|
||||
.await?;
|
||||
|
||||
if res.status != "OK" {
|
||||
Err(RpcError::InvalidFee)?;
|
||||
}
|
||||
|
||||
Ok(Fee { per_weight: res.fee * fee_multiplier, mask: res.quantization_mask })
|
||||
}
|
||||
|
||||
/// Get the currently estimated fee from the node.
|
||||
///
|
||||
/// This may be manipulated to unsafe levels and MUST be sanity checked.
|
||||
// TODO: Take a sanity check argument
|
||||
pub async fn get_fee(&self, protocol: Protocol, priority: FeePriority) -> Result<Fee, RpcError> {
|
||||
// TODO: Implement wallet2's adjust_priority which by default automatically uses a lower
|
||||
// priority than provided depending on the backlog in the pool
|
||||
if protocol.v16_fee() {
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct FeeResponse {
|
||||
status: String,
|
||||
fees: Vec<u64>,
|
||||
quantization_mask: u64,
|
||||
}
|
||||
|
||||
let res: FeeResponse = self
|
||||
.json_rpc_call(
|
||||
"get_fee_estimate",
|
||||
Some(json!({ "grace_blocks": GRACE_BLOCKS_FOR_FEE_ESTIMATE })),
|
||||
)
|
||||
.await?;
|
||||
|
||||
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
|
||||
// src/wallet/wallet2.cpp#L7615-L7620
|
||||
let priority_idx = usize::try_from(if priority.fee_priority() >= 4 {
|
||||
3
|
||||
} else {
|
||||
priority.fee_priority().saturating_sub(1)
|
||||
})
|
||||
.map_err(|_| RpcError::InvalidPriority)?;
|
||||
|
||||
if res.status != "OK" {
|
||||
Err(RpcError::InvalidFee)
|
||||
} else if priority_idx >= res.fees.len() {
|
||||
Err(RpcError::InvalidPriority)
|
||||
} else {
|
||||
Ok(Fee { per_weight: res.fees[priority_idx], mask: res.quantization_mask })
|
||||
}
|
||||
} else {
|
||||
self.get_fee_v14(priority).await
|
||||
}
|
||||
}
|
||||
|
||||
pub async fn publish_transaction(&self, tx: &Transaction) -> Result<(), RpcError> {
|
||||
#[allow(dead_code)]
|
||||
#[derive(Deserialize, Debug)]
|
||||
struct SendRawResponse {
|
||||
status: String,
|
||||
double_spend: bool,
|
||||
fee_too_low: bool,
|
||||
invalid_input: bool,
|
||||
invalid_output: bool,
|
||||
low_mixin: bool,
|
||||
not_relayed: bool,
|
||||
overspend: bool,
|
||||
too_big: bool,
|
||||
too_few_outputs: bool,
|
||||
reason: String,
|
||||
}
|
||||
|
||||
let res: SendRawResponse = self
|
||||
.rpc_call("send_raw_transaction", Some(json!({ "tx_as_hex": hex::encode(tx.serialize()) })))
|
||||
.await?;
|
||||
|
||||
if res.status != "OK" {
|
||||
Err(RpcError::InvalidTransaction(tx.hash()))?;
|
||||
}
|
||||
|
||||
Ok(())
|
||||
}
|
||||
|
||||
// TODO: Take &Address, not &str?
|
||||
pub async fn generate_blocks(
|
||||
&self,
|
||||
address: &str,
|
||||
block_count: usize,
|
||||
) -> Result<(Vec<[u8; 32]>, usize), RpcError> {
|
||||
#[derive(Debug, Deserialize)]
|
||||
struct BlocksResponse {
|
||||
blocks: Vec<String>,
|
||||
height: usize,
|
||||
}
|
||||
|
||||
let res = self
|
||||
.json_rpc_call::<BlocksResponse>(
|
||||
"generateblocks",
|
||||
Some(json!({
|
||||
"wallet_address": address,
|
||||
"amount_of_blocks": block_count
|
||||
})),
|
||||
)
|
||||
.await?;
|
||||
|
||||
let mut blocks = Vec::with_capacity(res.blocks.len());
|
||||
for block in res.blocks {
|
||||
blocks.push(hash_hex(&block)?);
|
||||
}
|
||||
Ok((blocks, res.height))
|
||||
}
|
||||
}
|
||||
172
coins/monero/src/serialize.rs
Normal file
172
coins/monero/src/serialize.rs
Normal file
@@ -0,0 +1,172 @@
|
||||
use core::fmt::Debug;
|
||||
use std_shims::{
|
||||
vec::Vec,
|
||||
io::{self, Read, Write},
|
||||
};
|
||||
|
||||
use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
||||
|
||||
use monero_generators::decompress_point;
|
||||
|
||||
const VARINT_CONTINUATION_MASK: u8 = 0b1000_0000;
|
||||
|
||||
mod sealed {
|
||||
pub trait VarInt: TryInto<u64> + TryFrom<u64> + Copy {
|
||||
const BITS: usize;
|
||||
}
|
||||
impl VarInt for u8 {
|
||||
const BITS: usize = 8;
|
||||
}
|
||||
impl VarInt for u32 {
|
||||
const BITS: usize = 32;
|
||||
}
|
||||
impl VarInt for u64 {
|
||||
const BITS: usize = 64;
|
||||
}
|
||||
impl VarInt for usize {
|
||||
const BITS: usize = core::mem::size_of::<usize>() * 8;
|
||||
}
|
||||
}
|
||||
|
||||
// This will panic if the VarInt exceeds u64::MAX
|
||||
pub(crate) fn varint_len<U: sealed::VarInt>(varint: U) -> usize {
|
||||
let varint_u64: u64 = varint.try_into().map_err(|_| "varint exceeded u64").unwrap();
|
||||
((usize::try_from(u64::BITS - varint_u64.leading_zeros()).unwrap().saturating_sub(1)) / 7) + 1
|
||||
}
|
||||
|
||||
pub(crate) fn write_byte<W: Write>(byte: &u8, w: &mut W) -> io::Result<()> {
|
||||
w.write_all(&[*byte])
|
||||
}
|
||||
|
||||
// This will panic if the VarInt exceeds u64::MAX
|
||||
pub(crate) fn write_varint<W: Write, U: sealed::VarInt>(varint: &U, w: &mut W) -> io::Result<()> {
|
||||
let mut varint: u64 = (*varint).try_into().map_err(|_| "varint exceeded u64").unwrap();
|
||||
while {
|
||||
let mut b = u8::try_from(varint & u64::from(!VARINT_CONTINUATION_MASK)).unwrap();
|
||||
varint >>= 7;
|
||||
if varint != 0 {
|
||||
b |= VARINT_CONTINUATION_MASK;
|
||||
}
|
||||
write_byte(&b, w)?;
|
||||
varint != 0
|
||||
} {}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn write_scalar<W: Write>(scalar: &Scalar, w: &mut W) -> io::Result<()> {
|
||||
w.write_all(&scalar.to_bytes())
|
||||
}
|
||||
|
||||
pub(crate) fn write_point<W: Write>(point: &EdwardsPoint, w: &mut W) -> io::Result<()> {
|
||||
w.write_all(&point.compress().to_bytes())
|
||||
}
|
||||
|
||||
pub(crate) fn write_raw_vec<T, W: Write, F: Fn(&T, &mut W) -> io::Result<()>>(
|
||||
f: F,
|
||||
values: &[T],
|
||||
w: &mut W,
|
||||
) -> io::Result<()> {
|
||||
for value in values {
|
||||
f(value, w)?;
|
||||
}
|
||||
Ok(())
|
||||
}
|
||||
|
||||
pub(crate) fn write_vec<T, W: Write, F: Fn(&T, &mut W) -> io::Result<()>>(
|
||||
f: F,
|
||||
values: &[T],
|
||||
w: &mut W,
|
||||
) -> io::Result<()> {
|
||||
write_varint(&values.len(), w)?;
|
||||
write_raw_vec(f, values, w)
|
||||
}
|
||||
|
||||
pub(crate) fn read_bytes<R: Read, const N: usize>(r: &mut R) -> io::Result<[u8; N]> {
|
||||
let mut res = [0; N];
|
||||
r.read_exact(&mut res)?;
|
||||
Ok(res)
|
||||
}
|
||||
|
||||
pub(crate) fn read_byte<R: Read>(r: &mut R) -> io::Result<u8> {
|
||||
Ok(read_bytes::<_, 1>(r)?[0])
|
||||
}
|
||||
|
||||
pub(crate) fn read_u16<R: Read>(r: &mut R) -> io::Result<u16> {
|
||||
read_bytes(r).map(u16::from_le_bytes)
|
||||
}
|
||||
|
||||
pub(crate) fn read_u32<R: Read>(r: &mut R) -> io::Result<u32> {
|
||||
read_bytes(r).map(u32::from_le_bytes)
|
||||
}
|
||||
|
||||
pub(crate) fn read_u64<R: Read>(r: &mut R) -> io::Result<u64> {
|
||||
read_bytes(r).map(u64::from_le_bytes)
|
||||
}
|
||||
|
||||
pub(crate) fn read_varint<R: Read, U: sealed::VarInt>(r: &mut R) -> io::Result<U> {
|
||||
let mut bits = 0;
|
||||
let mut res = 0;
|
||||
while {
|
||||
let b = read_byte(r)?;
|
||||
if (bits != 0) && (b == 0) {
|
||||
Err(io::Error::other("non-canonical varint"))?;
|
||||
}
|
||||
if ((bits + 7) >= U::BITS) && (b >= (1 << (U::BITS - bits))) {
|
||||
Err(io::Error::other("varint overflow"))?;
|
||||
}
|
||||
|
||||
res += u64::from(b & (!VARINT_CONTINUATION_MASK)) << bits;
|
||||
bits += 7;
|
||||
b & VARINT_CONTINUATION_MASK == VARINT_CONTINUATION_MASK
|
||||
} {}
|
||||
res.try_into().map_err(|_| io::Error::other("VarInt does not fit into integer type"))
|
||||
}
|
||||
|
||||
// All scalar fields supported by monero-serai are checked to be canonical for valid transactions
|
||||
// While from_bytes_mod_order would be more flexible, it's not currently needed and would be
|
||||
// inaccurate to include now. While casting a wide net may be preferable, it'd also be inaccurate
|
||||
// for now. There's also further edge cases as noted by
|
||||
// https://github.com/monero-project/monero/issues/8438, where some scalars had an archaic
|
||||
// reduction applied
|
||||
pub(crate) fn read_scalar<R: Read>(r: &mut R) -> io::Result<Scalar> {
|
||||
Option::from(Scalar::from_canonical_bytes(read_bytes(r)?))
|
||||
.ok_or_else(|| io::Error::other("unreduced scalar"))
|
||||
}
|
||||
|
||||
pub(crate) fn read_point<R: Read>(r: &mut R) -> io::Result<EdwardsPoint> {
|
||||
let bytes = read_bytes(r)?;
|
||||
decompress_point(bytes).ok_or_else(|| io::Error::other("invalid point"))
|
||||
}
|
||||
|
||||
pub(crate) fn read_torsion_free_point<R: Read>(r: &mut R) -> io::Result<EdwardsPoint> {
|
||||
read_point(r)
|
||||
.ok()
|
||||
.filter(EdwardsPoint::is_torsion_free)
|
||||
.ok_or_else(|| io::Error::other("invalid point"))
|
||||
}
|
||||
|
||||
pub(crate) fn read_raw_vec<R: Read, T, F: Fn(&mut R) -> io::Result<T>>(
|
||||
f: F,
|
||||
len: usize,
|
||||
r: &mut R,
|
||||
) -> io::Result<Vec<T>> {
|
||||
let mut res = vec![];
|
||||
for _ in 0 .. len {
|
||||
res.push(f(r)?);
|
||||
}
|
||||
Ok(res)
|
||||
}
|
||||
|
||||
pub(crate) fn read_array<R: Read, T: Debug, F: Fn(&mut R) -> io::Result<T>, const N: usize>(
|
||||
f: F,
|
||||
r: &mut R,
|
||||
) -> io::Result<[T; N]> {
|
||||
read_raw_vec(f, N, r).map(|vec| vec.try_into().unwrap())
|
||||
}
|
||||
|
||||
pub(crate) fn read_vec<R: Read, T, F: Fn(&mut R) -> io::Result<T>>(
|
||||
f: F,
|
||||
r: &mut R,
|
||||
) -> io::Result<Vec<T>> {
|
||||
read_raw_vec(f, read_varint(r)?, r)
|
||||
}
|
||||
176
coins/monero/src/tests/address.rs
Normal file
176
coins/monero/src/tests/address.rs
Normal file
@@ -0,0 +1,176 @@
|
||||
use hex_literal::hex;
|
||||
|
||||
use rand_core::{RngCore, OsRng};
|
||||
|
||||
use curve25519_dalek::constants::ED25519_BASEPOINT_TABLE;
|
||||
|
||||
use monero_generators::decompress_point;
|
||||
|
||||
use crate::{
|
||||
random_scalar,
|
||||
wallet::address::{Network, AddressType, AddressMeta, MoneroAddress},
|
||||
};
|
||||
|
||||
const SPEND: [u8; 32] = hex!("f8631661f6ab4e6fda310c797330d86e23a682f20d5bc8cc27b18051191f16d7");
|
||||
const VIEW: [u8; 32] = hex!("4a1535063ad1fee2dabbf909d4fd9a873e29541b401f0944754e17c9a41820ce");
|
||||
|
||||
const STANDARD: &str =
|
||||
"4B33mFPMq6mKi7Eiyd5XuyKRVMGVZz1Rqb9ZTyGApXW5d1aT7UBDZ89ewmnWFkzJ5wPd2SFbn313vCT8a4E2Qf4KQH4pNey";
|
||||
|
||||
const PAYMENT_ID: [u8; 8] = hex!("b8963a57855cf73f");
|
||||
const INTEGRATED: &str =
|
||||
"4Ljin4CrSNHKi7Eiyd5XuyKRVMGVZz1Rqb9ZTyGApXW5d1aT7UBDZ89ewmnWFkzJ5wPd2SFbn313vCT8a4E2Qf4KbaTH6Mn\
|
||||
pXSn88oBX35";
|
||||
|
||||
const SUB_SPEND: [u8; 32] =
|
||||
hex!("fe358188b528335ad1cfdc24a22a23988d742c882b6f19a602892eaab3c1b62b");
|
||||
const SUB_VIEW: [u8; 32] = hex!("9bc2b464de90d058468522098d5610c5019c45fd1711a9517db1eea7794f5470");
|
||||
const SUBADDRESS: &str =
|
||||
"8C5zHM5ud8nGC4hC2ULiBLSWx9infi8JUUmWEat4fcTf8J4H38iWYVdFmPCA9UmfLTZxD43RsyKnGEdZkoGij6csDeUnbEB";
|
||||
|
||||
const FEATURED_JSON: &str = include_str!("vectors/featured_addresses.json");
|
||||
|
||||
#[test]
|
||||
fn standard_address() {
|
||||
let addr = MoneroAddress::from_str(Network::Mainnet, STANDARD).unwrap();
|
||||
assert_eq!(addr.meta.network, Network::Mainnet);
|
||||
assert_eq!(addr.meta.kind, AddressType::Standard);
|
||||
assert!(!addr.meta.kind.is_subaddress());
|
||||
assert_eq!(addr.meta.kind.payment_id(), None);
|
||||
assert!(!addr.meta.kind.is_guaranteed());
|
||||
assert_eq!(addr.spend.compress().to_bytes(), SPEND);
|
||||
assert_eq!(addr.view.compress().to_bytes(), VIEW);
|
||||
assert_eq!(addr.to_string(), STANDARD);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn integrated_address() {
|
||||
let addr = MoneroAddress::from_str(Network::Mainnet, INTEGRATED).unwrap();
|
||||
assert_eq!(addr.meta.network, Network::Mainnet);
|
||||
assert_eq!(addr.meta.kind, AddressType::Integrated(PAYMENT_ID));
|
||||
assert!(!addr.meta.kind.is_subaddress());
|
||||
assert_eq!(addr.meta.kind.payment_id(), Some(PAYMENT_ID));
|
||||
assert!(!addr.meta.kind.is_guaranteed());
|
||||
assert_eq!(addr.spend.compress().to_bytes(), SPEND);
|
||||
assert_eq!(addr.view.compress().to_bytes(), VIEW);
|
||||
assert_eq!(addr.to_string(), INTEGRATED);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn subaddress() {
|
||||
let addr = MoneroAddress::from_str(Network::Mainnet, SUBADDRESS).unwrap();
|
||||
assert_eq!(addr.meta.network, Network::Mainnet);
|
||||
assert_eq!(addr.meta.kind, AddressType::Subaddress);
|
||||
assert!(addr.meta.kind.is_subaddress());
|
||||
assert_eq!(addr.meta.kind.payment_id(), None);
|
||||
assert!(!addr.meta.kind.is_guaranteed());
|
||||
assert_eq!(addr.spend.compress().to_bytes(), SUB_SPEND);
|
||||
assert_eq!(addr.view.compress().to_bytes(), SUB_VIEW);
|
||||
assert_eq!(addr.to_string(), SUBADDRESS);
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn featured() {
|
||||
for (network, first) in
|
||||
[(Network::Mainnet, 'C'), (Network::Testnet, 'K'), (Network::Stagenet, 'F')]
|
||||
{
|
||||
for _ in 0 .. 100 {
|
||||
let spend = &random_scalar(&mut OsRng) * ED25519_BASEPOINT_TABLE;
|
||||
let view = &random_scalar(&mut OsRng) * ED25519_BASEPOINT_TABLE;
|
||||
|
||||
for features in 0 .. (1 << 3) {
|
||||
const SUBADDRESS_FEATURE_BIT: u8 = 1;
|
||||
const INTEGRATED_FEATURE_BIT: u8 = 1 << 1;
|
||||
const GUARANTEED_FEATURE_BIT: u8 = 1 << 2;
|
||||
|
||||
let subaddress = (features & SUBADDRESS_FEATURE_BIT) == SUBADDRESS_FEATURE_BIT;
|
||||
|
||||
let mut payment_id = [0; 8];
|
||||
OsRng.fill_bytes(&mut payment_id);
|
||||
let payment_id = Some(payment_id)
|
||||
.filter(|_| (features & INTEGRATED_FEATURE_BIT) == INTEGRATED_FEATURE_BIT);
|
||||
|
||||
let guaranteed = (features & GUARANTEED_FEATURE_BIT) == GUARANTEED_FEATURE_BIT;
|
||||
|
||||
let kind = AddressType::Featured { subaddress, payment_id, guaranteed };
|
||||
let meta = AddressMeta::new(network, kind);
|
||||
let addr = MoneroAddress::new(meta, spend, view);
|
||||
|
||||
assert_eq!(addr.to_string().chars().next().unwrap(), first);
|
||||
assert_eq!(MoneroAddress::from_str(network, &addr.to_string()).unwrap(), addr);
|
||||
|
||||
assert_eq!(addr.spend, spend);
|
||||
assert_eq!(addr.view, view);
|
||||
|
||||
assert_eq!(addr.is_subaddress(), subaddress);
|
||||
assert_eq!(addr.payment_id(), payment_id);
|
||||
assert_eq!(addr.is_guaranteed(), guaranteed);
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn featured_vectors() {
|
||||
#[derive(serde::Deserialize)]
|
||||
struct Vector {
|
||||
address: String,
|
||||
|
||||
network: String,
|
||||
spend: String,
|
||||
view: String,
|
||||
|
||||
subaddress: bool,
|
||||
integrated: bool,
|
||||
payment_id: Option<[u8; 8]>,
|
||||
guaranteed: bool,
|
||||
}
|
||||
|
||||
let vectors = serde_json::from_str::<Vec<Vector>>(FEATURED_JSON).unwrap();
|
||||
for vector in vectors {
|
||||
let first = vector.address.chars().next().unwrap();
|
||||
let network = match vector.network.as_str() {
|
||||
"Mainnet" => {
|
||||
assert_eq!(first, 'C');
|
||||
Network::Mainnet
|
||||
}
|
||||
"Testnet" => {
|
||||
assert_eq!(first, 'K');
|
||||
Network::Testnet
|
||||
}
|
||||
"Stagenet" => {
|
||||
assert_eq!(first, 'F');
|
||||
Network::Stagenet
|
||||
}
|
||||
_ => panic!("Unknown network"),
|
||||
};
|
||||
let spend = decompress_point(hex::decode(vector.spend).unwrap().try_into().unwrap()).unwrap();
|
||||
let view = decompress_point(hex::decode(vector.view).unwrap().try_into().unwrap()).unwrap();
|
||||
|
||||
let addr = MoneroAddress::from_str(network, &vector.address).unwrap();
|
||||
assert_eq!(addr.spend, spend);
|
||||
assert_eq!(addr.view, view);
|
||||
|
||||
assert_eq!(addr.is_subaddress(), vector.subaddress);
|
||||
assert_eq!(vector.integrated, vector.payment_id.is_some());
|
||||
assert_eq!(addr.payment_id(), vector.payment_id);
|
||||
assert_eq!(addr.is_guaranteed(), vector.guaranteed);
|
||||
|
||||
assert_eq!(
|
||||
MoneroAddress::new(
|
||||
AddressMeta::new(
|
||||
network,
|
||||
AddressType::Featured {
|
||||
subaddress: vector.subaddress,
|
||||
payment_id: vector.payment_id,
|
||||
guaranteed: vector.guaranteed
|
||||
}
|
||||
),
|
||||
spend,
|
||||
view
|
||||
)
|
||||
.to_string(),
|
||||
vector.address
|
||||
);
|
||||
}
|
||||
}
|
||||
95
coins/monero/src/tests/bulletproofs/mod.rs
Normal file
95
coins/monero/src/tests/bulletproofs/mod.rs
Normal file
@@ -0,0 +1,95 @@
|
||||
use hex_literal::hex;
|
||||
use rand_core::OsRng;
|
||||
|
||||
use curve25519_dalek::scalar::Scalar;
|
||||
use monero_generators::decompress_point;
|
||||
use multiexp::BatchVerifier;
|
||||
|
||||
use crate::{
|
||||
Commitment, random_scalar,
|
||||
ringct::bulletproofs::{Bulletproofs, original::OriginalStruct},
|
||||
};
|
||||
|
||||
mod plus;
|
||||
|
||||
#[test]
|
||||
fn bulletproofs_vector() {
|
||||
let scalar = |scalar| Scalar::from_canonical_bytes(scalar).unwrap();
|
||||
let point = |point| decompress_point(point).unwrap();
|
||||
|
||||
// Generated from Monero
|
||||
assert!(Bulletproofs::Original(OriginalStruct {
|
||||
A: point(hex!("ef32c0b9551b804decdcb107eb22aa715b7ce259bf3c5cac20e24dfa6b28ac71")),
|
||||
S: point(hex!("e1285960861783574ee2b689ae53622834eb0b035d6943103f960cd23e063fa0")),
|
||||
T1: point(hex!("4ea07735f184ba159d0e0eb662bac8cde3eb7d39f31e567b0fbda3aa23fe5620")),
|
||||
T2: point(hex!("b8390aa4b60b255630d40e592f55ec6b7ab5e3a96bfcdcd6f1cd1d2fc95f441e")),
|
||||
taux: scalar(hex!("5957dba8ea9afb23d6e81cc048a92f2d502c10c749dc1b2bd148ae8d41ec7107")),
|
||||
mu: scalar(hex!("923023b234c2e64774b820b4961f7181f6c1dc152c438643e5a25b0bf271bc02")),
|
||||
L: vec![
|
||||
point(hex!("c45f656316b9ebf9d357fb6a9f85b5f09e0b991dd50a6e0ae9b02de3946c9d99")),
|
||||
point(hex!("9304d2bf0f27183a2acc58cc755a0348da11bd345485fda41b872fee89e72aac")),
|
||||
point(hex!("1bb8b71925d155dd9569f64129ea049d6149fdc4e7a42a86d9478801d922129b")),
|
||||
point(hex!("5756a7bf887aa72b9a952f92f47182122e7b19d89e5dd434c747492b00e1c6b7")),
|
||||
point(hex!("6e497c910d102592830555356af5ff8340e8d141e3fb60ea24cfa587e964f07d")),
|
||||
point(hex!("f4fa3898e7b08e039183d444f3d55040f3c790ed806cb314de49f3068bdbb218")),
|
||||
point(hex!("0bbc37597c3ead517a3841e159c8b7b79a5ceaee24b2a9a20350127aab428713")),
|
||||
],
|
||||
R: vec![
|
||||
point(hex!("609420ba1702781692e84accfd225adb3d077aedc3cf8125563400466b52dbd9")),
|
||||
point(hex!("fb4e1d079e7a2b0ec14f7e2a3943bf50b6d60bc346a54fcf562fb234b342abf8")),
|
||||
point(hex!("6ae3ac97289c48ce95b9c557289e82a34932055f7f5e32720139824fe81b12e5")),
|
||||
point(hex!("d071cc2ffbdab2d840326ad15f68c01da6482271cae3cf644670d1632f29a15c")),
|
||||
point(hex!("e52a1754b95e1060589ba7ce0c43d0060820ebfc0d49dc52884bc3c65ad18af5")),
|
||||
point(hex!("41573b06140108539957df71aceb4b1816d2409ce896659aa5c86f037ca5e851")),
|
||||
point(hex!("a65970b2cc3c7b08b2b5b739dbc8e71e646783c41c625e2a5b1535e3d2e0f742")),
|
||||
],
|
||||
a: scalar(hex!("0077c5383dea44d3cd1bc74849376bd60679612dc4b945255822457fa0c0a209")),
|
||||
b: scalar(hex!("fe80cf5756473482581e1d38644007793ddc66fdeb9404ec1689a907e4863302")),
|
||||
t: scalar(hex!("40dfb08e09249040df997851db311bd6827c26e87d6f0f332c55be8eef10e603"))
|
||||
})
|
||||
.verify(
|
||||
&mut OsRng,
|
||||
&[
|
||||
// For some reason, these vectors are * INV_EIGHT
|
||||
point(hex!("8e8f23f315edae4f6c2f948d9a861e0ae32d356b933cd11d2f0e031ac744c41f"))
|
||||
.mul_by_cofactor(),
|
||||
point(hex!("2829cbd025aa54cd6e1b59a032564f22f0b2e5627f7f2c4297f90da438b5510f"))
|
||||
.mul_by_cofactor(),
|
||||
]
|
||||
));
|
||||
}
|
||||
|
||||
macro_rules! bulletproofs_tests {
|
||||
($name: ident, $max: ident, $plus: literal) => {
|
||||
#[test]
|
||||
fn $name() {
|
||||
// Create Bulletproofs for all possible output quantities
|
||||
let mut verifier = BatchVerifier::new(16);
|
||||
for i in 1 ..= 16 {
|
||||
let commitments = (1 ..= i)
|
||||
.map(|i| Commitment::new(random_scalar(&mut OsRng), u64::try_from(i).unwrap()))
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
let bp = Bulletproofs::prove(&mut OsRng, &commitments, $plus).unwrap();
|
||||
|
||||
let commitments = commitments.iter().map(Commitment::calculate).collect::<Vec<_>>();
|
||||
assert!(bp.verify(&mut OsRng, &commitments));
|
||||
assert!(bp.batch_verify(&mut OsRng, &mut verifier, i, &commitments));
|
||||
}
|
||||
assert!(verifier.verify_vartime());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn $max() {
|
||||
// Check Bulletproofs errors if we try to prove for too many outputs
|
||||
let mut commitments = vec![];
|
||||
for _ in 0 .. 17 {
|
||||
commitments.push(Commitment::new(Scalar::ZERO, 0));
|
||||
}
|
||||
assert!(Bulletproofs::prove(&mut OsRng, &commitments, $plus).is_err());
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
bulletproofs_tests!(bulletproofs, bulletproofs_max, false);
|
||||
bulletproofs_tests!(bulletproofs_plus, bulletproofs_plus_max, true);
|
||||
@@ -0,0 +1,30 @@
|
||||
use rand_core::{RngCore, OsRng};
|
||||
|
||||
use multiexp::BatchVerifier;
|
||||
use group::ff::Field;
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
|
||||
use crate::{
|
||||
Commitment,
|
||||
ringct::bulletproofs::plus::aggregate_range_proof::{
|
||||
AggregateRangeStatement, AggregateRangeWitness,
|
||||
},
|
||||
};
|
||||
|
||||
#[test]
|
||||
fn test_aggregate_range_proof() {
|
||||
let mut verifier = BatchVerifier::new(16);
|
||||
for m in 1 ..= 16 {
|
||||
let mut commitments = vec![];
|
||||
for _ in 0 .. m {
|
||||
commitments.push(Commitment::new(*Scalar::random(&mut OsRng), OsRng.next_u64()));
|
||||
}
|
||||
let commitment_points = commitments.iter().map(|com| EdwardsPoint(com.calculate())).collect();
|
||||
let statement = AggregateRangeStatement::new(commitment_points).unwrap();
|
||||
let witness = AggregateRangeWitness::new(&commitments).unwrap();
|
||||
|
||||
let proof = statement.clone().prove(&mut OsRng, &witness).unwrap();
|
||||
statement.verify(&mut OsRng, &mut verifier, (), proof);
|
||||
}
|
||||
assert!(verifier.verify_vartime());
|
||||
}
|
||||
4
coins/monero/src/tests/bulletproofs/plus/mod.rs
Normal file
4
coins/monero/src/tests/bulletproofs/plus/mod.rs
Normal file
@@ -0,0 +1,4 @@
|
||||
#[cfg(test)]
|
||||
mod weighted_inner_product;
|
||||
#[cfg(test)]
|
||||
mod aggregate_range_proof;
|
||||
@@ -0,0 +1,81 @@
|
||||
// The inner product relation is P = sum(g_bold * a, h_bold * b, g * (a * y * b), h * alpha)
|
||||
|
||||
use rand_core::OsRng;
|
||||
|
||||
use multiexp::BatchVerifier;
|
||||
use group::{ff::Field, Group};
|
||||
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||
|
||||
use crate::ringct::bulletproofs::plus::{
|
||||
ScalarVector, PointVector, GeneratorsList, Generators,
|
||||
weighted_inner_product::{WipStatement, WipWitness},
|
||||
};
|
||||
|
||||
#[test]
|
||||
fn test_zero_weighted_inner_product() {
|
||||
#[allow(non_snake_case)]
|
||||
let P = EdwardsPoint::identity();
|
||||
let y = Scalar::random(&mut OsRng);
|
||||
|
||||
let generators = Generators::new().reduce(1);
|
||||
let statement = WipStatement::new(generators, P, y);
|
||||
let witness = WipWitness::new(ScalarVector::new(1), ScalarVector::new(1), Scalar::ZERO).unwrap();
|
||||
|
||||
let transcript = Scalar::random(&mut OsRng);
|
||||
let proof = statement.clone().prove(&mut OsRng, transcript, &witness).unwrap();
|
||||
|
||||
let mut verifier = BatchVerifier::new(1);
|
||||
statement.verify(&mut OsRng, &mut verifier, (), transcript, proof);
|
||||
assert!(verifier.verify_vartime());
|
||||
}
|
||||
|
||||
#[test]
|
||||
fn test_weighted_inner_product() {
|
||||
// P = sum(g_bold * a, h_bold * b, g * (a * y * b), h * alpha)
|
||||
let mut verifier = BatchVerifier::new(6);
|
||||
let generators = Generators::new();
|
||||
for i in [1, 2, 4, 8, 16, 32] {
|
||||
let generators = generators.reduce(i);
|
||||
let g = Generators::g();
|
||||
let h = Generators::h();
|
||||
assert_eq!(generators.len(), i);
|
||||
let mut g_bold = vec![];
|
||||
let mut h_bold = vec![];
|
||||
for i in 0 .. i {
|
||||
g_bold.push(generators.generator(GeneratorsList::GBold1, i));
|
||||
h_bold.push(generators.generator(GeneratorsList::HBold1, i));
|
||||
}
|
||||
let g_bold = PointVector(g_bold);
|
||||
let h_bold = PointVector(h_bold);
|
||||
|
||||
let mut a = ScalarVector::new(i);
|
||||
let mut b = ScalarVector::new(i);
|
||||
let alpha = Scalar::random(&mut OsRng);
|
||||
|
||||
let y = Scalar::random(&mut OsRng);
|
||||
let mut y_vec = ScalarVector::new(g_bold.len());
|
||||
y_vec[0] = y;
|
||||
for i in 1 .. y_vec.len() {
|
||||
y_vec[i] = y_vec[i - 1] * y;
|
||||
}
|
||||
|
||||
for i in 0 .. i {
|
||||
a[i] = Scalar::random(&mut OsRng);
|
||||
b[i] = Scalar::random(&mut OsRng);
|
||||
}
|
||||
|
||||
#[allow(non_snake_case)]
|
||||
let P = g_bold.multiexp(&a) +
|
||||
h_bold.multiexp(&b) +
|
||||
(g * a.clone().weighted_inner_product(&b, &y_vec)) +
|
||||
(h * alpha);
|
||||
|
||||
let statement = WipStatement::new(generators, P, y);
|
||||
let witness = WipWitness::new(a, b, alpha).unwrap();
|
||||
|
||||
let transcript = Scalar::random(&mut OsRng);
|
||||
let proof = statement.clone().prove(&mut OsRng, transcript, &witness).unwrap();
|
||||
statement.verify(&mut OsRng, &mut verifier, (), transcript, proof);
|
||||
}
|
||||
assert!(verifier.verify_vartime());
|
||||
}
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user