Files
serai/networks/bitcoin/src/crypto.rs
Luke Parker a141deaf36 Smash the singular Ciphersuite trait into multiple
This helps identify where the various functionalities are used, or rather, not
used. The `Ciphersuite` trait present in `patches/ciphersuite`, facilitating
the entire FCMP++ tree, only requires the markers _and_ canonical point
decoding. I've opened a PR to upstream such a trait into `group`
(https://github.com/zkcrypto/group/pull/68).

`WrappedGroup` is still justified for as long as `Group::generator` exists.
Moving `::generator()` to its own trait, on an independent structure (upstream)
would be massively appreciated. @tarcieri also wanted to update from
`fn generator()` to `const GENERATOR`, which would encourage further discussion
on https://github.com/zkcrypto/group/issues/32 and
https://github.com/zkcrypto/group/issues/45, which have been stagnant.

The `Id` trait is occasionally used yet really should be first off the chopping
block.

Finally, `WithPreferredHash` is only actually used around a third of the time,
which more than justifies it being a separate trait.

---

Updates `dalek_ff_group::Scalar` to directly re-export
`curve25519_dalek::Scalar`, as without issue. `dalek_ff_group::RistrettoPoint`
also could be replaced with an export of `curve25519_dalek::RistrettoPoint`,
yet the coordinator relies on how we implemented `Hash` on it for the hell of
it so it isn't worth it at this time. `dalek_ff_group::EdwardsPoint` can't be
replaced for an re-export of `curve25519_dalek::SubgroupPoint` as it doesn't
implement `zeroize`, `subtle` traits within a released, non-yanked version.
Relevance to https://github.com/serai-dex/serai/issues/201 and
https://github.com/dalek-cryptography/curve25519-dalek/issues/811#issuecomment-3247732746.

Also updates the `Ristretto` ciphersuite to prefer `Blake2b-512` over
`SHA2-512`. In order to maintain compliance with FROST's IETF standard,
`modular-frost` defines its own ciphersuite for Ristretto which still uses
`SHA2-512`.
2025-09-03 13:50:20 -04:00

163 lines
5.0 KiB
Rust

#[cfg(feature = "std")]
use subtle::{Choice, ConstantTimeEq, ConditionallySelectable};
use k256::{elliptic_curve::sec1::ToEncodedPoint, ProjectivePoint};
use bitcoin::key::XOnlyPublicKey;
/// Get the x coordinate of a non-infinity point.
///
/// Panics on invalid input.
fn x(key: &ProjectivePoint) -> [u8; 32] {
let encoded = key.to_encoded_point(true);
(*encoded.x().expect("point at infinity")).into()
}
/// Convert a non-infinity point to a XOnlyPublicKey (dropping its sign).
///
/// Panics on invalid input.
pub(crate) fn x_only(key: &ProjectivePoint) -> XOnlyPublicKey {
XOnlyPublicKey::from_slice(&x(key)).expect("x_only was passed a point which was infinity or odd")
}
/// Return if a point must be negated to have an even Y coordinate and be eligible for use.
#[cfg(feature = "std")]
pub(crate) fn needs_negation(key: &ProjectivePoint) -> Choice {
use k256::elliptic_curve::sec1::Tag;
u8::from(key.to_encoded_point(true).tag()).ct_eq(&u8::from(Tag::CompressedOddY))
}
#[cfg(feature = "std")]
mod frost_crypto {
use core::fmt::Debug;
use std_shims::{vec::Vec, io};
use zeroize::Zeroizing;
use rand_core::{RngCore, CryptoRng};
use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256};
use k256::{elliptic_curve::ops::Reduce, U256, Scalar};
use frost::{
curve::{WrappedGroup, Secp256k1},
Participant, ThresholdKeys, ThresholdView, FrostError,
algorithm::{Hram as HramTrait, Algorithm, IetfSchnorr as FrostSchnorr},
};
use super::*;
/// A BIP-340 compatible HRAm for use with the modular-frost Schnorr Algorithm.
///
/// If passed an odd nonce, the challenge will be negated.
///
/// If either `R` or `A` is the point at infinity, this will panic.
#[derive(Clone, Copy, Debug)]
pub struct Hram;
#[allow(non_snake_case)]
impl HramTrait<Secp256k1> for Hram {
fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar {
const TAG_HASH: Sha256 = Sha256::const_hash(b"BIP0340/challenge");
let mut data = Sha256::engine();
data.input(TAG_HASH.as_ref());
data.input(TAG_HASH.as_ref());
data.input(&x(R));
data.input(&x(A));
data.input(m);
let c = Scalar::reduce(U256::from_be_slice(Sha256::from_engine(data).as_ref()));
// If the nonce was odd, sign `r - cx` instead of `r + cx`, allowing us to negate `s` at the
// end to sign as `-r + cx`
<_>::conditional_select(&c, &-c, needs_negation(R))
}
}
/// BIP-340 Schnorr signature algorithm.
///
/// This may panic if called with nonces/a group key which are the point at infinity (which have
/// a negligible probability for a well-reasoned caller, even with malicious participants
/// present).
///
/// `verify`, `verify_share` MUST be called after `sign_share` is called. Otherwise, this library
/// MAY panic.
#[derive(Clone)]
pub struct Schnorr(FrostSchnorr<Secp256k1, Hram>);
impl Schnorr {
/// Construct a Schnorr algorithm continuing the specified transcript.
#[allow(clippy::new_without_default)]
pub fn new() -> Schnorr {
Schnorr(FrostSchnorr::ietf())
}
}
impl Algorithm<Secp256k1> for Schnorr {
type Transcript = <FrostSchnorr<Secp256k1, Hram> as Algorithm<Secp256k1>>::Transcript;
type Addendum = ();
type Signature = [u8; 64];
fn transcript(&mut self) -> &mut Self::Transcript {
self.0.transcript()
}
fn nonces(&self) -> Vec<Vec<ProjectivePoint>> {
self.0.nonces()
}
fn preprocess_addendum<R: RngCore + CryptoRng>(
&mut self,
rng: &mut R,
keys: &ThresholdKeys<Secp256k1>,
) {
self.0.preprocess_addendum(rng, keys)
}
fn read_addendum<R: io::Read>(&self, reader: &mut R) -> io::Result<Self::Addendum> {
self.0.read_addendum(reader)
}
fn process_addendum(
&mut self,
view: &ThresholdView<Secp256k1>,
i: Participant,
addendum: (),
) -> Result<(), FrostError> {
self.0.process_addendum(view, i, addendum)
}
fn sign_share(
&mut self,
params: &ThresholdView<Secp256k1>,
nonce_sums: &[Vec<<Secp256k1 as WrappedGroup>::G>],
nonces: Vec<Zeroizing<<Secp256k1 as WrappedGroup>::F>>,
msg: &[u8],
) -> <Secp256k1 as WrappedGroup>::F {
self.0.sign_share(params, nonce_sums, nonces, msg)
}
fn verify(
&self,
group_key: ProjectivePoint,
nonces: &[Vec<ProjectivePoint>],
sum: Scalar,
) -> Option<Self::Signature> {
self.0.verify(group_key, nonces, sum).map(|mut sig| {
sig.s = <_>::conditional_select(&sum, &-sum, needs_negation(&sig.R));
// Convert to a Bitcoin signature by dropping the byte for the point's sign bit
sig.serialize()[1 ..].try_into().unwrap()
})
}
fn verify_share(
&self,
verification_share: ProjectivePoint,
nonces: &[Vec<ProjectivePoint>],
share: Scalar,
) -> Result<Vec<(Scalar, ProjectivePoint)>, ()> {
self.0.verify_share(verification_share, nonces, share)
}
}
}
#[cfg(feature = "std")]
pub use frost_crypto::*;