mirror of
https://github.com/serai-dex/serai.git
synced 2025-12-12 22:19:26 +00:00
Compare commits
14 Commits
undroppabl
...
90a5232bbd
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
90a5232bbd | ||
|
|
20cf4c930c | ||
|
|
7ecbfde936 | ||
|
|
926ddd09db | ||
|
|
826f9986e4 | ||
|
|
7041dbeb0b | ||
|
|
df774d153c | ||
|
|
8be0538eba | ||
|
|
c32040240c | ||
|
|
207f2bd28a | ||
|
|
2b32fe90ca | ||
|
|
b9df73e418 | ||
|
|
da51543588 | ||
|
|
c1bcb0f6c7 |
2
.github/actions/bitcoin/action.yml
vendored
2
.github/actions/bitcoin/action.yml
vendored
@@ -37,4 +37,4 @@ runs:
|
|||||||
|
|
||||||
- name: Bitcoin Regtest Daemon
|
- name: Bitcoin Regtest Daemon
|
||||||
shell: bash
|
shell: bash
|
||||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/bitcoin/run.sh -txindex -daemon
|
run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/bitcoin/run.sh -daemon
|
||||||
|
|||||||
@@ -42,8 +42,8 @@ runs:
|
|||||||
shell: bash
|
shell: bash
|
||||||
run: |
|
run: |
|
||||||
cargo install svm-rs
|
cargo install svm-rs
|
||||||
svm install 0.8.26
|
svm install 0.8.25
|
||||||
svm use 0.8.26
|
svm use 0.8.25
|
||||||
|
|
||||||
# - name: Cache Rust
|
# - name: Cache Rust
|
||||||
# uses: Swatinem/rust-cache@a95ba195448af2da9b00fb742d14ffaaf3c21f43
|
# uses: Swatinem/rust-cache@a95ba195448af2da9b00fb742d14ffaaf3c21f43
|
||||||
|
|||||||
2
.github/actions/monero-wallet-rpc/action.yml
vendored
2
.github/actions/monero-wallet-rpc/action.yml
vendored
@@ -5,7 +5,7 @@ inputs:
|
|||||||
version:
|
version:
|
||||||
description: "Version to download and run"
|
description: "Version to download and run"
|
||||||
required: false
|
required: false
|
||||||
default: v0.18.3.4
|
default: v0.18.3.1
|
||||||
|
|
||||||
runs:
|
runs:
|
||||||
using: "composite"
|
using: "composite"
|
||||||
|
|||||||
4
.github/actions/monero/action.yml
vendored
4
.github/actions/monero/action.yml
vendored
@@ -5,7 +5,7 @@ inputs:
|
|||||||
version:
|
version:
|
||||||
description: "Version to download and run"
|
description: "Version to download and run"
|
||||||
required: false
|
required: false
|
||||||
default: v0.18.3.4
|
default: v0.18.3.1
|
||||||
|
|
||||||
runs:
|
runs:
|
||||||
using: "composite"
|
using: "composite"
|
||||||
@@ -43,4 +43,4 @@ runs:
|
|||||||
|
|
||||||
- name: Monero Regtest Daemon
|
- name: Monero Regtest Daemon
|
||||||
shell: bash
|
shell: bash
|
||||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/monero/run.sh --detach
|
run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/monero/run.sh --detach
|
||||||
|
|||||||
4
.github/actions/test-dependencies/action.yml
vendored
4
.github/actions/test-dependencies/action.yml
vendored
@@ -5,12 +5,12 @@ inputs:
|
|||||||
monero-version:
|
monero-version:
|
||||||
description: "Monero version to download and run as a regtest node"
|
description: "Monero version to download and run as a regtest node"
|
||||||
required: false
|
required: false
|
||||||
default: v0.18.3.4
|
default: v0.18.3.1
|
||||||
|
|
||||||
bitcoin-version:
|
bitcoin-version:
|
||||||
description: "Bitcoin version to download and run as a regtest node"
|
description: "Bitcoin version to download and run as a regtest node"
|
||||||
required: false
|
required: false
|
||||||
default: "27.1"
|
default: "27.0"
|
||||||
|
|
||||||
runs:
|
runs:
|
||||||
using: "composite"
|
using: "composite"
|
||||||
|
|||||||
2
.github/nightly-version
vendored
2
.github/nightly-version
vendored
@@ -1 +1 @@
|
|||||||
nightly-2024-07-01
|
nightly-2024-05-01
|
||||||
|
|||||||
36
.github/workflows/coins-tests.yml
vendored
Normal file
36
.github/workflows/coins-tests.yml
vendored
Normal file
@@ -0,0 +1,36 @@
|
|||||||
|
name: coins/ Tests
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- develop
|
||||||
|
paths:
|
||||||
|
- "common/**"
|
||||||
|
- "crypto/**"
|
||||||
|
- "coins/**"
|
||||||
|
|
||||||
|
pull_request:
|
||||||
|
paths:
|
||||||
|
- "common/**"
|
||||||
|
- "crypto/**"
|
||||||
|
- "coins/**"
|
||||||
|
|
||||||
|
workflow_dispatch:
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
test-coins:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
|
|
||||||
|
- name: Test Dependencies
|
||||||
|
uses: ./.github/actions/test-dependencies
|
||||||
|
|
||||||
|
- name: Run Tests
|
||||||
|
run: |
|
||||||
|
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
||||||
|
-p bitcoin-serai \
|
||||||
|
-p alloy-simple-request-transport \
|
||||||
|
-p ethereum-serai \
|
||||||
|
-p monero-generators \
|
||||||
|
-p monero-serai
|
||||||
2
.github/workflows/common-tests.yml
vendored
2
.github/workflows/common-tests.yml
vendored
@@ -27,8 +27,6 @@ jobs:
|
|||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
||||||
-p std-shims \
|
-p std-shims \
|
||||||
-p zalloc \
|
-p zalloc \
|
||||||
-p patchable-async-sleep \
|
|
||||||
-p serai-db \
|
-p serai-db \
|
||||||
-p serai-env \
|
-p serai-env \
|
||||||
-p serai-task \
|
|
||||||
-p simple-request
|
-p simple-request
|
||||||
|
|||||||
6
.github/workflows/coordinator-tests.yml
vendored
6
.github/workflows/coordinator-tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -18,7 +18,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -37,4 +37,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run coordinator Docker tests
|
- name: Run coordinator Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-coordinator-tests
|
run: cd tests/coordinator && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
4
.github/workflows/crypto-tests.yml
vendored
4
.github/workflows/crypto-tests.yml
vendored
@@ -35,10 +35,6 @@ jobs:
|
|||||||
-p multiexp \
|
-p multiexp \
|
||||||
-p schnorr-signatures \
|
-p schnorr-signatures \
|
||||||
-p dleq \
|
-p dleq \
|
||||||
-p generalized-bulletproofs \
|
|
||||||
-p generalized-bulletproofs-circuit-abstraction \
|
|
||||||
-p ec-divisors \
|
|
||||||
-p generalized-bulletproofs-ec-gadgets \
|
|
||||||
-p dkg \
|
-p dkg \
|
||||||
-p modular-frost \
|
-p modular-frost \
|
||||||
-p frost-schnorrkel
|
-p frost-schnorrkel
|
||||||
|
|||||||
2
.github/workflows/full-stack-tests.yml
vendored
2
.github/workflows/full-stack-tests.yml
vendored
@@ -19,4 +19,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run Full Stack Docker tests
|
- name: Run Full Stack Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-full-stack-tests
|
run: cd tests/full-stack && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
31
.github/workflows/lint.yml
vendored
31
.github/workflows/lint.yml
vendored
@@ -73,15 +73,6 @@ jobs:
|
|||||||
- name: Run rustfmt
|
- name: Run rustfmt
|
||||||
run: cargo +${{ steps.nightly.outputs.version }} fmt -- --check
|
run: cargo +${{ steps.nightly.outputs.version }} fmt -- --check
|
||||||
|
|
||||||
- name: Install foundry
|
|
||||||
uses: foundry-rs/foundry-toolchain@8f1998e9878d786675189ef566a2e4bf24869773
|
|
||||||
with:
|
|
||||||
version: nightly-41d4e5437107f6f42c7711123890147bc736a609
|
|
||||||
cache: false
|
|
||||||
|
|
||||||
- name: Run forge fmt
|
|
||||||
run: FOUNDRY_FMT_SORT_INPUTS=false FOUNDRY_FMT_LINE_LENGTH=100 FOUNDRY_FMT_TAB_WIDTH=2 FOUNDRY_FMT_BRACKET_SPACING=true FOUNDRY_FMT_INT_TYPES=preserve forge fmt --check $(find . -iname "*.sol")
|
|
||||||
|
|
||||||
machete:
|
machete:
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
@@ -90,25 +81,3 @@ jobs:
|
|||||||
run: |
|
run: |
|
||||||
cargo install cargo-machete
|
cargo install cargo-machete
|
||||||
cargo machete
|
cargo machete
|
||||||
|
|
||||||
slither:
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
- name: Slither
|
|
||||||
run: |
|
|
||||||
python3 -m pip install solc-select
|
|
||||||
solc-select install 0.8.26
|
|
||||||
solc-select use 0.8.26
|
|
||||||
|
|
||||||
python3 -m pip install slither-analyzer
|
|
||||||
|
|
||||||
slither --include-paths ./networks/ethereum/schnorr/contracts/Schnorr.sol
|
|
||||||
slither --include-paths ./networks/ethereum/schnorr/contracts ./networks/ethereum/schnorr/contracts/tests/Schnorr.sol
|
|
||||||
slither processor/ethereum/deployer/contracts/Deployer.sol
|
|
||||||
slither processor/ethereum/erc20/contracts/IERC20.sol
|
|
||||||
|
|
||||||
cp networks/ethereum/schnorr/contracts/Schnorr.sol processor/ethereum/router/contracts/
|
|
||||||
cp processor/ethereum/erc20/contracts/IERC20.sol processor/ethereum/router/contracts/
|
|
||||||
cd processor/ethereum/router/contracts
|
|
||||||
slither Router.sol
|
|
||||||
|
|||||||
2
.github/workflows/message-queue-tests.yml
vendored
2
.github/workflows/message-queue-tests.yml
vendored
@@ -33,4 +33,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run message-queue Docker tests
|
- name: Run message-queue Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-message-queue-tests
|
run: cd tests/message-queue && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
39
.github/workflows/monero-tests.yaml
vendored
39
.github/workflows/monero-tests.yaml
vendored
@@ -5,12 +5,12 @@ on:
|
|||||||
branches:
|
branches:
|
||||||
- develop
|
- develop
|
||||||
paths:
|
paths:
|
||||||
- "networks/monero/**"
|
- "coins/monero/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
|
|
||||||
pull_request:
|
pull_request:
|
||||||
paths:
|
paths:
|
||||||
- "networks/monero/**"
|
- "coins/monero/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
|
|
||||||
workflow_dispatch:
|
workflow_dispatch:
|
||||||
@@ -26,22 +26,7 @@ jobs:
|
|||||||
uses: ./.github/actions/test-dependencies
|
uses: ./.github/actions/test-dependencies
|
||||||
|
|
||||||
- name: Run Unit Tests Without Features
|
- name: Run Unit Tests Without Features
|
||||||
run: |
|
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --lib
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-io --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-generators --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-primitives --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-mlsag --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-clsag --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-borromean --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-bulletproofs --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-rpc --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-simple-request-rpc --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-address --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-wallet --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-seed --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package polyseed --lib
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-wallet-util --lib
|
|
||||||
|
|
||||||
# Doesn't run unit tests with features as the tests workflow will
|
# Doesn't run unit tests with features as the tests workflow will
|
||||||
|
|
||||||
@@ -50,7 +35,7 @@ jobs:
|
|||||||
# Test against all supported protocol versions
|
# Test against all supported protocol versions
|
||||||
strategy:
|
strategy:
|
||||||
matrix:
|
matrix:
|
||||||
version: [v0.17.3.2, v0.18.3.4]
|
version: [v0.17.3.2, v0.18.2.0]
|
||||||
|
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
@@ -61,17 +46,11 @@ jobs:
|
|||||||
monero-version: ${{ matrix.version }}
|
monero-version: ${{ matrix.version }}
|
||||||
|
|
||||||
- name: Run Integration Tests Without Features
|
- name: Run Integration Tests Without Features
|
||||||
run: |
|
# Runs with the binaries feature so the binaries build
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --test '*'
|
# https://github.com/rust-lang/cargo/issues/8396
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-simple-request-rpc --test '*'
|
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --features binaries --test '*'
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-wallet --test '*'
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-wallet-util --test '*'
|
|
||||||
|
|
||||||
- name: Run Integration Tests
|
- name: Run Integration Tests
|
||||||
# Don't run if the the tests workflow also will
|
# Don't run if the the tests workflow also will
|
||||||
if: ${{ matrix.version != 'v0.18.3.4' }}
|
if: ${{ matrix.version != 'v0.18.2.0' }}
|
||||||
run: |
|
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --all-features --test '*'
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --all-features --test '*'
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-simple-request-rpc --test '*'
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-wallet --all-features --test '*'
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-wallet-util --all-features --test '*'
|
|
||||||
|
|||||||
259
.github/workflows/msrv.yml
vendored
259
.github/workflows/msrv.yml
vendored
@@ -1,259 +0,0 @@
|
|||||||
name: Weekly MSRV Check
|
|
||||||
|
|
||||||
on:
|
|
||||||
schedule:
|
|
||||||
- cron: "0 0 * * 0"
|
|
||||||
workflow_dispatch:
|
|
||||||
|
|
||||||
jobs:
|
|
||||||
msrv-common:
|
|
||||||
name: Run cargo msrv on common
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on common
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path common/zalloc/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path common/std-shims/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path common/env/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path common/db/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path common/task/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path common/request/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path common/patchable-async-sleep/Cargo.toml
|
|
||||||
|
|
||||||
msrv-crypto:
|
|
||||||
name: Run cargo msrv on crypto
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on crypto
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path crypto/transcript/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path crypto/ff-group-tests/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/dalek-ff-group/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/ed448/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path crypto/multiexp/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path crypto/dleq/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/ciphersuite/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/schnorr/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path crypto/evrf/generalized-bulletproofs/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/evrf/circuit-abstraction/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/evrf/divisors/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/evrf/ec-gadgets/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/evrf/embedwards25519/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/evrf/secq256k1/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path crypto/dkg/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/frost/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path crypto/schnorrkel/Cargo.toml
|
|
||||||
|
|
||||||
msrv-networks:
|
|
||||||
name: Run cargo msrv on networks
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on networks
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path networks/bitcoin/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path networks/ethereum/build-contracts/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/ethereum/schnorr/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/ethereum/alloy-simple-request-transport/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/ethereum/relayer/Cargo.toml --features parity-db
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path networks/monero/io/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/generators/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/ringct/mlsag/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/ringct/clsag/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/ringct/borromean/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/ringct/bulletproofs/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/rpc/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/rpc/simple-request/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/wallet/address/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/wallet/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path networks/monero/verify-chain/Cargo.toml
|
|
||||||
|
|
||||||
msrv-message-queue:
|
|
||||||
name: Run cargo msrv on message-queue
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on message-queue
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path message-queue/Cargo.toml --features parity-db
|
|
||||||
|
|
||||||
msrv-processor:
|
|
||||||
name: Run cargo msrv on processor
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on processor
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path processor/view-keys/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path processor/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/messages/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path processor/scanner/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path processor/scheduler/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/scheduler/smart-contract/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/scheduler/utxo/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/scheduler/utxo/standard/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/scheduler/utxo/transaction-chaining/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path processor/key-gen/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/frost-attempt-manager/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/signers/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/bin/Cargo.toml --features parity-db
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path processor/bitcoin/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path processor/ethereum/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/ethereum/test-primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/ethereum/erc20/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/ethereum/deployer/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/ethereum/router/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path processor/ethereum/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path processor/monero/Cargo.toml
|
|
||||||
|
|
||||||
msrv-coordinator:
|
|
||||||
name: Run cargo msrv on coordinator
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on coordinator
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path coordinator/tributary-sdk/tendermint/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path coordinator/tributary-sdk/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path coordinator/cosign/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path coordinator/substrate/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path coordinator/tributary/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path coordinator/p2p/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path coordinator/p2p/libp2p/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path coordinator/Cargo.toml
|
|
||||||
|
|
||||||
msrv-substrate:
|
|
||||||
name: Run cargo msrv on substrate
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on substrate
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path substrate/primitives/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/coins/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/coins/pallet/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/dex/pallet/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/economic-security/pallet/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/genesis-liquidity/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/genesis-liquidity/pallet/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/in-instructions/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/in-instructions/pallet/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/validator-sets/pallet/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/validator-sets/primitives/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/emissions/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/emissions/pallet/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/signals/primitives/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/signals/pallet/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/abi/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/client/Cargo.toml
|
|
||||||
|
|
||||||
cargo msrv verify --manifest-path substrate/runtime/Cargo.toml
|
|
||||||
cargo msrv verify --manifest-path substrate/node/Cargo.toml
|
|
||||||
|
|
||||||
msrv-orchestration:
|
|
||||||
name: Run cargo msrv on orchestration
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on message-queue
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path orchestration/Cargo.toml
|
|
||||||
|
|
||||||
msrv-mini:
|
|
||||||
name: Run cargo msrv on mini
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Install Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
|
|
||||||
- name: Install cargo msrv
|
|
||||||
run: cargo install --locked cargo-msrv
|
|
||||||
|
|
||||||
- name: Run cargo msrv on mini
|
|
||||||
run: |
|
|
||||||
cargo msrv verify --manifest-path mini/Cargo.toml
|
|
||||||
52
.github/workflows/networks-tests.yml
vendored
52
.github/workflows/networks-tests.yml
vendored
@@ -1,52 +0,0 @@
|
|||||||
name: networks/ Tests
|
|
||||||
|
|
||||||
on:
|
|
||||||
push:
|
|
||||||
branches:
|
|
||||||
- develop
|
|
||||||
paths:
|
|
||||||
- "common/**"
|
|
||||||
- "crypto/**"
|
|
||||||
- "networks/**"
|
|
||||||
|
|
||||||
pull_request:
|
|
||||||
paths:
|
|
||||||
- "common/**"
|
|
||||||
- "crypto/**"
|
|
||||||
- "networks/**"
|
|
||||||
|
|
||||||
workflow_dispatch:
|
|
||||||
|
|
||||||
jobs:
|
|
||||||
test-networks:
|
|
||||||
runs-on: ubuntu-latest
|
|
||||||
steps:
|
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
|
||||||
|
|
||||||
- name: Test Dependencies
|
|
||||||
uses: ./.github/actions/test-dependencies
|
|
||||||
|
|
||||||
- name: Run Tests
|
|
||||||
run: |
|
|
||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
|
||||||
-p bitcoin-serai \
|
|
||||||
-p build-solidity-contracts \
|
|
||||||
-p ethereum-schnorr-contract \
|
|
||||||
-p alloy-simple-request-transport \
|
|
||||||
-p serai-ethereum-relayer \
|
|
||||||
-p monero-io \
|
|
||||||
-p monero-generators \
|
|
||||||
-p monero-primitives \
|
|
||||||
-p monero-mlsag \
|
|
||||||
-p monero-clsag \
|
|
||||||
-p monero-borromean \
|
|
||||||
-p monero-bulletproofs \
|
|
||||||
-p monero-serai \
|
|
||||||
-p monero-rpc \
|
|
||||||
-p monero-simple-request-rpc \
|
|
||||||
-p monero-address \
|
|
||||||
-p monero-wallet \
|
|
||||||
-p monero-seed \
|
|
||||||
-p polyseed \
|
|
||||||
-p monero-wallet-util \
|
|
||||||
-p monero-serai-verify-chain
|
|
||||||
6
.github/workflows/no-std.yml
vendored
6
.github/workflows/no-std.yml
vendored
@@ -7,14 +7,14 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "tests/no-std/**"
|
- "tests/no-std/**"
|
||||||
|
|
||||||
pull_request:
|
pull_request:
|
||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "tests/no-std/**"
|
- "tests/no-std/**"
|
||||||
|
|
||||||
workflow_dispatch:
|
workflow_dispatch:
|
||||||
@@ -32,4 +32,4 @@ jobs:
|
|||||||
run: sudo apt update && sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib && rustup target add riscv32imac-unknown-none-elf
|
run: sudo apt update && sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib && rustup target add riscv32imac-unknown-none-elf
|
||||||
|
|
||||||
- name: Verify no-std builds
|
- name: Verify no-std builds
|
||||||
run: CFLAGS=-I/usr/include cargo build --target riscv32imac-unknown-none-elf -p serai-no-std-tests
|
run: cd tests/no-std && CFLAGS=-I/usr/include cargo build --target riscv32imac-unknown-none-elf
|
||||||
|
|||||||
6
.github/workflows/processor-tests.yml
vendored
6
.github/workflows/processor-tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -18,7 +18,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -37,4 +37,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run processor Docker tests
|
- name: Run processor Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-processor-tests
|
run: cd tests/processor && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
2
.github/workflows/reproducible-runtime.yml
vendored
2
.github/workflows/reproducible-runtime.yml
vendored
@@ -33,4 +33,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run Reproducible Runtime tests
|
- name: Run Reproducible Runtime tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-reproducible-runtime-tests
|
run: cd tests/reproducible-runtime && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
37
.github/workflows/tests.yml
vendored
37
.github/workflows/tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
@@ -17,7 +17,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
@@ -39,33 +39,9 @@ jobs:
|
|||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
||||||
-p serai-message-queue \
|
-p serai-message-queue \
|
||||||
-p serai-processor-messages \
|
-p serai-processor-messages \
|
||||||
-p serai-processor-key-gen \
|
-p serai-processor \
|
||||||
-p serai-processor-view-keys \
|
|
||||||
-p serai-processor-frost-attempt-manager \
|
|
||||||
-p serai-processor-primitives \
|
|
||||||
-p serai-processor-scanner \
|
|
||||||
-p serai-processor-scheduler-primitives \
|
|
||||||
-p serai-processor-utxo-scheduler-primitives \
|
|
||||||
-p serai-processor-utxo-scheduler \
|
|
||||||
-p serai-processor-transaction-chaining-scheduler \
|
|
||||||
-p serai-processor-smart-contract-scheduler \
|
|
||||||
-p serai-processor-signers \
|
|
||||||
-p serai-processor-bin \
|
|
||||||
-p serai-bitcoin-processor \
|
|
||||||
-p serai-processor-ethereum-primitives \
|
|
||||||
-p serai-processor-ethereum-test-primitives \
|
|
||||||
-p serai-processor-ethereum-deployer \
|
|
||||||
-p serai-processor-ethereum-router \
|
|
||||||
-p serai-processor-ethereum-erc20 \
|
|
||||||
-p serai-ethereum-processor \
|
|
||||||
-p serai-monero-processor \
|
|
||||||
-p tendermint-machine \
|
-p tendermint-machine \
|
||||||
-p tributary-sdk \
|
-p tributary-chain \
|
||||||
-p serai-cosign \
|
|
||||||
-p serai-coordinator-substrate \
|
|
||||||
-p serai-coordinator-tributary \
|
|
||||||
-p serai-coordinator-p2p \
|
|
||||||
-p serai-coordinator-libp2p-p2p \
|
|
||||||
-p serai-coordinator \
|
-p serai-coordinator \
|
||||||
-p serai-orchestrator \
|
-p serai-orchestrator \
|
||||||
-p serai-docker-tests
|
-p serai-docker-tests
|
||||||
@@ -87,11 +63,6 @@ jobs:
|
|||||||
-p serai-dex-pallet \
|
-p serai-dex-pallet \
|
||||||
-p serai-validator-sets-primitives \
|
-p serai-validator-sets-primitives \
|
||||||
-p serai-validator-sets-pallet \
|
-p serai-validator-sets-pallet \
|
||||||
-p serai-genesis-liquidity-primitives \
|
|
||||||
-p serai-genesis-liquidity-pallet \
|
|
||||||
-p serai-emissions-primitives \
|
|
||||||
-p serai-emissions-pallet \
|
|
||||||
-p serai-economic-security-pallet \
|
|
||||||
-p serai-in-instructions-primitives \
|
-p serai-in-instructions-primitives \
|
||||||
-p serai-in-instructions-pallet \
|
-p serai-in-instructions-pallet \
|
||||||
-p serai-signals-primitives \
|
-p serai-signals-primitives \
|
||||||
|
|||||||
3616
Cargo.lock
generated
3616
Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
118
Cargo.toml
118
Cargo.toml
@@ -2,10 +2,9 @@
|
|||||||
resolver = "2"
|
resolver = "2"
|
||||||
members = [
|
members = [
|
||||||
# Version patches
|
# Version patches
|
||||||
"patches/parking_lot_core",
|
|
||||||
"patches/parking_lot",
|
|
||||||
"patches/zstd",
|
"patches/zstd",
|
||||||
"patches/rocksdb",
|
"patches/rocksdb",
|
||||||
|
"patches/proc-macro-crate",
|
||||||
|
|
||||||
# std patches
|
# std patches
|
||||||
"patches/matches",
|
"patches/matches",
|
||||||
@@ -17,10 +16,8 @@ members = [
|
|||||||
|
|
||||||
"common/std-shims",
|
"common/std-shims",
|
||||||
"common/zalloc",
|
"common/zalloc",
|
||||||
"common/patchable-async-sleep",
|
|
||||||
"common/db",
|
"common/db",
|
||||||
"common/env",
|
"common/env",
|
||||||
"common/task",
|
|
||||||
"common/request",
|
"common/request",
|
||||||
|
|
||||||
"crypto/transcript",
|
"crypto/transcript",
|
||||||
@@ -31,78 +28,26 @@ members = [
|
|||||||
"crypto/ciphersuite",
|
"crypto/ciphersuite",
|
||||||
|
|
||||||
"crypto/multiexp",
|
"crypto/multiexp",
|
||||||
|
|
||||||
"crypto/schnorr",
|
"crypto/schnorr",
|
||||||
"crypto/dleq",
|
"crypto/dleq",
|
||||||
|
|
||||||
"crypto/evrf/secq256k1",
|
|
||||||
"crypto/evrf/embedwards25519",
|
|
||||||
"crypto/evrf/generalized-bulletproofs",
|
|
||||||
"crypto/evrf/circuit-abstraction",
|
|
||||||
"crypto/evrf/divisors",
|
|
||||||
"crypto/evrf/ec-gadgets",
|
|
||||||
|
|
||||||
"crypto/dkg",
|
"crypto/dkg",
|
||||||
"crypto/frost",
|
"crypto/frost",
|
||||||
"crypto/schnorrkel",
|
"crypto/schnorrkel",
|
||||||
|
|
||||||
"networks/bitcoin",
|
"coins/bitcoin",
|
||||||
|
"coins/ethereum/alloy-simple-request-transport",
|
||||||
"networks/ethereum/build-contracts",
|
"coins/ethereum",
|
||||||
"networks/ethereum/schnorr",
|
"coins/monero/generators",
|
||||||
"networks/ethereum/alloy-simple-request-transport",
|
"coins/monero",
|
||||||
"networks/ethereum/relayer",
|
|
||||||
|
|
||||||
"networks/monero/io",
|
|
||||||
"networks/monero/generators",
|
|
||||||
"networks/monero/primitives",
|
|
||||||
"networks/monero/ringct/mlsag",
|
|
||||||
"networks/monero/ringct/clsag",
|
|
||||||
"networks/monero/ringct/borromean",
|
|
||||||
"networks/monero/ringct/bulletproofs",
|
|
||||||
"networks/monero",
|
|
||||||
"networks/monero/rpc",
|
|
||||||
"networks/monero/rpc/simple-request",
|
|
||||||
"networks/monero/wallet/address",
|
|
||||||
"networks/monero/wallet",
|
|
||||||
"networks/monero/wallet/seed",
|
|
||||||
"networks/monero/wallet/polyseed",
|
|
||||||
"networks/monero/wallet/util",
|
|
||||||
"networks/monero/verify-chain",
|
|
||||||
|
|
||||||
"message-queue",
|
"message-queue",
|
||||||
|
|
||||||
"processor/messages",
|
"processor/messages",
|
||||||
|
"processor",
|
||||||
|
|
||||||
"processor/key-gen",
|
"coordinator/tributary/tendermint",
|
||||||
"processor/view-keys",
|
|
||||||
"processor/frost-attempt-manager",
|
|
||||||
|
|
||||||
"processor/primitives",
|
|
||||||
"processor/scanner",
|
|
||||||
"processor/scheduler/primitives",
|
|
||||||
"processor/scheduler/utxo/primitives",
|
|
||||||
"processor/scheduler/utxo/standard",
|
|
||||||
"processor/scheduler/utxo/transaction-chaining",
|
|
||||||
"processor/scheduler/smart-contract",
|
|
||||||
"processor/signers",
|
|
||||||
|
|
||||||
"processor/bin",
|
|
||||||
"processor/bitcoin",
|
|
||||||
"processor/ethereum/primitives",
|
|
||||||
"processor/ethereum/test-primitives",
|
|
||||||
"processor/ethereum/deployer",
|
|
||||||
"processor/ethereum/router",
|
|
||||||
"processor/ethereum/erc20",
|
|
||||||
"processor/ethereum",
|
|
||||||
"processor/monero",
|
|
||||||
|
|
||||||
"coordinator/tributary-sdk/tendermint",
|
|
||||||
"coordinator/tributary-sdk",
|
|
||||||
"coordinator/cosign",
|
|
||||||
"coordinator/substrate",
|
|
||||||
"coordinator/tributary",
|
"coordinator/tributary",
|
||||||
"coordinator/p2p",
|
|
||||||
"coordinator/p2p/libp2p",
|
|
||||||
"coordinator",
|
"coordinator",
|
||||||
|
|
||||||
"substrate/primitives",
|
"substrate/primitives",
|
||||||
@@ -110,22 +55,12 @@ members = [
|
|||||||
"substrate/coins/primitives",
|
"substrate/coins/primitives",
|
||||||
"substrate/coins/pallet",
|
"substrate/coins/pallet",
|
||||||
|
|
||||||
"substrate/dex/pallet",
|
"substrate/in-instructions/primitives",
|
||||||
|
"substrate/in-instructions/pallet",
|
||||||
|
|
||||||
"substrate/validator-sets/primitives",
|
"substrate/validator-sets/primitives",
|
||||||
"substrate/validator-sets/pallet",
|
"substrate/validator-sets/pallet",
|
||||||
|
|
||||||
"substrate/genesis-liquidity/primitives",
|
|
||||||
"substrate/genesis-liquidity/pallet",
|
|
||||||
|
|
||||||
"substrate/emissions/primitives",
|
|
||||||
"substrate/emissions/pallet",
|
|
||||||
|
|
||||||
"substrate/economic-security/pallet",
|
|
||||||
|
|
||||||
"substrate/in-instructions/primitives",
|
|
||||||
"substrate/in-instructions/pallet",
|
|
||||||
|
|
||||||
"substrate/signals/primitives",
|
"substrate/signals/primitives",
|
||||||
"substrate/signals/pallet",
|
"substrate/signals/pallet",
|
||||||
|
|
||||||
@@ -154,32 +89,18 @@ members = [
|
|||||||
# to the extensive operations required for Bulletproofs
|
# to the extensive operations required for Bulletproofs
|
||||||
[profile.dev.package]
|
[profile.dev.package]
|
||||||
subtle = { opt-level = 3 }
|
subtle = { opt-level = 3 }
|
||||||
|
curve25519-dalek = { opt-level = 3 }
|
||||||
|
|
||||||
ff = { opt-level = 3 }
|
ff = { opt-level = 3 }
|
||||||
group = { opt-level = 3 }
|
group = { opt-level = 3 }
|
||||||
|
|
||||||
crypto-bigint = { opt-level = 3 }
|
crypto-bigint = { opt-level = 3 }
|
||||||
secp256k1 = { opt-level = 3 }
|
|
||||||
curve25519-dalek = { opt-level = 3 }
|
|
||||||
dalek-ff-group = { opt-level = 3 }
|
dalek-ff-group = { opt-level = 3 }
|
||||||
minimal-ed448 = { opt-level = 3 }
|
minimal-ed448 = { opt-level = 3 }
|
||||||
|
|
||||||
multiexp = { opt-level = 3 }
|
multiexp = { opt-level = 3 }
|
||||||
|
|
||||||
secq256k1 = { opt-level = 3 }
|
monero-serai = { opt-level = 3 }
|
||||||
embedwards25519 = { opt-level = 3 }
|
|
||||||
generalized-bulletproofs = { opt-level = 3 }
|
|
||||||
generalized-bulletproofs-circuit-abstraction = { opt-level = 3 }
|
|
||||||
ec-divisors = { opt-level = 3 }
|
|
||||||
generalized-bulletproofs-ec-gadgets = { opt-level = 3 }
|
|
||||||
|
|
||||||
dkg = { opt-level = 3 }
|
|
||||||
|
|
||||||
monero-generators = { opt-level = 3 }
|
|
||||||
monero-borromean = { opt-level = 3 }
|
|
||||||
monero-bulletproofs = { opt-level = 3 }
|
|
||||||
monero-mlsag = { opt-level = 3 }
|
|
||||||
monero-clsag = { opt-level = 3 }
|
|
||||||
|
|
||||||
[profile.release]
|
[profile.release]
|
||||||
panic = "unwind"
|
panic = "unwind"
|
||||||
@@ -188,12 +109,15 @@ panic = "unwind"
|
|||||||
# https://github.com/rust-lang-nursery/lazy-static.rs/issues/201
|
# https://github.com/rust-lang-nursery/lazy-static.rs/issues/201
|
||||||
lazy_static = { git = "https://github.com/rust-lang-nursery/lazy-static.rs", rev = "5735630d46572f1e5377c8f2ba0f79d18f53b10c" }
|
lazy_static = { git = "https://github.com/rust-lang-nursery/lazy-static.rs", rev = "5735630d46572f1e5377c8f2ba0f79d18f53b10c" }
|
||||||
|
|
||||||
parking_lot_core = { path = "patches/parking_lot_core" }
|
# Needed due to dockertest's usage of `Rc`s when we need `Arc`s
|
||||||
parking_lot = { path = "patches/parking_lot" }
|
dockertest = { git = "https://github.com/kayabaNerve/dockertest-rs", branch = "arc" }
|
||||||
|
|
||||||
# wasmtime pulls in an old version for this
|
# wasmtime pulls in an old version for this
|
||||||
zstd = { path = "patches/zstd" }
|
zstd = { path = "patches/zstd" }
|
||||||
# Needed for WAL compression
|
# Needed for WAL compression
|
||||||
rocksdb = { path = "patches/rocksdb" }
|
rocksdb = { path = "patches/rocksdb" }
|
||||||
|
# proc-macro-crate 2 binds to an old version of toml for msrv so we patch to 3
|
||||||
|
proc-macro-crate = { path = "patches/proc-macro-crate" }
|
||||||
|
|
||||||
# is-terminal now has an std-based solution with an equivalent API
|
# is-terminal now has an std-based solution with an equivalent API
|
||||||
is-terminal = { path = "patches/is-terminal" }
|
is-terminal = { path = "patches/is-terminal" }
|
||||||
@@ -208,12 +132,8 @@ matches = { path = "patches/matches" }
|
|||||||
option-ext = { path = "patches/option-ext" }
|
option-ext = { path = "patches/option-ext" }
|
||||||
directories-next = { path = "patches/directories-next" }
|
directories-next = { path = "patches/directories-next" }
|
||||||
|
|
||||||
# The official pasta_curves repo doesn't support Zeroize
|
|
||||||
pasta_curves = { git = "https://github.com/kayabaNerve/pasta_curves", rev = "a46b5be95cacbff54d06aad8d3bbcba42e05d616" }
|
|
||||||
|
|
||||||
[workspace.lints.clippy]
|
[workspace.lints.clippy]
|
||||||
unwrap_or_default = "allow"
|
unwrap_or_default = "allow"
|
||||||
map_unwrap_or = "allow"
|
|
||||||
borrow_as_ptr = "deny"
|
borrow_as_ptr = "deny"
|
||||||
cast_lossless = "deny"
|
cast_lossless = "deny"
|
||||||
cast_possible_truncation = "deny"
|
cast_possible_truncation = "deny"
|
||||||
@@ -241,6 +161,7 @@ manual_instant_elapsed = "deny"
|
|||||||
manual_let_else = "deny"
|
manual_let_else = "deny"
|
||||||
manual_ok_or = "deny"
|
manual_ok_or = "deny"
|
||||||
manual_string_new = "deny"
|
manual_string_new = "deny"
|
||||||
|
map_unwrap_or = "deny"
|
||||||
match_bool = "deny"
|
match_bool = "deny"
|
||||||
match_same_arms = "deny"
|
match_same_arms = "deny"
|
||||||
missing_fields_in_debug = "deny"
|
missing_fields_in_debug = "deny"
|
||||||
@@ -252,7 +173,6 @@ range_plus_one = "deny"
|
|||||||
redundant_closure_for_method_calls = "deny"
|
redundant_closure_for_method_calls = "deny"
|
||||||
redundant_else = "deny"
|
redundant_else = "deny"
|
||||||
string_add_assign = "deny"
|
string_add_assign = "deny"
|
||||||
string_slice = "deny"
|
|
||||||
unchecked_duration_subtraction = "deny"
|
unchecked_duration_subtraction = "deny"
|
||||||
uninlined_format_args = "deny"
|
uninlined_format_args = "deny"
|
||||||
unnecessary_box_returns = "deny"
|
unnecessary_box_returns = "deny"
|
||||||
|
|||||||
@@ -24,7 +24,7 @@ wallet.
|
|||||||
infrastructure, to our IETF-compliant FROST implementation, to a DLEq proof as
|
infrastructure, to our IETF-compliant FROST implementation, to a DLEq proof as
|
||||||
needed for Bitcoin-Monero atomic swaps.
|
needed for Bitcoin-Monero atomic swaps.
|
||||||
|
|
||||||
- `networks`: Various libraries intended for usage in Serai yet also by the
|
- `coins`: Various coin libraries intended for usage in Serai yet also by the
|
||||||
wider community. This means they will always support the functionality Serai
|
wider community. This means they will always support the functionality Serai
|
||||||
needs, yet won't disadvantage other use cases when possible.
|
needs, yet won't disadvantage other use cases when possible.
|
||||||
|
|
||||||
|
|||||||
6
audits/Cypher Stack coins bitcoin August 2023/README.md
Normal file
6
audits/Cypher Stack coins bitcoin August 2023/README.md
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
# Cypher Stack /coins/bitcoin Audit, August 2023
|
||||||
|
|
||||||
|
This audit was over the /coins/bitcoin folder. It is encompassing up to commit
|
||||||
|
5121ca75199dff7bd34230880a1fdd793012068c.
|
||||||
|
|
||||||
|
Please see https://github.com/cypherstack/serai-btc-audit for provenance.
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
# Cypher Stack /networks/bitcoin Audit, August 2023
|
|
||||||
|
|
||||||
This audit was over the `/networks/bitcoin` folder (at the time located at
|
|
||||||
`/coins/bitcoin`). It is encompassing up to commit
|
|
||||||
5121ca75199dff7bd34230880a1fdd793012068c.
|
|
||||||
|
|
||||||
Please see https://github.com/cypherstack/serai-btc-audit for provenance.
|
|
||||||
@@ -3,10 +3,10 @@ name = "bitcoin-serai"
|
|||||||
version = "0.3.0"
|
version = "0.3.0"
|
||||||
description = "A Bitcoin library for FROST-signing transactions"
|
description = "A Bitcoin library for FROST-signing transactions"
|
||||||
license = "MIT"
|
license = "MIT"
|
||||||
repository = "https://github.com/serai-dex/serai/tree/develop/networks/bitcoin"
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/bitcoin"
|
||||||
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Vrx <vrx00@proton.me>"]
|
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Vrx <vrx00@proton.me>"]
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
rust-version = "1.80"
|
rust-version = "1.74"
|
||||||
|
|
||||||
[package.metadata.docs.rs]
|
[package.metadata.docs.rs]
|
||||||
all-features = true
|
all-features = true
|
||||||
@@ -18,14 +18,16 @@ workspace = true
|
|||||||
[dependencies]
|
[dependencies]
|
||||||
std-shims = { version = "0.1.1", path = "../../common/std-shims", default-features = false }
|
std-shims = { version = "0.1.1", path = "../../common/std-shims", default-features = false }
|
||||||
|
|
||||||
thiserror = { version = "2", default-features = false }
|
thiserror = { version = "1", default-features = false, optional = true }
|
||||||
|
|
||||||
zeroize = { version = "^1.5", default-features = false }
|
zeroize = { version = "^1.5", default-features = false }
|
||||||
rand_core = { version = "0.6", default-features = false }
|
rand_core = { version = "0.6", default-features = false }
|
||||||
|
|
||||||
bitcoin = { version = "0.32", default-features = false }
|
bitcoin = { version = "0.31", default-features = false, features = ["no-std"] }
|
||||||
|
|
||||||
k256 = { version = "^0.13.1", default-features = false, features = ["arithmetic", "bits"] }
|
k256 = { version = "^0.13.1", default-features = false, features = ["arithmetic", "bits"] }
|
||||||
|
|
||||||
|
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
|
||||||
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["secp256k1"], optional = true }
|
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["secp256k1"], optional = true }
|
||||||
|
|
||||||
hex = { version = "0.4", default-features = false, optional = true }
|
hex = { version = "0.4", default-features = false, optional = true }
|
||||||
@@ -34,7 +36,7 @@ serde_json = { version = "1", default-features = false, optional = true }
|
|||||||
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls", "basic-auth"], optional = true }
|
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls", "basic-auth"], optional = true }
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
secp256k1 = { version = "0.29", default-features = false, features = ["std"] }
|
secp256k1 = { version = "0.28", default-features = false, features = ["std"] }
|
||||||
|
|
||||||
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
||||||
|
|
||||||
@@ -44,7 +46,7 @@ tokio = { version = "1", features = ["macros"] }
|
|||||||
std = [
|
std = [
|
||||||
"std-shims/std",
|
"std-shims/std",
|
||||||
|
|
||||||
"thiserror/std",
|
"thiserror",
|
||||||
|
|
||||||
"zeroize/std",
|
"zeroize/std",
|
||||||
"rand_core/std",
|
"rand_core/std",
|
||||||
@@ -53,6 +55,8 @@ std = [
|
|||||||
"bitcoin/serde",
|
"bitcoin/serde",
|
||||||
|
|
||||||
"k256/std",
|
"k256/std",
|
||||||
|
|
||||||
|
"transcript/std",
|
||||||
"frost",
|
"frost",
|
||||||
|
|
||||||
"hex/std",
|
"hex/std",
|
||||||
@@ -40,12 +40,14 @@ mod frost_crypto {
|
|||||||
|
|
||||||
use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256};
|
use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256};
|
||||||
|
|
||||||
|
use transcript::Transcript;
|
||||||
|
|
||||||
use k256::{elliptic_curve::ops::Reduce, U256, Scalar};
|
use k256::{elliptic_curve::ops::Reduce, U256, Scalar};
|
||||||
|
|
||||||
use frost::{
|
use frost::{
|
||||||
curve::{Ciphersuite, Secp256k1},
|
curve::{Ciphersuite, Secp256k1},
|
||||||
Participant, ThresholdKeys, ThresholdView, FrostError,
|
Participant, ThresholdKeys, ThresholdView, FrostError,
|
||||||
algorithm::{Hram as HramTrait, Algorithm, IetfSchnorr as FrostSchnorr},
|
algorithm::{Hram as HramTrait, Algorithm, Schnorr as FrostSchnorr},
|
||||||
};
|
};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
@@ -80,17 +82,16 @@ mod frost_crypto {
|
|||||||
///
|
///
|
||||||
/// This must be used with a ThresholdKeys whose group key is even. If it is odd, this will panic.
|
/// This must be used with a ThresholdKeys whose group key is even. If it is odd, this will panic.
|
||||||
#[derive(Clone)]
|
#[derive(Clone)]
|
||||||
pub struct Schnorr(FrostSchnorr<Secp256k1, Hram>);
|
pub struct Schnorr<T: Sync + Clone + Debug + Transcript>(FrostSchnorr<Secp256k1, T, Hram>);
|
||||||
impl Schnorr {
|
impl<T: Sync + Clone + Debug + Transcript> Schnorr<T> {
|
||||||
/// Construct a Schnorr algorithm continuing the specified transcript.
|
/// Construct a Schnorr algorithm continuing the specified transcript.
|
||||||
#[allow(clippy::new_without_default)]
|
pub fn new(transcript: T) -> Schnorr<T> {
|
||||||
pub fn new() -> Schnorr {
|
Schnorr(FrostSchnorr::new(transcript))
|
||||||
Schnorr(FrostSchnorr::ietf())
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Algorithm<Secp256k1> for Schnorr {
|
impl<T: Sync + Clone + Debug + Transcript> Algorithm<Secp256k1> for Schnorr<T> {
|
||||||
type Transcript = <FrostSchnorr<Secp256k1, Hram> as Algorithm<Secp256k1>>::Transcript;
|
type Transcript = T;
|
||||||
type Addendum = ();
|
type Addendum = ();
|
||||||
type Signature = [u8; 64];
|
type Signature = [u8; 64];
|
||||||
|
|
||||||
@@ -195,13 +195,13 @@ impl Rpc {
|
|||||||
// If this was already successfully published, consider this having succeeded
|
// If this was already successfully published, consider this having succeeded
|
||||||
if let RpcError::RequestError(Error { code, .. }) = e {
|
if let RpcError::RequestError(Error { code, .. }) = e {
|
||||||
if code == RPC_VERIFY_ALREADY_IN_CHAIN {
|
if code == RPC_VERIFY_ALREADY_IN_CHAIN {
|
||||||
return Ok(tx.compute_txid());
|
return Ok(tx.txid());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
Err(e)?
|
Err(e)?
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
if txid != tx.compute_txid() {
|
if txid != tx.txid() {
|
||||||
Err(RpcError::InvalidResponse("returned TX ID inequals calculated TX ID"))?;
|
Err(RpcError::InvalidResponse("returned TX ID inequals calculated TX ID"))?;
|
||||||
}
|
}
|
||||||
Ok(txid)
|
Ok(txid)
|
||||||
@@ -215,7 +215,7 @@ impl Rpc {
|
|||||||
let tx: Transaction = encode::deserialize(&bytes)
|
let tx: Transaction = encode::deserialize(&bytes)
|
||||||
.map_err(|_| RpcError::InvalidResponse("node sent an improperly serialized transaction"))?;
|
.map_err(|_| RpcError::InvalidResponse("node sent an improperly serialized transaction"))?;
|
||||||
|
|
||||||
let mut tx_hash = *tx.compute_txid().as_raw_hash().as_byte_array();
|
let mut tx_hash = *tx.txid().as_raw_hash().as_byte_array();
|
||||||
tx_hash.reverse();
|
tx_hash.reverse();
|
||||||
if hash != &tx_hash {
|
if hash != &tx_hash {
|
||||||
Err(RpcError::InvalidResponse("node replied with a different transaction"))?;
|
Err(RpcError::InvalidResponse("node replied with a different transaction"))?;
|
||||||
@@ -3,6 +3,7 @@ use rand_core::OsRng;
|
|||||||
use secp256k1::{Secp256k1 as BContext, Message, schnorr::Signature};
|
use secp256k1::{Secp256k1 as BContext, Message, schnorr::Signature};
|
||||||
|
|
||||||
use k256::Scalar;
|
use k256::Scalar;
|
||||||
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
use frost::{
|
use frost::{
|
||||||
curve::Secp256k1,
|
curve::Secp256k1,
|
||||||
Participant,
|
Participant,
|
||||||
@@ -24,7 +25,8 @@ fn test_algorithm() {
|
|||||||
*keys = keys.offset(Scalar::from(offset));
|
*keys = keys.offset(Scalar::from(offset));
|
||||||
}
|
}
|
||||||
|
|
||||||
let algo = Schnorr::new();
|
let algo =
|
||||||
|
Schnorr::<RecommendedTranscript>::new(RecommendedTranscript::new(b"bitcoin-serai sign test"));
|
||||||
let sig = sign(
|
let sig = sign(
|
||||||
&mut OsRng,
|
&mut OsRng,
|
||||||
&algo,
|
&algo,
|
||||||
@@ -37,7 +39,7 @@ fn test_algorithm() {
|
|||||||
.verify_schnorr(
|
.verify_schnorr(
|
||||||
&Signature::from_slice(&sig)
|
&Signature::from_slice(&sig)
|
||||||
.expect("couldn't convert produced signature to secp256k1::Signature"),
|
.expect("couldn't convert produced signature to secp256k1::Signature"),
|
||||||
&Message::from_digest_slice(Hash::hash(MESSAGE).as_ref()).unwrap(),
|
&Message::from(Hash::hash(MESSAGE)),
|
||||||
&x_only(&keys[&Participant::new(1).unwrap()].group_key()),
|
&x_only(&keys[&Participant::new(1).unwrap()].group_key()),
|
||||||
)
|
)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
@@ -4,7 +4,7 @@ use std_shims::{
|
|||||||
io::{self, Write},
|
io::{self, Write},
|
||||||
};
|
};
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
use std::io::{Read, BufReader};
|
use std_shims::io::Read;
|
||||||
|
|
||||||
use k256::{
|
use k256::{
|
||||||
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
||||||
@@ -18,11 +18,11 @@ use frost::{
|
|||||||
};
|
};
|
||||||
|
|
||||||
use bitcoin::{
|
use bitcoin::{
|
||||||
consensus::encode::serialize, key::TweakedPublicKey, OutPoint, ScriptBuf, TxOut, Transaction,
|
consensus::encode::serialize, key::TweakedPublicKey, address::Payload, OutPoint, ScriptBuf,
|
||||||
Block,
|
TxOut, Transaction, Block,
|
||||||
};
|
};
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
use bitcoin::{hashes::Hash, consensus::encode::Decodable, TapTweakHash};
|
use bitcoin::consensus::encode::Decodable;
|
||||||
|
|
||||||
use crate::crypto::x_only;
|
use crate::crypto::x_only;
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
@@ -33,40 +33,12 @@ mod send;
|
|||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
pub use send::*;
|
pub use send::*;
|
||||||
|
|
||||||
/// Tweak keys to ensure they're usable with Bitcoin's Taproot upgrade.
|
/// Tweak keys to ensure they're usable with Bitcoin.
|
||||||
///
|
///
|
||||||
/// This adds an unspendable script path to the key, preventing any outputs received to this key
|
/// Taproot keys, which these keys are used as, must be even. This offsets the keys until they're
|
||||||
/// from being spent via a script. To have keys which have spendable script paths, further offsets
|
/// even.
|
||||||
/// from this position must be used.
|
|
||||||
///
|
|
||||||
/// After adding an unspendable script path, the key is incremented until its even. This means the
|
|
||||||
/// existence of the unspendable script path may not provable, without an understanding of the
|
|
||||||
/// algorithm used here.
|
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
pub fn tweak_keys(keys: &ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
|
pub fn tweak_keys(keys: &ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
|
||||||
// Adds the unspendable script path per
|
|
||||||
// https://github.com/bitcoin/bips/blob/master/bip-0341.mediawiki#cite_note-23
|
|
||||||
let keys = {
|
|
||||||
use k256::elliptic_curve::{
|
|
||||||
bigint::{Encoding, U256},
|
|
||||||
ops::Reduce,
|
|
||||||
group::GroupEncoding,
|
|
||||||
};
|
|
||||||
let tweak_hash = TapTweakHash::hash(&keys.group_key().to_bytes().as_slice()[1 ..]);
|
|
||||||
/*
|
|
||||||
https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki#cite_ref-13-0 states how the
|
|
||||||
bias is negligible. This reduction shouldn't ever occur, yet if it did, the script path
|
|
||||||
would be unusable due to a check the script path hash is less than the order. That doesn't
|
|
||||||
impact us as we don't want the script path to be usable.
|
|
||||||
*/
|
|
||||||
keys.offset(<Secp256k1 as Ciphersuite>::F::reduce(U256::from_be_bytes(
|
|
||||||
*tweak_hash.to_raw_hash().as_ref(),
|
|
||||||
)))
|
|
||||||
};
|
|
||||||
|
|
||||||
// This doesn't risk re-introducing a script path as you'd have to find a preimage for the tweak
|
|
||||||
// hash with whatever increment, or manipulate the key so that the tweak hash and increment
|
|
||||||
// equals the desired offset, yet manipulating the key would change the tweak hash
|
|
||||||
let (_, offset) = make_even(keys.group_key());
|
let (_, offset) = make_even(keys.group_key());
|
||||||
keys.offset(Scalar::from(offset))
|
keys.offset(Scalar::from(offset))
|
||||||
}
|
}
|
||||||
@@ -74,12 +46,12 @@ pub fn tweak_keys(keys: &ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
|
|||||||
/// Return the Taproot address payload for a public key.
|
/// Return the Taproot address payload for a public key.
|
||||||
///
|
///
|
||||||
/// If the key is odd, this will return None.
|
/// If the key is odd, this will return None.
|
||||||
pub fn p2tr_script_buf(key: ProjectivePoint) -> Option<ScriptBuf> {
|
pub fn address_payload(key: ProjectivePoint) -> Option<Payload> {
|
||||||
if key.to_encoded_point(true).tag() != Tag::CompressedEvenY {
|
if key.to_encoded_point(true).tag() != Tag::CompressedEvenY {
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
Some(ScriptBuf::new_p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key))))
|
Some(Payload::p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key))))
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A spendable output.
|
/// A spendable output.
|
||||||
@@ -117,17 +89,11 @@ impl ReceivedOutput {
|
|||||||
/// Read a ReceivedOutput from a generic satisfying Read.
|
/// Read a ReceivedOutput from a generic satisfying Read.
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
pub fn read<R: Read>(r: &mut R) -> io::Result<ReceivedOutput> {
|
pub fn read<R: Read>(r: &mut R) -> io::Result<ReceivedOutput> {
|
||||||
let offset = Secp256k1::read_F(r)?;
|
Ok(ReceivedOutput {
|
||||||
let output;
|
offset: Secp256k1::read_F(r)?,
|
||||||
let outpoint;
|
output: TxOut::consensus_decode(r).map_err(|_| io::Error::other("invalid TxOut"))?,
|
||||||
{
|
outpoint: OutPoint::consensus_decode(r).map_err(|_| io::Error::other("invalid OutPoint"))?,
|
||||||
let mut buf_r = BufReader::with_capacity(0, r);
|
})
|
||||||
output =
|
|
||||||
TxOut::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid TxOut"))?;
|
|
||||||
outpoint =
|
|
||||||
OutPoint::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid OutPoint"))?;
|
|
||||||
}
|
|
||||||
Ok(ReceivedOutput { offset, output, outpoint })
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Write a ReceivedOutput to a generic satisfying Write.
|
/// Write a ReceivedOutput to a generic satisfying Write.
|
||||||
@@ -158,7 +124,7 @@ impl Scanner {
|
|||||||
/// Returns None if this key can't be scanned for.
|
/// Returns None if this key can't be scanned for.
|
||||||
pub fn new(key: ProjectivePoint) -> Option<Scanner> {
|
pub fn new(key: ProjectivePoint) -> Option<Scanner> {
|
||||||
let mut scripts = HashMap::new();
|
let mut scripts = HashMap::new();
|
||||||
scripts.insert(p2tr_script_buf(key)?, Scalar::ZERO);
|
scripts.insert(address_payload(key)?.script_pubkey(), Scalar::ZERO);
|
||||||
Some(Scanner { key, scripts })
|
Some(Scanner { key, scripts })
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -170,17 +136,14 @@ impl Scanner {
|
|||||||
///
|
///
|
||||||
/// This means offsets are surjective, not bijective, and the order offsets are registered in
|
/// This means offsets are surjective, not bijective, and the order offsets are registered in
|
||||||
/// may determine the validity of future offsets.
|
/// may determine the validity of future offsets.
|
||||||
///
|
|
||||||
/// The offsets registered must be securely generated. Arbitrary offsets may introduce a script
|
|
||||||
/// path into the output, allowing the output to be spent by satisfaction of an arbitrary script
|
|
||||||
/// (not by the signature of the key).
|
|
||||||
pub fn register_offset(&mut self, mut offset: Scalar) -> Option<Scalar> {
|
pub fn register_offset(&mut self, mut offset: Scalar) -> Option<Scalar> {
|
||||||
// This loop will terminate as soon as an even point is found, with any point having a ~50%
|
// This loop will terminate as soon as an even point is found, with any point having a ~50%
|
||||||
// chance of being even
|
// chance of being even
|
||||||
// That means this should terminate within a very small amount of iterations
|
// That means this should terminate within a very small amount of iterations
|
||||||
loop {
|
loop {
|
||||||
match p2tr_script_buf(self.key + (ProjectivePoint::GENERATOR * offset)) {
|
match address_payload(self.key + (ProjectivePoint::GENERATOR * offset)) {
|
||||||
Some(script) => {
|
Some(address) => {
|
||||||
|
let script = address.script_pubkey();
|
||||||
if self.scripts.contains_key(&script) {
|
if self.scripts.contains_key(&script) {
|
||||||
None?;
|
None?;
|
||||||
}
|
}
|
||||||
@@ -203,7 +166,7 @@ impl Scanner {
|
|||||||
res.push(ReceivedOutput {
|
res.push(ReceivedOutput {
|
||||||
offset: *offset,
|
offset: *offset,
|
||||||
output: output.clone(),
|
output: output.clone(),
|
||||||
outpoint: OutPoint::new(tx.compute_txid(), vout),
|
outpoint: OutPoint::new(tx.txid(), vout),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -7,7 +7,9 @@ use thiserror::Error;
|
|||||||
|
|
||||||
use rand_core::{RngCore, CryptoRng};
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
use k256::Scalar;
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
|
|
||||||
|
use k256::{elliptic_curve::sec1::ToEncodedPoint, Scalar};
|
||||||
use frost::{curve::Secp256k1, Participant, ThresholdKeys, FrostError, sign::*};
|
use frost::{curve::Secp256k1, Participant, ThresholdKeys, FrostError, sign::*};
|
||||||
|
|
||||||
use bitcoin::{
|
use bitcoin::{
|
||||||
@@ -16,12 +18,12 @@ use bitcoin::{
|
|||||||
absolute::LockTime,
|
absolute::LockTime,
|
||||||
script::{PushBytesBuf, ScriptBuf},
|
script::{PushBytesBuf, ScriptBuf},
|
||||||
transaction::{Version, Transaction},
|
transaction::{Version, Transaction},
|
||||||
OutPoint, Sequence, Witness, TxIn, Amount, TxOut,
|
OutPoint, Sequence, Witness, TxIn, Amount, TxOut, Address,
|
||||||
};
|
};
|
||||||
|
|
||||||
use crate::{
|
use crate::{
|
||||||
crypto::Schnorr,
|
crypto::Schnorr,
|
||||||
wallet::{ReceivedOutput, p2tr_script_buf},
|
wallet::{ReceivedOutput, address_payload},
|
||||||
};
|
};
|
||||||
|
|
||||||
#[rustfmt::skip]
|
#[rustfmt::skip]
|
||||||
@@ -44,7 +46,7 @@ pub enum TransactionError {
|
|||||||
#[error("fee was too low to pass the default minimum fee rate")]
|
#[error("fee was too low to pass the default minimum fee rate")]
|
||||||
TooLowFee,
|
TooLowFee,
|
||||||
#[error("not enough funds for these payments")]
|
#[error("not enough funds for these payments")]
|
||||||
NotEnoughFunds { inputs: u64, payments: u64, fee: u64 },
|
NotEnoughFunds,
|
||||||
#[error("transaction was too large")]
|
#[error("transaction was too large")]
|
||||||
TooLargeTransaction,
|
TooLargeTransaction,
|
||||||
}
|
}
|
||||||
@@ -59,11 +61,7 @@ pub struct SignableTransaction {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl SignableTransaction {
|
impl SignableTransaction {
|
||||||
fn calculate_weight_vbytes(
|
fn calculate_weight(inputs: usize, payments: &[(Address, u64)], change: Option<&Address>) -> u64 {
|
||||||
inputs: usize,
|
|
||||||
payments: &[(ScriptBuf, u64)],
|
|
||||||
change: Option<&ScriptBuf>,
|
|
||||||
) -> (u64, u64) {
|
|
||||||
// Expand this a full transaction in order to use the bitcoin library's weight function
|
// Expand this a full transaction in order to use the bitcoin library's weight function
|
||||||
let mut tx = Transaction {
|
let mut tx = Transaction {
|
||||||
version: Version(2),
|
version: Version(2),
|
||||||
@@ -88,42 +86,16 @@ impl SignableTransaction {
|
|||||||
// The script pub key is not of a fixed size and does have to be used here
|
// The script pub key is not of a fixed size and does have to be used here
|
||||||
.map(|payment| TxOut {
|
.map(|payment| TxOut {
|
||||||
value: Amount::from_sat(payment.1),
|
value: Amount::from_sat(payment.1),
|
||||||
script_pubkey: payment.0.clone(),
|
script_pubkey: payment.0.script_pubkey(),
|
||||||
})
|
})
|
||||||
.collect(),
|
.collect(),
|
||||||
};
|
};
|
||||||
if let Some(change) = change {
|
if let Some(change) = change {
|
||||||
// Use a 0 value since we're currently unsure what the change amount will be, and since
|
// Use a 0 value since we're currently unsure what the change amount will be, and since
|
||||||
// the value is fixed size (so any value could be used here)
|
// the value is fixed size (so any value could be used here)
|
||||||
tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.clone() });
|
tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.script_pubkey() });
|
||||||
}
|
}
|
||||||
|
u64::from(tx.weight())
|
||||||
let weight = tx.weight();
|
|
||||||
|
|
||||||
// Now calculate the size in vbytes
|
|
||||||
|
|
||||||
/*
|
|
||||||
"Virtual transaction size" is weight ceildiv 4 per
|
|
||||||
https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
|
|
||||||
|
|
||||||
https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04
|
|
||||||
/src/policy/policy.cpp#L295-L298
|
|
||||||
implements this almost as expected, with an additional consideration to signature operations
|
|
||||||
|
|
||||||
Signature operations (the second argument of the following call) do not count Taproot
|
|
||||||
signatures per https://github.com/bitcoin/bips/blob/master/bip-0342.mediawiki#cite_ref-11-0
|
|
||||||
|
|
||||||
We don't risk running afoul of the Taproot signature limit as it allows at least one per
|
|
||||||
input, which is all we use
|
|
||||||
*/
|
|
||||||
(
|
|
||||||
weight.to_wu(),
|
|
||||||
u64::try_from(bitcoin::policy::get_virtual_tx_size(
|
|
||||||
i64::try_from(weight.to_wu()).unwrap(),
|
|
||||||
0i64,
|
|
||||||
))
|
|
||||||
.unwrap(),
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns the fee necessary for this transaction to achieve the fee rate specified at
|
/// Returns the fee necessary for this transaction to achieve the fee rate specified at
|
||||||
@@ -149,10 +121,10 @@ impl SignableTransaction {
|
|||||||
/// If data is specified, an OP_RETURN output will be added with it.
|
/// If data is specified, an OP_RETURN output will be added with it.
|
||||||
pub fn new(
|
pub fn new(
|
||||||
mut inputs: Vec<ReceivedOutput>,
|
mut inputs: Vec<ReceivedOutput>,
|
||||||
payments: &[(ScriptBuf, u64)],
|
payments: &[(Address, u64)],
|
||||||
change: Option<ScriptBuf>,
|
change: Option<&Address>,
|
||||||
data: Option<Vec<u8>>,
|
data: Option<Vec<u8>>,
|
||||||
fee_per_vbyte: u64,
|
fee_per_weight: u64,
|
||||||
) -> Result<SignableTransaction, TransactionError> {
|
) -> Result<SignableTransaction, TransactionError> {
|
||||||
if inputs.is_empty() {
|
if inputs.is_empty() {
|
||||||
Err(TransactionError::NoInputs)?;
|
Err(TransactionError::NoInputs)?;
|
||||||
@@ -187,7 +159,10 @@ impl SignableTransaction {
|
|||||||
let payment_sat = payments.iter().map(|payment| payment.1).sum::<u64>();
|
let payment_sat = payments.iter().map(|payment| payment.1).sum::<u64>();
|
||||||
let mut tx_outs = payments
|
let mut tx_outs = payments
|
||||||
.iter()
|
.iter()
|
||||||
.map(|payment| TxOut { value: Amount::from_sat(payment.1), script_pubkey: payment.0.clone() })
|
.map(|payment| TxOut {
|
||||||
|
value: Amount::from_sat(payment.1),
|
||||||
|
script_pubkey: payment.0.script_pubkey(),
|
||||||
|
})
|
||||||
.collect::<Vec<_>>();
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
// Add the OP_RETURN output
|
// Add the OP_RETURN output
|
||||||
@@ -201,33 +176,49 @@ impl SignableTransaction {
|
|||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
let (mut weight, vbytes) = Self::calculate_weight_vbytes(tx_ins.len(), payments, None);
|
let mut weight = Self::calculate_weight(tx_ins.len(), payments, None);
|
||||||
|
let mut needed_fee = fee_per_weight * weight;
|
||||||
|
|
||||||
let mut needed_fee = fee_per_vbyte * vbytes;
|
// "Virtual transaction size" is weight ceildiv 4 per
|
||||||
|
// https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
|
||||||
|
|
||||||
|
// https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04/
|
||||||
|
// src/policy/policy.cpp#L295-L298
|
||||||
|
// implements this as expected
|
||||||
|
|
||||||
|
// Technically, it takes whatever's greater, the weight or the amount of signature operations
|
||||||
|
// multiplied by DEFAULT_BYTES_PER_SIGOP (20)
|
||||||
|
// We only use 1 signature per input, and our inputs have a weight exceeding 20
|
||||||
|
// Accordingly, our inputs' weight will always be greater than the cost of the signature ops
|
||||||
|
let vsize = weight.div_ceil(4);
|
||||||
|
debug_assert_eq!(
|
||||||
|
u64::try_from(bitcoin::policy::get_virtual_tx_size(
|
||||||
|
weight.try_into().unwrap(),
|
||||||
|
tx_ins.len().try_into().unwrap()
|
||||||
|
))
|
||||||
|
.unwrap(),
|
||||||
|
vsize
|
||||||
|
);
|
||||||
// Technically, if there isn't change, this TX may still pay enough of a fee to pass the
|
// Technically, if there isn't change, this TX may still pay enough of a fee to pass the
|
||||||
// minimum fee. Such edge cases aren't worth programming when they go against intent, as the
|
// minimum fee. Such edge cases aren't worth programming when they go against intent, as the
|
||||||
// specified fee rate is too low to be valid
|
// specified fee rate is too low to be valid
|
||||||
// bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE is in sats/kilo-vbyte
|
// bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE is in sats/kilo-vbyte
|
||||||
if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vbytes) / 1000) {
|
if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vsize) / 1000) {
|
||||||
Err(TransactionError::TooLowFee)?;
|
Err(TransactionError::TooLowFee)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
if input_sat < (payment_sat + needed_fee) {
|
if input_sat < (payment_sat + needed_fee) {
|
||||||
Err(TransactionError::NotEnoughFunds {
|
Err(TransactionError::NotEnoughFunds)?;
|
||||||
inputs: input_sat,
|
|
||||||
payments: payment_sat,
|
|
||||||
fee: needed_fee,
|
|
||||||
})?;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// If there's a change address, check if there's change to give it
|
// If there's a change address, check if there's change to give it
|
||||||
if let Some(change) = change {
|
if let Some(change) = change {
|
||||||
let (weight_with_change, vbytes_with_change) =
|
let weight_with_change = Self::calculate_weight(tx_ins.len(), payments, Some(change));
|
||||||
Self::calculate_weight_vbytes(tx_ins.len(), payments, Some(&change));
|
let fee_with_change = fee_per_weight * weight_with_change;
|
||||||
let fee_with_change = fee_per_vbyte * vbytes_with_change;
|
|
||||||
if let Some(value) = input_sat.checked_sub(payment_sat + fee_with_change) {
|
if let Some(value) = input_sat.checked_sub(payment_sat + fee_with_change) {
|
||||||
if value >= DUST {
|
if value >= DUST {
|
||||||
tx_outs.push(TxOut { value: Amount::from_sat(value), script_pubkey: change });
|
tx_outs
|
||||||
|
.push(TxOut { value: Amount::from_sat(value), script_pubkey: change.script_pubkey() });
|
||||||
weight = weight_with_change;
|
weight = weight_with_change;
|
||||||
needed_fee = fee_with_change;
|
needed_fee = fee_with_change;
|
||||||
}
|
}
|
||||||
@@ -257,28 +248,54 @@ impl SignableTransaction {
|
|||||||
|
|
||||||
/// Returns the TX ID of the transaction this will create.
|
/// Returns the TX ID of the transaction this will create.
|
||||||
pub fn txid(&self) -> [u8; 32] {
|
pub fn txid(&self) -> [u8; 32] {
|
||||||
let mut res = self.tx.compute_txid().to_byte_array();
|
let mut res = self.tx.txid().to_byte_array();
|
||||||
res.reverse();
|
res.reverse();
|
||||||
res
|
res
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns the transaction, sans witness, this will create if signed.
|
/// Returns the outputs this transaction will create.
|
||||||
pub fn transaction(&self) -> &Transaction {
|
pub fn outputs(&self) -> &[TxOut] {
|
||||||
&self.tx
|
&self.tx.output
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Create a multisig machine for this transaction.
|
/// Create a multisig machine for this transaction.
|
||||||
///
|
///
|
||||||
/// Returns None if the wrong keys are used.
|
/// Returns None if the wrong keys are used.
|
||||||
pub fn multisig(self, keys: &ThresholdKeys<Secp256k1>) -> Option<TransactionMachine> {
|
pub fn multisig(
|
||||||
|
self,
|
||||||
|
keys: &ThresholdKeys<Secp256k1>,
|
||||||
|
mut transcript: RecommendedTranscript,
|
||||||
|
) -> Option<TransactionMachine> {
|
||||||
|
transcript.domain_separate(b"bitcoin_transaction");
|
||||||
|
transcript.append_message(b"root_key", keys.group_key().to_encoded_point(true).as_bytes());
|
||||||
|
|
||||||
|
// Transcript the inputs and outputs
|
||||||
|
let tx = &self.tx;
|
||||||
|
for input in &tx.input {
|
||||||
|
transcript.append_message(b"input_hash", input.previous_output.txid);
|
||||||
|
transcript.append_message(b"input_output_index", input.previous_output.vout.to_le_bytes());
|
||||||
|
}
|
||||||
|
for payment in &tx.output {
|
||||||
|
transcript.append_message(b"output_script", payment.script_pubkey.as_bytes());
|
||||||
|
transcript.append_message(b"output_amount", payment.value.to_sat().to_le_bytes());
|
||||||
|
}
|
||||||
|
|
||||||
let mut sigs = vec![];
|
let mut sigs = vec![];
|
||||||
for i in 0 .. self.tx.input.len() {
|
for i in 0 .. tx.input.len() {
|
||||||
|
let mut transcript = transcript.clone();
|
||||||
|
// This unwrap is safe since any transaction with this many inputs violates the maximum
|
||||||
|
// size allowed under standards, which this lib will error on creation of
|
||||||
|
transcript.append_message(b"signing_input", u32::try_from(i).unwrap().to_le_bytes());
|
||||||
|
|
||||||
let offset = keys.clone().offset(self.offsets[i]);
|
let offset = keys.clone().offset(self.offsets[i]);
|
||||||
if p2tr_script_buf(offset.group_key())? != self.prevouts[i].script_pubkey {
|
if address_payload(offset.group_key())?.script_pubkey() != self.prevouts[i].script_pubkey {
|
||||||
None?;
|
None?;
|
||||||
}
|
}
|
||||||
|
|
||||||
sigs.push(AlgorithmMachine::new(Schnorr::new(), keys.clone().offset(self.offsets[i])));
|
sigs.push(AlgorithmMachine::new(
|
||||||
|
Schnorr::new(transcript),
|
||||||
|
keys.clone().offset(self.offsets[i]),
|
||||||
|
));
|
||||||
}
|
}
|
||||||
|
|
||||||
Some(TransactionMachine { tx: self, sigs })
|
Some(TransactionMachine { tx: self, sigs })
|
||||||
@@ -291,7 +308,7 @@ impl SignableTransaction {
|
|||||||
/// This will panic if either `cache` is called or the message isn't empty.
|
/// This will panic if either `cache` is called or the message isn't empty.
|
||||||
pub struct TransactionMachine {
|
pub struct TransactionMachine {
|
||||||
tx: SignableTransaction,
|
tx: SignableTransaction,
|
||||||
sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr>>,
|
sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl PreprocessMachine for TransactionMachine {
|
impl PreprocessMachine for TransactionMachine {
|
||||||
@@ -320,7 +337,7 @@ impl PreprocessMachine for TransactionMachine {
|
|||||||
|
|
||||||
pub struct TransactionSignMachine {
|
pub struct TransactionSignMachine {
|
||||||
tx: SignableTransaction,
|
tx: SignableTransaction,
|
||||||
sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr>>,
|
sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl SignMachine<Transaction> for TransactionSignMachine {
|
impl SignMachine<Transaction> for TransactionSignMachine {
|
||||||
@@ -400,7 +417,7 @@ impl SignMachine<Transaction> for TransactionSignMachine {
|
|||||||
|
|
||||||
pub struct TransactionSignatureMachine {
|
pub struct TransactionSignatureMachine {
|
||||||
tx: Transaction,
|
tx: Transaction,
|
||||||
sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr>>,
|
sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl SignatureMachine<Transaction> for TransactionSignatureMachine {
|
impl SignatureMachine<Transaction> for TransactionSignatureMachine {
|
||||||
@@ -1,11 +1,14 @@
|
|||||||
use std::sync::LazyLock;
|
use std::sync::OnceLock;
|
||||||
|
|
||||||
use bitcoin_serai::rpc::Rpc;
|
use bitcoin_serai::rpc::Rpc;
|
||||||
|
|
||||||
use tokio::sync::Mutex;
|
use tokio::sync::Mutex;
|
||||||
|
|
||||||
#[allow(dead_code)]
|
static SEQUENTIAL_CELL: OnceLock<Mutex<()>> = OnceLock::new();
|
||||||
pub(crate) static SEQUENTIAL: LazyLock<Mutex<()>> = LazyLock::new(|| Mutex::new(()));
|
#[allow(non_snake_case)]
|
||||||
|
pub fn SEQUENTIAL() -> &'static Mutex<()> {
|
||||||
|
SEQUENTIAL_CELL.get_or_init(|| Mutex::new(()))
|
||||||
|
}
|
||||||
|
|
||||||
#[allow(dead_code)]
|
#[allow(dead_code)]
|
||||||
pub(crate) async fn rpc() -> Rpc {
|
pub(crate) async fn rpc() -> Rpc {
|
||||||
@@ -31,7 +34,7 @@ macro_rules! async_sequential {
|
|||||||
$(
|
$(
|
||||||
#[tokio::test]
|
#[tokio::test]
|
||||||
async fn $name() {
|
async fn $name() {
|
||||||
let guard = runner::SEQUENTIAL.lock().await;
|
let guard = runner::SEQUENTIAL().lock().await;
|
||||||
let local = tokio::task::LocalSet::new();
|
let local = tokio::task::LocalSet::new();
|
||||||
local.run_until(async move {
|
local.run_until(async move {
|
||||||
if let Err(err) = tokio::task::spawn_local(async move { $body }).await {
|
if let Err(err) = tokio::task::spawn_local(async move { $body }).await {
|
||||||
@@ -2,6 +2,8 @@ use std::collections::HashMap;
|
|||||||
|
|
||||||
use rand_core::{RngCore, OsRng};
|
use rand_core::{RngCore, OsRng};
|
||||||
|
|
||||||
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
|
|
||||||
use k256::{
|
use k256::{
|
||||||
elliptic_curve::{
|
elliptic_curve::{
|
||||||
group::{ff::Field, Group},
|
group::{ff::Field, Group},
|
||||||
@@ -20,10 +22,11 @@ use bitcoin_serai::{
|
|||||||
hashes::Hash as HashTrait,
|
hashes::Hash as HashTrait,
|
||||||
blockdata::opcodes::all::OP_RETURN,
|
blockdata::opcodes::all::OP_RETURN,
|
||||||
script::{PushBytesBuf, Instruction, Instructions, Script},
|
script::{PushBytesBuf, Instruction, Instructions, Script},
|
||||||
|
address::NetworkChecked,
|
||||||
OutPoint, Amount, TxOut, Transaction, Network, Address,
|
OutPoint, Amount, TxOut, Transaction, Network, Address,
|
||||||
},
|
},
|
||||||
wallet::{
|
wallet::{
|
||||||
tweak_keys, p2tr_script_buf, ReceivedOutput, Scanner, TransactionError, SignableTransaction,
|
tweak_keys, address_payload, ReceivedOutput, Scanner, TransactionError, SignableTransaction,
|
||||||
},
|
},
|
||||||
rpc::Rpc,
|
rpc::Rpc,
|
||||||
};
|
};
|
||||||
@@ -45,7 +48,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
|||||||
"generatetoaddress",
|
"generatetoaddress",
|
||||||
serde_json::json!([
|
serde_json::json!([
|
||||||
1,
|
1,
|
||||||
Address::from_script(&p2tr_script_buf(key).unwrap(), Network::Regtest).unwrap()
|
Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())
|
||||||
]),
|
]),
|
||||||
)
|
)
|
||||||
.await
|
.await
|
||||||
@@ -66,7 +69,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
|||||||
assert_eq!(outputs, scanner.scan_transaction(&block.txdata[0]));
|
assert_eq!(outputs, scanner.scan_transaction(&block.txdata[0]));
|
||||||
|
|
||||||
assert_eq!(outputs.len(), 1);
|
assert_eq!(outputs.len(), 1);
|
||||||
assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].compute_txid(), 0));
|
assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].txid(), 0));
|
||||||
assert_eq!(outputs[0].value(), block.txdata[0].output[0].value.to_sat());
|
assert_eq!(outputs[0].value(), block.txdata[0].output[0].value.to_sat());
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -92,11 +95,46 @@ fn sign(
|
|||||||
) -> Transaction {
|
) -> Transaction {
|
||||||
let mut machines = HashMap::new();
|
let mut machines = HashMap::new();
|
||||||
for i in (1 ..= THRESHOLD).map(|i| Participant::new(i).unwrap()) {
|
for i in (1 ..= THRESHOLD).map(|i| Participant::new(i).unwrap()) {
|
||||||
machines.insert(i, tx.clone().multisig(&keys[&i].clone()).unwrap());
|
machines.insert(
|
||||||
|
i,
|
||||||
|
tx.clone()
|
||||||
|
.multisig(&keys[&i].clone(), RecommendedTranscript::new(b"bitcoin-serai Test Transaction"))
|
||||||
|
.unwrap(),
|
||||||
|
);
|
||||||
}
|
}
|
||||||
sign_without_caching(&mut OsRng, machines, &[])
|
sign_without_caching(&mut OsRng, machines, &[])
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_tweak_keys() {
|
||||||
|
let mut even = false;
|
||||||
|
let mut odd = false;
|
||||||
|
|
||||||
|
// Generate keys until we get an even set and an odd set
|
||||||
|
while !(even && odd) {
|
||||||
|
let mut keys = key_gen(&mut OsRng).drain().next().unwrap().1;
|
||||||
|
if is_even(keys.group_key()) {
|
||||||
|
// Tweaking should do nothing
|
||||||
|
assert_eq!(tweak_keys(&keys).group_key(), keys.group_key());
|
||||||
|
|
||||||
|
even = true;
|
||||||
|
} else {
|
||||||
|
let tweaked = tweak_keys(&keys).group_key();
|
||||||
|
assert_ne!(tweaked, keys.group_key());
|
||||||
|
// Tweaking should produce an even key
|
||||||
|
assert!(is_even(tweaked));
|
||||||
|
|
||||||
|
// Verify it uses the smallest possible offset
|
||||||
|
while keys.group_key().to_encoded_point(true).tag() == Tag::CompressedOddY {
|
||||||
|
keys = keys.offset(Scalar::ONE);
|
||||||
|
}
|
||||||
|
assert_eq!(tweaked, keys.group_key());
|
||||||
|
|
||||||
|
odd = true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
async_sequential! {
|
async_sequential! {
|
||||||
async fn test_scanner() {
|
async fn test_scanner() {
|
||||||
// Test Scanners are creatable for even keys.
|
// Test Scanners are creatable for even keys.
|
||||||
@@ -155,7 +193,7 @@ async_sequential! {
|
|||||||
assert_eq!(output.offset(), Scalar::ZERO);
|
assert_eq!(output.offset(), Scalar::ZERO);
|
||||||
|
|
||||||
let inputs = vec![output];
|
let inputs = vec![output];
|
||||||
let addr = || p2tr_script_buf(key).unwrap();
|
let addr = || Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap());
|
||||||
let payments = vec![(addr(), 1000)];
|
let payments = vec![(addr(), 1000)];
|
||||||
|
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &payments, None, None, FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &payments, None, None, FEE).is_ok());
|
||||||
@@ -168,7 +206,7 @@ async_sequential! {
|
|||||||
// No change
|
// No change
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &[(addr(), 1000)], None, None, FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &[(addr(), 1000)], None, None, FEE).is_ok());
|
||||||
// Consolidation TX
|
// Consolidation TX
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, FEE).is_ok());
|
||||||
// Data
|
// Data
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &[], None, Some(vec![]), FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &[], None, Some(vec![]), FEE).is_ok());
|
||||||
// No outputs
|
// No outputs
|
||||||
@@ -191,14 +229,14 @@ async_sequential! {
|
|||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, 0),
|
SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, 0),
|
||||||
Err(TransactionError::TooLowFee),
|
Err(TransactionError::TooLowFee),
|
||||||
);
|
);
|
||||||
|
|
||||||
assert!(matches!(
|
assert_eq!(
|
||||||
SignableTransaction::new(inputs.clone(), &[(addr(), inputs[0].value() * 2)], None, None, FEE),
|
SignableTransaction::new(inputs.clone(), &[(addr(), inputs[0].value() * 2)], None, None, FEE),
|
||||||
Err(TransactionError::NotEnoughFunds { .. }),
|
Err(TransactionError::NotEnoughFunds),
|
||||||
));
|
);
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
SignableTransaction::new(inputs, &vec![(addr(), 1000); 10000], None, None, FEE),
|
SignableTransaction::new(inputs, &vec![(addr(), 1000); 10000], None, None, FEE),
|
||||||
@@ -223,19 +261,20 @@ async_sequential! {
|
|||||||
|
|
||||||
// Declare payments, change, fee
|
// Declare payments, change, fee
|
||||||
let payments = [
|
let payments = [
|
||||||
(p2tr_script_buf(key).unwrap(), 1005),
|
(Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap()), 1005),
|
||||||
(p2tr_script_buf(offset_key).unwrap(), 1007)
|
(Address::<NetworkChecked>::new(Network::Regtest, address_payload(offset_key).unwrap()), 1007)
|
||||||
];
|
];
|
||||||
|
|
||||||
let change_offset = scanner.register_offset(Scalar::random(&mut OsRng)).unwrap();
|
let change_offset = scanner.register_offset(Scalar::random(&mut OsRng)).unwrap();
|
||||||
let change_key = key + (ProjectivePoint::GENERATOR * change_offset);
|
let change_key = key + (ProjectivePoint::GENERATOR * change_offset);
|
||||||
let change_addr = p2tr_script_buf(change_key).unwrap();
|
let change_addr =
|
||||||
|
Address::<NetworkChecked>::new(Network::Regtest, address_payload(change_key).unwrap());
|
||||||
|
|
||||||
// Create and sign the TX
|
// Create and sign the TX
|
||||||
let tx = SignableTransaction::new(
|
let tx = SignableTransaction::new(
|
||||||
vec![output.clone(), offset_output.clone()],
|
vec![output.clone(), offset_output.clone()],
|
||||||
&payments,
|
&payments,
|
||||||
Some(change_addr.clone()),
|
Some(&change_addr),
|
||||||
None,
|
None,
|
||||||
FEE
|
FEE
|
||||||
).unwrap();
|
).unwrap();
|
||||||
@@ -248,7 +287,7 @@ async_sequential! {
|
|||||||
// Ensure we can scan it
|
// Ensure we can scan it
|
||||||
let outputs = scanner.scan_transaction(&tx);
|
let outputs = scanner.scan_transaction(&tx);
|
||||||
for (o, output) in outputs.iter().enumerate() {
|
for (o, output) in outputs.iter().enumerate() {
|
||||||
assert_eq!(output.outpoint(), &OutPoint::new(tx.compute_txid(), u32::try_from(o).unwrap()));
|
assert_eq!(output.outpoint(), &OutPoint::new(tx.txid(), u32::try_from(o).unwrap()));
|
||||||
assert_eq!(&ReceivedOutput::read::<&[u8]>(&mut output.serialize().as_ref()).unwrap(), output);
|
assert_eq!(&ReceivedOutput::read::<&[u8]>(&mut output.serialize().as_ref()).unwrap(), output);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -260,13 +299,13 @@ async_sequential! {
|
|||||||
for ((output, scanned), payment) in tx.output.iter().zip(outputs.iter()).zip(payments.iter()) {
|
for ((output, scanned), payment) in tx.output.iter().zip(outputs.iter()).zip(payments.iter()) {
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
output,
|
output,
|
||||||
&TxOut { script_pubkey: payment.0.clone(), value: Amount::from_sat(payment.1) },
|
&TxOut { script_pubkey: payment.0.script_pubkey(), value: Amount::from_sat(payment.1) },
|
||||||
);
|
);
|
||||||
assert_eq!(scanned.value(), payment.1 );
|
assert_eq!(scanned.value(), payment.1 );
|
||||||
}
|
}
|
||||||
|
|
||||||
// Make sure the change is correct
|
// Make sure the change is correct
|
||||||
assert_eq!(needed_fee, u64::try_from(tx.vsize()).unwrap() * FEE);
|
assert_eq!(needed_fee, u64::from(tx.weight()) * FEE);
|
||||||
let input_value = output.value() + offset_output.value();
|
let input_value = output.value() + offset_output.value();
|
||||||
let output_value = tx.output.iter().map(|output| output.value.to_sat()).sum::<u64>();
|
let output_value = tx.output.iter().map(|output| output.value.to_sat()).sum::<u64>();
|
||||||
assert_eq!(input_value - output_value, needed_fee);
|
assert_eq!(input_value - output_value, needed_fee);
|
||||||
@@ -275,13 +314,13 @@ async_sequential! {
|
|||||||
input_value - payments.iter().map(|payment| payment.1).sum::<u64>() - needed_fee;
|
input_value - payments.iter().map(|payment| payment.1).sum::<u64>() - needed_fee;
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tx.output[2],
|
tx.output[2],
|
||||||
TxOut { script_pubkey: change_addr, value: Amount::from_sat(change_amount) },
|
TxOut { script_pubkey: change_addr.script_pubkey(), value: Amount::from_sat(change_amount) },
|
||||||
);
|
);
|
||||||
|
|
||||||
// This also tests send_raw_transaction and get_transaction, which the RPC test can't
|
// This also tests send_raw_transaction and get_transaction, which the RPC test can't
|
||||||
// effectively test
|
// effectively test
|
||||||
rpc.send_raw_transaction(&tx).await.unwrap();
|
rpc.send_raw_transaction(&tx).await.unwrap();
|
||||||
let mut hash = *tx.compute_txid().as_raw_hash().as_byte_array();
|
let mut hash = *tx.txid().as_raw_hash().as_byte_array();
|
||||||
hash.reverse();
|
hash.reverse();
|
||||||
assert_eq!(tx, rpc.get_transaction(&hash).await.unwrap());
|
assert_eq!(tx, rpc.get_transaction(&hash).await.unwrap());
|
||||||
assert_eq!(expected_id, hash);
|
assert_eq!(expected_id, hash);
|
||||||
@@ -305,7 +344,7 @@ async_sequential! {
|
|||||||
&SignableTransaction::new(
|
&SignableTransaction::new(
|
||||||
vec![output],
|
vec![output],
|
||||||
&[],
|
&[],
|
||||||
Some(p2tr_script_buf(key).unwrap()),
|
Some(&Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())),
|
||||||
Some(data.clone()),
|
Some(data.clone()),
|
||||||
FEE
|
FEE
|
||||||
).unwrap()
|
).unwrap()
|
||||||
3
coins/ethereum/.gitignore
vendored
Normal file
3
coins/ethereum/.gitignore
vendored
Normal file
@@ -0,0 +1,3 @@
|
|||||||
|
# Solidity build outputs
|
||||||
|
cache
|
||||||
|
artifacts
|
||||||
46
coins/ethereum/Cargo.toml
Normal file
46
coins/ethereum/Cargo.toml
Normal file
@@ -0,0 +1,46 @@
|
|||||||
|
[package]
|
||||||
|
name = "ethereum-serai"
|
||||||
|
version = "0.1.0"
|
||||||
|
description = "An Ethereum library supporting Schnorr signing and on-chain verification"
|
||||||
|
license = "AGPL-3.0-only"
|
||||||
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/ethereum"
|
||||||
|
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Elizabeth Binks <elizabethjbinks@gmail.com>"]
|
||||||
|
edition = "2021"
|
||||||
|
publish = false
|
||||||
|
rust-version = "1.74"
|
||||||
|
|
||||||
|
[package.metadata.docs.rs]
|
||||||
|
all-features = true
|
||||||
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|
||||||
|
[lints]
|
||||||
|
workspace = true
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
thiserror = { version = "1", default-features = false }
|
||||||
|
|
||||||
|
rand_core = { version = "0.6", default-features = false, features = ["std"] }
|
||||||
|
|
||||||
|
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", default-features = false, features = ["recommended"] }
|
||||||
|
|
||||||
|
group = { version = "0.13", default-features = false }
|
||||||
|
k256 = { version = "^0.13.1", default-features = false, features = ["std", "ecdsa", "arithmetic"] }
|
||||||
|
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["secp256k1"] }
|
||||||
|
|
||||||
|
alloy-core = { version = "0.7", default-features = false }
|
||||||
|
alloy-sol-types = { version = "0.7", default-features = false, features = ["json"] }
|
||||||
|
alloy-consensus = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false, features = ["k256"] }
|
||||||
|
alloy-rpc-types = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
alloy-rpc-client = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
alloy-simple-request-transport = { path = "./alloy-simple-request-transport", default-features = false }
|
||||||
|
alloy-provider = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["tests"] }
|
||||||
|
|
||||||
|
tokio = { version = "1", features = ["macros"] }
|
||||||
|
|
||||||
|
alloy-node-bindings = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
|
||||||
|
[features]
|
||||||
|
tests = []
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
AGPL-3.0-only license
|
AGPL-3.0-only license
|
||||||
|
|
||||||
Copyright (c) 2023-2025 Luke Parker
|
Copyright (c) 2022-2023 Luke Parker
|
||||||
|
|
||||||
This program is free software: you can redistribute it and/or modify
|
This program is free software: you can redistribute it and/or modify
|
||||||
it under the terms of the GNU Affero General Public License Version 3 as
|
it under the terms of the GNU Affero General Public License Version 3 as
|
||||||
15
coins/ethereum/README.md
Normal file
15
coins/ethereum/README.md
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
# Ethereum
|
||||||
|
|
||||||
|
This package contains Ethereum-related functionality, specifically deploying and
|
||||||
|
interacting with Serai contracts.
|
||||||
|
|
||||||
|
While `monero-serai` and `bitcoin-serai` are general purpose libraries,
|
||||||
|
`ethereum-serai` is Serai specific. If any of the utilities are generally
|
||||||
|
desired, please fork and maintain your own copy to ensure the desired
|
||||||
|
functionality is preserved, or open an issue to request we make this library
|
||||||
|
general purpose.
|
||||||
|
|
||||||
|
### Dependencies
|
||||||
|
|
||||||
|
- solc
|
||||||
|
- [Foundry](https://github.com/foundry-rs/foundry)
|
||||||
29
coins/ethereum/alloy-simple-request-transport/Cargo.toml
Normal file
29
coins/ethereum/alloy-simple-request-transport/Cargo.toml
Normal file
@@ -0,0 +1,29 @@
|
|||||||
|
[package]
|
||||||
|
name = "alloy-simple-request-transport"
|
||||||
|
version = "0.1.0"
|
||||||
|
description = "A transport for alloy based off simple-request"
|
||||||
|
license = "MIT"
|
||||||
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/ethereum/alloy-simple-request-transport"
|
||||||
|
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||||
|
edition = "2021"
|
||||||
|
rust-version = "1.74"
|
||||||
|
|
||||||
|
[package.metadata.docs.rs]
|
||||||
|
all-features = true
|
||||||
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|
||||||
|
[lints]
|
||||||
|
workspace = true
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
tower = "0.4"
|
||||||
|
|
||||||
|
serde_json = { version = "1", default-features = false }
|
||||||
|
simple-request = { path = "../../../common/request", default-features = false }
|
||||||
|
|
||||||
|
alloy-json-rpc = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
alloy-transport = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
|
||||||
|
[features]
|
||||||
|
default = ["tls"]
|
||||||
|
tls = ["simple-request/tls"]
|
||||||
41
coins/ethereum/build.rs
Normal file
41
coins/ethereum/build.rs
Normal file
@@ -0,0 +1,41 @@
|
|||||||
|
use std::process::Command;
|
||||||
|
|
||||||
|
fn main() {
|
||||||
|
println!("cargo:rerun-if-changed=contracts/*");
|
||||||
|
println!("cargo:rerun-if-changed=artifacts/*");
|
||||||
|
|
||||||
|
for line in String::from_utf8(Command::new("solc").args(["--version"]).output().unwrap().stdout)
|
||||||
|
.unwrap()
|
||||||
|
.lines()
|
||||||
|
{
|
||||||
|
if let Some(version) = line.strip_prefix("Version: ") {
|
||||||
|
let version = version.split('+').next().unwrap();
|
||||||
|
assert_eq!(version, "0.8.25");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[rustfmt::skip]
|
||||||
|
let args = [
|
||||||
|
"--base-path", ".",
|
||||||
|
"-o", "./artifacts", "--overwrite",
|
||||||
|
"--bin", "--abi",
|
||||||
|
"--via-ir", "--optimize",
|
||||||
|
|
||||||
|
"./contracts/IERC20.sol",
|
||||||
|
|
||||||
|
"./contracts/Schnorr.sol",
|
||||||
|
"./contracts/Deployer.sol",
|
||||||
|
"./contracts/Sandbox.sol",
|
||||||
|
"./contracts/Router.sol",
|
||||||
|
|
||||||
|
"./src/tests/contracts/Schnorr.sol",
|
||||||
|
"./src/tests/contracts/ERC20.sol",
|
||||||
|
|
||||||
|
"--no-color",
|
||||||
|
];
|
||||||
|
let solc = Command::new("solc").args(args).output().unwrap();
|
||||||
|
assert!(solc.status.success());
|
||||||
|
for line in String::from_utf8(solc.stderr).unwrap().lines() {
|
||||||
|
assert!(!line.starts_with("Error:"));
|
||||||
|
}
|
||||||
|
}
|
||||||
52
coins/ethereum/contracts/Deployer.sol
Normal file
52
coins/ethereum/contracts/Deployer.sol
Normal file
@@ -0,0 +1,52 @@
|
|||||||
|
// SPDX-License-Identifier: AGPLv3
|
||||||
|
pragma solidity ^0.8.0;
|
||||||
|
|
||||||
|
/*
|
||||||
|
The expected deployment process of the Router is as follows:
|
||||||
|
|
||||||
|
1) A transaction deploying Deployer is made. Then, a deterministic signature is
|
||||||
|
created such that an account with an unknown private key is the creator of
|
||||||
|
the contract. Anyone can fund this address, and once anyone does, the
|
||||||
|
transaction deploying Deployer can be published by anyone. No other
|
||||||
|
transaction may be made from that account.
|
||||||
|
|
||||||
|
2) Anyone deploys the Router through the Deployer. This uses a sequential nonce
|
||||||
|
such that meet-in-the-middle attacks, with complexity 2**80, aren't feasible.
|
||||||
|
While such attacks would still be feasible if the Deployer's address was
|
||||||
|
controllable, the usage of a deterministic signature with a NUMS method
|
||||||
|
prevents that.
|
||||||
|
|
||||||
|
This doesn't have any denial-of-service risks and will resolve once anyone steps
|
||||||
|
forward as deployer. This does fail to guarantee an identical address across
|
||||||
|
every chain, though it enables letting anyone efficiently ask the Deployer for
|
||||||
|
the address (with the Deployer having an identical address on every chain).
|
||||||
|
|
||||||
|
Unfortunately, guaranteeing identical addresses aren't feasible. We'd need the
|
||||||
|
Deployer contract to use a consistent salt for the Router, yet the Router must
|
||||||
|
be deployed with a specific public key for Serai. Since Ethereum isn't able to
|
||||||
|
determine a valid public key (one the result of a Serai DKG) from a dishonest
|
||||||
|
public key, we have to allow multiple deployments with Serai being the one to
|
||||||
|
determine which to use.
|
||||||
|
|
||||||
|
The alternative would be to have a council publish the Serai key on-Ethereum,
|
||||||
|
with Serai verifying the published result. This would introduce a DoS risk in
|
||||||
|
the council not publishing the correct key/not publishing any key.
|
||||||
|
*/
|
||||||
|
|
||||||
|
contract Deployer {
|
||||||
|
event Deployment(bytes32 indexed init_code_hash, address created);
|
||||||
|
|
||||||
|
error DeploymentFailed();
|
||||||
|
|
||||||
|
function deploy(bytes memory init_code) external {
|
||||||
|
address created;
|
||||||
|
assembly {
|
||||||
|
created := create(0, add(init_code, 0x20), mload(init_code))
|
||||||
|
}
|
||||||
|
if (created == address(0)) {
|
||||||
|
revert DeploymentFailed();
|
||||||
|
}
|
||||||
|
// These may be emitted out of order upon re-entrancy
|
||||||
|
emit Deployment(keccak256(init_code), created);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,5 +1,5 @@
|
|||||||
// SPDX-License-Identifier: CC0
|
// SPDX-License-Identifier: CC0
|
||||||
pragma solidity ^0.8.26;
|
pragma solidity ^0.8.0;
|
||||||
|
|
||||||
interface IERC20 {
|
interface IERC20 {
|
||||||
event Transfer(address indexed from, address indexed to, uint256 value);
|
event Transfer(address indexed from, address indexed to, uint256 value);
|
||||||
222
coins/ethereum/contracts/Router.sol
Normal file
222
coins/ethereum/contracts/Router.sol
Normal file
@@ -0,0 +1,222 @@
|
|||||||
|
// SPDX-License-Identifier: AGPLv3
|
||||||
|
pragma solidity ^0.8.0;
|
||||||
|
|
||||||
|
import "./IERC20.sol";
|
||||||
|
|
||||||
|
import "./Schnorr.sol";
|
||||||
|
import "./Sandbox.sol";
|
||||||
|
|
||||||
|
contract Router {
|
||||||
|
// Nonce is incremented for each batch of transactions executed/key update
|
||||||
|
uint256 public nonce;
|
||||||
|
|
||||||
|
// Current public key's x-coordinate
|
||||||
|
// This key must always have the parity defined within the Schnorr contract
|
||||||
|
bytes32 public seraiKey;
|
||||||
|
|
||||||
|
struct OutInstruction {
|
||||||
|
address to;
|
||||||
|
Call[] calls;
|
||||||
|
|
||||||
|
uint256 value;
|
||||||
|
}
|
||||||
|
|
||||||
|
struct Signature {
|
||||||
|
bytes32 c;
|
||||||
|
bytes32 s;
|
||||||
|
}
|
||||||
|
|
||||||
|
event SeraiKeyUpdated(
|
||||||
|
uint256 indexed nonce,
|
||||||
|
bytes32 indexed key,
|
||||||
|
Signature signature
|
||||||
|
);
|
||||||
|
event InInstruction(
|
||||||
|
address indexed from,
|
||||||
|
address indexed coin,
|
||||||
|
uint256 amount,
|
||||||
|
bytes instruction
|
||||||
|
);
|
||||||
|
// success is a uint256 representing a bitfield of transaction successes
|
||||||
|
event Executed(
|
||||||
|
uint256 indexed nonce,
|
||||||
|
bytes32 indexed batch,
|
||||||
|
uint256 success,
|
||||||
|
Signature signature
|
||||||
|
);
|
||||||
|
|
||||||
|
// error types
|
||||||
|
error InvalidKey();
|
||||||
|
error InvalidSignature();
|
||||||
|
error InvalidAmount();
|
||||||
|
error FailedTransfer();
|
||||||
|
error TooManyTransactions();
|
||||||
|
|
||||||
|
modifier _updateSeraiKeyAtEndOfFn(
|
||||||
|
uint256 _nonce,
|
||||||
|
bytes32 key,
|
||||||
|
Signature memory sig
|
||||||
|
) {
|
||||||
|
if (
|
||||||
|
(key == bytes32(0)) ||
|
||||||
|
((bytes32(uint256(key) % Schnorr.Q)) != key)
|
||||||
|
) {
|
||||||
|
revert InvalidKey();
|
||||||
|
}
|
||||||
|
|
||||||
|
_;
|
||||||
|
|
||||||
|
seraiKey = key;
|
||||||
|
emit SeraiKeyUpdated(_nonce, key, sig);
|
||||||
|
}
|
||||||
|
|
||||||
|
constructor(bytes32 _seraiKey) _updateSeraiKeyAtEndOfFn(
|
||||||
|
0,
|
||||||
|
_seraiKey,
|
||||||
|
Signature({ c: bytes32(0), s: bytes32(0) })
|
||||||
|
) {
|
||||||
|
nonce = 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
// updateSeraiKey validates the given Schnorr signature against the current
|
||||||
|
// public key, and if successful, updates the contract's public key to the
|
||||||
|
// given one.
|
||||||
|
function updateSeraiKey(
|
||||||
|
bytes32 _seraiKey,
|
||||||
|
Signature calldata sig
|
||||||
|
) external _updateSeraiKeyAtEndOfFn(nonce, _seraiKey, sig) {
|
||||||
|
bytes memory message =
|
||||||
|
abi.encodePacked("updateSeraiKey", block.chainid, nonce, _seraiKey);
|
||||||
|
nonce++;
|
||||||
|
|
||||||
|
if (!Schnorr.verify(seraiKey, message, sig.c, sig.s)) {
|
||||||
|
revert InvalidSignature();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
function inInstruction(
|
||||||
|
address coin,
|
||||||
|
uint256 amount,
|
||||||
|
bytes memory instruction
|
||||||
|
) external payable {
|
||||||
|
if (coin == address(0)) {
|
||||||
|
if (amount != msg.value) {
|
||||||
|
revert InvalidAmount();
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
(bool success, bytes memory res) =
|
||||||
|
address(coin).call(
|
||||||
|
abi.encodeWithSelector(
|
||||||
|
IERC20.transferFrom.selector,
|
||||||
|
msg.sender,
|
||||||
|
address(this),
|
||||||
|
amount
|
||||||
|
)
|
||||||
|
);
|
||||||
|
|
||||||
|
// Require there was nothing returned, which is done by some non-standard
|
||||||
|
// tokens, or that the ERC20 contract did in fact return true
|
||||||
|
bool nonStandardResOrTrue =
|
||||||
|
(res.length == 0) || abi.decode(res, (bool));
|
||||||
|
if (!(success && nonStandardResOrTrue)) {
|
||||||
|
revert FailedTransfer();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/*
|
||||||
|
Due to fee-on-transfer tokens, emitting the amount directly is frowned upon.
|
||||||
|
The amount instructed to transfer may not actually be the amount
|
||||||
|
transferred.
|
||||||
|
|
||||||
|
If we add nonReentrant to every single function which can effect the
|
||||||
|
balance, we can check the amount exactly matches. This prevents transfers of
|
||||||
|
less value than expected occurring, at least, not without an additional
|
||||||
|
transfer to top up the difference (which isn't routed through this contract
|
||||||
|
and accordingly isn't trying to artificially create events).
|
||||||
|
|
||||||
|
If we don't add nonReentrant, a transfer can be started, and then a new
|
||||||
|
transfer for the difference can follow it up (again and again until a
|
||||||
|
rounding error is reached). This contract would believe all transfers were
|
||||||
|
done in full, despite each only being done in part (except for the last
|
||||||
|
one).
|
||||||
|
|
||||||
|
Given fee-on-transfer tokens aren't intended to be supported, the only
|
||||||
|
token planned to be supported is Dai and it doesn't have any fee-on-transfer
|
||||||
|
logic, fee-on-transfer tokens aren't even able to be supported at this time,
|
||||||
|
we simply classify this entire class of tokens as non-standard
|
||||||
|
implementations which induce undefined behavior. It is the Serai network's
|
||||||
|
role not to add support for any non-standard implementations.
|
||||||
|
*/
|
||||||
|
emit InInstruction(msg.sender, coin, amount, instruction);
|
||||||
|
}
|
||||||
|
|
||||||
|
// execute accepts a list of transactions to execute as well as a signature.
|
||||||
|
// if signature verification passes, the given transactions are executed.
|
||||||
|
// if signature verification fails, this function will revert.
|
||||||
|
function execute(
|
||||||
|
OutInstruction[] calldata transactions,
|
||||||
|
Signature calldata sig
|
||||||
|
) external {
|
||||||
|
if (transactions.length > 256) {
|
||||||
|
revert TooManyTransactions();
|
||||||
|
}
|
||||||
|
|
||||||
|
bytes memory message =
|
||||||
|
abi.encode("execute", block.chainid, nonce, transactions);
|
||||||
|
uint256 executed_with_nonce = nonce;
|
||||||
|
// This prevents re-entrancy from causing double spends yet does allow
|
||||||
|
// out-of-order execution via re-entrancy
|
||||||
|
nonce++;
|
||||||
|
|
||||||
|
if (!Schnorr.verify(seraiKey, message, sig.c, sig.s)) {
|
||||||
|
revert InvalidSignature();
|
||||||
|
}
|
||||||
|
|
||||||
|
uint256 successes;
|
||||||
|
for (uint256 i = 0; i < transactions.length; i++) {
|
||||||
|
bool success;
|
||||||
|
|
||||||
|
// If there are no calls, send to `to` the value
|
||||||
|
if (transactions[i].calls.length == 0) {
|
||||||
|
(success, ) = transactions[i].to.call{
|
||||||
|
value: transactions[i].value,
|
||||||
|
gas: 5_000
|
||||||
|
}("");
|
||||||
|
} else {
|
||||||
|
// If there are calls, ignore `to`. Deploy a new Sandbox and proxy the
|
||||||
|
// calls through that
|
||||||
|
//
|
||||||
|
// We could use a single sandbox in order to reduce gas costs, yet that
|
||||||
|
// risks one person creating an approval that's hooked before another
|
||||||
|
// user's intended action executes, in order to drain their coins
|
||||||
|
//
|
||||||
|
// While technically, that would be a flaw in the sandboxed flow, this
|
||||||
|
// is robust and prevents such flaws from being possible
|
||||||
|
//
|
||||||
|
// We also don't want people to set state via the Sandbox and expect it
|
||||||
|
// future available when anyone else could set a distinct value
|
||||||
|
Sandbox sandbox = new Sandbox();
|
||||||
|
(success, ) = address(sandbox).call{
|
||||||
|
value: transactions[i].value,
|
||||||
|
// TODO: Have the Call specify the gas up front
|
||||||
|
gas: 350_000
|
||||||
|
}(
|
||||||
|
abi.encodeWithSelector(
|
||||||
|
Sandbox.sandbox.selector,
|
||||||
|
transactions[i].calls
|
||||||
|
)
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
assembly {
|
||||||
|
successes := or(successes, shl(i, success))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
emit Executed(
|
||||||
|
executed_with_nonce,
|
||||||
|
keccak256(message),
|
||||||
|
successes,
|
||||||
|
sig
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
48
coins/ethereum/contracts/Sandbox.sol
Normal file
48
coins/ethereum/contracts/Sandbox.sol
Normal file
@@ -0,0 +1,48 @@
|
|||||||
|
// SPDX-License-Identifier: AGPLv3
|
||||||
|
pragma solidity ^0.8.24;
|
||||||
|
|
||||||
|
struct Call {
|
||||||
|
address to;
|
||||||
|
uint256 value;
|
||||||
|
bytes data;
|
||||||
|
}
|
||||||
|
|
||||||
|
// A minimal sandbox focused on gas efficiency.
|
||||||
|
//
|
||||||
|
// The first call is executed if any of the calls fail, making it a fallback.
|
||||||
|
// All other calls are executed sequentially.
|
||||||
|
contract Sandbox {
|
||||||
|
error AlreadyCalled();
|
||||||
|
error CallsFailed();
|
||||||
|
|
||||||
|
function sandbox(Call[] calldata calls) external payable {
|
||||||
|
// Prevent re-entrancy due to this executing arbitrary calls from anyone
|
||||||
|
// and anywhere
|
||||||
|
bool called;
|
||||||
|
assembly { called := tload(0) }
|
||||||
|
if (called) {
|
||||||
|
revert AlreadyCalled();
|
||||||
|
}
|
||||||
|
assembly { tstore(0, 1) }
|
||||||
|
|
||||||
|
// Execute the calls, starting from 1
|
||||||
|
for (uint256 i = 1; i < calls.length; i++) {
|
||||||
|
(bool success, ) =
|
||||||
|
calls[i].to.call{ value: calls[i].value }(calls[i].data);
|
||||||
|
|
||||||
|
// If this call failed, execute the fallback (call 0)
|
||||||
|
if (!success) {
|
||||||
|
(success, ) =
|
||||||
|
calls[0].to.call{ value: address(this).balance }(calls[0].data);
|
||||||
|
// If this call also failed, revert entirely
|
||||||
|
if (!success) {
|
||||||
|
revert CallsFailed();
|
||||||
|
}
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// We don't clear the re-entrancy guard as this contract should never be
|
||||||
|
// called again, so there's no reason to spend the effort
|
||||||
|
}
|
||||||
|
}
|
||||||
44
coins/ethereum/contracts/Schnorr.sol
Normal file
44
coins/ethereum/contracts/Schnorr.sol
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
// SPDX-License-Identifier: AGPLv3
|
||||||
|
pragma solidity ^0.8.0;
|
||||||
|
|
||||||
|
// see https://github.com/noot/schnorr-verify for implementation details
|
||||||
|
library Schnorr {
|
||||||
|
// secp256k1 group order
|
||||||
|
uint256 constant public Q =
|
||||||
|
0xFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEBAAEDCE6AF48A03BBFD25E8CD0364141;
|
||||||
|
|
||||||
|
// Fixed parity for the public keys used in this contract
|
||||||
|
// This avoids spending a word passing the parity in a similar style to
|
||||||
|
// Bitcoin's Taproot
|
||||||
|
uint8 constant public KEY_PARITY = 27;
|
||||||
|
|
||||||
|
error InvalidSOrA();
|
||||||
|
error MalformedSignature();
|
||||||
|
|
||||||
|
// px := public key x-coord, where the public key has a parity of KEY_PARITY
|
||||||
|
// message := 32-byte hash of the message
|
||||||
|
// c := schnorr signature challenge
|
||||||
|
// s := schnorr signature
|
||||||
|
function verify(
|
||||||
|
bytes32 px,
|
||||||
|
bytes memory message,
|
||||||
|
bytes32 c,
|
||||||
|
bytes32 s
|
||||||
|
) internal pure returns (bool) {
|
||||||
|
// ecrecover = (m, v, r, s) -> key
|
||||||
|
// We instead pass the following to obtain the nonce (not the key)
|
||||||
|
// Then we hash it and verify it matches the challenge
|
||||||
|
bytes32 sa = bytes32(Q - mulmod(uint256(s), uint256(px), Q));
|
||||||
|
bytes32 ca = bytes32(Q - mulmod(uint256(c), uint256(px), Q));
|
||||||
|
|
||||||
|
// For safety, we want each input to ecrecover to be 0 (sa, px, ca)
|
||||||
|
// The ecreover precomple checks `r` and `s` (`px` and `ca`) are non-zero
|
||||||
|
// That leaves us to check `sa` are non-zero
|
||||||
|
if (sa == 0) revert InvalidSOrA();
|
||||||
|
address R = ecrecover(sa, KEY_PARITY, px, ca);
|
||||||
|
if (R == address(0)) revert MalformedSignature();
|
||||||
|
|
||||||
|
// Check the signature is correct by rebuilding the challenge
|
||||||
|
return c == keccak256(abi.encodePacked(R, px, message));
|
||||||
|
}
|
||||||
|
}
|
||||||
37
coins/ethereum/src/abi/mod.rs
Normal file
37
coins/ethereum/src/abi/mod.rs
Normal file
@@ -0,0 +1,37 @@
|
|||||||
|
use alloy_sol_types::sol;
|
||||||
|
|
||||||
|
#[rustfmt::skip]
|
||||||
|
#[allow(warnings)]
|
||||||
|
#[allow(needless_pass_by_value)]
|
||||||
|
#[allow(clippy::all)]
|
||||||
|
#[allow(clippy::ignored_unit_patterns)]
|
||||||
|
#[allow(clippy::redundant_closure_for_method_calls)]
|
||||||
|
mod erc20_container {
|
||||||
|
use super::*;
|
||||||
|
sol!("contracts/IERC20.sol");
|
||||||
|
}
|
||||||
|
pub use erc20_container::IERC20 as erc20;
|
||||||
|
|
||||||
|
#[rustfmt::skip]
|
||||||
|
#[allow(warnings)]
|
||||||
|
#[allow(needless_pass_by_value)]
|
||||||
|
#[allow(clippy::all)]
|
||||||
|
#[allow(clippy::ignored_unit_patterns)]
|
||||||
|
#[allow(clippy::redundant_closure_for_method_calls)]
|
||||||
|
mod deployer_container {
|
||||||
|
use super::*;
|
||||||
|
sol!("contracts/Deployer.sol");
|
||||||
|
}
|
||||||
|
pub use deployer_container::Deployer as deployer;
|
||||||
|
|
||||||
|
#[rustfmt::skip]
|
||||||
|
#[allow(warnings)]
|
||||||
|
#[allow(needless_pass_by_value)]
|
||||||
|
#[allow(clippy::all)]
|
||||||
|
#[allow(clippy::ignored_unit_patterns)]
|
||||||
|
#[allow(clippy::redundant_closure_for_method_calls)]
|
||||||
|
mod router_container {
|
||||||
|
use super::*;
|
||||||
|
sol!(Router, "artifacts/Router.abi");
|
||||||
|
}
|
||||||
|
pub use router_container::Router as router;
|
||||||
1164
coins/ethereum/src/abi/router.rs
Normal file
1164
coins/ethereum/src/abi/router.rs
Normal file
File diff suppressed because it is too large
Load Diff
410
coins/ethereum/src/abi/schnorr.rs
Normal file
410
coins/ethereum/src/abi/schnorr.rs
Normal file
@@ -0,0 +1,410 @@
|
|||||||
|
pub use schnorr::*;
|
||||||
|
/// This module was auto-generated with ethers-rs Abigen.
|
||||||
|
/// More information at: <https://github.com/gakonst/ethers-rs>
|
||||||
|
#[allow(
|
||||||
|
clippy::enum_variant_names,
|
||||||
|
clippy::too_many_arguments,
|
||||||
|
clippy::upper_case_acronyms,
|
||||||
|
clippy::type_complexity,
|
||||||
|
dead_code,
|
||||||
|
non_camel_case_types,
|
||||||
|
)]
|
||||||
|
pub mod schnorr {
|
||||||
|
#[allow(deprecated)]
|
||||||
|
fn __abi() -> ::ethers_core::abi::Abi {
|
||||||
|
::ethers_core::abi::ethabi::Contract {
|
||||||
|
constructor: ::core::option::Option::None,
|
||||||
|
functions: ::core::convert::From::from([
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("Q"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Function {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("Q"),
|
||||||
|
inputs: ::std::vec![],
|
||||||
|
outputs: ::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::string::String::new(),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::Uint(256usize),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("uint256"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
constant: ::core::option::Option::None,
|
||||||
|
state_mutability: ::ethers_core::abi::ethabi::StateMutability::View,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("verify"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Function {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("verify"),
|
||||||
|
inputs: ::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("parity"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::Uint(8usize),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("uint8"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("px"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("message"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("c"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("s"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
outputs: ::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::string::String::new(),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::Bool,
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bool"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
constant: ::core::option::Option::None,
|
||||||
|
state_mutability: ::ethers_core::abi::ethabi::StateMutability::View,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
]),
|
||||||
|
events: ::std::collections::BTreeMap::new(),
|
||||||
|
errors: ::core::convert::From::from([
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("InvalidSOrA"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::AbiError {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("InvalidSOrA"),
|
||||||
|
inputs: ::std::vec![],
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("InvalidSignature"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::AbiError {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("InvalidSignature"),
|
||||||
|
inputs: ::std::vec![],
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
]),
|
||||||
|
receive: false,
|
||||||
|
fallback: false,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///The parsed JSON ABI of the contract.
|
||||||
|
pub static SCHNORR_ABI: ::ethers_contract::Lazy<::ethers_core::abi::Abi> = ::ethers_contract::Lazy::new(
|
||||||
|
__abi,
|
||||||
|
);
|
||||||
|
pub struct Schnorr<M>(::ethers_contract::Contract<M>);
|
||||||
|
impl<M> ::core::clone::Clone for Schnorr<M> {
|
||||||
|
fn clone(&self) -> Self {
|
||||||
|
Self(::core::clone::Clone::clone(&self.0))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M> ::core::ops::Deref for Schnorr<M> {
|
||||||
|
type Target = ::ethers_contract::Contract<M>;
|
||||||
|
fn deref(&self) -> &Self::Target {
|
||||||
|
&self.0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M> ::core::ops::DerefMut for Schnorr<M> {
|
||||||
|
fn deref_mut(&mut self) -> &mut Self::Target {
|
||||||
|
&mut self.0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M> ::core::fmt::Debug for Schnorr<M> {
|
||||||
|
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
|
||||||
|
f.debug_tuple(::core::stringify!(Schnorr)).field(&self.address()).finish()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M: ::ethers_providers::Middleware> Schnorr<M> {
|
||||||
|
/// Creates a new contract instance with the specified `ethers` client at
|
||||||
|
/// `address`. The contract derefs to a `ethers::Contract` object.
|
||||||
|
pub fn new<T: Into<::ethers_core::types::Address>>(
|
||||||
|
address: T,
|
||||||
|
client: ::std::sync::Arc<M>,
|
||||||
|
) -> Self {
|
||||||
|
Self(
|
||||||
|
::ethers_contract::Contract::new(
|
||||||
|
address.into(),
|
||||||
|
SCHNORR_ABI.clone(),
|
||||||
|
client,
|
||||||
|
),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
///Calls the contract's `Q` (0xe493ef8c) function
|
||||||
|
pub fn q(
|
||||||
|
&self,
|
||||||
|
) -> ::ethers_contract::builders::ContractCall<M, ::ethers_core::types::U256> {
|
||||||
|
self.0
|
||||||
|
.method_hash([228, 147, 239, 140], ())
|
||||||
|
.expect("method not found (this should never happen)")
|
||||||
|
}
|
||||||
|
///Calls the contract's `verify` (0x9186da4c) function
|
||||||
|
pub fn verify(
|
||||||
|
&self,
|
||||||
|
parity: u8,
|
||||||
|
px: [u8; 32],
|
||||||
|
message: [u8; 32],
|
||||||
|
c: [u8; 32],
|
||||||
|
s: [u8; 32],
|
||||||
|
) -> ::ethers_contract::builders::ContractCall<M, bool> {
|
||||||
|
self.0
|
||||||
|
.method_hash([145, 134, 218, 76], (parity, px, message, c, s))
|
||||||
|
.expect("method not found (this should never happen)")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M: ::ethers_providers::Middleware> From<::ethers_contract::Contract<M>>
|
||||||
|
for Schnorr<M> {
|
||||||
|
fn from(contract: ::ethers_contract::Contract<M>) -> Self {
|
||||||
|
Self::new(contract.address(), contract.client())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///Custom Error type `InvalidSOrA` with signature `InvalidSOrA()` and selector `0x4e99a12e`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthError,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[etherror(name = "InvalidSOrA", abi = "InvalidSOrA()")]
|
||||||
|
pub struct InvalidSOrA;
|
||||||
|
///Custom Error type `InvalidSignature` with signature `InvalidSignature()` and selector `0x8baa579f`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthError,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[etherror(name = "InvalidSignature", abi = "InvalidSignature()")]
|
||||||
|
pub struct InvalidSignature;
|
||||||
|
///Container type for all of the contract's custom errors
|
||||||
|
#[derive(Clone, ::ethers_contract::EthAbiType, Debug, PartialEq, Eq, Hash)]
|
||||||
|
pub enum SchnorrErrors {
|
||||||
|
InvalidSOrA(InvalidSOrA),
|
||||||
|
InvalidSignature(InvalidSignature),
|
||||||
|
/// The standard solidity revert string, with selector
|
||||||
|
/// Error(string) -- 0x08c379a0
|
||||||
|
RevertString(::std::string::String),
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiDecode for SchnorrErrors {
|
||||||
|
fn decode(
|
||||||
|
data: impl AsRef<[u8]>,
|
||||||
|
) -> ::core::result::Result<Self, ::ethers_core::abi::AbiError> {
|
||||||
|
let data = data.as_ref();
|
||||||
|
if let Ok(decoded) = <::std::string::String as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::RevertString(decoded));
|
||||||
|
}
|
||||||
|
if let Ok(decoded) = <InvalidSOrA as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::InvalidSOrA(decoded));
|
||||||
|
}
|
||||||
|
if let Ok(decoded) = <InvalidSignature as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::InvalidSignature(decoded));
|
||||||
|
}
|
||||||
|
Err(::ethers_core::abi::Error::InvalidData.into())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiEncode for SchnorrErrors {
|
||||||
|
fn encode(self) -> ::std::vec::Vec<u8> {
|
||||||
|
match self {
|
||||||
|
Self::InvalidSOrA(element) => {
|
||||||
|
::ethers_core::abi::AbiEncode::encode(element)
|
||||||
|
}
|
||||||
|
Self::InvalidSignature(element) => {
|
||||||
|
::ethers_core::abi::AbiEncode::encode(element)
|
||||||
|
}
|
||||||
|
Self::RevertString(s) => ::ethers_core::abi::AbiEncode::encode(s),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::ethers_contract::ContractRevert for SchnorrErrors {
|
||||||
|
fn valid_selector(selector: [u8; 4]) -> bool {
|
||||||
|
match selector {
|
||||||
|
[0x08, 0xc3, 0x79, 0xa0] => true,
|
||||||
|
_ if selector
|
||||||
|
== <InvalidSOrA as ::ethers_contract::EthError>::selector() => true,
|
||||||
|
_ if selector
|
||||||
|
== <InvalidSignature as ::ethers_contract::EthError>::selector() => {
|
||||||
|
true
|
||||||
|
}
|
||||||
|
_ => false,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::fmt::Display for SchnorrErrors {
|
||||||
|
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::InvalidSOrA(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
Self::InvalidSignature(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
Self::RevertString(s) => ::core::fmt::Display::fmt(s, f),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<::std::string::String> for SchnorrErrors {
|
||||||
|
fn from(value: String) -> Self {
|
||||||
|
Self::RevertString(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<InvalidSOrA> for SchnorrErrors {
|
||||||
|
fn from(value: InvalidSOrA) -> Self {
|
||||||
|
Self::InvalidSOrA(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<InvalidSignature> for SchnorrErrors {
|
||||||
|
fn from(value: InvalidSignature) -> Self {
|
||||||
|
Self::InvalidSignature(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///Container type for all input parameters for the `Q` function with signature `Q()` and selector `0xe493ef8c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthCall,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[ethcall(name = "Q", abi = "Q()")]
|
||||||
|
pub struct QCall;
|
||||||
|
///Container type for all input parameters for the `verify` function with signature `verify(uint8,bytes32,bytes32,bytes32,bytes32)` and selector `0x9186da4c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthCall,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[ethcall(name = "verify", abi = "verify(uint8,bytes32,bytes32,bytes32,bytes32)")]
|
||||||
|
pub struct VerifyCall {
|
||||||
|
pub parity: u8,
|
||||||
|
pub px: [u8; 32],
|
||||||
|
pub message: [u8; 32],
|
||||||
|
pub c: [u8; 32],
|
||||||
|
pub s: [u8; 32],
|
||||||
|
}
|
||||||
|
///Container type for all of the contract's call
|
||||||
|
#[derive(Clone, ::ethers_contract::EthAbiType, Debug, PartialEq, Eq, Hash)]
|
||||||
|
pub enum SchnorrCalls {
|
||||||
|
Q(QCall),
|
||||||
|
Verify(VerifyCall),
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiDecode for SchnorrCalls {
|
||||||
|
fn decode(
|
||||||
|
data: impl AsRef<[u8]>,
|
||||||
|
) -> ::core::result::Result<Self, ::ethers_core::abi::AbiError> {
|
||||||
|
let data = data.as_ref();
|
||||||
|
if let Ok(decoded) = <QCall as ::ethers_core::abi::AbiDecode>::decode(data) {
|
||||||
|
return Ok(Self::Q(decoded));
|
||||||
|
}
|
||||||
|
if let Ok(decoded) = <VerifyCall as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::Verify(decoded));
|
||||||
|
}
|
||||||
|
Err(::ethers_core::abi::Error::InvalidData.into())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiEncode for SchnorrCalls {
|
||||||
|
fn encode(self) -> Vec<u8> {
|
||||||
|
match self {
|
||||||
|
Self::Q(element) => ::ethers_core::abi::AbiEncode::encode(element),
|
||||||
|
Self::Verify(element) => ::ethers_core::abi::AbiEncode::encode(element),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::fmt::Display for SchnorrCalls {
|
||||||
|
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Q(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
Self::Verify(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<QCall> for SchnorrCalls {
|
||||||
|
fn from(value: QCall) -> Self {
|
||||||
|
Self::Q(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<VerifyCall> for SchnorrCalls {
|
||||||
|
fn from(value: VerifyCall) -> Self {
|
||||||
|
Self::Verify(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///Container type for all return fields from the `Q` function with signature `Q()` and selector `0xe493ef8c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthAbiType,
|
||||||
|
::ethers_contract::EthAbiCodec,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
pub struct QReturn(pub ::ethers_core::types::U256);
|
||||||
|
///Container type for all return fields from the `verify` function with signature `verify(uint8,bytes32,bytes32,bytes32,bytes32)` and selector `0x9186da4c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthAbiType,
|
||||||
|
::ethers_contract::EthAbiCodec,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
pub struct VerifyReturn(pub bool);
|
||||||
|
}
|
||||||
185
coins/ethereum/src/crypto.rs
Normal file
185
coins/ethereum/src/crypto.rs
Normal file
@@ -0,0 +1,185 @@
|
|||||||
|
use group::ff::PrimeField;
|
||||||
|
use k256::{
|
||||||
|
elliptic_curve::{ops::Reduce, point::AffineCoordinates, sec1::ToEncodedPoint},
|
||||||
|
ProjectivePoint, Scalar, U256 as KU256,
|
||||||
|
};
|
||||||
|
#[cfg(test)]
|
||||||
|
use k256::{elliptic_curve::point::DecompressPoint, AffinePoint};
|
||||||
|
|
||||||
|
use frost::{
|
||||||
|
algorithm::{Hram, SchnorrSignature},
|
||||||
|
curve::{Ciphersuite, Secp256k1},
|
||||||
|
};
|
||||||
|
|
||||||
|
use alloy_core::primitives::{Parity, Signature as AlloySignature};
|
||||||
|
use alloy_consensus::{SignableTransaction, Signed, TxLegacy};
|
||||||
|
|
||||||
|
use crate::abi::router::{Signature as AbiSignature};
|
||||||
|
|
||||||
|
pub(crate) fn keccak256(data: &[u8]) -> [u8; 32] {
|
||||||
|
alloy_core::primitives::keccak256(data).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||||
|
<Scalar as Reduce<KU256>>::reduce_bytes(&keccak256(data).into())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn address(point: &ProjectivePoint) -> [u8; 20] {
|
||||||
|
let encoded_point = point.to_encoded_point(false);
|
||||||
|
// Last 20 bytes of the hash of the concatenated x and y coordinates
|
||||||
|
// We obtain the concatenated x and y coordinates via the uncompressed encoding of the point
|
||||||
|
keccak256(&encoded_point.as_ref()[1 .. 65])[12 ..].try_into().unwrap()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn deterministically_sign(tx: &TxLegacy) -> Signed<TxLegacy> {
|
||||||
|
assert!(
|
||||||
|
tx.chain_id.is_none(),
|
||||||
|
"chain ID was Some when deterministically signing a TX (causing a non-deterministic signer)"
|
||||||
|
);
|
||||||
|
|
||||||
|
let sig_hash = tx.signature_hash().0;
|
||||||
|
let mut r = hash_to_scalar(&[sig_hash.as_slice(), b"r"].concat());
|
||||||
|
let mut s = hash_to_scalar(&[sig_hash.as_slice(), b"s"].concat());
|
||||||
|
loop {
|
||||||
|
let r_bytes: [u8; 32] = r.to_repr().into();
|
||||||
|
let s_bytes: [u8; 32] = s.to_repr().into();
|
||||||
|
let v = Parity::NonEip155(false);
|
||||||
|
let signature =
|
||||||
|
AlloySignature::from_scalars_and_parity(r_bytes.into(), s_bytes.into(), v).unwrap();
|
||||||
|
let tx = tx.clone().into_signed(signature);
|
||||||
|
if tx.recover_signer().is_ok() {
|
||||||
|
return tx;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Re-hash until valid
|
||||||
|
r = hash_to_scalar(r_bytes.as_ref());
|
||||||
|
s = hash_to_scalar(s_bytes.as_ref());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The public key for a Schnorr-signing account.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
#[derive(Clone, Copy, PartialEq, Eq, Debug)]
|
||||||
|
pub struct PublicKey {
|
||||||
|
pub(crate) A: ProjectivePoint,
|
||||||
|
pub(crate) px: Scalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl PublicKey {
|
||||||
|
/// Construct a new `PublicKey`.
|
||||||
|
///
|
||||||
|
/// This will return None if the provided point isn't eligible to be a public key (due to
|
||||||
|
/// bounds such as parity).
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub fn new(A: ProjectivePoint) -> Option<PublicKey> {
|
||||||
|
let affine = A.to_affine();
|
||||||
|
// Only allow even keys to save a word within Ethereum
|
||||||
|
let is_odd = bool::from(affine.y_is_odd());
|
||||||
|
if is_odd {
|
||||||
|
None?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let x_coord = affine.x();
|
||||||
|
let x_coord_scalar = <Scalar as Reduce<KU256>>::reduce_bytes(&x_coord);
|
||||||
|
// Return None if a reduction would occur
|
||||||
|
// Reductions would be incredibly unlikely and shouldn't be an issue, yet it's one less
|
||||||
|
// headache/concern to have
|
||||||
|
// This does ban a trivial amoount of public keys
|
||||||
|
if x_coord_scalar.to_repr() != x_coord {
|
||||||
|
None?;
|
||||||
|
}
|
||||||
|
|
||||||
|
Some(PublicKey { A, px: x_coord_scalar })
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn point(&self) -> ProjectivePoint {
|
||||||
|
self.A
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn eth_repr(&self) -> [u8; 32] {
|
||||||
|
self.px.to_repr().into()
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
pub(crate) fn from_eth_repr(repr: [u8; 32]) -> Option<Self> {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let A = Option::<AffinePoint>::from(AffinePoint::decompress(&repr.into(), 0.into()))?.into();
|
||||||
|
Option::from(Scalar::from_repr(repr.into())).map(|px| PublicKey { A, px })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The HRAm to use for the Schnorr contract.
|
||||||
|
#[derive(Clone, Default)]
|
||||||
|
pub struct EthereumHram {}
|
||||||
|
impl Hram<Secp256k1> for EthereumHram {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar {
|
||||||
|
let x_coord = A.to_affine().x();
|
||||||
|
|
||||||
|
let mut data = address(R).to_vec();
|
||||||
|
data.extend(x_coord.as_slice());
|
||||||
|
data.extend(m);
|
||||||
|
|
||||||
|
<Scalar as Reduce<KU256>>::reduce_bytes(&keccak256(&data).into())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A signature for the Schnorr contract.
|
||||||
|
#[derive(Clone, Copy, PartialEq, Eq, Debug)]
|
||||||
|
pub struct Signature {
|
||||||
|
pub(crate) c: Scalar,
|
||||||
|
pub(crate) s: Scalar,
|
||||||
|
}
|
||||||
|
impl Signature {
|
||||||
|
pub fn verify(&self, public_key: &PublicKey, message: &[u8]) -> bool {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let R = (Secp256k1::generator() * self.s) - (public_key.A * self.c);
|
||||||
|
EthereumHram::hram(&R, &public_key.A, message) == self.c
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a new `Signature`.
|
||||||
|
///
|
||||||
|
/// This will return None if the signature is invalid.
|
||||||
|
pub fn new(
|
||||||
|
public_key: &PublicKey,
|
||||||
|
message: &[u8],
|
||||||
|
signature: SchnorrSignature<Secp256k1>,
|
||||||
|
) -> Option<Signature> {
|
||||||
|
let c = EthereumHram::hram(&signature.R, &public_key.A, message);
|
||||||
|
if !signature.verify(public_key.A, c) {
|
||||||
|
None?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let res = Signature { c, s: signature.s };
|
||||||
|
assert!(res.verify(public_key, message));
|
||||||
|
Some(res)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn c(&self) -> Scalar {
|
||||||
|
self.c
|
||||||
|
}
|
||||||
|
pub fn s(&self) -> Scalar {
|
||||||
|
self.s
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn to_bytes(&self) -> [u8; 64] {
|
||||||
|
let mut res = [0; 64];
|
||||||
|
res[.. 32].copy_from_slice(self.c.to_repr().as_ref());
|
||||||
|
res[32 ..].copy_from_slice(self.s.to_repr().as_ref());
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn from_bytes(bytes: [u8; 64]) -> std::io::Result<Self> {
|
||||||
|
let mut reader = bytes.as_slice();
|
||||||
|
let c = Secp256k1::read_F(&mut reader)?;
|
||||||
|
let s = Secp256k1::read_F(&mut reader)?;
|
||||||
|
Ok(Signature { c, s })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl From<&Signature> for AbiSignature {
|
||||||
|
fn from(sig: &Signature) -> AbiSignature {
|
||||||
|
let c: [u8; 32] = sig.c.to_repr().into();
|
||||||
|
let s: [u8; 32] = sig.s.to_repr().into();
|
||||||
|
AbiSignature { c: c.into(), s: s.into() }
|
||||||
|
}
|
||||||
|
}
|
||||||
120
coins/ethereum/src/deployer.rs
Normal file
120
coins/ethereum/src/deployer.rs
Normal file
@@ -0,0 +1,120 @@
|
|||||||
|
use std::sync::Arc;
|
||||||
|
|
||||||
|
use alloy_core::primitives::{hex::FromHex, Address, B256, U256, Bytes, TxKind};
|
||||||
|
use alloy_consensus::{Signed, TxLegacy};
|
||||||
|
|
||||||
|
use alloy_sol_types::{SolCall, SolEvent};
|
||||||
|
|
||||||
|
use alloy_rpc_types::{BlockNumberOrTag, Filter};
|
||||||
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
Error,
|
||||||
|
crypto::{self, keccak256, PublicKey},
|
||||||
|
router::Router,
|
||||||
|
};
|
||||||
|
pub use crate::abi::deployer as abi;
|
||||||
|
|
||||||
|
/// The Deployer contract for the Router contract.
|
||||||
|
///
|
||||||
|
/// This Deployer has a deterministic address, letting it be immediately identified on any
|
||||||
|
/// compatible chain. It then supports retrieving the Router contract's address (which isn't
|
||||||
|
/// deterministic) using a single log query.
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub struct Deployer;
|
||||||
|
impl Deployer {
|
||||||
|
/// Obtain the transaction to deploy this contract, already signed.
|
||||||
|
///
|
||||||
|
/// The account this transaction is sent from (which is populated in `from`) must be sufficiently
|
||||||
|
/// funded for this transaction to be submitted. This account has no known private key to anyone,
|
||||||
|
/// so ETH sent can be neither misappropriated nor returned.
|
||||||
|
pub fn deployment_tx() -> Signed<TxLegacy> {
|
||||||
|
let bytecode = include_str!("../artifacts/Deployer.bin");
|
||||||
|
let bytecode =
|
||||||
|
Bytes::from_hex(bytecode).expect("compiled-in Deployer bytecode wasn't valid hex");
|
||||||
|
|
||||||
|
let tx = TxLegacy {
|
||||||
|
chain_id: None,
|
||||||
|
nonce: 0,
|
||||||
|
gas_price: 100_000_000_000u128,
|
||||||
|
// TODO: Use a more accurate gas limit
|
||||||
|
gas_limit: 1_000_000u128,
|
||||||
|
to: TxKind::Create,
|
||||||
|
value: U256::ZERO,
|
||||||
|
input: bytecode,
|
||||||
|
};
|
||||||
|
|
||||||
|
crypto::deterministically_sign(&tx)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Obtain the deterministic address for this contract.
|
||||||
|
pub fn address() -> [u8; 20] {
|
||||||
|
let deployer_deployer =
|
||||||
|
Self::deployment_tx().recover_signer().expect("deployment_tx didn't have a valid signature");
|
||||||
|
**Address::create(&deployer_deployer, 0)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Construct a new view of the `Deployer`.
|
||||||
|
pub async fn new(provider: Arc<RootProvider<SimpleRequest>>) -> Result<Option<Self>, Error> {
|
||||||
|
let address = Self::address();
|
||||||
|
#[cfg(not(test))]
|
||||||
|
let required_block = BlockNumberOrTag::Finalized;
|
||||||
|
#[cfg(test)]
|
||||||
|
let required_block = BlockNumberOrTag::Latest;
|
||||||
|
let code = provider
|
||||||
|
.get_code_at(address.into(), required_block.into())
|
||||||
|
.await
|
||||||
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
|
// Contract has yet to be deployed
|
||||||
|
if code.is_empty() {
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
Ok(Some(Self))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Yield the `ContractCall` necessary to deploy the Router.
|
||||||
|
pub fn deploy_router(&self, key: &PublicKey) -> TxLegacy {
|
||||||
|
TxLegacy {
|
||||||
|
to: TxKind::Call(Self::address().into()),
|
||||||
|
input: abi::deployCall::new((Router::init_code(key).into(),)).abi_encode().into(),
|
||||||
|
gas_limit: 1_000_000,
|
||||||
|
..Default::default()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Find the first Router deployed with the specified key as its first key.
|
||||||
|
///
|
||||||
|
/// This is the Router Serai will use, and is the only way to construct a `Router`.
|
||||||
|
pub async fn find_router(
|
||||||
|
&self,
|
||||||
|
provider: Arc<RootProvider<SimpleRequest>>,
|
||||||
|
key: &PublicKey,
|
||||||
|
) -> Result<Option<Router>, Error> {
|
||||||
|
let init_code = Router::init_code(key);
|
||||||
|
let init_code_hash = keccak256(&init_code);
|
||||||
|
|
||||||
|
#[cfg(not(test))]
|
||||||
|
let to_block = BlockNumberOrTag::Finalized;
|
||||||
|
#[cfg(test)]
|
||||||
|
let to_block = BlockNumberOrTag::Latest;
|
||||||
|
|
||||||
|
// Find the first log using this init code (where the init code is binding to the key)
|
||||||
|
// TODO: Make an abstraction for event filtering (de-duplicating common code)
|
||||||
|
let filter =
|
||||||
|
Filter::new().from_block(0).to_block(to_block).address(Address::from(Self::address()));
|
||||||
|
let filter = filter.event_signature(abi::Deployment::SIGNATURE_HASH);
|
||||||
|
let filter = filter.topic1(B256::from(init_code_hash));
|
||||||
|
let logs = provider.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
let Some(first_log) = logs.first() else { return Ok(None) };
|
||||||
|
let router = first_log
|
||||||
|
.log_decode::<abi::Deployment>()
|
||||||
|
.map_err(|_| Error::ConnectionError)?
|
||||||
|
.inner
|
||||||
|
.data
|
||||||
|
.created;
|
||||||
|
|
||||||
|
Ok(Some(Router::new(provider, router)))
|
||||||
|
}
|
||||||
|
}
|
||||||
118
coins/ethereum/src/erc20.rs
Normal file
118
coins/ethereum/src/erc20.rs
Normal file
@@ -0,0 +1,118 @@
|
|||||||
|
use std::{sync::Arc, collections::HashSet};
|
||||||
|
|
||||||
|
use alloy_core::primitives::{Address, B256, U256};
|
||||||
|
|
||||||
|
use alloy_sol_types::{SolInterface, SolEvent};
|
||||||
|
|
||||||
|
use alloy_rpc_types::{BlockNumberOrTag, Filter};
|
||||||
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
|
use crate::Error;
|
||||||
|
pub use crate::abi::erc20 as abi;
|
||||||
|
use abi::{IERC20Calls, Transfer, transferCall, transferFromCall};
|
||||||
|
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub struct TopLevelErc20Transfer {
|
||||||
|
pub id: [u8; 32],
|
||||||
|
pub from: [u8; 20],
|
||||||
|
pub amount: U256,
|
||||||
|
pub data: Vec<u8>,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A view for an ERC20 contract.
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub struct Erc20(Arc<RootProvider<SimpleRequest>>, Address);
|
||||||
|
impl Erc20 {
|
||||||
|
/// Construct a new view of the specified ERC20 contract.
|
||||||
|
///
|
||||||
|
/// This checks a contract is deployed at that address yet does not check the contract is
|
||||||
|
/// actually an ERC20.
|
||||||
|
pub async fn new(
|
||||||
|
provider: Arc<RootProvider<SimpleRequest>>,
|
||||||
|
address: [u8; 20],
|
||||||
|
) -> Result<Option<Self>, Error> {
|
||||||
|
let code = provider
|
||||||
|
.get_code_at(address.into(), BlockNumberOrTag::Finalized.into())
|
||||||
|
.await
|
||||||
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
|
// Contract has yet to be deployed
|
||||||
|
if code.is_empty() {
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
Ok(Some(Self(provider.clone(), Address::from(&address))))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub async fn top_level_transfers(
|
||||||
|
&self,
|
||||||
|
block: u64,
|
||||||
|
to: [u8; 20],
|
||||||
|
) -> Result<Vec<TopLevelErc20Transfer>, Error> {
|
||||||
|
let filter = Filter::new().from_block(block).to_block(block).address(self.1);
|
||||||
|
let filter = filter.event_signature(Transfer::SIGNATURE_HASH);
|
||||||
|
let mut to_topic = [0; 32];
|
||||||
|
to_topic[12 ..].copy_from_slice(&to);
|
||||||
|
let filter = filter.topic2(B256::from(to_topic));
|
||||||
|
let logs = self.0.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
let mut handled = HashSet::new();
|
||||||
|
|
||||||
|
let mut top_level_transfers = vec![];
|
||||||
|
for log in logs {
|
||||||
|
// Double check the address which emitted this log
|
||||||
|
if log.address() != self.1 {
|
||||||
|
Err(Error::ConnectionError)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let tx_id = log.transaction_hash.ok_or(Error::ConnectionError)?;
|
||||||
|
let tx = self.0.get_transaction_by_hash(tx_id).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
// If this is a top-level call...
|
||||||
|
if tx.to == Some(self.1) {
|
||||||
|
// And we recognize the call...
|
||||||
|
// Don't validate the encoding as this can't be re-encoded to an identical bytestring due
|
||||||
|
// to the InInstruction appended
|
||||||
|
if let Ok(call) = IERC20Calls::abi_decode(&tx.input, false) {
|
||||||
|
// Extract the top-level call's from/to/value
|
||||||
|
let (from, call_to, value) = match call {
|
||||||
|
IERC20Calls::transfer(transferCall { to: call_to, value }) => (tx.from, call_to, value),
|
||||||
|
IERC20Calls::transferFrom(transferFromCall { from, to: call_to, value }) => {
|
||||||
|
(from, call_to, value)
|
||||||
|
}
|
||||||
|
// Treat any other function selectors as unrecognized
|
||||||
|
_ => continue,
|
||||||
|
};
|
||||||
|
|
||||||
|
let log = log.log_decode::<Transfer>().map_err(|_| Error::ConnectionError)?.inner.data;
|
||||||
|
|
||||||
|
// Ensure the top-level transfer is equivalent, and this presumably isn't a log for an
|
||||||
|
// internal transfer
|
||||||
|
if (log.from != from) || (call_to != to) || (value != log.value) {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Now that the top-level transfer is confirmed to be equivalent to the log, ensure it's
|
||||||
|
// the only log we handle
|
||||||
|
if handled.contains(&tx_id) {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
handled.insert(tx_id);
|
||||||
|
|
||||||
|
// Read the data appended after
|
||||||
|
let encoded = call.abi_encode();
|
||||||
|
let data = tx.input.as_ref()[encoded.len() ..].to_vec();
|
||||||
|
|
||||||
|
// Push the transfer
|
||||||
|
top_level_transfers.push(TopLevelErc20Transfer {
|
||||||
|
// Since we'll only handle one log for this TX, set the ID to the TX ID
|
||||||
|
id: *tx_id,
|
||||||
|
from: *log.from.0,
|
||||||
|
amount: log.value,
|
||||||
|
data,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(top_level_transfers)
|
||||||
|
}
|
||||||
|
}
|
||||||
30
coins/ethereum/src/lib.rs
Normal file
30
coins/ethereum/src/lib.rs
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
use thiserror::Error;
|
||||||
|
|
||||||
|
pub use alloy_core;
|
||||||
|
pub use alloy_consensus;
|
||||||
|
|
||||||
|
pub use alloy_rpc_types;
|
||||||
|
pub use alloy_simple_request_transport;
|
||||||
|
pub use alloy_rpc_client;
|
||||||
|
pub use alloy_provider;
|
||||||
|
|
||||||
|
pub mod crypto;
|
||||||
|
|
||||||
|
pub(crate) mod abi;
|
||||||
|
|
||||||
|
pub mod erc20;
|
||||||
|
pub mod deployer;
|
||||||
|
pub mod router;
|
||||||
|
|
||||||
|
pub mod machine;
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod tests;
|
||||||
|
|
||||||
|
#[derive(Clone, Copy, PartialEq, Eq, Debug, Error)]
|
||||||
|
pub enum Error {
|
||||||
|
#[error("failed to verify Schnorr signature")]
|
||||||
|
InvalidSignature,
|
||||||
|
#[error("couldn't make call/send TX")]
|
||||||
|
ConnectionError,
|
||||||
|
}
|
||||||
414
coins/ethereum/src/machine.rs
Normal file
414
coins/ethereum/src/machine.rs
Normal file
@@ -0,0 +1,414 @@
|
|||||||
|
use std::{
|
||||||
|
io::{self, Read},
|
||||||
|
collections::HashMap,
|
||||||
|
};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
|
|
||||||
|
use group::GroupEncoding;
|
||||||
|
use frost::{
|
||||||
|
curve::{Ciphersuite, Secp256k1},
|
||||||
|
Participant, ThresholdKeys, FrostError,
|
||||||
|
algorithm::Schnorr,
|
||||||
|
sign::*,
|
||||||
|
};
|
||||||
|
|
||||||
|
use alloy_core::primitives::U256;
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
crypto::{PublicKey, EthereumHram, Signature},
|
||||||
|
router::{
|
||||||
|
abi::{Call as AbiCall, OutInstruction as AbiOutInstruction},
|
||||||
|
Router,
|
||||||
|
},
|
||||||
|
};
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct Call {
|
||||||
|
pub to: [u8; 20],
|
||||||
|
pub value: U256,
|
||||||
|
pub data: Vec<u8>,
|
||||||
|
}
|
||||||
|
impl Call {
|
||||||
|
pub fn read<R: io::Read>(reader: &mut R) -> io::Result<Self> {
|
||||||
|
let mut to = [0; 20];
|
||||||
|
reader.read_exact(&mut to)?;
|
||||||
|
|
||||||
|
let value = {
|
||||||
|
let mut value_bytes = [0; 32];
|
||||||
|
reader.read_exact(&mut value_bytes)?;
|
||||||
|
U256::from_le_slice(&value_bytes)
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut data_len = {
|
||||||
|
let mut data_len = [0; 4];
|
||||||
|
reader.read_exact(&mut data_len)?;
|
||||||
|
usize::try_from(u32::from_le_bytes(data_len)).expect("u32 couldn't fit within a usize")
|
||||||
|
};
|
||||||
|
|
||||||
|
// A valid DoS would be to claim a 4 GB data is present for only 4 bytes
|
||||||
|
// We read this in 1 KB chunks to only read data actually present (with a max DoS of 1 KB)
|
||||||
|
let mut data = vec![];
|
||||||
|
while data_len > 0 {
|
||||||
|
let chunk_len = data_len.min(1024);
|
||||||
|
let mut chunk = vec![0; chunk_len];
|
||||||
|
reader.read_exact(&mut chunk)?;
|
||||||
|
data.extend(&chunk);
|
||||||
|
data_len -= chunk_len;
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(Call { to, value, data })
|
||||||
|
}
|
||||||
|
|
||||||
|
fn write<W: io::Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
|
writer.write_all(&self.to)?;
|
||||||
|
writer.write_all(&self.value.as_le_bytes())?;
|
||||||
|
|
||||||
|
let data_len = u32::try_from(self.data.len())
|
||||||
|
.map_err(|_| io::Error::other("call data length exceeded 2**32"))?;
|
||||||
|
writer.write_all(&data_len.to_le_bytes())?;
|
||||||
|
writer.write_all(&self.data)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl From<Call> for AbiCall {
|
||||||
|
fn from(call: Call) -> AbiCall {
|
||||||
|
AbiCall { to: call.to.into(), value: call.value, data: call.data.into() }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub enum OutInstructionTarget {
|
||||||
|
Direct([u8; 20]),
|
||||||
|
Calls(Vec<Call>),
|
||||||
|
}
|
||||||
|
impl OutInstructionTarget {
|
||||||
|
fn read<R: io::Read>(reader: &mut R) -> io::Result<Self> {
|
||||||
|
let mut kind = [0xff];
|
||||||
|
reader.read_exact(&mut kind)?;
|
||||||
|
|
||||||
|
match kind[0] {
|
||||||
|
0 => {
|
||||||
|
let mut addr = [0; 20];
|
||||||
|
reader.read_exact(&mut addr)?;
|
||||||
|
Ok(OutInstructionTarget::Direct(addr))
|
||||||
|
}
|
||||||
|
1 => {
|
||||||
|
let mut calls_len = [0; 4];
|
||||||
|
reader.read_exact(&mut calls_len)?;
|
||||||
|
let calls_len = u32::from_le_bytes(calls_len);
|
||||||
|
|
||||||
|
let mut calls = vec![];
|
||||||
|
for _ in 0 .. calls_len {
|
||||||
|
calls.push(Call::read(reader)?);
|
||||||
|
}
|
||||||
|
Ok(OutInstructionTarget::Calls(calls))
|
||||||
|
}
|
||||||
|
_ => Err(io::Error::other("unrecognized OutInstructionTarget"))?,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn write<W: io::Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
|
match self {
|
||||||
|
OutInstructionTarget::Direct(addr) => {
|
||||||
|
writer.write_all(&[0])?;
|
||||||
|
writer.write_all(addr)?;
|
||||||
|
}
|
||||||
|
OutInstructionTarget::Calls(calls) => {
|
||||||
|
writer.write_all(&[1])?;
|
||||||
|
let call_len = u32::try_from(calls.len())
|
||||||
|
.map_err(|_| io::Error::other("amount of calls exceeded 2**32"))?;
|
||||||
|
writer.write_all(&call_len.to_le_bytes())?;
|
||||||
|
for call in calls {
|
||||||
|
call.write(writer)?;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct OutInstruction {
|
||||||
|
pub target: OutInstructionTarget,
|
||||||
|
pub value: U256,
|
||||||
|
}
|
||||||
|
impl OutInstruction {
|
||||||
|
fn read<R: io::Read>(reader: &mut R) -> io::Result<Self> {
|
||||||
|
let target = OutInstructionTarget::read(reader)?;
|
||||||
|
|
||||||
|
let value = {
|
||||||
|
let mut value_bytes = [0; 32];
|
||||||
|
reader.read_exact(&mut value_bytes)?;
|
||||||
|
U256::from_le_slice(&value_bytes)
|
||||||
|
};
|
||||||
|
|
||||||
|
Ok(OutInstruction { target, value })
|
||||||
|
}
|
||||||
|
fn write<W: io::Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
|
self.target.write(writer)?;
|
||||||
|
writer.write_all(&self.value.as_le_bytes())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl From<OutInstruction> for AbiOutInstruction {
|
||||||
|
fn from(instruction: OutInstruction) -> AbiOutInstruction {
|
||||||
|
match instruction.target {
|
||||||
|
OutInstructionTarget::Direct(addr) => {
|
||||||
|
AbiOutInstruction { to: addr.into(), calls: vec![], value: instruction.value }
|
||||||
|
}
|
||||||
|
OutInstructionTarget::Calls(calls) => AbiOutInstruction {
|
||||||
|
to: [0; 20].into(),
|
||||||
|
calls: calls.into_iter().map(Into::into).collect(),
|
||||||
|
value: instruction.value,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub enum RouterCommand {
|
||||||
|
UpdateSeraiKey { chain_id: U256, nonce: U256, key: PublicKey },
|
||||||
|
Execute { chain_id: U256, nonce: U256, outs: Vec<OutInstruction> },
|
||||||
|
}
|
||||||
|
|
||||||
|
impl RouterCommand {
|
||||||
|
pub fn msg(&self) -> Vec<u8> {
|
||||||
|
match self {
|
||||||
|
RouterCommand::UpdateSeraiKey { chain_id, nonce, key } => {
|
||||||
|
Router::update_serai_key_message(*chain_id, *nonce, key)
|
||||||
|
}
|
||||||
|
RouterCommand::Execute { chain_id, nonce, outs } => Router::execute_message(
|
||||||
|
*chain_id,
|
||||||
|
*nonce,
|
||||||
|
outs.iter().map(|out| out.clone().into()).collect(),
|
||||||
|
),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: io::Read>(reader: &mut R) -> io::Result<Self> {
|
||||||
|
let mut kind = [0xff];
|
||||||
|
reader.read_exact(&mut kind)?;
|
||||||
|
|
||||||
|
match kind[0] {
|
||||||
|
0 => {
|
||||||
|
let mut chain_id = [0; 32];
|
||||||
|
reader.read_exact(&mut chain_id)?;
|
||||||
|
|
||||||
|
let mut nonce = [0; 32];
|
||||||
|
reader.read_exact(&mut nonce)?;
|
||||||
|
|
||||||
|
let key = PublicKey::new(Secp256k1::read_G(reader)?)
|
||||||
|
.ok_or(io::Error::other("key for RouterCommand doesn't have an eth representation"))?;
|
||||||
|
Ok(RouterCommand::UpdateSeraiKey {
|
||||||
|
chain_id: U256::from_le_slice(&chain_id),
|
||||||
|
nonce: U256::from_le_slice(&nonce),
|
||||||
|
key,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
1 => {
|
||||||
|
let mut chain_id = [0; 32];
|
||||||
|
reader.read_exact(&mut chain_id)?;
|
||||||
|
let chain_id = U256::from_le_slice(&chain_id);
|
||||||
|
|
||||||
|
let mut nonce = [0; 32];
|
||||||
|
reader.read_exact(&mut nonce)?;
|
||||||
|
let nonce = U256::from_le_slice(&nonce);
|
||||||
|
|
||||||
|
let mut outs_len = [0; 4];
|
||||||
|
reader.read_exact(&mut outs_len)?;
|
||||||
|
let outs_len = u32::from_le_bytes(outs_len);
|
||||||
|
|
||||||
|
let mut outs = vec![];
|
||||||
|
for _ in 0 .. outs_len {
|
||||||
|
outs.push(OutInstruction::read(reader)?);
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(RouterCommand::Execute { chain_id, nonce, outs })
|
||||||
|
}
|
||||||
|
_ => Err(io::Error::other("reading unknown type of RouterCommand"))?,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: io::Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
|
match self {
|
||||||
|
RouterCommand::UpdateSeraiKey { chain_id, nonce, key } => {
|
||||||
|
writer.write_all(&[0])?;
|
||||||
|
writer.write_all(&chain_id.as_le_bytes())?;
|
||||||
|
writer.write_all(&nonce.as_le_bytes())?;
|
||||||
|
writer.write_all(&key.A.to_bytes())
|
||||||
|
}
|
||||||
|
RouterCommand::Execute { chain_id, nonce, outs } => {
|
||||||
|
writer.write_all(&[1])?;
|
||||||
|
writer.write_all(&chain_id.as_le_bytes())?;
|
||||||
|
writer.write_all(&nonce.as_le_bytes())?;
|
||||||
|
writer.write_all(&u32::try_from(outs.len()).unwrap().to_le_bytes())?;
|
||||||
|
for out in outs {
|
||||||
|
out.write(writer)?;
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn serialize(&self) -> Vec<u8> {
|
||||||
|
let mut res = vec![];
|
||||||
|
self.write(&mut res).unwrap();
|
||||||
|
res
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct SignedRouterCommand {
|
||||||
|
command: RouterCommand,
|
||||||
|
signature: Signature,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignedRouterCommand {
|
||||||
|
pub fn new(key: &PublicKey, command: RouterCommand, signature: &[u8; 64]) -> Option<Self> {
|
||||||
|
let c = Secp256k1::read_F(&mut &signature[.. 32]).ok()?;
|
||||||
|
let s = Secp256k1::read_F(&mut &signature[32 ..]).ok()?;
|
||||||
|
let signature = Signature { c, s };
|
||||||
|
|
||||||
|
if !signature.verify(key, &command.msg()) {
|
||||||
|
None?
|
||||||
|
}
|
||||||
|
Some(SignedRouterCommand { command, signature })
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn command(&self) -> &RouterCommand {
|
||||||
|
&self.command
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn signature(&self) -> &Signature {
|
||||||
|
&self.signature
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: io::Read>(reader: &mut R) -> io::Result<Self> {
|
||||||
|
let command = RouterCommand::read(reader)?;
|
||||||
|
|
||||||
|
let mut sig = [0; 64];
|
||||||
|
reader.read_exact(&mut sig)?;
|
||||||
|
let signature = Signature::from_bytes(sig)?;
|
||||||
|
|
||||||
|
Ok(SignedRouterCommand { command, signature })
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: io::Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
|
self.command.write(writer)?;
|
||||||
|
writer.write_all(&self.signature.to_bytes())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub struct RouterCommandMachine {
|
||||||
|
key: PublicKey,
|
||||||
|
command: RouterCommand,
|
||||||
|
machine: AlgorithmMachine<Secp256k1, Schnorr<Secp256k1, RecommendedTranscript, EthereumHram>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl RouterCommandMachine {
|
||||||
|
pub fn new(keys: ThresholdKeys<Secp256k1>, command: RouterCommand) -> Option<Self> {
|
||||||
|
// The Schnorr algorithm should be fine without this, even when using the IETF variant
|
||||||
|
// If this is better and more comprehensive, we should do it, even if not necessary
|
||||||
|
let mut transcript = RecommendedTranscript::new(b"ethereum-serai RouterCommandMachine v0.1");
|
||||||
|
let key = keys.group_key();
|
||||||
|
transcript.append_message(b"key", key.to_bytes());
|
||||||
|
transcript.append_message(b"command", command.serialize());
|
||||||
|
|
||||||
|
Some(Self {
|
||||||
|
key: PublicKey::new(key)?,
|
||||||
|
command,
|
||||||
|
machine: AlgorithmMachine::new(Schnorr::new(transcript), keys),
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl PreprocessMachine for RouterCommandMachine {
|
||||||
|
type Preprocess = Preprocess<Secp256k1, ()>;
|
||||||
|
type Signature = SignedRouterCommand;
|
||||||
|
type SignMachine = RouterCommandSignMachine;
|
||||||
|
|
||||||
|
fn preprocess<R: RngCore + CryptoRng>(
|
||||||
|
self,
|
||||||
|
rng: &mut R,
|
||||||
|
) -> (Self::SignMachine, Self::Preprocess) {
|
||||||
|
let (machine, preprocess) = self.machine.preprocess(rng);
|
||||||
|
|
||||||
|
(RouterCommandSignMachine { key: self.key, command: self.command, machine }, preprocess)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub struct RouterCommandSignMachine {
|
||||||
|
key: PublicKey,
|
||||||
|
command: RouterCommand,
|
||||||
|
machine: AlgorithmSignMachine<Secp256k1, Schnorr<Secp256k1, RecommendedTranscript, EthereumHram>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignMachine<SignedRouterCommand> for RouterCommandSignMachine {
|
||||||
|
type Params = ();
|
||||||
|
type Keys = ThresholdKeys<Secp256k1>;
|
||||||
|
type Preprocess = Preprocess<Secp256k1, ()>;
|
||||||
|
type SignatureShare = SignatureShare<Secp256k1>;
|
||||||
|
type SignatureMachine = RouterCommandSignatureMachine;
|
||||||
|
|
||||||
|
fn cache(self) -> CachedPreprocess {
|
||||||
|
unimplemented!(
|
||||||
|
"RouterCommand machines don't support caching their preprocesses due to {}",
|
||||||
|
"being already bound to a specific command"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
fn from_cache(
|
||||||
|
(): (),
|
||||||
|
_: ThresholdKeys<Secp256k1>,
|
||||||
|
_: CachedPreprocess,
|
||||||
|
) -> (Self, Self::Preprocess) {
|
||||||
|
unimplemented!(
|
||||||
|
"RouterCommand machines don't support caching their preprocesses due to {}",
|
||||||
|
"being already bound to a specific command"
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
fn read_preprocess<R: Read>(&self, reader: &mut R) -> io::Result<Self::Preprocess> {
|
||||||
|
self.machine.read_preprocess(reader)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn sign(
|
||||||
|
self,
|
||||||
|
commitments: HashMap<Participant, Self::Preprocess>,
|
||||||
|
msg: &[u8],
|
||||||
|
) -> Result<(RouterCommandSignatureMachine, Self::SignatureShare), FrostError> {
|
||||||
|
if !msg.is_empty() {
|
||||||
|
panic!("message was passed to a RouterCommand machine when it generates its own");
|
||||||
|
}
|
||||||
|
|
||||||
|
let (machine, share) = self.machine.sign(commitments, &self.command.msg())?;
|
||||||
|
|
||||||
|
Ok((RouterCommandSignatureMachine { key: self.key, command: self.command, machine }, share))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub struct RouterCommandSignatureMachine {
|
||||||
|
key: PublicKey,
|
||||||
|
command: RouterCommand,
|
||||||
|
machine:
|
||||||
|
AlgorithmSignatureMachine<Secp256k1, Schnorr<Secp256k1, RecommendedTranscript, EthereumHram>>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl SignatureMachine<SignedRouterCommand> for RouterCommandSignatureMachine {
|
||||||
|
type SignatureShare = SignatureShare<Secp256k1>;
|
||||||
|
|
||||||
|
fn read_share<R: Read>(&self, reader: &mut R) -> io::Result<Self::SignatureShare> {
|
||||||
|
self.machine.read_share(reader)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn complete(
|
||||||
|
self,
|
||||||
|
shares: HashMap<Participant, Self::SignatureShare>,
|
||||||
|
) -> Result<SignedRouterCommand, FrostError> {
|
||||||
|
let sig = self.machine.complete(shares)?;
|
||||||
|
let signature = Signature::new(&self.key, &self.command.msg(), sig)
|
||||||
|
.expect("machine produced an invalid signature");
|
||||||
|
Ok(SignedRouterCommand { command: self.command, signature })
|
||||||
|
}
|
||||||
|
}
|
||||||
428
coins/ethereum/src/router.rs
Normal file
428
coins/ethereum/src/router.rs
Normal file
@@ -0,0 +1,428 @@
|
|||||||
|
use std::{sync::Arc, io, collections::HashSet};
|
||||||
|
|
||||||
|
use k256::{
|
||||||
|
elliptic_curve::{group::GroupEncoding, sec1},
|
||||||
|
ProjectivePoint,
|
||||||
|
};
|
||||||
|
|
||||||
|
use alloy_core::primitives::{hex::FromHex, Address, U256, Bytes, TxKind};
|
||||||
|
#[cfg(test)]
|
||||||
|
use alloy_core::primitives::B256;
|
||||||
|
use alloy_consensus::TxLegacy;
|
||||||
|
|
||||||
|
use alloy_sol_types::{SolValue, SolConstructor, SolCall, SolEvent};
|
||||||
|
|
||||||
|
use alloy_rpc_types::Filter;
|
||||||
|
#[cfg(test)]
|
||||||
|
use alloy_rpc_types::{BlockId, TransactionRequest, TransactionInput};
|
||||||
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
|
pub use crate::{
|
||||||
|
Error,
|
||||||
|
crypto::{PublicKey, Signature},
|
||||||
|
abi::{erc20::Transfer, router as abi},
|
||||||
|
};
|
||||||
|
use abi::{SeraiKeyUpdated, InInstruction as InInstructionEvent, Executed as ExecutedEvent};
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub enum Coin {
|
||||||
|
Ether,
|
||||||
|
Erc20([u8; 20]),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Coin {
|
||||||
|
pub fn read<R: io::Read>(reader: &mut R) -> io::Result<Self> {
|
||||||
|
let mut kind = [0xff];
|
||||||
|
reader.read_exact(&mut kind)?;
|
||||||
|
Ok(match kind[0] {
|
||||||
|
0 => Coin::Ether,
|
||||||
|
1 => {
|
||||||
|
let mut address = [0; 20];
|
||||||
|
reader.read_exact(&mut address)?;
|
||||||
|
Coin::Erc20(address)
|
||||||
|
}
|
||||||
|
_ => Err(io::Error::other("unrecognized Coin type"))?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: io::Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
|
match self {
|
||||||
|
Coin::Ether => writer.write_all(&[0]),
|
||||||
|
Coin::Erc20(token) => {
|
||||||
|
writer.write_all(&[1])?;
|
||||||
|
writer.write_all(token)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct InInstruction {
|
||||||
|
pub id: ([u8; 32], u64),
|
||||||
|
pub from: [u8; 20],
|
||||||
|
pub coin: Coin,
|
||||||
|
pub amount: U256,
|
||||||
|
pub data: Vec<u8>,
|
||||||
|
pub key_at_end_of_block: ProjectivePoint,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl InInstruction {
|
||||||
|
pub fn read<R: io::Read>(reader: &mut R) -> io::Result<Self> {
|
||||||
|
let id = {
|
||||||
|
let mut id_hash = [0; 32];
|
||||||
|
reader.read_exact(&mut id_hash)?;
|
||||||
|
let mut id_pos = [0; 8];
|
||||||
|
reader.read_exact(&mut id_pos)?;
|
||||||
|
let id_pos = u64::from_le_bytes(id_pos);
|
||||||
|
(id_hash, id_pos)
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut from = [0; 20];
|
||||||
|
reader.read_exact(&mut from)?;
|
||||||
|
|
||||||
|
let coin = Coin::read(reader)?;
|
||||||
|
let mut amount = [0; 32];
|
||||||
|
reader.read_exact(&mut amount)?;
|
||||||
|
let amount = U256::from_le_slice(&amount);
|
||||||
|
|
||||||
|
let mut data_len = [0; 4];
|
||||||
|
reader.read_exact(&mut data_len)?;
|
||||||
|
let data_len = usize::try_from(u32::from_le_bytes(data_len))
|
||||||
|
.map_err(|_| io::Error::other("InInstruction data exceeded 2**32 in length"))?;
|
||||||
|
let mut data = vec![0; data_len];
|
||||||
|
reader.read_exact(&mut data)?;
|
||||||
|
|
||||||
|
let mut key_at_end_of_block = <ProjectivePoint as GroupEncoding>::Repr::default();
|
||||||
|
reader.read_exact(&mut key_at_end_of_block)?;
|
||||||
|
let key_at_end_of_block = Option::from(ProjectivePoint::from_bytes(&key_at_end_of_block))
|
||||||
|
.ok_or(io::Error::other("InInstruction had key at end of block which wasn't valid"))?;
|
||||||
|
|
||||||
|
Ok(InInstruction { id, from, coin, amount, data, key_at_end_of_block })
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: io::Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
|
writer.write_all(&self.id.0)?;
|
||||||
|
writer.write_all(&self.id.1.to_le_bytes())?;
|
||||||
|
|
||||||
|
writer.write_all(&self.from)?;
|
||||||
|
|
||||||
|
self.coin.write(writer)?;
|
||||||
|
writer.write_all(&self.amount.as_le_bytes())?;
|
||||||
|
|
||||||
|
writer.write_all(
|
||||||
|
&u32::try_from(self.data.len())
|
||||||
|
.map_err(|_| {
|
||||||
|
io::Error::other("InInstruction being written had data exceeding 2**32 in length")
|
||||||
|
})?
|
||||||
|
.to_le_bytes(),
|
||||||
|
)?;
|
||||||
|
writer.write_all(&self.data)?;
|
||||||
|
|
||||||
|
writer.write_all(&self.key_at_end_of_block.to_bytes())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct Executed {
|
||||||
|
pub tx_id: [u8; 32],
|
||||||
|
pub nonce: u64,
|
||||||
|
pub signature: [u8; 64],
|
||||||
|
}
|
||||||
|
|
||||||
|
/// The contract Serai uses to manage its state.
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub struct Router(Arc<RootProvider<SimpleRequest>>, Address);
|
||||||
|
impl Router {
|
||||||
|
pub(crate) fn code() -> Vec<u8> {
|
||||||
|
let bytecode = include_str!("../artifacts/Router.bin");
|
||||||
|
Bytes::from_hex(bytecode).expect("compiled-in Router bytecode wasn't valid hex").to_vec()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn init_code(key: &PublicKey) -> Vec<u8> {
|
||||||
|
let mut bytecode = Self::code();
|
||||||
|
// Append the constructor arguments
|
||||||
|
bytecode.extend((abi::constructorCall { _seraiKey: key.eth_repr().into() }).abi_encode());
|
||||||
|
bytecode
|
||||||
|
}
|
||||||
|
|
||||||
|
// This isn't pub in order to force users to use `Deployer::find_router`.
|
||||||
|
pub(crate) fn new(provider: Arc<RootProvider<SimpleRequest>>, address: Address) -> Self {
|
||||||
|
Self(provider, address)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn address(&self) -> [u8; 20] {
|
||||||
|
**self.1
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the key for Serai at the specified block.
|
||||||
|
#[cfg(test)]
|
||||||
|
pub async fn serai_key(&self, at: [u8; 32]) -> Result<PublicKey, Error> {
|
||||||
|
let call = TransactionRequest::default()
|
||||||
|
.to(Some(self.1))
|
||||||
|
.input(TransactionInput::new(abi::seraiKeyCall::new(()).abi_encode().into()));
|
||||||
|
let bytes = self
|
||||||
|
.0
|
||||||
|
.call(&call, Some(BlockId::Hash(B256::from(at).into())))
|
||||||
|
.await
|
||||||
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
|
let res =
|
||||||
|
abi::seraiKeyCall::abi_decode_returns(&bytes, true).map_err(|_| Error::ConnectionError)?;
|
||||||
|
PublicKey::from_eth_repr(res._0.0).ok_or(Error::ConnectionError)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the message to be signed in order to update the key for Serai.
|
||||||
|
pub(crate) fn update_serai_key_message(chain_id: U256, nonce: U256, key: &PublicKey) -> Vec<u8> {
|
||||||
|
let mut buffer = b"updateSeraiKey".to_vec();
|
||||||
|
buffer.extend(&chain_id.to_be_bytes::<32>());
|
||||||
|
buffer.extend(&nonce.to_be_bytes::<32>());
|
||||||
|
buffer.extend(&key.eth_repr());
|
||||||
|
buffer
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Update the key representing Serai.
|
||||||
|
pub fn update_serai_key(&self, public_key: &PublicKey, sig: &Signature) -> TxLegacy {
|
||||||
|
// TODO: Set a more accurate gas
|
||||||
|
TxLegacy {
|
||||||
|
to: TxKind::Call(self.1),
|
||||||
|
input: abi::updateSeraiKeyCall::new((public_key.eth_repr().into(), sig.into()))
|
||||||
|
.abi_encode()
|
||||||
|
.into(),
|
||||||
|
gas_limit: 100_000,
|
||||||
|
..Default::default()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the current nonce for the published batches.
|
||||||
|
#[cfg(test)]
|
||||||
|
pub async fn nonce(&self, at: [u8; 32]) -> Result<U256, Error> {
|
||||||
|
let call = TransactionRequest::default()
|
||||||
|
.to(Some(self.1))
|
||||||
|
.input(TransactionInput::new(abi::nonceCall::new(()).abi_encode().into()));
|
||||||
|
let bytes = self
|
||||||
|
.0
|
||||||
|
.call(&call, Some(BlockId::Hash(B256::from(at).into())))
|
||||||
|
.await
|
||||||
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
|
let res =
|
||||||
|
abi::nonceCall::abi_decode_returns(&bytes, true).map_err(|_| Error::ConnectionError)?;
|
||||||
|
Ok(res._0)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Get the message to be signed in order to update the key for Serai.
|
||||||
|
pub(crate) fn execute_message(
|
||||||
|
chain_id: U256,
|
||||||
|
nonce: U256,
|
||||||
|
outs: Vec<abi::OutInstruction>,
|
||||||
|
) -> Vec<u8> {
|
||||||
|
("execute".to_string(), chain_id, nonce, outs).abi_encode_params()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Execute a batch of `OutInstruction`s.
|
||||||
|
pub fn execute(&self, outs: &[abi::OutInstruction], sig: &Signature) -> TxLegacy {
|
||||||
|
TxLegacy {
|
||||||
|
to: TxKind::Call(self.1),
|
||||||
|
input: abi::executeCall::new((outs.to_vec(), sig.into())).abi_encode().into(),
|
||||||
|
// TODO
|
||||||
|
gas_limit: 100_000 + ((200_000 + 10_000) * u128::try_from(outs.len()).unwrap()),
|
||||||
|
..Default::default()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub async fn key_at_end_of_block(&self, block: u64) -> Result<ProjectivePoint, Error> {
|
||||||
|
let filter = Filter::new().from_block(0).to_block(block).address(self.1);
|
||||||
|
let filter = filter.event_signature(SeraiKeyUpdated::SIGNATURE_HASH);
|
||||||
|
let all_keys = self.0.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
let last_key_x_coordinate_log = all_keys.last().ok_or(Error::ConnectionError)?;
|
||||||
|
let last_key_x_coordinate = last_key_x_coordinate_log
|
||||||
|
.log_decode::<SeraiKeyUpdated>()
|
||||||
|
.map_err(|_| Error::ConnectionError)?
|
||||||
|
.inner
|
||||||
|
.data
|
||||||
|
.key;
|
||||||
|
|
||||||
|
let mut compressed_point = <ProjectivePoint as GroupEncoding>::Repr::default();
|
||||||
|
compressed_point[0] = u8::from(sec1::Tag::CompressedEvenY);
|
||||||
|
compressed_point[1 ..].copy_from_slice(last_key_x_coordinate.as_slice());
|
||||||
|
|
||||||
|
Option::from(ProjectivePoint::from_bytes(&compressed_point)).ok_or(Error::ConnectionError)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub async fn in_instructions(
|
||||||
|
&self,
|
||||||
|
block: u64,
|
||||||
|
allowed_tokens: &HashSet<[u8; 20]>,
|
||||||
|
) -> Result<Vec<InInstruction>, Error> {
|
||||||
|
let key_at_end_of_block = self.key_at_end_of_block(block).await?;
|
||||||
|
|
||||||
|
let filter = Filter::new().from_block(block).to_block(block).address(self.1);
|
||||||
|
let filter = filter.event_signature(InInstructionEvent::SIGNATURE_HASH);
|
||||||
|
let logs = self.0.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
let mut transfer_check = HashSet::new();
|
||||||
|
let mut in_instructions = vec![];
|
||||||
|
for log in logs {
|
||||||
|
// Double check the address which emitted this log
|
||||||
|
if log.address() != self.1 {
|
||||||
|
Err(Error::ConnectionError)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let id = (
|
||||||
|
log.block_hash.ok_or(Error::ConnectionError)?.into(),
|
||||||
|
log.log_index.ok_or(Error::ConnectionError)?,
|
||||||
|
);
|
||||||
|
|
||||||
|
let tx_hash = log.transaction_hash.ok_or(Error::ConnectionError)?;
|
||||||
|
let tx = self.0.get_transaction_by_hash(tx_hash).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
let log =
|
||||||
|
log.log_decode::<InInstructionEvent>().map_err(|_| Error::ConnectionError)?.inner.data;
|
||||||
|
|
||||||
|
let coin = if log.coin.0 == [0; 20] {
|
||||||
|
Coin::Ether
|
||||||
|
} else {
|
||||||
|
let token = *log.coin.0;
|
||||||
|
|
||||||
|
if !allowed_tokens.contains(&token) {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If this also counts as a top-level transfer via the token, drop it
|
||||||
|
//
|
||||||
|
// Necessary in order to handle a potential edge case with some theoretical token
|
||||||
|
// implementations
|
||||||
|
//
|
||||||
|
// This will either let it be handled by the top-level transfer hook or will drop it
|
||||||
|
// entirely on the side of caution
|
||||||
|
if tx.to == Some(token.into()) {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get all logs for this TX
|
||||||
|
let receipt = self
|
||||||
|
.0
|
||||||
|
.get_transaction_receipt(tx_hash)
|
||||||
|
.await
|
||||||
|
.map_err(|_| Error::ConnectionError)?
|
||||||
|
.ok_or(Error::ConnectionError)?;
|
||||||
|
let tx_logs = receipt.inner.logs();
|
||||||
|
|
||||||
|
// Find a matching transfer log
|
||||||
|
let mut found_transfer = false;
|
||||||
|
for tx_log in tx_logs {
|
||||||
|
let log_index = tx_log.log_index.ok_or(Error::ConnectionError)?;
|
||||||
|
// Ensure we didn't already use this transfer to check a distinct InInstruction event
|
||||||
|
if transfer_check.contains(&log_index) {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if this log is from the token we expected to be transferred
|
||||||
|
if tx_log.address().0 != token {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
// Check if this is a transfer log
|
||||||
|
// https://github.com/alloy-rs/core/issues/589
|
||||||
|
if tx_log.topics()[0] != Transfer::SIGNATURE_HASH {
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
let Ok(transfer) = Transfer::decode_log(&tx_log.inner.clone(), true) else { continue };
|
||||||
|
// Check if this is a transfer to us for the expected amount
|
||||||
|
if (transfer.to == self.1) && (transfer.value == log.amount) {
|
||||||
|
transfer_check.insert(log_index);
|
||||||
|
found_transfer = true;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if !found_transfer {
|
||||||
|
// This shouldn't be a ConnectionError
|
||||||
|
// This is an exploit, a non-conforming ERC20, or an invalid connection
|
||||||
|
// This should halt the process which is sufficient, yet this is sub-optimal
|
||||||
|
// TODO
|
||||||
|
Err(Error::ConnectionError)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
Coin::Erc20(token)
|
||||||
|
};
|
||||||
|
|
||||||
|
in_instructions.push(InInstruction {
|
||||||
|
id,
|
||||||
|
from: *log.from.0,
|
||||||
|
coin,
|
||||||
|
amount: log.amount,
|
||||||
|
data: log.instruction.as_ref().to_vec(),
|
||||||
|
key_at_end_of_block,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(in_instructions)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub async fn executed_commands(&self, block: u64) -> Result<Vec<Executed>, Error> {
|
||||||
|
let mut res = vec![];
|
||||||
|
|
||||||
|
{
|
||||||
|
let filter = Filter::new().from_block(block).to_block(block).address(self.1);
|
||||||
|
let filter = filter.event_signature(SeraiKeyUpdated::SIGNATURE_HASH);
|
||||||
|
let logs = self.0.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
for log in logs {
|
||||||
|
// Double check the address which emitted this log
|
||||||
|
if log.address() != self.1 {
|
||||||
|
Err(Error::ConnectionError)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let tx_id = log.transaction_hash.ok_or(Error::ConnectionError)?.into();
|
||||||
|
|
||||||
|
let log =
|
||||||
|
log.log_decode::<SeraiKeyUpdated>().map_err(|_| Error::ConnectionError)?.inner.data;
|
||||||
|
|
||||||
|
let mut signature = [0; 64];
|
||||||
|
signature[.. 32].copy_from_slice(log.signature.c.as_ref());
|
||||||
|
signature[32 ..].copy_from_slice(log.signature.s.as_ref());
|
||||||
|
res.push(Executed {
|
||||||
|
tx_id,
|
||||||
|
nonce: log.nonce.try_into().map_err(|_| Error::ConnectionError)?,
|
||||||
|
signature,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
{
|
||||||
|
let filter = Filter::new().from_block(block).to_block(block).address(self.1);
|
||||||
|
let filter = filter.event_signature(ExecutedEvent::SIGNATURE_HASH);
|
||||||
|
let logs = self.0.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
for log in logs {
|
||||||
|
// Double check the address which emitted this log
|
||||||
|
if log.address() != self.1 {
|
||||||
|
Err(Error::ConnectionError)?;
|
||||||
|
}
|
||||||
|
|
||||||
|
let tx_id = log.transaction_hash.ok_or(Error::ConnectionError)?.into();
|
||||||
|
|
||||||
|
let log = log.log_decode::<ExecutedEvent>().map_err(|_| Error::ConnectionError)?.inner.data;
|
||||||
|
|
||||||
|
let mut signature = [0; 64];
|
||||||
|
signature[.. 32].copy_from_slice(log.signature.c.as_ref());
|
||||||
|
signature[32 ..].copy_from_slice(log.signature.s.as_ref());
|
||||||
|
res.push(Executed {
|
||||||
|
tx_id,
|
||||||
|
nonce: log.nonce.try_into().map_err(|_| Error::ConnectionError)?,
|
||||||
|
signature,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(res)
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "tests")]
|
||||||
|
pub fn key_updated_filter(&self) -> Filter {
|
||||||
|
Filter::new().address(self.1).event_signature(SeraiKeyUpdated::SIGNATURE_HASH)
|
||||||
|
}
|
||||||
|
#[cfg(feature = "tests")]
|
||||||
|
pub fn executed_filter(&self) -> Filter {
|
||||||
|
Filter::new().address(self.1).event_signature(ExecutedEvent::SIGNATURE_HASH)
|
||||||
|
}
|
||||||
|
}
|
||||||
13
coins/ethereum/src/tests/abi/mod.rs
Normal file
13
coins/ethereum/src/tests/abi/mod.rs
Normal file
@@ -0,0 +1,13 @@
|
|||||||
|
use alloy_sol_types::sol;
|
||||||
|
|
||||||
|
#[rustfmt::skip]
|
||||||
|
#[allow(warnings)]
|
||||||
|
#[allow(needless_pass_by_value)]
|
||||||
|
#[allow(clippy::all)]
|
||||||
|
#[allow(clippy::ignored_unit_patterns)]
|
||||||
|
#[allow(clippy::redundant_closure_for_method_calls)]
|
||||||
|
mod schnorr_container {
|
||||||
|
use super::*;
|
||||||
|
sol!("src/tests/contracts/Schnorr.sol");
|
||||||
|
}
|
||||||
|
pub(crate) use schnorr_container::TestSchnorr as schnorr;
|
||||||
@@ -1,5 +1,5 @@
|
|||||||
// SPDX-License-Identifier: AGPL-3.0-only
|
// SPDX-License-Identifier: AGPLv3
|
||||||
pragma solidity ^0.8.26;
|
pragma solidity ^0.8.0;
|
||||||
|
|
||||||
contract TestERC20 {
|
contract TestERC20 {
|
||||||
event Transfer(address indexed from, address indexed to, uint256 value);
|
event Transfer(address indexed from, address indexed to, uint256 value);
|
||||||
@@ -8,11 +8,9 @@ contract TestERC20 {
|
|||||||
function name() public pure returns (string memory) {
|
function name() public pure returns (string memory) {
|
||||||
return "Test ERC20";
|
return "Test ERC20";
|
||||||
}
|
}
|
||||||
|
|
||||||
function symbol() public pure returns (string memory) {
|
function symbol() public pure returns (string memory) {
|
||||||
return "TEST";
|
return "TEST";
|
||||||
}
|
}
|
||||||
|
|
||||||
function decimals() public pure returns (uint8) {
|
function decimals() public pure returns (uint8) {
|
||||||
return 18;
|
return 18;
|
||||||
}
|
}
|
||||||
@@ -31,13 +29,11 @@ contract TestERC20 {
|
|||||||
function balanceOf(address owner) public view returns (uint256) {
|
function balanceOf(address owner) public view returns (uint256) {
|
||||||
return balances[owner];
|
return balances[owner];
|
||||||
}
|
}
|
||||||
|
|
||||||
function transfer(address to, uint256 value) public returns (bool) {
|
function transfer(address to, uint256 value) public returns (bool) {
|
||||||
balances[msg.sender] -= value;
|
balances[msg.sender] -= value;
|
||||||
balances[to] += value;
|
balances[to] += value;
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
function transferFrom(address from, address to, uint256 value) public returns (bool) {
|
function transferFrom(address from, address to, uint256 value) public returns (bool) {
|
||||||
allowances[from][msg.sender] -= value;
|
allowances[from][msg.sender] -= value;
|
||||||
balances[from] -= value;
|
balances[from] -= value;
|
||||||
@@ -49,7 +45,6 @@ contract TestERC20 {
|
|||||||
allowances[msg.sender][spender] = value;
|
allowances[msg.sender][spender] = value;
|
||||||
return true;
|
return true;
|
||||||
}
|
}
|
||||||
|
|
||||||
function allowance(address owner, address spender) public view returns (uint256) {
|
function allowance(address owner, address spender) public view returns (uint256) {
|
||||||
return allowances[owner][spender];
|
return allowances[owner][spender];
|
||||||
}
|
}
|
||||||
15
coins/ethereum/src/tests/contracts/Schnorr.sol
Normal file
15
coins/ethereum/src/tests/contracts/Schnorr.sol
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
// SPDX-License-Identifier: AGPLv3
|
||||||
|
pragma solidity ^0.8.0;
|
||||||
|
|
||||||
|
import "../../../contracts/Schnorr.sol";
|
||||||
|
|
||||||
|
contract TestSchnorr {
|
||||||
|
function verify(
|
||||||
|
bytes32 px,
|
||||||
|
bytes calldata message,
|
||||||
|
bytes32 c,
|
||||||
|
bytes32 s
|
||||||
|
) external pure returns (bool) {
|
||||||
|
return Schnorr.verify(px, message, c, s);
|
||||||
|
}
|
||||||
|
}
|
||||||
105
coins/ethereum/src/tests/crypto.rs
Normal file
105
coins/ethereum/src/tests/crypto.rs
Normal file
@@ -0,0 +1,105 @@
|
|||||||
|
use rand_core::OsRng;
|
||||||
|
|
||||||
|
use group::ff::{Field, PrimeField};
|
||||||
|
use k256::{
|
||||||
|
ecdsa::{
|
||||||
|
self, hazmat::SignPrimitive, signature::hazmat::PrehashVerifier, SigningKey, VerifyingKey,
|
||||||
|
},
|
||||||
|
Scalar, ProjectivePoint,
|
||||||
|
};
|
||||||
|
|
||||||
|
use frost::{
|
||||||
|
curve::{Ciphersuite, Secp256k1},
|
||||||
|
algorithm::{Hram, IetfSchnorr},
|
||||||
|
tests::{algorithm_machines, sign},
|
||||||
|
};
|
||||||
|
|
||||||
|
use crate::{crypto::*, tests::key_gen};
|
||||||
|
|
||||||
|
// The ecrecover opcode, yet with parity replacing v
|
||||||
|
pub(crate) fn ecrecover(message: Scalar, odd_y: bool, r: Scalar, s: Scalar) -> Option<[u8; 20]> {
|
||||||
|
let sig = ecdsa::Signature::from_scalars(r, s).ok()?;
|
||||||
|
let message: [u8; 32] = message.to_repr().into();
|
||||||
|
alloy_core::primitives::Signature::from_signature_and_parity(
|
||||||
|
sig,
|
||||||
|
alloy_core::primitives::Parity::Parity(odd_y),
|
||||||
|
)
|
||||||
|
.ok()?
|
||||||
|
.recover_address_from_prehash(&alloy_core::primitives::B256::from(message))
|
||||||
|
.ok()
|
||||||
|
.map(Into::into)
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_ecrecover() {
|
||||||
|
let private = SigningKey::random(&mut OsRng);
|
||||||
|
let public = VerifyingKey::from(&private);
|
||||||
|
|
||||||
|
// Sign the signature
|
||||||
|
const MESSAGE: &[u8] = b"Hello, World!";
|
||||||
|
let (sig, recovery_id) = private
|
||||||
|
.as_nonzero_scalar()
|
||||||
|
.try_sign_prehashed(
|
||||||
|
<Secp256k1 as Ciphersuite>::F::random(&mut OsRng),
|
||||||
|
&keccak256(MESSAGE).into(),
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
|
||||||
|
// Sanity check the signature verifies
|
||||||
|
#[allow(clippy::unit_cmp)] // Intended to assert this wasn't changed to Result<bool>
|
||||||
|
{
|
||||||
|
assert_eq!(public.verify_prehash(&keccak256(MESSAGE), &sig).unwrap(), ());
|
||||||
|
}
|
||||||
|
|
||||||
|
// Perform the ecrecover
|
||||||
|
assert_eq!(
|
||||||
|
ecrecover(
|
||||||
|
hash_to_scalar(MESSAGE),
|
||||||
|
u8::from(recovery_id.unwrap().is_y_odd()) == 1,
|
||||||
|
*sig.r(),
|
||||||
|
*sig.s()
|
||||||
|
)
|
||||||
|
.unwrap(),
|
||||||
|
address(&ProjectivePoint::from(public.as_affine()))
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run the sign test with the EthereumHram
|
||||||
|
#[test]
|
||||||
|
fn test_signing() {
|
||||||
|
let (keys, _) = key_gen();
|
||||||
|
|
||||||
|
const MESSAGE: &[u8] = b"Hello, World!";
|
||||||
|
|
||||||
|
let algo = IetfSchnorr::<Secp256k1, EthereumHram>::ietf();
|
||||||
|
let _sig =
|
||||||
|
sign(&mut OsRng, &algo, keys.clone(), algorithm_machines(&mut OsRng, &algo, &keys), MESSAGE);
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub fn preprocess_signature_for_ecrecover(
|
||||||
|
R: ProjectivePoint,
|
||||||
|
public_key: &PublicKey,
|
||||||
|
m: &[u8],
|
||||||
|
s: Scalar,
|
||||||
|
) -> (Scalar, Scalar) {
|
||||||
|
let c = EthereumHram::hram(&R, &public_key.A, m);
|
||||||
|
let sa = -(s * public_key.px);
|
||||||
|
let ca = -(c * public_key.px);
|
||||||
|
(sa, ca)
|
||||||
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_ecrecover_hack() {
|
||||||
|
let (keys, public_key) = key_gen();
|
||||||
|
|
||||||
|
const MESSAGE: &[u8] = b"Hello, World!";
|
||||||
|
|
||||||
|
let algo = IetfSchnorr::<Secp256k1, EthereumHram>::ietf();
|
||||||
|
let sig =
|
||||||
|
sign(&mut OsRng, &algo, keys.clone(), algorithm_machines(&mut OsRng, &algo, &keys), MESSAGE);
|
||||||
|
|
||||||
|
let (sa, ca) = preprocess_signature_for_ecrecover(sig.R, &public_key, MESSAGE, sig.s);
|
||||||
|
let q = ecrecover(sa, false, public_key.px, ca).unwrap();
|
||||||
|
assert_eq!(q, address(&sig.R));
|
||||||
|
}
|
||||||
@@ -1,5 +1,3 @@
|
|||||||
// TODO
|
|
||||||
|
|
||||||
use std::{sync::Arc, collections::HashMap};
|
use std::{sync::Arc, collections::HashMap};
|
||||||
|
|
||||||
use rand_core::OsRng;
|
use rand_core::OsRng;
|
||||||
@@ -8,23 +6,21 @@ use k256::{Scalar, ProjectivePoint};
|
|||||||
use frost::{curve::Secp256k1, Participant, ThresholdKeys, tests::key_gen as frost_key_gen};
|
use frost::{curve::Secp256k1, Participant, ThresholdKeys, tests::key_gen as frost_key_gen};
|
||||||
|
|
||||||
use alloy_core::{
|
use alloy_core::{
|
||||||
primitives::{Address, U256, Bytes, Signature, TxKind},
|
primitives::{Address, U256, Bytes, TxKind},
|
||||||
hex::FromHex,
|
hex::FromHex,
|
||||||
};
|
};
|
||||||
use alloy_consensus::{SignableTransaction, TxLegacy};
|
use alloy_consensus::{SignableTransaction, TxLegacy};
|
||||||
|
|
||||||
use alloy_rpc_types_eth::TransactionReceipt;
|
use alloy_rpc_types::TransactionReceipt;
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
use crate::crypto::{address, deterministically_sign, PublicKey};
|
use crate::crypto::{address, deterministically_sign, PublicKey};
|
||||||
|
|
||||||
#[cfg(test)]
|
|
||||||
mod crypto;
|
mod crypto;
|
||||||
|
|
||||||
#[cfg(test)]
|
mod abi;
|
||||||
use contracts::tests as abi;
|
mod schnorr;
|
||||||
#[cfg(test)]
|
|
||||||
mod router;
|
mod router;
|
||||||
|
|
||||||
pub fn key_gen() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, PublicKey) {
|
pub fn key_gen() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, PublicKey) {
|
||||||
@@ -57,19 +53,19 @@ pub async fn send(
|
|||||||
// let chain_id = provider.get_chain_id().await.unwrap();
|
// let chain_id = provider.get_chain_id().await.unwrap();
|
||||||
// tx.chain_id = Some(chain_id);
|
// tx.chain_id = Some(chain_id);
|
||||||
tx.chain_id = None;
|
tx.chain_id = None;
|
||||||
tx.nonce = provider.get_transaction_count(address).await.unwrap();
|
tx.nonce = provider.get_transaction_count(address, None).await.unwrap();
|
||||||
// 100 gwei
|
// 100 gwei
|
||||||
tx.gas_price = 100_000_000_000u128;
|
tx.gas_price = 100_000_000_000u128;
|
||||||
|
|
||||||
let sig = wallet.sign_prehash_recoverable(tx.signature_hash().as_ref()).unwrap();
|
let sig = wallet.sign_prehash_recoverable(tx.signature_hash().as_ref()).unwrap();
|
||||||
assert_eq!(address, tx.clone().into_signed(sig.into()).recover_signer().unwrap());
|
assert_eq!(address, tx.clone().into_signed(sig.into()).recover_signer().unwrap());
|
||||||
assert!(
|
assert!(
|
||||||
provider.get_balance(address).await.unwrap() >
|
provider.get_balance(address, None).await.unwrap() >
|
||||||
((U256::from(tx.gas_price) * U256::from(tx.gas_limit)) + tx.value)
|
((U256::from(tx.gas_price) * U256::from(tx.gas_limit)) + tx.value)
|
||||||
);
|
);
|
||||||
|
|
||||||
let mut bytes = vec![];
|
let mut bytes = vec![];
|
||||||
tx.encode_with_signature_fields(&Signature::from(sig), &mut bytes);
|
tx.encode_with_signature_fields(&sig.into(), &mut bytes);
|
||||||
let pending_tx = provider.send_raw_transaction(&bytes).await.ok()?;
|
let pending_tx = provider.send_raw_transaction(&bytes).await.ok()?;
|
||||||
pending_tx.get_receipt().await.ok()
|
pending_tx.get_receipt().await.ok()
|
||||||
}
|
}
|
||||||
@@ -1,5 +1,3 @@
|
|||||||
// TODO
|
|
||||||
|
|
||||||
use std::{convert::TryFrom, sync::Arc, collections::HashMap};
|
use std::{convert::TryFrom, sync::Arc, collections::HashMap};
|
||||||
|
|
||||||
use rand_core::OsRng;
|
use rand_core::OsRng;
|
||||||
@@ -16,7 +14,6 @@ use frost::{
|
|||||||
use alloy_core::primitives::{Address, U256};
|
use alloy_core::primitives::{Address, U256};
|
||||||
|
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_rpc_types_eth::BlockTransactionsKind;
|
|
||||||
use alloy_rpc_client::ClientBuilder;
|
use alloy_rpc_client::ClientBuilder;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
@@ -87,12 +84,13 @@ async fn setup_test() -> (
|
|||||||
|
|
||||||
async fn latest_block_hash(client: &RootProvider<SimpleRequest>) -> [u8; 32] {
|
async fn latest_block_hash(client: &RootProvider<SimpleRequest>) -> [u8; 32] {
|
||||||
client
|
client
|
||||||
.get_block(client.get_block_number().await.unwrap().into(), BlockTransactionsKind::Hashes)
|
.get_block(client.get_block_number().await.unwrap().into(), false)
|
||||||
.await
|
.await
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.header
|
.header
|
||||||
.hash
|
.hash
|
||||||
|
.unwrap()
|
||||||
.0
|
.0
|
||||||
}
|
}
|
||||||
|
|
||||||
93
coins/ethereum/src/tests/schnorr.rs
Normal file
93
coins/ethereum/src/tests/schnorr.rs
Normal file
@@ -0,0 +1,93 @@
|
|||||||
|
use std::sync::Arc;
|
||||||
|
|
||||||
|
use rand_core::OsRng;
|
||||||
|
|
||||||
|
use group::ff::PrimeField;
|
||||||
|
use k256::Scalar;
|
||||||
|
|
||||||
|
use frost::{
|
||||||
|
curve::Secp256k1,
|
||||||
|
algorithm::IetfSchnorr,
|
||||||
|
tests::{algorithm_machines, sign},
|
||||||
|
};
|
||||||
|
|
||||||
|
use alloy_core::primitives::Address;
|
||||||
|
|
||||||
|
use alloy_sol_types::SolCall;
|
||||||
|
|
||||||
|
use alloy_rpc_types::{TransactionInput, TransactionRequest};
|
||||||
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
|
use alloy_rpc_client::ClientBuilder;
|
||||||
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
|
use alloy_node_bindings::{Anvil, AnvilInstance};
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
Error,
|
||||||
|
crypto::*,
|
||||||
|
tests::{key_gen, deploy_contract, abi::schnorr as abi},
|
||||||
|
};
|
||||||
|
|
||||||
|
async fn setup_test() -> (AnvilInstance, Arc<RootProvider<SimpleRequest>>, Address) {
|
||||||
|
let anvil = Anvil::new().spawn();
|
||||||
|
|
||||||
|
let provider = RootProvider::new(
|
||||||
|
ClientBuilder::default().transport(SimpleRequest::new(anvil.endpoint()), true),
|
||||||
|
);
|
||||||
|
let wallet = anvil.keys()[0].clone().into();
|
||||||
|
let client = Arc::new(provider);
|
||||||
|
|
||||||
|
let address = deploy_contract(client.clone(), &wallet, "TestSchnorr").await.unwrap();
|
||||||
|
(anvil, client, address)
|
||||||
|
}
|
||||||
|
|
||||||
|
#[tokio::test]
|
||||||
|
async fn test_deploy_contract() {
|
||||||
|
setup_test().await;
|
||||||
|
}
|
||||||
|
|
||||||
|
pub async fn call_verify(
|
||||||
|
provider: &RootProvider<SimpleRequest>,
|
||||||
|
contract: Address,
|
||||||
|
public_key: &PublicKey,
|
||||||
|
message: &[u8],
|
||||||
|
signature: &Signature,
|
||||||
|
) -> Result<(), Error> {
|
||||||
|
let px: [u8; 32] = public_key.px.to_repr().into();
|
||||||
|
let c_bytes: [u8; 32] = signature.c.to_repr().into();
|
||||||
|
let s_bytes: [u8; 32] = signature.s.to_repr().into();
|
||||||
|
let call = TransactionRequest::default().to(Some(contract)).input(TransactionInput::new(
|
||||||
|
abi::verifyCall::new((px.into(), message.to_vec().into(), c_bytes.into(), s_bytes.into()))
|
||||||
|
.abi_encode()
|
||||||
|
.into(),
|
||||||
|
));
|
||||||
|
let bytes = provider.call(&call, None).await.map_err(|_| Error::ConnectionError)?;
|
||||||
|
let res =
|
||||||
|
abi::verifyCall::abi_decode_returns(&bytes, true).map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
|
if res._0 {
|
||||||
|
Ok(())
|
||||||
|
} else {
|
||||||
|
Err(Error::InvalidSignature)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[tokio::test]
|
||||||
|
async fn test_ecrecover_hack() {
|
||||||
|
let (_anvil, client, contract) = setup_test().await;
|
||||||
|
|
||||||
|
let (keys, public_key) = key_gen();
|
||||||
|
|
||||||
|
const MESSAGE: &[u8] = b"Hello, World!";
|
||||||
|
|
||||||
|
let algo = IetfSchnorr::<Secp256k1, EthereumHram>::ietf();
|
||||||
|
let sig =
|
||||||
|
sign(&mut OsRng, &algo, keys.clone(), algorithm_machines(&mut OsRng, &algo, &keys), MESSAGE);
|
||||||
|
let sig = Signature::new(&public_key, MESSAGE, sig).unwrap();
|
||||||
|
|
||||||
|
call_verify(&client, contract, &public_key, MESSAGE, &sig).await.unwrap();
|
||||||
|
// Test an invalid signature fails
|
||||||
|
let mut sig = sig;
|
||||||
|
sig.s += Scalar::ONE;
|
||||||
|
assert!(call_verify(&client, contract, &public_key, MESSAGE, &sig).await.is_err());
|
||||||
|
}
|
||||||
111
coins/monero/Cargo.toml
Normal file
111
coins/monero/Cargo.toml
Normal file
@@ -0,0 +1,111 @@
|
|||||||
|
[package]
|
||||||
|
name = "monero-serai"
|
||||||
|
version = "0.1.4-alpha"
|
||||||
|
description = "A modern Monero transaction library"
|
||||||
|
license = "MIT"
|
||||||
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero"
|
||||||
|
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||||
|
edition = "2021"
|
||||||
|
rust-version = "1.74"
|
||||||
|
|
||||||
|
[package.metadata.docs.rs]
|
||||||
|
all-features = true
|
||||||
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|
||||||
|
[lints]
|
||||||
|
workspace = true
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
std-shims = { path = "../../common/std-shims", version = "^0.1.1", default-features = false }
|
||||||
|
|
||||||
|
async-trait = { version = "0.1", default-features = false }
|
||||||
|
thiserror = { version = "1", default-features = false, optional = true }
|
||||||
|
|
||||||
|
zeroize = { version = "^1.5", default-features = false, features = ["zeroize_derive"] }
|
||||||
|
subtle = { version = "^2.4", default-features = false }
|
||||||
|
|
||||||
|
rand_core = { version = "0.6", default-features = false }
|
||||||
|
# Used to send transactions
|
||||||
|
rand = { version = "0.8", default-features = false }
|
||||||
|
rand_chacha = { version = "0.3", default-features = false }
|
||||||
|
# Used to select decoys
|
||||||
|
rand_distr = { version = "0.4", default-features = false }
|
||||||
|
|
||||||
|
sha3 = { version = "0.10", default-features = false }
|
||||||
|
pbkdf2 = { version = "0.12", features = ["simple"], default-features = false }
|
||||||
|
|
||||||
|
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
|
||||||
|
|
||||||
|
# Used for the hash to curve, along with the more complicated proofs
|
||||||
|
group = { version = "0.13", default-features = false }
|
||||||
|
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||||
|
multiexp = { path = "../../crypto/multiexp", version = "0.4", default-features = false, features = ["batch"] }
|
||||||
|
|
||||||
|
# Needed for multisig
|
||||||
|
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
|
||||||
|
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["ed25519"], optional = true }
|
||||||
|
|
||||||
|
monero-generators = { path = "generators", version = "0.4", default-features = false }
|
||||||
|
|
||||||
|
async-lock = { version = "3", default-features = false, optional = true }
|
||||||
|
|
||||||
|
hex-literal = "0.4"
|
||||||
|
hex = { version = "0.4", default-features = false, features = ["alloc"] }
|
||||||
|
serde = { version = "1", default-features = false, features = ["derive", "alloc"] }
|
||||||
|
serde_json = { version = "1", default-features = false, features = ["alloc"] }
|
||||||
|
|
||||||
|
base58-monero = { version = "2", default-features = false, features = ["check"] }
|
||||||
|
|
||||||
|
# Used for the provided HTTP RPC
|
||||||
|
digest_auth = { version = "0.3", default-features = false, optional = true }
|
||||||
|
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls"], optional = true }
|
||||||
|
tokio = { version = "1", default-features = false, optional = true }
|
||||||
|
|
||||||
|
[build-dependencies]
|
||||||
|
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||||
|
monero-generators = { path = "generators", version = "0.4", default-features = false }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
tokio = { version = "1", features = ["sync", "macros"] }
|
||||||
|
|
||||||
|
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
||||||
|
|
||||||
|
[features]
|
||||||
|
std = [
|
||||||
|
"std-shims/std",
|
||||||
|
|
||||||
|
"thiserror",
|
||||||
|
|
||||||
|
"zeroize/std",
|
||||||
|
"subtle/std",
|
||||||
|
|
||||||
|
"rand_core/std",
|
||||||
|
"rand/std",
|
||||||
|
"rand_chacha/std",
|
||||||
|
"rand_distr/std",
|
||||||
|
|
||||||
|
"sha3/std",
|
||||||
|
"pbkdf2/std",
|
||||||
|
|
||||||
|
"multiexp/std",
|
||||||
|
|
||||||
|
"transcript/std",
|
||||||
|
|
||||||
|
"monero-generators/std",
|
||||||
|
|
||||||
|
"async-lock?/std",
|
||||||
|
|
||||||
|
"hex/std",
|
||||||
|
"serde/std",
|
||||||
|
"serde_json/std",
|
||||||
|
|
||||||
|
"base58-monero/std",
|
||||||
|
]
|
||||||
|
|
||||||
|
cache-distribution = ["async-lock"]
|
||||||
|
http-rpc = ["digest_auth", "simple-request", "tokio"]
|
||||||
|
multisig = ["transcript", "frost", "std"]
|
||||||
|
binaries = ["tokio/rt-multi-thread", "tokio/macros", "http-rpc"]
|
||||||
|
experimental = []
|
||||||
|
|
||||||
|
default = ["std", "http-rpc"]
|
||||||
49
coins/monero/README.md
Normal file
49
coins/monero/README.md
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
# monero-serai
|
||||||
|
|
||||||
|
A modern Monero transaction library intended for usage in wallets. It prides
|
||||||
|
itself on accuracy, correctness, and removing common pit falls developers may
|
||||||
|
face.
|
||||||
|
|
||||||
|
monero-serai also offers the following features:
|
||||||
|
|
||||||
|
- Featured Addresses
|
||||||
|
- A FROST-based multisig orders of magnitude more performant than Monero's
|
||||||
|
|
||||||
|
### Purpose and support
|
||||||
|
|
||||||
|
monero-serai was written for Serai, a decentralized exchange aiming to support
|
||||||
|
Monero. Despite this, monero-serai is intended to be a widely usable library,
|
||||||
|
accurate to Monero. monero-serai guarantees the functionality needed for Serai,
|
||||||
|
yet will not deprive functionality from other users.
|
||||||
|
|
||||||
|
Various legacy transaction formats are not currently implemented, yet we are
|
||||||
|
willing to add support for them. There aren't active development efforts around
|
||||||
|
them however.
|
||||||
|
|
||||||
|
### Caveats
|
||||||
|
|
||||||
|
This library DOES attempt to do the following:
|
||||||
|
|
||||||
|
- Create on-chain transactions identical to how wallet2 would (unless told not
|
||||||
|
to)
|
||||||
|
- Not be detectable as monero-serai when scanning outputs
|
||||||
|
- Not reveal spent outputs to the connected RPC node
|
||||||
|
|
||||||
|
This library DOES NOT attempt to do the following:
|
||||||
|
|
||||||
|
- Have identical RPC behavior when creating transactions
|
||||||
|
- Be a wallet
|
||||||
|
|
||||||
|
This means that monero-serai shouldn't be fingerprintable on-chain. It also
|
||||||
|
shouldn't be fingerprintable if a targeted attack occurs to detect if the
|
||||||
|
receiving wallet is monero-serai or wallet2. It also should be generally safe
|
||||||
|
for usage with remote nodes.
|
||||||
|
|
||||||
|
It won't hide from remote nodes it's monero-serai however, potentially
|
||||||
|
allowing a remote node to profile you. The implications of this are left to the
|
||||||
|
user to consider.
|
||||||
|
|
||||||
|
It also won't act as a wallet, just as a transaction library. wallet2 has
|
||||||
|
several *non-transaction-level* policies, such as always attempting to use two
|
||||||
|
inputs to create transactions. These are considered out of scope to
|
||||||
|
monero-serai.
|
||||||
67
coins/monero/build.rs
Normal file
67
coins/monero/build.rs
Normal file
@@ -0,0 +1,67 @@
|
|||||||
|
use std::{
|
||||||
|
io::Write,
|
||||||
|
env,
|
||||||
|
path::Path,
|
||||||
|
fs::{File, remove_file},
|
||||||
|
};
|
||||||
|
|
||||||
|
use dalek_ff_group::EdwardsPoint;
|
||||||
|
|
||||||
|
use monero_generators::bulletproofs_generators;
|
||||||
|
|
||||||
|
fn serialize(generators_string: &mut String, points: &[EdwardsPoint]) {
|
||||||
|
for generator in points {
|
||||||
|
generators_string.extend(
|
||||||
|
format!(
|
||||||
|
"
|
||||||
|
dalek_ff_group::EdwardsPoint(
|
||||||
|
curve25519_dalek::edwards::CompressedEdwardsY({:?}).decompress().unwrap()
|
||||||
|
),
|
||||||
|
",
|
||||||
|
generator.compress().to_bytes()
|
||||||
|
)
|
||||||
|
.chars(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn generators(prefix: &'static str, path: &str) {
|
||||||
|
let generators = bulletproofs_generators(prefix.as_bytes());
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let mut G_str = String::new();
|
||||||
|
serialize(&mut G_str, &generators.G);
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let mut H_str = String::new();
|
||||||
|
serialize(&mut H_str, &generators.H);
|
||||||
|
|
||||||
|
let path = Path::new(&env::var("OUT_DIR").unwrap()).join(path);
|
||||||
|
let _ = remove_file(&path);
|
||||||
|
File::create(&path)
|
||||||
|
.unwrap()
|
||||||
|
.write_all(
|
||||||
|
format!(
|
||||||
|
"
|
||||||
|
pub(crate) static GENERATORS_CELL: OnceLock<Generators> = OnceLock::new();
|
||||||
|
pub fn GENERATORS() -> &'static Generators {{
|
||||||
|
GENERATORS_CELL.get_or_init(|| Generators {{
|
||||||
|
G: vec![
|
||||||
|
{G_str}
|
||||||
|
],
|
||||||
|
H: vec![
|
||||||
|
{H_str}
|
||||||
|
],
|
||||||
|
}})
|
||||||
|
}}
|
||||||
|
",
|
||||||
|
)
|
||||||
|
.as_bytes(),
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
fn main() {
|
||||||
|
println!("cargo:rerun-if-changed=build.rs");
|
||||||
|
|
||||||
|
generators("bulletproof", "generators.rs");
|
||||||
|
generators("bulletproof_plus", "generators_plus.rs");
|
||||||
|
}
|
||||||
@@ -1,12 +1,11 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "monero-generators"
|
name = "monero-generators"
|
||||||
version = "0.4.0"
|
version = "0.4.0"
|
||||||
description = "Monero's hash to point function and generators"
|
description = "Monero's hash_to_point and generators"
|
||||||
license = "MIT"
|
license = "MIT"
|
||||||
repository = "https://github.com/serai-dex/serai/tree/develop/networks/monero/generators"
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero/generators"
|
||||||
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
rust-version = "1.80"
|
|
||||||
|
|
||||||
[package.metadata.docs.rs]
|
[package.metadata.docs.rs]
|
||||||
all-features = true
|
all-features = true
|
||||||
@@ -21,27 +20,15 @@ std-shims = { path = "../../../common/std-shims", version = "^0.1.1", default-fe
|
|||||||
subtle = { version = "^2.4", default-features = false }
|
subtle = { version = "^2.4", default-features = false }
|
||||||
|
|
||||||
sha3 = { version = "0.10", default-features = false }
|
sha3 = { version = "0.10", default-features = false }
|
||||||
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize"] }
|
|
||||||
|
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
|
||||||
|
|
||||||
group = { version = "0.13", default-features = false }
|
group = { version = "0.13", default-features = false }
|
||||||
dalek-ff-group = { path = "../../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
dalek-ff-group = { path = "../../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||||
|
|
||||||
monero-io = { path = "../io", version = "0.1", default-features = false }
|
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
hex = "0.4"
|
hex = "0.4"
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
std = [
|
std = ["std-shims/std", "subtle/std", "sha3/std", "dalek-ff-group/std"]
|
||||||
"std-shims/std",
|
|
||||||
|
|
||||||
"subtle/std",
|
|
||||||
|
|
||||||
"sha3/std",
|
|
||||||
|
|
||||||
"group/alloc",
|
|
||||||
"dalek-ff-group/std",
|
|
||||||
|
|
||||||
"monero-io/std"
|
|
||||||
]
|
|
||||||
default = ["std"]
|
default = ["std"]
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
MIT License
|
MIT License
|
||||||
|
|
||||||
Copyright (c) 2024 Luke Parker
|
Copyright (c) 2022-2023 Luke Parker
|
||||||
|
|
||||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
of this software and associated documentation files (the "Software"), to deal
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
7
coins/monero/generators/README.md
Normal file
7
coins/monero/generators/README.md
Normal file
@@ -0,0 +1,7 @@
|
|||||||
|
# Monero Generators
|
||||||
|
|
||||||
|
Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
|
||||||
|
An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
|
||||||
|
`hash_to_point` here, is included, as needed to generate generators.
|
||||||
|
|
||||||
|
This library is usable under no-std when the `std` feature is disabled.
|
||||||
@@ -1,20 +1,27 @@
|
|||||||
use subtle::ConditionallySelectable;
|
use subtle::ConditionallySelectable;
|
||||||
|
|
||||||
use curve25519_dalek::edwards::EdwardsPoint;
|
use curve25519_dalek::edwards::{EdwardsPoint, CompressedEdwardsY};
|
||||||
|
|
||||||
use group::ff::{Field, PrimeField};
|
use group::ff::{Field, PrimeField};
|
||||||
use dalek_ff_group::FieldElement;
|
use dalek_ff_group::FieldElement;
|
||||||
|
|
||||||
use monero_io::decompress_point;
|
use crate::hash;
|
||||||
|
|
||||||
use crate::keccak256;
|
/// Decompress canonically encoded ed25519 point
|
||||||
|
/// It does not check if the point is in the prime order subgroup
|
||||||
|
pub fn decompress_point(bytes: [u8; 32]) -> Option<EdwardsPoint> {
|
||||||
|
CompressedEdwardsY(bytes)
|
||||||
|
.decompress()
|
||||||
|
// Ban points which are either unreduced or -0
|
||||||
|
.filter(|point| point.compress().to_bytes() == bytes)
|
||||||
|
}
|
||||||
|
|
||||||
/// Monero's `hash_to_ec` function.
|
/// Monero's hash to point function, as named `hash_to_ec`.
|
||||||
pub fn hash_to_point(bytes: [u8; 32]) -> EdwardsPoint {
|
pub fn hash_to_point(bytes: [u8; 32]) -> EdwardsPoint {
|
||||||
#[allow(non_snake_case)]
|
#[allow(non_snake_case)]
|
||||||
let A = FieldElement::from(486662u64);
|
let A = FieldElement::from(486662u64);
|
||||||
|
|
||||||
let v = FieldElement::from_square(keccak256(&bytes)).double();
|
let v = FieldElement::from_square(hash(&bytes)).double();
|
||||||
let w = v + FieldElement::ONE;
|
let w = v + FieldElement::ONE;
|
||||||
let x = w.square() + (-A.square() * v);
|
let x = w.square() + (-A.square() * v);
|
||||||
|
|
||||||
79
coins/monero/generators/src/lib.rs
Normal file
79
coins/monero/generators/src/lib.rs
Normal file
@@ -0,0 +1,79 @@
|
|||||||
|
//! Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
|
||||||
|
//!
|
||||||
|
//! An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
|
||||||
|
//! `hash_to_point` here, is included, as needed to generate generators.
|
||||||
|
|
||||||
|
#![cfg_attr(not(feature = "std"), no_std)]
|
||||||
|
|
||||||
|
use std_shims::{sync::OnceLock, vec::Vec};
|
||||||
|
|
||||||
|
use sha3::{Digest, Keccak256};
|
||||||
|
|
||||||
|
use curve25519_dalek::edwards::{EdwardsPoint as DalekPoint};
|
||||||
|
|
||||||
|
use group::{Group, GroupEncoding};
|
||||||
|
use dalek_ff_group::EdwardsPoint;
|
||||||
|
|
||||||
|
mod varint;
|
||||||
|
use varint::write_varint;
|
||||||
|
|
||||||
|
mod hash_to_point;
|
||||||
|
pub use hash_to_point::{hash_to_point, decompress_point};
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod tests;
|
||||||
|
|
||||||
|
fn hash(data: &[u8]) -> [u8; 32] {
|
||||||
|
Keccak256::digest(data).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
static H_CELL: OnceLock<DalekPoint> = OnceLock::new();
|
||||||
|
/// Monero's alternate generator `H`, used for amounts in Pedersen commitments.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub fn H() -> DalekPoint {
|
||||||
|
*H_CELL.get_or_init(|| {
|
||||||
|
decompress_point(hash(&EdwardsPoint::generator().to_bytes())).unwrap().mul_by_cofactor()
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
static H_POW_2_CELL: OnceLock<[DalekPoint; 64]> = OnceLock::new();
|
||||||
|
/// Monero's alternate generator `H`, multiplied by 2**i for i in 1 ..= 64.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub fn H_pow_2() -> &'static [DalekPoint; 64] {
|
||||||
|
H_POW_2_CELL.get_or_init(|| {
|
||||||
|
let mut res = [H(); 64];
|
||||||
|
for i in 1 .. 64 {
|
||||||
|
res[i] = res[i - 1] + res[i - 1];
|
||||||
|
}
|
||||||
|
res
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
const MAX_M: usize = 16;
|
||||||
|
const N: usize = 64;
|
||||||
|
const MAX_MN: usize = MAX_M * N;
|
||||||
|
|
||||||
|
/// Container struct for Bulletproofs(+) generators.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub struct Generators {
|
||||||
|
pub G: Vec<EdwardsPoint>,
|
||||||
|
pub H: Vec<EdwardsPoint>,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Generate generators as needed for Bulletproofs(+), as Monero does.
|
||||||
|
pub fn bulletproofs_generators(dst: &'static [u8]) -> Generators {
|
||||||
|
let mut res = Generators { G: Vec::with_capacity(MAX_MN), H: Vec::with_capacity(MAX_MN) };
|
||||||
|
for i in 0 .. MAX_MN {
|
||||||
|
let i = 2 * i;
|
||||||
|
|
||||||
|
let mut even = H().compress().to_bytes().to_vec();
|
||||||
|
even.extend(dst);
|
||||||
|
let mut odd = even.clone();
|
||||||
|
|
||||||
|
write_varint(&i.try_into().unwrap(), &mut even).unwrap();
|
||||||
|
write_varint(&(i + 1).try_into().unwrap(), &mut odd).unwrap();
|
||||||
|
res.H.push(EdwardsPoint(hash_to_point(hash(&even))));
|
||||||
|
res.G.push(EdwardsPoint(hash_to_point(hash(&odd))));
|
||||||
|
}
|
||||||
|
res
|
||||||
|
}
|
||||||
@@ -1,7 +1,7 @@
|
|||||||
use crate::{decompress_point, hash_to_point};
|
use crate::{decompress_point, hash_to_point};
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
fn test_vectors() {
|
fn crypto_tests() {
|
||||||
// tests.txt file copied from monero repo
|
// tests.txt file copied from monero repo
|
||||||
// https://github.com/monero-project/monero/
|
// https://github.com/monero-project/monero/
|
||||||
// blob/ac02af92867590ca80b2779a7bbeafa99ff94dcb/tests/crypto/tests.txt
|
// blob/ac02af92867590ca80b2779a7bbeafa99ff94dcb/tests/crypto/tests.txt
|
||||||
@@ -21,6 +21,7 @@ fn test_vectors() {
|
|||||||
};
|
};
|
||||||
|
|
||||||
let actual = decompress_point(hex::decode(key).unwrap().try_into().unwrap());
|
let actual = decompress_point(hex::decode(key).unwrap().try_into().unwrap());
|
||||||
|
|
||||||
assert_eq!(actual.is_some(), expected);
|
assert_eq!(actual.is_some(), expected);
|
||||||
}
|
}
|
||||||
"hash_to_ec" => {
|
"hash_to_ec" => {
|
||||||
@@ -28,6 +29,7 @@ fn test_vectors() {
|
|||||||
let expected = words.next().unwrap();
|
let expected = words.next().unwrap();
|
||||||
|
|
||||||
let actual = hash_to_point(hex::decode(bytes).unwrap().try_into().unwrap());
|
let actual = hash_to_point(hex::decode(bytes).unwrap().try_into().unwrap());
|
||||||
|
|
||||||
assert_eq!(hex::encode(actual.compress().to_bytes()), expected);
|
assert_eq!(hex::encode(actual.compress().to_bytes()), expected);
|
||||||
}
|
}
|
||||||
_ => unreachable!("unknown command"),
|
_ => unreachable!("unknown command"),
|
||||||
1
coins/monero/generators/src/tests/mod.rs
Normal file
1
coins/monero/generators/src/tests/mod.rs
Normal file
@@ -0,0 +1 @@
|
|||||||
|
mod hash_to_point;
|
||||||
16
coins/monero/generators/src/varint.rs
Normal file
16
coins/monero/generators/src/varint.rs
Normal file
@@ -0,0 +1,16 @@
|
|||||||
|
use std_shims::io::{self, Write};
|
||||||
|
|
||||||
|
const VARINT_CONTINUATION_MASK: u8 = 0b1000_0000;
|
||||||
|
pub(crate) fn write_varint<W: Write>(varint: &u64, w: &mut W) -> io::Result<()> {
|
||||||
|
let mut varint = *varint;
|
||||||
|
while {
|
||||||
|
let mut b = u8::try_from(varint & u64::from(!VARINT_CONTINUATION_MASK)).unwrap();
|
||||||
|
varint >>= 7;
|
||||||
|
if varint != 0 {
|
||||||
|
b |= VARINT_CONTINUATION_MASK;
|
||||||
|
}
|
||||||
|
w.write_all(&[b])?;
|
||||||
|
varint != 0
|
||||||
|
} {}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
321
coins/monero/src/bin/reserialize_chain.rs
Normal file
321
coins/monero/src/bin/reserialize_chain.rs
Normal file
@@ -0,0 +1,321 @@
|
|||||||
|
#[cfg(feature = "binaries")]
|
||||||
|
mod binaries {
|
||||||
|
pub(crate) use std::sync::Arc;
|
||||||
|
|
||||||
|
pub(crate) use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
||||||
|
|
||||||
|
pub(crate) use multiexp::BatchVerifier;
|
||||||
|
|
||||||
|
pub(crate) use serde::Deserialize;
|
||||||
|
pub(crate) use serde_json::json;
|
||||||
|
|
||||||
|
pub(crate) use monero_serai::{
|
||||||
|
Commitment,
|
||||||
|
ringct::RctPrunable,
|
||||||
|
transaction::{Input, Transaction},
|
||||||
|
block::Block,
|
||||||
|
rpc::{RpcError, Rpc, HttpRpc},
|
||||||
|
};
|
||||||
|
|
||||||
|
pub(crate) use monero_generators::decompress_point;
|
||||||
|
|
||||||
|
pub(crate) use tokio::task::JoinHandle;
|
||||||
|
|
||||||
|
pub(crate) async fn check_block(rpc: Arc<Rpc<HttpRpc>>, block_i: usize) {
|
||||||
|
let hash = loop {
|
||||||
|
match rpc.get_block_hash(block_i).await {
|
||||||
|
Ok(hash) => break hash,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_block_hash ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't get block {block_i}'s hash: {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// TODO: Grab the JSON to also check it was deserialized correctly
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct BlockResponse {
|
||||||
|
blob: String,
|
||||||
|
}
|
||||||
|
let res: BlockResponse = loop {
|
||||||
|
match rpc.json_rpc_call("get_block", Some(json!({ "hash": hex::encode(hash) }))).await {
|
||||||
|
Ok(res) => break res,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_block ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't get block {block_i} via block.hash(): {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let blob = hex::decode(res.blob).expect("node returned non-hex block");
|
||||||
|
let block = Block::read(&mut blob.as_slice())
|
||||||
|
.unwrap_or_else(|e| panic!("couldn't deserialize block {block_i}: {e}"));
|
||||||
|
assert_eq!(block.hash(), hash, "hash differs");
|
||||||
|
assert_eq!(block.serialize(), blob, "serialization differs");
|
||||||
|
|
||||||
|
let txs_len = 1 + block.txs.len();
|
||||||
|
|
||||||
|
if !block.txs.is_empty() {
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct TransactionResponse {
|
||||||
|
tx_hash: String,
|
||||||
|
as_hex: String,
|
||||||
|
}
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct TransactionsResponse {
|
||||||
|
#[serde(default)]
|
||||||
|
missed_tx: Vec<String>,
|
||||||
|
txs: Vec<TransactionResponse>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut hashes_hex = block.txs.iter().map(hex::encode).collect::<Vec<_>>();
|
||||||
|
let mut all_txs = vec![];
|
||||||
|
while !hashes_hex.is_empty() {
|
||||||
|
let txs: TransactionsResponse = loop {
|
||||||
|
match rpc
|
||||||
|
.rpc_call(
|
||||||
|
"get_transactions",
|
||||||
|
Some(json!({
|
||||||
|
"txs_hashes": hashes_hex.drain(.. hashes_hex.len().min(100)).collect::<Vec<_>>(),
|
||||||
|
})),
|
||||||
|
)
|
||||||
|
.await
|
||||||
|
{
|
||||||
|
Ok(txs) => break txs,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_transactions ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't call get_transactions: {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
assert!(txs.missed_tx.is_empty());
|
||||||
|
all_txs.extend(txs.txs);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut batch = BatchVerifier::new(block.txs.len());
|
||||||
|
for (tx_hash, tx_res) in block.txs.into_iter().zip(all_txs) {
|
||||||
|
assert_eq!(
|
||||||
|
tx_res.tx_hash,
|
||||||
|
hex::encode(tx_hash),
|
||||||
|
"node returned a transaction with different hash"
|
||||||
|
);
|
||||||
|
|
||||||
|
let tx = Transaction::read(
|
||||||
|
&mut hex::decode(&tx_res.as_hex).expect("node returned non-hex transaction").as_slice(),
|
||||||
|
)
|
||||||
|
.expect("couldn't deserialize transaction");
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
hex::encode(tx.serialize()),
|
||||||
|
tx_res.as_hex,
|
||||||
|
"Transaction serialization was different"
|
||||||
|
);
|
||||||
|
assert_eq!(tx.hash(), tx_hash, "Transaction hash was different");
|
||||||
|
|
||||||
|
if matches!(tx.rct_signatures.prunable, RctPrunable::Null) {
|
||||||
|
assert_eq!(tx.prefix.version, 1);
|
||||||
|
assert!(!tx.signatures.is_empty());
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
let sig_hash = tx.signature_hash();
|
||||||
|
// Verify all proofs we support proving for
|
||||||
|
// This is due to having debug_asserts calling verify within their proving, and CLSAG
|
||||||
|
// multisig explicitly calling verify as part of its signing process
|
||||||
|
// Accordingly, making sure our signature_hash algorithm is correct is great, and further
|
||||||
|
// making sure the verification functions are valid is appreciated
|
||||||
|
match tx.rct_signatures.prunable {
|
||||||
|
RctPrunable::Null |
|
||||||
|
RctPrunable::AggregateMlsagBorromean { .. } |
|
||||||
|
RctPrunable::MlsagBorromean { .. } => {}
|
||||||
|
RctPrunable::MlsagBulletproofs { bulletproofs, .. } => {
|
||||||
|
assert!(bulletproofs.batch_verify(
|
||||||
|
&mut rand_core::OsRng,
|
||||||
|
&mut batch,
|
||||||
|
(),
|
||||||
|
&tx.rct_signatures.base.commitments
|
||||||
|
));
|
||||||
|
}
|
||||||
|
RctPrunable::Clsag { bulletproofs, clsags, pseudo_outs } => {
|
||||||
|
assert!(bulletproofs.batch_verify(
|
||||||
|
&mut rand_core::OsRng,
|
||||||
|
&mut batch,
|
||||||
|
(),
|
||||||
|
&tx.rct_signatures.base.commitments
|
||||||
|
));
|
||||||
|
|
||||||
|
for (i, clsag) in clsags.into_iter().enumerate() {
|
||||||
|
let (amount, key_offsets, image) = match &tx.prefix.inputs[i] {
|
||||||
|
Input::Gen(_) => panic!("Input::Gen"),
|
||||||
|
Input::ToKey { amount, key_offsets, key_image } => (amount, key_offsets, key_image),
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut running_sum = 0;
|
||||||
|
let mut actual_indexes = vec![];
|
||||||
|
for offset in key_offsets {
|
||||||
|
running_sum += offset;
|
||||||
|
actual_indexes.push(running_sum);
|
||||||
|
}
|
||||||
|
|
||||||
|
async fn get_outs(
|
||||||
|
rpc: &Rpc<HttpRpc>,
|
||||||
|
amount: u64,
|
||||||
|
indexes: &[u64],
|
||||||
|
) -> Vec<[EdwardsPoint; 2]> {
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct Out {
|
||||||
|
key: String,
|
||||||
|
mask: String,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct Outs {
|
||||||
|
outs: Vec<Out>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let outs: Outs = loop {
|
||||||
|
match rpc
|
||||||
|
.rpc_call(
|
||||||
|
"get_outs",
|
||||||
|
Some(json!({
|
||||||
|
"get_txid": true,
|
||||||
|
"outputs": indexes.iter().map(|o| json!({
|
||||||
|
"amount": amount,
|
||||||
|
"index": o
|
||||||
|
})).collect::<Vec<_>>()
|
||||||
|
})),
|
||||||
|
)
|
||||||
|
.await
|
||||||
|
{
|
||||||
|
Ok(outs) => break outs,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_outs ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't connect to RPC to get outs: {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let rpc_point = |point: &str| {
|
||||||
|
decompress_point(
|
||||||
|
hex::decode(point)
|
||||||
|
.expect("invalid hex for ring member")
|
||||||
|
.try_into()
|
||||||
|
.expect("invalid point len for ring member"),
|
||||||
|
)
|
||||||
|
.expect("invalid point for ring member")
|
||||||
|
};
|
||||||
|
|
||||||
|
outs
|
||||||
|
.outs
|
||||||
|
.iter()
|
||||||
|
.map(|out| {
|
||||||
|
let mask = rpc_point(&out.mask);
|
||||||
|
if amount != 0 {
|
||||||
|
assert_eq!(mask, Commitment::new(Scalar::from(1u8), amount).calculate());
|
||||||
|
}
|
||||||
|
[rpc_point(&out.key), mask]
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
clsag
|
||||||
|
.verify(
|
||||||
|
&get_outs(&rpc, amount.unwrap_or(0), &actual_indexes).await,
|
||||||
|
image,
|
||||||
|
&pseudo_outs[i],
|
||||||
|
&sig_hash,
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
assert!(batch.verify_vartime());
|
||||||
|
}
|
||||||
|
|
||||||
|
println!("Deserialized, hashed, and reserialized {block_i} with {txs_len} TXs");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "binaries")]
|
||||||
|
#[tokio::main]
|
||||||
|
async fn main() {
|
||||||
|
use binaries::*;
|
||||||
|
|
||||||
|
let args = std::env::args().collect::<Vec<String>>();
|
||||||
|
|
||||||
|
// Read start block as the first arg
|
||||||
|
let mut block_i = args[1].parse::<usize>().expect("invalid start block");
|
||||||
|
|
||||||
|
// How many blocks to work on at once
|
||||||
|
let async_parallelism: usize =
|
||||||
|
args.get(2).unwrap_or(&"8".to_string()).parse::<usize>().expect("invalid parallelism argument");
|
||||||
|
|
||||||
|
// Read further args as RPC URLs
|
||||||
|
let default_nodes = vec![
|
||||||
|
"http://xmr-node.cakewallet.com:18081".to_string(),
|
||||||
|
"https://node.sethforprivacy.com".to_string(),
|
||||||
|
];
|
||||||
|
let mut specified_nodes = vec![];
|
||||||
|
{
|
||||||
|
let mut i = 0;
|
||||||
|
loop {
|
||||||
|
let Some(node) = args.get(3 + i) else { break };
|
||||||
|
specified_nodes.push(node.clone());
|
||||||
|
i += 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
let nodes = if specified_nodes.is_empty() { default_nodes } else { specified_nodes };
|
||||||
|
|
||||||
|
let rpc = |url: String| async move {
|
||||||
|
HttpRpc::new(url.clone())
|
||||||
|
.await
|
||||||
|
.unwrap_or_else(|_| panic!("couldn't create HttpRpc connected to {url}"))
|
||||||
|
};
|
||||||
|
let main_rpc = rpc(nodes[0].clone()).await;
|
||||||
|
let mut rpcs = vec![];
|
||||||
|
for i in 0 .. async_parallelism {
|
||||||
|
rpcs.push(Arc::new(rpc(nodes[i % nodes.len()].clone()).await));
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut rpc_i = 0;
|
||||||
|
let mut handles: Vec<JoinHandle<()>> = vec![];
|
||||||
|
let mut height = 0;
|
||||||
|
loop {
|
||||||
|
let new_height = main_rpc.get_height().await.expect("couldn't call get_height");
|
||||||
|
if new_height == height {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
height = new_height;
|
||||||
|
|
||||||
|
while block_i < height {
|
||||||
|
if handles.len() >= async_parallelism {
|
||||||
|
// Guarantee one handle is complete
|
||||||
|
handles.swap_remove(0).await.unwrap();
|
||||||
|
|
||||||
|
// Remove all of the finished handles
|
||||||
|
let mut i = 0;
|
||||||
|
while i < handles.len() {
|
||||||
|
if handles[i].is_finished() {
|
||||||
|
handles.swap_remove(i).await.unwrap();
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
i += 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
handles.push(tokio::spawn(check_block(rpcs[rpc_i].clone(), block_i)));
|
||||||
|
rpc_i = (rpc_i + 1) % rpcs.len();
|
||||||
|
block_i += 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(not(feature = "binaries"))]
|
||||||
|
fn main() {
|
||||||
|
panic!("To run binaries, please build with `--feature binaries`.");
|
||||||
|
}
|
||||||
130
coins/monero/src/block.rs
Normal file
130
coins/monero/src/block.rs
Normal file
@@ -0,0 +1,130 @@
|
|||||||
|
use std_shims::{
|
||||||
|
vec::Vec,
|
||||||
|
io::{self, Read, Write},
|
||||||
|
};
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
hash,
|
||||||
|
merkle::merkle_root,
|
||||||
|
serialize::*,
|
||||||
|
transaction::{Input, Transaction},
|
||||||
|
};
|
||||||
|
|
||||||
|
const CORRECT_BLOCK_HASH_202612: [u8; 32] =
|
||||||
|
hex_literal::hex!("426d16cff04c71f8b16340b722dc4010a2dd3831c22041431f772547ba6e331a");
|
||||||
|
const EXISTING_BLOCK_HASH_202612: [u8; 32] =
|
||||||
|
hex_literal::hex!("bbd604d2ba11ba27935e006ed39c9bfdd99b76bf4a50654bc1e1e61217962698");
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct BlockHeader {
|
||||||
|
pub major_version: u8,
|
||||||
|
pub minor_version: u8,
|
||||||
|
pub timestamp: u64,
|
||||||
|
pub previous: [u8; 32],
|
||||||
|
pub nonce: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl BlockHeader {
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
write_varint(&self.major_version, w)?;
|
||||||
|
write_varint(&self.minor_version, w)?;
|
||||||
|
write_varint(&self.timestamp, w)?;
|
||||||
|
w.write_all(&self.previous)?;
|
||||||
|
w.write_all(&self.nonce.to_le_bytes())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn serialize(&self) -> Vec<u8> {
|
||||||
|
let mut serialized = vec![];
|
||||||
|
self.write(&mut serialized).unwrap();
|
||||||
|
serialized
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<BlockHeader> {
|
||||||
|
Ok(BlockHeader {
|
||||||
|
major_version: read_varint(r)?,
|
||||||
|
minor_version: read_varint(r)?,
|
||||||
|
timestamp: read_varint(r)?,
|
||||||
|
previous: read_bytes(r)?,
|
||||||
|
nonce: read_bytes(r).map(u32::from_le_bytes)?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct Block {
|
||||||
|
pub header: BlockHeader,
|
||||||
|
pub miner_tx: Transaction,
|
||||||
|
pub txs: Vec<[u8; 32]>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Block {
|
||||||
|
pub fn number(&self) -> Option<u64> {
|
||||||
|
match self.miner_tx.prefix.inputs.first() {
|
||||||
|
Some(Input::Gen(number)) => Some(*number),
|
||||||
|
_ => None,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
self.header.write(w)?;
|
||||||
|
self.miner_tx.write(w)?;
|
||||||
|
write_varint(&self.txs.len(), w)?;
|
||||||
|
for tx in &self.txs {
|
||||||
|
w.write_all(tx)?;
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn tx_merkle_root(&self) -> [u8; 32] {
|
||||||
|
merkle_root(self.miner_tx.hash(), &self.txs)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Serialize the block as required for the proof of work hash.
|
||||||
|
///
|
||||||
|
/// This is distinct from the serialization required for the block hash. To get the block hash,
|
||||||
|
/// use the [`Block::hash`] function.
|
||||||
|
pub fn serialize_hashable(&self) -> Vec<u8> {
|
||||||
|
let mut blob = self.header.serialize();
|
||||||
|
blob.extend_from_slice(&self.tx_merkle_root());
|
||||||
|
write_varint(&(1 + u64::try_from(self.txs.len()).unwrap()), &mut blob).unwrap();
|
||||||
|
|
||||||
|
blob
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn hash(&self) -> [u8; 32] {
|
||||||
|
let mut hashable = self.serialize_hashable();
|
||||||
|
// Monero pre-appends a VarInt of the block hashing blobs length before getting the block hash
|
||||||
|
// but doesn't do this when getting the proof of work hash :)
|
||||||
|
let mut hashing_blob = Vec::with_capacity(8 + hashable.len());
|
||||||
|
write_varint(&u64::try_from(hashable.len()).unwrap(), &mut hashing_blob).unwrap();
|
||||||
|
hashing_blob.append(&mut hashable);
|
||||||
|
|
||||||
|
let hash = hash(&hashing_blob);
|
||||||
|
if hash == CORRECT_BLOCK_HASH_202612 {
|
||||||
|
return EXISTING_BLOCK_HASH_202612;
|
||||||
|
};
|
||||||
|
|
||||||
|
hash
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn serialize(&self) -> Vec<u8> {
|
||||||
|
let mut serialized = vec![];
|
||||||
|
self.write(&mut serialized).unwrap();
|
||||||
|
serialized
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<Block> {
|
||||||
|
let header = BlockHeader::read(r)?;
|
||||||
|
|
||||||
|
let miner_tx = Transaction::read(r)?;
|
||||||
|
if !matches!(miner_tx.prefix.inputs.as_slice(), &[Input::Gen(_)]) {
|
||||||
|
Err(io::Error::other("Miner transaction has incorrect input type."))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(Block {
|
||||||
|
header,
|
||||||
|
miner_tx,
|
||||||
|
txs: (0_usize .. read_varint(r)?).map(|_| read_bytes(r)).collect::<Result<_, _>>()?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
241
coins/monero/src/lib.rs
Normal file
241
coins/monero/src/lib.rs
Normal file
@@ -0,0 +1,241 @@
|
|||||||
|
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
|
||||||
|
#![doc = include_str!("../README.md")]
|
||||||
|
#![cfg_attr(not(feature = "std"), no_std)]
|
||||||
|
|
||||||
|
#[cfg(not(feature = "std"))]
|
||||||
|
#[macro_use]
|
||||||
|
extern crate alloc;
|
||||||
|
|
||||||
|
use std_shims::{sync::OnceLock, io};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||||
|
|
||||||
|
use sha3::{Digest, Keccak256};
|
||||||
|
|
||||||
|
use curve25519_dalek::{
|
||||||
|
constants::{ED25519_BASEPOINT_TABLE, ED25519_BASEPOINT_POINT},
|
||||||
|
scalar::Scalar,
|
||||||
|
edwards::{EdwardsPoint, VartimeEdwardsPrecomputation},
|
||||||
|
traits::VartimePrecomputedMultiscalarMul,
|
||||||
|
};
|
||||||
|
|
||||||
|
pub use monero_generators::{H, decompress_point};
|
||||||
|
|
||||||
|
mod merkle;
|
||||||
|
|
||||||
|
mod serialize;
|
||||||
|
use serialize::{read_byte, read_u16};
|
||||||
|
|
||||||
|
/// UnreducedScalar struct with functionality for recovering incorrectly reduced scalars.
|
||||||
|
mod unreduced_scalar;
|
||||||
|
|
||||||
|
/// Ring Signature structs and functionality.
|
||||||
|
pub mod ring_signatures;
|
||||||
|
|
||||||
|
/// RingCT structs and functionality.
|
||||||
|
pub mod ringct;
|
||||||
|
use ringct::RctType;
|
||||||
|
|
||||||
|
/// Transaction structs.
|
||||||
|
pub mod transaction;
|
||||||
|
/// Block structs.
|
||||||
|
pub mod block;
|
||||||
|
|
||||||
|
/// Monero daemon RPC interface.
|
||||||
|
pub mod rpc;
|
||||||
|
/// Wallet functionality, enabling scanning and sending transactions.
|
||||||
|
pub mod wallet;
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod tests;
|
||||||
|
|
||||||
|
pub const DEFAULT_LOCK_WINDOW: usize = 10;
|
||||||
|
pub const COINBASE_LOCK_WINDOW: usize = 60;
|
||||||
|
pub const BLOCK_TIME: usize = 120;
|
||||||
|
|
||||||
|
static INV_EIGHT_CELL: OnceLock<Scalar> = OnceLock::new();
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub(crate) fn INV_EIGHT() -> Scalar {
|
||||||
|
*INV_EIGHT_CELL.get_or_init(|| Scalar::from(8u8).invert())
|
||||||
|
}
|
||||||
|
|
||||||
|
static BASEPOINT_PRECOMP_CELL: OnceLock<VartimeEdwardsPrecomputation> = OnceLock::new();
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub(crate) fn BASEPOINT_PRECOMP() -> &'static VartimeEdwardsPrecomputation {
|
||||||
|
BASEPOINT_PRECOMP_CELL
|
||||||
|
.get_or_init(|| VartimeEdwardsPrecomputation::new([ED25519_BASEPOINT_POINT]))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Monero protocol version.
|
||||||
|
///
|
||||||
|
/// v15 is omitted as v15 was simply v14 and v16 being active at the same time, with regards to the
|
||||||
|
/// transactions supported. Accordingly, v16 should be used during v15.
|
||||||
|
#[derive(Clone, Copy, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
#[allow(non_camel_case_types)]
|
||||||
|
pub enum Protocol {
|
||||||
|
v14,
|
||||||
|
v16,
|
||||||
|
Custom {
|
||||||
|
ring_len: usize,
|
||||||
|
bp_plus: bool,
|
||||||
|
optimal_rct_type: RctType,
|
||||||
|
view_tags: bool,
|
||||||
|
v16_fee: bool,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Protocol {
|
||||||
|
/// Amount of ring members under this protocol version.
|
||||||
|
pub fn ring_len(&self) -> usize {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => 11,
|
||||||
|
Protocol::v16 => 16,
|
||||||
|
Protocol::Custom { ring_len, .. } => *ring_len,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether or not the specified version uses Bulletproofs or Bulletproofs+.
|
||||||
|
///
|
||||||
|
/// This method will likely be reworked when versions not using Bulletproofs at all are added.
|
||||||
|
pub fn bp_plus(&self) -> bool {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => false,
|
||||||
|
Protocol::v16 => true,
|
||||||
|
Protocol::Custom { bp_plus, .. } => *bp_plus,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// TODO: Make this an Option when we support pre-RCT protocols
|
||||||
|
pub fn optimal_rct_type(&self) -> RctType {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => RctType::Clsag,
|
||||||
|
Protocol::v16 => RctType::BulletproofsPlus,
|
||||||
|
Protocol::Custom { optimal_rct_type, .. } => *optimal_rct_type,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether or not the specified version uses view tags.
|
||||||
|
pub fn view_tags(&self) -> bool {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => false,
|
||||||
|
Protocol::v16 => true,
|
||||||
|
Protocol::Custom { view_tags, .. } => *view_tags,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether or not the specified version uses the fee algorithm from Monero
|
||||||
|
/// hard fork version 16 (released in v18 binaries).
|
||||||
|
pub fn v16_fee(&self) -> bool {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => false,
|
||||||
|
Protocol::v16 => true,
|
||||||
|
Protocol::Custom { v16_fee, .. } => *v16_fee,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn write<W: io::Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => w.write_all(&[0, 14]),
|
||||||
|
Protocol::v16 => w.write_all(&[0, 16]),
|
||||||
|
Protocol::Custom { ring_len, bp_plus, optimal_rct_type, view_tags, v16_fee } => {
|
||||||
|
// Custom, version 0
|
||||||
|
w.write_all(&[1, 0])?;
|
||||||
|
w.write_all(&u16::try_from(*ring_len).unwrap().to_le_bytes())?;
|
||||||
|
w.write_all(&[u8::from(*bp_plus)])?;
|
||||||
|
w.write_all(&[optimal_rct_type.to_byte()])?;
|
||||||
|
w.write_all(&[u8::from(*view_tags)])?;
|
||||||
|
w.write_all(&[u8::from(*v16_fee)])
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn read<R: io::Read>(r: &mut R) -> io::Result<Protocol> {
|
||||||
|
Ok(match read_byte(r)? {
|
||||||
|
// Monero protocol
|
||||||
|
0 => match read_byte(r)? {
|
||||||
|
14 => Protocol::v14,
|
||||||
|
16 => Protocol::v16,
|
||||||
|
_ => Err(io::Error::other("unrecognized monero protocol"))?,
|
||||||
|
},
|
||||||
|
// Custom
|
||||||
|
1 => match read_byte(r)? {
|
||||||
|
0 => Protocol::Custom {
|
||||||
|
ring_len: read_u16(r)?.into(),
|
||||||
|
bp_plus: match read_byte(r)? {
|
||||||
|
0 => false,
|
||||||
|
1 => true,
|
||||||
|
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||||
|
},
|
||||||
|
optimal_rct_type: RctType::from_byte(read_byte(r)?)
|
||||||
|
.ok_or_else(|| io::Error::other("invalid RctType serialization"))?,
|
||||||
|
view_tags: match read_byte(r)? {
|
||||||
|
0 => false,
|
||||||
|
1 => true,
|
||||||
|
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||||
|
},
|
||||||
|
v16_fee: match read_byte(r)? {
|
||||||
|
0 => false,
|
||||||
|
1 => true,
|
||||||
|
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
_ => Err(io::Error::other("unrecognized custom protocol serialization"))?,
|
||||||
|
},
|
||||||
|
_ => Err(io::Error::other("unrecognized protocol serialization"))?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Transparent structure representing a Pedersen commitment's contents.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
#[derive(Clone, PartialEq, Eq, Zeroize, ZeroizeOnDrop)]
|
||||||
|
pub struct Commitment {
|
||||||
|
pub mask: Scalar,
|
||||||
|
pub amount: u64,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Debug for Commitment {
|
||||||
|
fn fmt(&self, fmt: &mut core::fmt::Formatter<'_>) -> Result<(), core::fmt::Error> {
|
||||||
|
fmt.debug_struct("Commitment").field("amount", &self.amount).finish_non_exhaustive()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Commitment {
|
||||||
|
/// A commitment to zero, defined with a mask of 1 (as to not be the identity).
|
||||||
|
pub fn zero() -> Commitment {
|
||||||
|
Commitment { mask: Scalar::ONE, amount: 0 }
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn new(mask: Scalar, amount: u64) -> Commitment {
|
||||||
|
Commitment { mask, amount }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Calculate a Pedersen commitment, as a point, from the transparent structure.
|
||||||
|
pub fn calculate(&self) -> EdwardsPoint {
|
||||||
|
(&self.mask * ED25519_BASEPOINT_TABLE) + (Scalar::from(self.amount) * H())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Support generating a random scalar using a modern rand, as dalek's is notoriously dated.
|
||||||
|
pub fn random_scalar<R: RngCore + CryptoRng>(rng: &mut R) -> Scalar {
|
||||||
|
let mut r = [0; 64];
|
||||||
|
rng.fill_bytes(&mut r);
|
||||||
|
Scalar::from_bytes_mod_order_wide(&r)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash(data: &[u8]) -> [u8; 32] {
|
||||||
|
Keccak256::digest(data).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Hash the provided data to a scalar via keccak256(data) % l.
|
||||||
|
pub fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||||
|
let scalar = Scalar::from_bytes_mod_order(hash(data));
|
||||||
|
// Monero will explicitly error in this case
|
||||||
|
// This library acknowledges its practical impossibility of it occurring, and doesn't bother to
|
||||||
|
// code in logic to handle it. That said, if it ever occurs, something must happen in order to
|
||||||
|
// not generate/verify a proof we believe to be valid when it isn't
|
||||||
|
assert!(scalar != Scalar::ZERO, "ZERO HASH: {data:?}");
|
||||||
|
scalar
|
||||||
|
}
|
||||||
@@ -1,11 +1,11 @@
|
|||||||
use std_shims::vec::Vec;
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
use crate::primitives::keccak256;
|
use crate::hash;
|
||||||
|
|
||||||
pub(crate) fn merkle_root(root: [u8; 32], leafs: &[[u8; 32]]) -> [u8; 32] {
|
pub(crate) fn merkle_root(root: [u8; 32], leafs: &[[u8; 32]]) -> [u8; 32] {
|
||||||
match leafs.len() {
|
match leafs.len() {
|
||||||
0 => root,
|
0 => root,
|
||||||
1 => keccak256([root, leafs[0]].concat()),
|
1 => hash(&[root, leafs[0]].concat()),
|
||||||
_ => {
|
_ => {
|
||||||
let mut hashes = Vec::with_capacity(1 + leafs.len());
|
let mut hashes = Vec::with_capacity(1 + leafs.len());
|
||||||
hashes.push(root);
|
hashes.push(root);
|
||||||
@@ -29,7 +29,7 @@ pub(crate) fn merkle_root(root: [u8; 32], leafs: &[[u8; 32]]) -> [u8; 32] {
|
|||||||
let mut paired_hashes = Vec::with_capacity(overage);
|
let mut paired_hashes = Vec::with_capacity(overage);
|
||||||
while let Some(left) = rightmost.next() {
|
while let Some(left) = rightmost.next() {
|
||||||
let right = rightmost.next().unwrap();
|
let right = rightmost.next().unwrap();
|
||||||
paired_hashes.push(keccak256([left.as_ref(), &right].concat()));
|
paired_hashes.push(hash(&[left.as_ref(), &right].concat()));
|
||||||
}
|
}
|
||||||
drop(rightmost);
|
drop(rightmost);
|
||||||
|
|
||||||
@@ -42,7 +42,7 @@ pub(crate) fn merkle_root(root: [u8; 32], leafs: &[[u8; 32]]) -> [u8; 32] {
|
|||||||
while hashes.len() > 1 {
|
while hashes.len() > 1 {
|
||||||
let mut i = 0;
|
let mut i = 0;
|
||||||
while i < hashes.len() {
|
while i < hashes.len() {
|
||||||
new_hashes.push(keccak256([hashes[i], hashes[i + 1]].concat()));
|
new_hashes.push(hash(&[hashes[i], hashes[i + 1]].concat()));
|
||||||
i += 2;
|
i += 2;
|
||||||
}
|
}
|
||||||
|
|
||||||
72
coins/monero/src/ring_signatures.rs
Normal file
72
coins/monero/src/ring_signatures.rs
Normal file
@@ -0,0 +1,72 @@
|
|||||||
|
use std_shims::{
|
||||||
|
io::{self, *},
|
||||||
|
vec::Vec,
|
||||||
|
};
|
||||||
|
|
||||||
|
use zeroize::Zeroize;
|
||||||
|
|
||||||
|
use curve25519_dalek::{EdwardsPoint, Scalar};
|
||||||
|
|
||||||
|
use monero_generators::hash_to_point;
|
||||||
|
|
||||||
|
use crate::{serialize::*, hash_to_scalar};
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
pub struct Signature {
|
||||||
|
c: Scalar,
|
||||||
|
r: Scalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Signature {
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
write_scalar(&self.c, w)?;
|
||||||
|
write_scalar(&self.r, w)?;
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<Signature> {
|
||||||
|
Ok(Signature { c: read_scalar(r)?, r: read_scalar(r)? })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
pub struct RingSignature {
|
||||||
|
sigs: Vec<Signature>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl RingSignature {
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
for sig in &self.sigs {
|
||||||
|
sig.write(w)?;
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(members: usize, r: &mut R) -> io::Result<RingSignature> {
|
||||||
|
Ok(RingSignature { sigs: read_raw_vec(Signature::read, members, r)? })
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn verify(&self, msg: &[u8; 32], ring: &[EdwardsPoint], key_image: &EdwardsPoint) -> bool {
|
||||||
|
if ring.len() != self.sigs.len() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut buf = Vec::with_capacity(32 + (32 * 2 * ring.len()));
|
||||||
|
buf.extend_from_slice(msg);
|
||||||
|
|
||||||
|
let mut sum = Scalar::ZERO;
|
||||||
|
|
||||||
|
for (ring_member, sig) in ring.iter().zip(&self.sigs) {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let Li = EdwardsPoint::vartime_double_scalar_mul_basepoint(&sig.c, ring_member, &sig.r);
|
||||||
|
buf.extend_from_slice(Li.compress().as_bytes());
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let Ri = (sig.r * hash_to_point(ring_member.compress().to_bytes())) + (sig.c * key_image);
|
||||||
|
buf.extend_from_slice(Ri.compress().as_bytes());
|
||||||
|
|
||||||
|
sum += sig.c;
|
||||||
|
}
|
||||||
|
|
||||||
|
sum == hash_to_scalar(&buf)
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,35 +1,26 @@
|
|||||||
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
|
|
||||||
#![doc = include_str!("../README.md")]
|
|
||||||
#![deny(missing_docs)]
|
|
||||||
#![cfg_attr(not(feature = "std"), no_std)]
|
|
||||||
#![allow(non_snake_case)]
|
|
||||||
|
|
||||||
use core::fmt::Debug;
|
use core::fmt::Debug;
|
||||||
use std_shims::io::{self, Read, Write};
|
use std_shims::io::{self, Read, Write};
|
||||||
|
|
||||||
use zeroize::Zeroize;
|
|
||||||
|
|
||||||
use curve25519_dalek::{traits::Identity, Scalar, EdwardsPoint};
|
use curve25519_dalek::{traits::Identity, Scalar, EdwardsPoint};
|
||||||
|
|
||||||
use monero_io::*;
|
|
||||||
use monero_generators::H_pow_2;
|
use monero_generators::H_pow_2;
|
||||||
use monero_primitives::{keccak256_to_scalar, UnreducedScalar};
|
|
||||||
|
|
||||||
// 64 Borromean ring signatures, as needed for a 64-bit range proof.
|
use crate::{hash_to_scalar, unreduced_scalar::UnreducedScalar, serialize::*};
|
||||||
//
|
|
||||||
// s0 and s1 are stored as `UnreducedScalar`s due to Monero not requiring they were reduced.
|
/// 64 Borromean ring signatures.
|
||||||
// `UnreducedScalar` preserves their original byte encoding and implements a custom reduction
|
///
|
||||||
// algorithm which was in use.
|
/// s0 and s1 are stored as `UnreducedScalar`s due to Monero not requiring they were reduced.
|
||||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
/// `UnreducedScalar` preserves their original byte encoding and implements a custom reduction
|
||||||
struct BorromeanSignatures {
|
/// algorithm which was in use.
|
||||||
s0: [UnreducedScalar; 64],
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
s1: [UnreducedScalar; 64],
|
pub struct BorromeanSignatures {
|
||||||
ee: Scalar,
|
pub s0: [UnreducedScalar; 64],
|
||||||
|
pub s1: [UnreducedScalar; 64],
|
||||||
|
pub ee: Scalar,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl BorromeanSignatures {
|
impl BorromeanSignatures {
|
||||||
// Read a set of BorromeanSignatures.
|
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanSignatures> {
|
||||||
fn read<R: Read>(r: &mut R) -> io::Result<BorromeanSignatures> {
|
|
||||||
Ok(BorromeanSignatures {
|
Ok(BorromeanSignatures {
|
||||||
s0: read_array(UnreducedScalar::read, r)?,
|
s0: read_array(UnreducedScalar::read, r)?,
|
||||||
s1: read_array(UnreducedScalar::read, r)?,
|
s1: read_array(UnreducedScalar::read, r)?,
|
||||||
@@ -37,8 +28,7 @@ impl BorromeanSignatures {
|
|||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
// Write the set of BorromeanSignatures.
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
|
||||||
for s0 in &self.s0 {
|
for s0 in &self.s0 {
|
||||||
s0.write(w)?;
|
s0.write(w)?;
|
||||||
}
|
}
|
||||||
@@ -60,41 +50,36 @@ impl BorromeanSignatures {
|
|||||||
);
|
);
|
||||||
#[allow(non_snake_case)]
|
#[allow(non_snake_case)]
|
||||||
let LV = EdwardsPoint::vartime_double_scalar_mul_basepoint(
|
let LV = EdwardsPoint::vartime_double_scalar_mul_basepoint(
|
||||||
&keccak256_to_scalar(LL.compress().as_bytes()),
|
&hash_to_scalar(LL.compress().as_bytes()),
|
||||||
&keys_b[i],
|
&keys_b[i],
|
||||||
&self.s1[i].recover_monero_slide_scalar(),
|
&self.s1[i].recover_monero_slide_scalar(),
|
||||||
);
|
);
|
||||||
transcript[(i * 32) .. ((i + 1) * 32)].copy_from_slice(LV.compress().as_bytes());
|
transcript[(i * 32) .. ((i + 1) * 32)].copy_from_slice(LV.compress().as_bytes());
|
||||||
}
|
}
|
||||||
|
|
||||||
keccak256_to_scalar(transcript) == self.ee
|
hash_to_scalar(&transcript) == self.ee
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A range proof premised on Borromean ring signatures.
|
/// A range proof premised on Borromean ring signatures.
|
||||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
pub struct BorromeanRange {
|
pub struct BorromeanRange {
|
||||||
sigs: BorromeanSignatures,
|
pub sigs: BorromeanSignatures,
|
||||||
bit_commitments: [EdwardsPoint; 64],
|
pub bit_commitments: [EdwardsPoint; 64],
|
||||||
}
|
}
|
||||||
|
|
||||||
impl BorromeanRange {
|
impl BorromeanRange {
|
||||||
/// Read a BorromeanRange proof.
|
|
||||||
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanRange> {
|
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanRange> {
|
||||||
Ok(BorromeanRange {
|
Ok(BorromeanRange {
|
||||||
sigs: BorromeanSignatures::read(r)?,
|
sigs: BorromeanSignatures::read(r)?,
|
||||||
bit_commitments: read_array(read_point, r)?,
|
bit_commitments: read_array(read_point, r)?,
|
||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Write the BorromeanRange proof.
|
|
||||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
self.sigs.write(w)?;
|
self.sigs.write(w)?;
|
||||||
write_raw_vec(write_point, &self.bit_commitments, w)
|
write_raw_vec(write_point, &self.bit_commitments, w)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Verify the commitment contains a 64-bit value.
|
|
||||||
#[must_use]
|
|
||||||
pub fn verify(&self, commitment: &EdwardsPoint) -> bool {
|
pub fn verify(&self, commitment: &EdwardsPoint) -> bool {
|
||||||
if &self.bit_commitments.iter().sum::<EdwardsPoint>() != commitment {
|
if &self.bit_commitments.iter().sum::<EdwardsPoint>() != commitment {
|
||||||
return false;
|
return false;
|
||||||
151
coins/monero/src/ringct/bulletproofs/core.rs
Normal file
151
coins/monero/src/ringct/bulletproofs/core.rs
Normal file
@@ -0,0 +1,151 @@
|
|||||||
|
use std_shims::{vec::Vec, sync::OnceLock};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use subtle::{Choice, ConditionallySelectable};
|
||||||
|
|
||||||
|
use curve25519_dalek::edwards::EdwardsPoint as DalekPoint;
|
||||||
|
|
||||||
|
use group::{ff::Field, Group};
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use multiexp::multiexp as multiexp_const;
|
||||||
|
|
||||||
|
pub(crate) use monero_generators::Generators;
|
||||||
|
|
||||||
|
use crate::{INV_EIGHT as DALEK_INV_EIGHT, H as DALEK_H, Commitment, hash_to_scalar as dalek_hash};
|
||||||
|
pub(crate) use crate::ringct::bulletproofs::scalar_vector::*;
|
||||||
|
|
||||||
|
#[inline]
|
||||||
|
pub(crate) fn INV_EIGHT() -> Scalar {
|
||||||
|
Scalar(DALEK_INV_EIGHT())
|
||||||
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
|
pub(crate) fn H() -> EdwardsPoint {
|
||||||
|
EdwardsPoint(DALEK_H())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||||
|
Scalar(dalek_hash(data))
|
||||||
|
}
|
||||||
|
|
||||||
|
// Components common between variants
|
||||||
|
pub(crate) const MAX_M: usize = 16;
|
||||||
|
pub(crate) const LOG_N: usize = 6; // 2 << 6 == N
|
||||||
|
pub(crate) const N: usize = 64;
|
||||||
|
|
||||||
|
pub(crate) fn prove_multiexp(pairs: &[(Scalar, EdwardsPoint)]) -> EdwardsPoint {
|
||||||
|
multiexp_const(pairs) * INV_EIGHT()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn vector_exponent(
|
||||||
|
generators: &Generators,
|
||||||
|
a: &ScalarVector,
|
||||||
|
b: &ScalarVector,
|
||||||
|
) -> EdwardsPoint {
|
||||||
|
debug_assert_eq!(a.len(), b.len());
|
||||||
|
(a * &generators.G[.. a.len()]) + (b * &generators.H[.. b.len()])
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_cache(cache: &mut Scalar, mash: &[[u8; 32]]) -> Scalar {
|
||||||
|
let slice =
|
||||||
|
&[cache.to_bytes().as_ref(), mash.iter().copied().flatten().collect::<Vec<_>>().as_ref()]
|
||||||
|
.concat();
|
||||||
|
*cache = hash_to_scalar(slice);
|
||||||
|
*cache
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn MN(outputs: usize) -> (usize, usize, usize) {
|
||||||
|
let mut logM = 0;
|
||||||
|
let mut M;
|
||||||
|
while {
|
||||||
|
M = 1 << logM;
|
||||||
|
(M <= MAX_M) && (M < outputs)
|
||||||
|
} {
|
||||||
|
logM += 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
(logM + LOG_N, M, M * N)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn bit_decompose(commitments: &[Commitment]) -> (ScalarVector, ScalarVector) {
|
||||||
|
let (_, M, MN) = MN(commitments.len());
|
||||||
|
|
||||||
|
let sv = commitments.iter().map(|c| Scalar::from(c.amount)).collect::<Vec<_>>();
|
||||||
|
let mut aL = ScalarVector::new(MN);
|
||||||
|
let mut aR = ScalarVector::new(MN);
|
||||||
|
|
||||||
|
for j in 0 .. M {
|
||||||
|
for i in (0 .. N).rev() {
|
||||||
|
let bit =
|
||||||
|
if j < sv.len() { Choice::from((sv[j][i / 8] >> (i % 8)) & 1) } else { Choice::from(0) };
|
||||||
|
aL.0[(j * N) + i] = Scalar::conditional_select(&Scalar::ZERO, &Scalar::ONE, bit);
|
||||||
|
aR.0[(j * N) + i] = Scalar::conditional_select(&-Scalar::ONE, &Scalar::ZERO, bit);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
(aL, aR)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_commitments<C: IntoIterator<Item = DalekPoint>>(
|
||||||
|
commitments: C,
|
||||||
|
) -> (Scalar, Vec<EdwardsPoint>) {
|
||||||
|
let V = commitments.into_iter().map(|c| EdwardsPoint(c) * INV_EIGHT()).collect::<Vec<_>>();
|
||||||
|
(hash_to_scalar(&V.iter().flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>()), V)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn alpha_rho<R: RngCore + CryptoRng>(
|
||||||
|
rng: &mut R,
|
||||||
|
generators: &Generators,
|
||||||
|
aL: &ScalarVector,
|
||||||
|
aR: &ScalarVector,
|
||||||
|
) -> (Scalar, EdwardsPoint) {
|
||||||
|
let ar = Scalar::random(rng);
|
||||||
|
(ar, (vector_exponent(generators, aL, aR) + (EdwardsPoint::generator() * ar)) * INV_EIGHT())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn LR_statements(
|
||||||
|
a: &ScalarVector,
|
||||||
|
G_i: &[EdwardsPoint],
|
||||||
|
b: &ScalarVector,
|
||||||
|
H_i: &[EdwardsPoint],
|
||||||
|
cL: Scalar,
|
||||||
|
U: EdwardsPoint,
|
||||||
|
) -> Vec<(Scalar, EdwardsPoint)> {
|
||||||
|
let mut res = a
|
||||||
|
.0
|
||||||
|
.iter()
|
||||||
|
.copied()
|
||||||
|
.zip(G_i.iter().copied())
|
||||||
|
.chain(b.0.iter().copied().zip(H_i.iter().copied()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
res.push((cL, U));
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
static TWO_N_CELL: OnceLock<ScalarVector> = OnceLock::new();
|
||||||
|
pub(crate) fn TWO_N() -> &'static ScalarVector {
|
||||||
|
TWO_N_CELL.get_or_init(|| ScalarVector::powers(Scalar::from(2u8), N))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn challenge_products(w: &[Scalar], winv: &[Scalar]) -> Vec<Scalar> {
|
||||||
|
let mut products = vec![Scalar::ZERO; 1 << w.len()];
|
||||||
|
products[0] = winv[0];
|
||||||
|
products[1] = w[0];
|
||||||
|
for j in 1 .. w.len() {
|
||||||
|
let mut slots = (1 << (j + 1)) - 1;
|
||||||
|
while slots > 0 {
|
||||||
|
products[slots] = products[slots / 2] * w[j];
|
||||||
|
products[slots - 1] = products[slots / 2] * winv[j];
|
||||||
|
slots = slots.saturating_sub(2);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Sanity check as if the above failed to populate, it'd be critical
|
||||||
|
for w in &products {
|
||||||
|
debug_assert!(!bool::from(w.is_zero()));
|
||||||
|
}
|
||||||
|
|
||||||
|
products
|
||||||
|
}
|
||||||
229
coins/monero/src/ringct/bulletproofs/mod.rs
Normal file
229
coins/monero/src/ringct/bulletproofs/mod.rs
Normal file
@@ -0,0 +1,229 @@
|
|||||||
|
#![allow(non_snake_case)]
|
||||||
|
|
||||||
|
use std_shims::{
|
||||||
|
vec::Vec,
|
||||||
|
io::{self, Read, Write},
|
||||||
|
};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::{Zeroize, Zeroizing};
|
||||||
|
|
||||||
|
use curve25519_dalek::edwards::EdwardsPoint;
|
||||||
|
use multiexp::BatchVerifier;
|
||||||
|
|
||||||
|
use crate::{Commitment, wallet::TransactionError, serialize::*};
|
||||||
|
|
||||||
|
pub(crate) mod scalar_vector;
|
||||||
|
pub(crate) mod core;
|
||||||
|
use self::core::LOG_N;
|
||||||
|
|
||||||
|
pub(crate) mod original;
|
||||||
|
use self::original::OriginalStruct;
|
||||||
|
|
||||||
|
pub(crate) mod plus;
|
||||||
|
use self::plus::*;
|
||||||
|
|
||||||
|
pub(crate) const MAX_OUTPUTS: usize = self::core::MAX_M;
|
||||||
|
|
||||||
|
/// Bulletproofs enum, supporting the original and plus formulations.
|
||||||
|
#[allow(clippy::large_enum_variant)]
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub enum Bulletproofs {
|
||||||
|
Original(OriginalStruct),
|
||||||
|
Plus(AggregateRangeProof),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Bulletproofs {
|
||||||
|
fn bp_fields(plus: bool) -> usize {
|
||||||
|
if plus {
|
||||||
|
6
|
||||||
|
} else {
|
||||||
|
9
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
|
||||||
|
// src/cryptonote_basic/cryptonote_format_utils.cpp#L106-L124
|
||||||
|
pub(crate) fn calculate_bp_clawback(plus: bool, n_outputs: usize) -> (usize, usize) {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let mut LR_len = 0;
|
||||||
|
let mut n_padded_outputs = 1;
|
||||||
|
while n_padded_outputs < n_outputs {
|
||||||
|
LR_len += 1;
|
||||||
|
n_padded_outputs = 1 << LR_len;
|
||||||
|
}
|
||||||
|
LR_len += LOG_N;
|
||||||
|
|
||||||
|
let mut bp_clawback = 0;
|
||||||
|
if n_padded_outputs > 2 {
|
||||||
|
let fields = Bulletproofs::bp_fields(plus);
|
||||||
|
let base = ((fields + (2 * (LOG_N + 1))) * 32) / 2;
|
||||||
|
let size = (fields + (2 * LR_len)) * 32;
|
||||||
|
bp_clawback = ((base * n_padded_outputs) - size) * 4 / 5;
|
||||||
|
}
|
||||||
|
|
||||||
|
(bp_clawback, LR_len)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn fee_weight(plus: bool, outputs: usize) -> usize {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let (bp_clawback, LR_len) = Bulletproofs::calculate_bp_clawback(plus, outputs);
|
||||||
|
32 * (Bulletproofs::bp_fields(plus) + (2 * LR_len)) + 2 + bp_clawback
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Prove the list of commitments are within [0 .. 2^64).
|
||||||
|
pub fn prove<R: RngCore + CryptoRng>(
|
||||||
|
rng: &mut R,
|
||||||
|
outputs: &[Commitment],
|
||||||
|
plus: bool,
|
||||||
|
) -> Result<Bulletproofs, TransactionError> {
|
||||||
|
if outputs.is_empty() {
|
||||||
|
Err(TransactionError::NoOutputs)?;
|
||||||
|
}
|
||||||
|
if outputs.len() > MAX_OUTPUTS {
|
||||||
|
Err(TransactionError::TooManyOutputs)?;
|
||||||
|
}
|
||||||
|
Ok(if !plus {
|
||||||
|
Bulletproofs::Original(OriginalStruct::prove(rng, outputs))
|
||||||
|
} else {
|
||||||
|
use dalek_ff_group::EdwardsPoint as DfgPoint;
|
||||||
|
Bulletproofs::Plus(
|
||||||
|
AggregateRangeStatement::new(outputs.iter().map(|com| DfgPoint(com.calculate())).collect())
|
||||||
|
.unwrap()
|
||||||
|
.prove(rng, &Zeroizing::new(AggregateRangeWitness::new(outputs.to_vec()).unwrap()))
|
||||||
|
.unwrap(),
|
||||||
|
)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Verify the given Bulletproofs.
|
||||||
|
#[must_use]
|
||||||
|
pub fn verify<R: RngCore + CryptoRng>(&self, rng: &mut R, commitments: &[EdwardsPoint]) -> bool {
|
||||||
|
match self {
|
||||||
|
Bulletproofs::Original(bp) => bp.verify(rng, commitments),
|
||||||
|
Bulletproofs::Plus(bp) => {
|
||||||
|
let mut verifier = BatchVerifier::new(1);
|
||||||
|
// If this commitment is torsioned (which is allowed), this won't be a well-formed
|
||||||
|
// dfg::EdwardsPoint (expected to be of prime-order)
|
||||||
|
// The actual BP+ impl will perform a torsion clear though, making this safe
|
||||||
|
// TODO: Have AggregateRangeStatement take in dalek EdwardsPoint for clarity on this
|
||||||
|
let Some(statement) = AggregateRangeStatement::new(
|
||||||
|
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
|
||||||
|
) else {
|
||||||
|
return false;
|
||||||
|
};
|
||||||
|
if !statement.verify(rng, &mut verifier, (), bp.clone()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
verifier.verify_vartime()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Accumulate the verification for the given Bulletproofs into the specified BatchVerifier.
|
||||||
|
/// Returns false if the Bulletproofs aren't sane, without mutating the BatchVerifier.
|
||||||
|
/// Returns true if the Bulletproofs are sane, regardless of their validity.
|
||||||
|
#[must_use]
|
||||||
|
pub fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<ID, dalek_ff_group::EdwardsPoint>,
|
||||||
|
id: ID,
|
||||||
|
commitments: &[EdwardsPoint],
|
||||||
|
) -> bool {
|
||||||
|
match self {
|
||||||
|
Bulletproofs::Original(bp) => bp.batch_verify(rng, verifier, id, commitments),
|
||||||
|
Bulletproofs::Plus(bp) => {
|
||||||
|
let Some(statement) = AggregateRangeStatement::new(
|
||||||
|
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
|
||||||
|
) else {
|
||||||
|
return false;
|
||||||
|
};
|
||||||
|
statement.verify(rng, verifier, id, bp.clone())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn write_core<W: Write, F: Fn(&[EdwardsPoint], &mut W) -> io::Result<()>>(
|
||||||
|
&self,
|
||||||
|
w: &mut W,
|
||||||
|
specific_write_vec: F,
|
||||||
|
) -> io::Result<()> {
|
||||||
|
match self {
|
||||||
|
Bulletproofs::Original(bp) => {
|
||||||
|
write_point(&bp.A, w)?;
|
||||||
|
write_point(&bp.S, w)?;
|
||||||
|
write_point(&bp.T1, w)?;
|
||||||
|
write_point(&bp.T2, w)?;
|
||||||
|
write_scalar(&bp.taux, w)?;
|
||||||
|
write_scalar(&bp.mu, w)?;
|
||||||
|
specific_write_vec(&bp.L, w)?;
|
||||||
|
specific_write_vec(&bp.R, w)?;
|
||||||
|
write_scalar(&bp.a, w)?;
|
||||||
|
write_scalar(&bp.b, w)?;
|
||||||
|
write_scalar(&bp.t, w)
|
||||||
|
}
|
||||||
|
|
||||||
|
Bulletproofs::Plus(bp) => {
|
||||||
|
write_point(&bp.A.0, w)?;
|
||||||
|
write_point(&bp.wip.A.0, w)?;
|
||||||
|
write_point(&bp.wip.B.0, w)?;
|
||||||
|
write_scalar(&bp.wip.r_answer.0, w)?;
|
||||||
|
write_scalar(&bp.wip.s_answer.0, w)?;
|
||||||
|
write_scalar(&bp.wip.delta_answer.0, w)?;
|
||||||
|
specific_write_vec(&bp.wip.L.iter().copied().map(|L| L.0).collect::<Vec<_>>(), w)?;
|
||||||
|
specific_write_vec(&bp.wip.R.iter().copied().map(|R| R.0).collect::<Vec<_>>(), w)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn signature_write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
self.write_core(w, |points, w| write_raw_vec(write_point, points, w))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
self.write_core(w, |points, w| write_vec(write_point, points, w))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn serialize(&self) -> Vec<u8> {
|
||||||
|
let mut serialized = vec![];
|
||||||
|
self.write(&mut serialized).unwrap();
|
||||||
|
serialized
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Read Bulletproofs.
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
|
||||||
|
Ok(Bulletproofs::Original(OriginalStruct {
|
||||||
|
A: read_point(r)?,
|
||||||
|
S: read_point(r)?,
|
||||||
|
T1: read_point(r)?,
|
||||||
|
T2: read_point(r)?,
|
||||||
|
taux: read_scalar(r)?,
|
||||||
|
mu: read_scalar(r)?,
|
||||||
|
L: read_vec(read_point, r)?,
|
||||||
|
R: read_vec(read_point, r)?,
|
||||||
|
a: read_scalar(r)?,
|
||||||
|
b: read_scalar(r)?,
|
||||||
|
t: read_scalar(r)?,
|
||||||
|
}))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Read Bulletproofs+.
|
||||||
|
pub fn read_plus<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
|
||||||
|
use dalek_ff_group::{Scalar as DfgScalar, EdwardsPoint as DfgPoint};
|
||||||
|
|
||||||
|
Ok(Bulletproofs::Plus(AggregateRangeProof {
|
||||||
|
A: DfgPoint(read_point(r)?),
|
||||||
|
wip: WipProof {
|
||||||
|
A: DfgPoint(read_point(r)?),
|
||||||
|
B: DfgPoint(read_point(r)?),
|
||||||
|
r_answer: DfgScalar(read_scalar(r)?),
|
||||||
|
s_answer: DfgScalar(read_scalar(r)?),
|
||||||
|
delta_answer: DfgScalar(read_scalar(r)?),
|
||||||
|
L: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
|
||||||
|
R: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
|
||||||
|
},
|
||||||
|
}))
|
||||||
|
}
|
||||||
|
}
|
||||||
322
coins/monero/src/ringct/bulletproofs/original.rs
Normal file
322
coins/monero/src/ringct/bulletproofs/original.rs
Normal file
@@ -0,0 +1,322 @@
|
|||||||
|
use std_shims::{vec::Vec, sync::OnceLock};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::Zeroize;
|
||||||
|
|
||||||
|
use curve25519_dalek::{scalar::Scalar as DalekScalar, edwards::EdwardsPoint as DalekPoint};
|
||||||
|
|
||||||
|
use group::{ff::Field, Group};
|
||||||
|
use dalek_ff_group::{ED25519_BASEPOINT_POINT as G, Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use multiexp::{BatchVerifier, multiexp};
|
||||||
|
|
||||||
|
use crate::{Commitment, ringct::bulletproofs::core::*};
|
||||||
|
|
||||||
|
include!(concat!(env!("OUT_DIR"), "/generators.rs"));
|
||||||
|
|
||||||
|
static IP12_CELL: OnceLock<Scalar> = OnceLock::new();
|
||||||
|
pub(crate) fn IP12() -> Scalar {
|
||||||
|
*IP12_CELL.get_or_init(|| ScalarVector(vec![Scalar::ONE; N]).inner_product(TWO_N()))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hadamard_fold(
|
||||||
|
l: &[EdwardsPoint],
|
||||||
|
r: &[EdwardsPoint],
|
||||||
|
a: Scalar,
|
||||||
|
b: Scalar,
|
||||||
|
) -> Vec<EdwardsPoint> {
|
||||||
|
let mut res = Vec::with_capacity(l.len() / 2);
|
||||||
|
for i in 0 .. l.len() {
|
||||||
|
res.push(multiexp(&[(a, l[i]), (b, r[i])]));
|
||||||
|
}
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct OriginalStruct {
|
||||||
|
pub(crate) A: DalekPoint,
|
||||||
|
pub(crate) S: DalekPoint,
|
||||||
|
pub(crate) T1: DalekPoint,
|
||||||
|
pub(crate) T2: DalekPoint,
|
||||||
|
pub(crate) taux: DalekScalar,
|
||||||
|
pub(crate) mu: DalekScalar,
|
||||||
|
pub(crate) L: Vec<DalekPoint>,
|
||||||
|
pub(crate) R: Vec<DalekPoint>,
|
||||||
|
pub(crate) a: DalekScalar,
|
||||||
|
pub(crate) b: DalekScalar,
|
||||||
|
pub(crate) t: DalekScalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl OriginalStruct {
|
||||||
|
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||||
|
rng: &mut R,
|
||||||
|
commitments: &[Commitment],
|
||||||
|
) -> OriginalStruct {
|
||||||
|
let (logMN, M, MN) = MN(commitments.len());
|
||||||
|
|
||||||
|
let (aL, aR) = bit_decompose(commitments);
|
||||||
|
let commitments_points = commitments.iter().map(Commitment::calculate).collect::<Vec<_>>();
|
||||||
|
let (mut cache, _) = hash_commitments(commitments_points.clone());
|
||||||
|
|
||||||
|
let (sL, sR) =
|
||||||
|
ScalarVector((0 .. (MN * 2)).map(|_| Scalar::random(&mut *rng)).collect::<Vec<_>>()).split();
|
||||||
|
|
||||||
|
let generators = GENERATORS();
|
||||||
|
let (mut alpha, A) = alpha_rho(&mut *rng, generators, &aL, &aR);
|
||||||
|
let (mut rho, S) = alpha_rho(&mut *rng, generators, &sL, &sR);
|
||||||
|
|
||||||
|
let y = hash_cache(&mut cache, &[A.compress().to_bytes(), S.compress().to_bytes()]);
|
||||||
|
let mut cache = hash_to_scalar(&y.to_bytes());
|
||||||
|
let z = cache;
|
||||||
|
|
||||||
|
let l0 = aL - z;
|
||||||
|
let l1 = sL;
|
||||||
|
|
||||||
|
let mut zero_twos = Vec::with_capacity(MN);
|
||||||
|
let zpow = ScalarVector::powers(z, M + 2);
|
||||||
|
for j in 0 .. M {
|
||||||
|
for i in 0 .. N {
|
||||||
|
zero_twos.push(zpow[j + 2] * TWO_N()[i]);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let yMN = ScalarVector::powers(y, MN);
|
||||||
|
let r0 = ((aR + z) * &yMN) + &ScalarVector(zero_twos);
|
||||||
|
let r1 = yMN * &sR;
|
||||||
|
|
||||||
|
let (T1, T2, x, mut taux) = {
|
||||||
|
let t1 = l0.clone().inner_product(&r1) + r0.clone().inner_product(&l1);
|
||||||
|
let t2 = l1.clone().inner_product(&r1);
|
||||||
|
|
||||||
|
let mut tau1 = Scalar::random(&mut *rng);
|
||||||
|
let mut tau2 = Scalar::random(&mut *rng);
|
||||||
|
|
||||||
|
let T1 = prove_multiexp(&[(t1, H()), (tau1, EdwardsPoint::generator())]);
|
||||||
|
let T2 = prove_multiexp(&[(t2, H()), (tau2, EdwardsPoint::generator())]);
|
||||||
|
|
||||||
|
let x =
|
||||||
|
hash_cache(&mut cache, &[z.to_bytes(), T1.compress().to_bytes(), T2.compress().to_bytes()]);
|
||||||
|
|
||||||
|
let taux = (tau2 * (x * x)) + (tau1 * x);
|
||||||
|
|
||||||
|
tau1.zeroize();
|
||||||
|
tau2.zeroize();
|
||||||
|
(T1, T2, x, taux)
|
||||||
|
};
|
||||||
|
|
||||||
|
let mu = (x * rho) + alpha;
|
||||||
|
alpha.zeroize();
|
||||||
|
rho.zeroize();
|
||||||
|
|
||||||
|
for (i, gamma) in commitments.iter().map(|c| Scalar(c.mask)).enumerate() {
|
||||||
|
taux += zpow[i + 2] * gamma;
|
||||||
|
}
|
||||||
|
|
||||||
|
let l = l0 + &(l1 * x);
|
||||||
|
let r = r0 + &(r1 * x);
|
||||||
|
|
||||||
|
let t = l.clone().inner_product(&r);
|
||||||
|
|
||||||
|
let x_ip =
|
||||||
|
hash_cache(&mut cache, &[x.to_bytes(), taux.to_bytes(), mu.to_bytes(), t.to_bytes()]);
|
||||||
|
|
||||||
|
let mut a = l;
|
||||||
|
let mut b = r;
|
||||||
|
|
||||||
|
let yinv = y.invert().unwrap();
|
||||||
|
let yinvpow = ScalarVector::powers(yinv, MN);
|
||||||
|
|
||||||
|
let mut G_proof = generators.G[.. a.len()].to_vec();
|
||||||
|
let mut H_proof = generators.H[.. a.len()].to_vec();
|
||||||
|
H_proof.iter_mut().zip(yinvpow.0.iter()).for_each(|(this_H, yinvpow)| *this_H *= yinvpow);
|
||||||
|
let U = H() * x_ip;
|
||||||
|
|
||||||
|
let mut L = Vec::with_capacity(logMN);
|
||||||
|
let mut R = Vec::with_capacity(logMN);
|
||||||
|
|
||||||
|
while a.len() != 1 {
|
||||||
|
let (aL, aR) = a.split();
|
||||||
|
let (bL, bR) = b.split();
|
||||||
|
|
||||||
|
let cL = aL.clone().inner_product(&bR);
|
||||||
|
let cR = aR.clone().inner_product(&bL);
|
||||||
|
|
||||||
|
let (G_L, G_R) = G_proof.split_at(aL.len());
|
||||||
|
let (H_L, H_R) = H_proof.split_at(aL.len());
|
||||||
|
|
||||||
|
let L_i = prove_multiexp(&LR_statements(&aL, G_R, &bR, H_L, cL, U));
|
||||||
|
let R_i = prove_multiexp(&LR_statements(&aR, G_L, &bL, H_R, cR, U));
|
||||||
|
L.push(L_i);
|
||||||
|
R.push(R_i);
|
||||||
|
|
||||||
|
let w = hash_cache(&mut cache, &[L_i.compress().to_bytes(), R_i.compress().to_bytes()]);
|
||||||
|
let winv = w.invert().unwrap();
|
||||||
|
|
||||||
|
a = (aL * w) + &(aR * winv);
|
||||||
|
b = (bL * winv) + &(bR * w);
|
||||||
|
|
||||||
|
if a.len() != 1 {
|
||||||
|
G_proof = hadamard_fold(G_L, G_R, winv, w);
|
||||||
|
H_proof = hadamard_fold(H_L, H_R, w, winv);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let res = OriginalStruct {
|
||||||
|
A: *A,
|
||||||
|
S: *S,
|
||||||
|
T1: *T1,
|
||||||
|
T2: *T2,
|
||||||
|
taux: *taux,
|
||||||
|
mu: *mu,
|
||||||
|
L: L.drain(..).map(|L| *L).collect(),
|
||||||
|
R: R.drain(..).map(|R| *R).collect(),
|
||||||
|
a: *a[0],
|
||||||
|
b: *b[0],
|
||||||
|
t: *t,
|
||||||
|
};
|
||||||
|
debug_assert!(res.verify(rng, &commitments_points));
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
fn verify_core<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
|
||||||
|
id: ID,
|
||||||
|
commitments: &[DalekPoint],
|
||||||
|
) -> bool {
|
||||||
|
// Verify commitments are valid
|
||||||
|
if commitments.is_empty() || (commitments.len() > MAX_M) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Verify L and R are properly sized
|
||||||
|
if self.L.len() != self.R.len() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
let (logMN, M, MN) = MN(commitments.len());
|
||||||
|
if self.L.len() != logMN {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Rebuild all challenges
|
||||||
|
let (mut cache, commitments) = hash_commitments(commitments.iter().copied());
|
||||||
|
let y = hash_cache(&mut cache, &[self.A.compress().to_bytes(), self.S.compress().to_bytes()]);
|
||||||
|
|
||||||
|
let z = hash_to_scalar(&y.to_bytes());
|
||||||
|
cache = z;
|
||||||
|
|
||||||
|
let x = hash_cache(
|
||||||
|
&mut cache,
|
||||||
|
&[z.to_bytes(), self.T1.compress().to_bytes(), self.T2.compress().to_bytes()],
|
||||||
|
);
|
||||||
|
|
||||||
|
let x_ip = hash_cache(
|
||||||
|
&mut cache,
|
||||||
|
&[x.to_bytes(), self.taux.to_bytes(), self.mu.to_bytes(), self.t.to_bytes()],
|
||||||
|
);
|
||||||
|
|
||||||
|
let mut w = Vec::with_capacity(logMN);
|
||||||
|
let mut winv = Vec::with_capacity(logMN);
|
||||||
|
for (L, R) in self.L.iter().zip(&self.R) {
|
||||||
|
w.push(hash_cache(&mut cache, &[L.compress().to_bytes(), R.compress().to_bytes()]));
|
||||||
|
winv.push(cache.invert().unwrap());
|
||||||
|
}
|
||||||
|
|
||||||
|
// Convert the proof from * INV_EIGHT to its actual form
|
||||||
|
let normalize = |point: &DalekPoint| EdwardsPoint(point.mul_by_cofactor());
|
||||||
|
|
||||||
|
let L = self.L.iter().map(normalize).collect::<Vec<_>>();
|
||||||
|
let R = self.R.iter().map(normalize).collect::<Vec<_>>();
|
||||||
|
let T1 = normalize(&self.T1);
|
||||||
|
let T2 = normalize(&self.T2);
|
||||||
|
let A = normalize(&self.A);
|
||||||
|
let S = normalize(&self.S);
|
||||||
|
|
||||||
|
let commitments = commitments.iter().map(EdwardsPoint::mul_by_cofactor).collect::<Vec<_>>();
|
||||||
|
|
||||||
|
// Verify it
|
||||||
|
let mut proof = Vec::with_capacity(4 + commitments.len());
|
||||||
|
|
||||||
|
let zpow = ScalarVector::powers(z, M + 3);
|
||||||
|
let ip1y = ScalarVector::powers(y, M * N).sum();
|
||||||
|
let mut k = -(zpow[2] * ip1y);
|
||||||
|
for j in 1 ..= M {
|
||||||
|
k -= zpow[j + 2] * IP12();
|
||||||
|
}
|
||||||
|
let y1 = Scalar(self.t) - ((z * ip1y) + k);
|
||||||
|
proof.push((-y1, H()));
|
||||||
|
|
||||||
|
proof.push((-Scalar(self.taux), G));
|
||||||
|
|
||||||
|
for (j, commitment) in commitments.iter().enumerate() {
|
||||||
|
proof.push((zpow[j + 2], *commitment));
|
||||||
|
}
|
||||||
|
|
||||||
|
proof.push((x, T1));
|
||||||
|
proof.push((x * x, T2));
|
||||||
|
verifier.queue(&mut *rng, id, proof);
|
||||||
|
|
||||||
|
proof = Vec::with_capacity(4 + (2 * (MN + logMN)));
|
||||||
|
let z3 = (Scalar(self.t) - (Scalar(self.a) * Scalar(self.b))) * x_ip;
|
||||||
|
proof.push((z3, H()));
|
||||||
|
proof.push((-Scalar(self.mu), G));
|
||||||
|
|
||||||
|
proof.push((Scalar::ONE, A));
|
||||||
|
proof.push((x, S));
|
||||||
|
|
||||||
|
{
|
||||||
|
let ypow = ScalarVector::powers(y, MN);
|
||||||
|
let yinv = y.invert().unwrap();
|
||||||
|
let yinvpow = ScalarVector::powers(yinv, MN);
|
||||||
|
|
||||||
|
let w_cache = challenge_products(&w, &winv);
|
||||||
|
|
||||||
|
let generators = GENERATORS();
|
||||||
|
for i in 0 .. MN {
|
||||||
|
let g = (Scalar(self.a) * w_cache[i]) + z;
|
||||||
|
proof.push((-g, generators.G[i]));
|
||||||
|
|
||||||
|
let mut h = Scalar(self.b) * yinvpow[i] * w_cache[(!i) & (MN - 1)];
|
||||||
|
h -= ((zpow[(i / N) + 2] * TWO_N()[i % N]) + (z * ypow[i])) * yinvpow[i];
|
||||||
|
proof.push((-h, generators.H[i]));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for i in 0 .. logMN {
|
||||||
|
proof.push((w[i] * w[i], L[i]));
|
||||||
|
proof.push((winv[i] * winv[i], R[i]));
|
||||||
|
}
|
||||||
|
verifier.queue(rng, id, proof);
|
||||||
|
|
||||||
|
true
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
pub(crate) fn verify<R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
commitments: &[DalekPoint],
|
||||||
|
) -> bool {
|
||||||
|
let mut verifier = BatchVerifier::new(1);
|
||||||
|
if self.verify_core(rng, &mut verifier, (), commitments) {
|
||||||
|
verifier.verify_vartime()
|
||||||
|
} else {
|
||||||
|
false
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
pub(crate) fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
|
||||||
|
id: ID,
|
||||||
|
commitments: &[DalekPoint],
|
||||||
|
) -> bool {
|
||||||
|
self.verify_core(rng, verifier, id, commitments)
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,28 +1,40 @@
|
|||||||
use std_shims::{vec, vec::Vec};
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
use rand_core::{RngCore, CryptoRng};
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
|
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
|
||||||
|
|
||||||
use curve25519_dalek::{traits::Identity, scalar::Scalar, edwards::EdwardsPoint};
|
use multiexp::{multiexp, multiexp_vartime, BatchVerifier};
|
||||||
|
use group::{
|
||||||
use monero_primitives::{INV_EIGHT, Commitment, keccak256_to_scalar};
|
ff::{Field, PrimeField},
|
||||||
|
Group, GroupEncoding,
|
||||||
|
};
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
use crate::{
|
use crate::{
|
||||||
batch_verifier::BulletproofsPlusBatchVerifier,
|
Commitment,
|
||||||
core::{MAX_COMMITMENTS, COMMITMENT_BITS, multiexp, multiexp_vartime},
|
ringct::{
|
||||||
plus::{
|
bulletproofs::core::{MAX_M, N},
|
||||||
ScalarVector, PointVector, GeneratorsList, BpPlusGenerators,
|
bulletproofs::plus::{
|
||||||
|
ScalarVector, PointVector, GeneratorsList, Generators,
|
||||||
transcript::*,
|
transcript::*,
|
||||||
weighted_inner_product::{WipStatement, WipWitness, WipProof},
|
weighted_inner_product::{WipStatement, WipWitness, WipProof},
|
||||||
padded_pow_of_2, u64_decompose,
|
padded_pow_of_2, u64_decompose,
|
||||||
},
|
},
|
||||||
|
},
|
||||||
};
|
};
|
||||||
|
|
||||||
// Figure 3 of the Bulletproofs+ Paper
|
// Figure 3 of the Bulletproofs+ Paper
|
||||||
#[derive(Clone, Debug)]
|
#[derive(Clone, Debug)]
|
||||||
pub(crate) struct AggregateRangeStatement<'a> {
|
pub(crate) struct AggregateRangeStatement {
|
||||||
generators: BpPlusGenerators,
|
generators: Generators,
|
||||||
V: &'a [EdwardsPoint],
|
V: Vec<EdwardsPoint>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Zeroize for AggregateRangeStatement {
|
||||||
|
fn zeroize(&mut self) {
|
||||||
|
self.V.zeroize();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
@@ -30,7 +42,7 @@ pub(crate) struct AggregateRangeWitness(Vec<Commitment>);
|
|||||||
|
|
||||||
impl AggregateRangeWitness {
|
impl AggregateRangeWitness {
|
||||||
pub(crate) fn new(commitments: Vec<Commitment>) -> Option<Self> {
|
pub(crate) fn new(commitments: Vec<Commitment>) -> Option<Self> {
|
||||||
if commitments.is_empty() || (commitments.len() > MAX_COMMITMENTS) {
|
if commitments.is_empty() || (commitments.len() > MAX_M) {
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -38,48 +50,35 @@ impl AggregateRangeWitness {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Internal structure representing a Bulletproof+, as defined by Monero..
|
|
||||||
#[doc(hidden)]
|
|
||||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||||
pub struct AggregateRangeProof {
|
pub struct AggregateRangeProof {
|
||||||
pub(crate) A: EdwardsPoint,
|
pub(crate) A: EdwardsPoint,
|
||||||
pub(crate) wip: WipProof,
|
pub(crate) wip: WipProof,
|
||||||
}
|
}
|
||||||
|
|
||||||
struct AHatComputation {
|
impl AggregateRangeStatement {
|
||||||
y: Scalar,
|
pub(crate) fn new(V: Vec<EdwardsPoint>) -> Option<Self> {
|
||||||
d_descending_y_plus_z: ScalarVector,
|
if V.is_empty() || (V.len() > MAX_M) {
|
||||||
y_mn_plus_one: Scalar,
|
|
||||||
z: Scalar,
|
|
||||||
z_pow: ScalarVector,
|
|
||||||
A_hat: EdwardsPoint,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl<'a> AggregateRangeStatement<'a> {
|
|
||||||
pub(crate) fn new(V: &'a [EdwardsPoint]) -> Option<Self> {
|
|
||||||
if V.is_empty() || (V.len() > MAX_COMMITMENTS) {
|
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
Some(Self { generators: BpPlusGenerators::new(), V })
|
Some(Self { generators: Generators::new(), V })
|
||||||
}
|
}
|
||||||
|
|
||||||
fn transcript_A(transcript: &mut Scalar, A: EdwardsPoint) -> (Scalar, Scalar) {
|
fn transcript_A(transcript: &mut Scalar, A: EdwardsPoint) -> (Scalar, Scalar) {
|
||||||
let y = keccak256_to_scalar(
|
let y = hash_to_scalar(&[transcript.to_repr().as_ref(), A.to_bytes().as_ref()].concat());
|
||||||
[transcript.to_bytes().as_ref(), A.compress().to_bytes().as_ref()].concat(),
|
let z = hash_to_scalar(y.to_bytes().as_ref());
|
||||||
);
|
|
||||||
let z = keccak256_to_scalar(y.to_bytes().as_ref());
|
|
||||||
*transcript = z;
|
*transcript = z;
|
||||||
(y, z)
|
(y, z)
|
||||||
}
|
}
|
||||||
|
|
||||||
fn d_j(j: usize, m: usize) -> ScalarVector {
|
fn d_j(j: usize, m: usize) -> ScalarVector {
|
||||||
let mut d_j = Vec::with_capacity(m * COMMITMENT_BITS);
|
let mut d_j = Vec::with_capacity(m * N);
|
||||||
for _ in 0 .. (j - 1) * COMMITMENT_BITS {
|
for _ in 0 .. (j - 1) * N {
|
||||||
d_j.push(Scalar::ZERO);
|
d_j.push(Scalar::ZERO);
|
||||||
}
|
}
|
||||||
d_j.append(&mut ScalarVector::powers(Scalar::from(2u8), COMMITMENT_BITS).0);
|
d_j.append(&mut ScalarVector::powers(Scalar::from(2u8), N).0);
|
||||||
for _ in 0 .. (m - j) * COMMITMENT_BITS {
|
for _ in 0 .. (m - j) * N {
|
||||||
d_j.push(Scalar::ZERO);
|
d_j.push(Scalar::ZERO);
|
||||||
}
|
}
|
||||||
ScalarVector(d_j)
|
ScalarVector(d_j)
|
||||||
@@ -87,26 +86,23 @@ impl<'a> AggregateRangeStatement<'a> {
|
|||||||
|
|
||||||
fn compute_A_hat(
|
fn compute_A_hat(
|
||||||
mut V: PointVector,
|
mut V: PointVector,
|
||||||
generators: &BpPlusGenerators,
|
generators: &Generators,
|
||||||
transcript: &mut Scalar,
|
transcript: &mut Scalar,
|
||||||
mut A: EdwardsPoint,
|
mut A: EdwardsPoint,
|
||||||
) -> AHatComputation {
|
) -> (Scalar, ScalarVector, Scalar, Scalar, ScalarVector, EdwardsPoint) {
|
||||||
let (y, z) = Self::transcript_A(transcript, A);
|
let (y, z) = Self::transcript_A(transcript, A);
|
||||||
A = A.mul_by_cofactor();
|
A = A.mul_by_cofactor();
|
||||||
|
|
||||||
while V.len() < padded_pow_of_2(V.len()) {
|
while V.len() < padded_pow_of_2(V.len()) {
|
||||||
V.0.push(EdwardsPoint::identity());
|
V.0.push(EdwardsPoint::identity());
|
||||||
}
|
}
|
||||||
let mn = V.len() * COMMITMENT_BITS;
|
let mn = V.len() * N;
|
||||||
|
|
||||||
// 2, 4, 6, 8... powers of z, of length equivalent to the amount of commitments
|
|
||||||
let mut z_pow = Vec::with_capacity(V.len());
|
let mut z_pow = Vec::with_capacity(V.len());
|
||||||
// z**2
|
|
||||||
z_pow.push(z * z);
|
|
||||||
|
|
||||||
let mut d = ScalarVector::new(mn);
|
let mut d = ScalarVector::new(mn);
|
||||||
for j in 1 ..= V.len() {
|
for j in 1 ..= V.len() {
|
||||||
z_pow.push(*z_pow.last().unwrap() * z_pow[0]);
|
z_pow.push(z.pow(Scalar::from(2 * u64::try_from(j).unwrap()))); // TODO: Optimize this
|
||||||
d = d + &(Self::d_j(j, V.len()) * (z_pow[j - 1]));
|
d = d + &(Self::d_j(j, V.len()) * (z_pow[j - 1]));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -132,23 +128,23 @@ impl<'a> AggregateRangeStatement<'a> {
|
|||||||
let neg_z = -z;
|
let neg_z = -z;
|
||||||
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 2);
|
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 2);
|
||||||
for (i, d_y_z) in d_descending_y_plus_z.0.iter().enumerate() {
|
for (i, d_y_z) in d_descending_y_plus_z.0.iter().enumerate() {
|
||||||
A_terms.push((neg_z, generators.generator(GeneratorsList::GBold, i)));
|
A_terms.push((neg_z, generators.generator(GeneratorsList::GBold1, i)));
|
||||||
A_terms.push((*d_y_z, generators.generator(GeneratorsList::HBold, i)));
|
A_terms.push((*d_y_z, generators.generator(GeneratorsList::HBold1, i)));
|
||||||
}
|
}
|
||||||
A_terms.push((y_mn_plus_one, commitment_accum));
|
A_terms.push((y_mn_plus_one, commitment_accum));
|
||||||
A_terms.push((
|
A_terms.push((
|
||||||
((y_pows * z) - (d.sum() * y_mn_plus_one * z) - (y_pows * (z * z))),
|
((y_pows * z) - (d.sum() * y_mn_plus_one * z) - (y_pows * z.square())),
|
||||||
BpPlusGenerators::g(),
|
Generators::g(),
|
||||||
));
|
));
|
||||||
|
|
||||||
AHatComputation {
|
(
|
||||||
y,
|
y,
|
||||||
d_descending_y_plus_z,
|
d_descending_y_plus_z,
|
||||||
y_mn_plus_one,
|
y_mn_plus_one,
|
||||||
z,
|
z,
|
||||||
z_pow: ScalarVector(z_pow),
|
ScalarVector(z_pow),
|
||||||
A_hat: A + multiexp_vartime(&A_terms),
|
A + multiexp_vartime(&A_terms),
|
||||||
}
|
)
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||||
@@ -161,7 +157,7 @@ impl<'a> AggregateRangeStatement<'a> {
|
|||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
for (commitment, witness) in self.V.iter().zip(witness.0.iter()) {
|
for (commitment, witness) in self.V.iter().zip(witness.0.iter()) {
|
||||||
if witness.calculate() != *commitment {
|
if witness.calculate() != **commitment {
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -174,19 +170,19 @@ impl<'a> AggregateRangeStatement<'a> {
|
|||||||
// Commitments aren't transmitted INV_EIGHT though, so this multiplies by INV_EIGHT to enable
|
// Commitments aren't transmitted INV_EIGHT though, so this multiplies by INV_EIGHT to enable
|
||||||
// clearing its cofactor without mutating the value
|
// clearing its cofactor without mutating the value
|
||||||
// For some reason, these values are transcripted * INV_EIGHT, not as transmitted
|
// For some reason, these values are transcripted * INV_EIGHT, not as transmitted
|
||||||
let V = V.iter().map(|V| V * INV_EIGHT()).collect::<Vec<_>>();
|
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
|
||||||
let mut transcript = initial_transcript(V.iter());
|
let mut transcript = initial_transcript(V.iter());
|
||||||
let mut V = V.iter().map(EdwardsPoint::mul_by_cofactor).collect::<Vec<_>>();
|
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
|
||||||
|
|
||||||
// Pad V
|
// Pad V
|
||||||
while V.len() < padded_pow_of_2(V.len()) {
|
while V.len() < padded_pow_of_2(V.len()) {
|
||||||
V.push(EdwardsPoint::identity());
|
V.push(EdwardsPoint::identity());
|
||||||
}
|
}
|
||||||
|
|
||||||
let generators = generators.reduce(V.len() * COMMITMENT_BITS);
|
let generators = generators.reduce(V.len() * N);
|
||||||
|
|
||||||
let mut d_js = Vec::with_capacity(V.len());
|
let mut d_js = Vec::with_capacity(V.len());
|
||||||
let mut a_l = ScalarVector(Vec::with_capacity(V.len() * COMMITMENT_BITS));
|
let mut a_l = ScalarVector(Vec::with_capacity(V.len() * N));
|
||||||
for j in 1 ..= V.len() {
|
for j in 1 ..= V.len() {
|
||||||
d_js.push(Self::d_j(j, V.len()));
|
d_js.push(Self::d_j(j, V.len()));
|
||||||
#[allow(clippy::map_unwrap_or)]
|
#[allow(clippy::map_unwrap_or)]
|
||||||
@@ -204,26 +200,26 @@ impl<'a> AggregateRangeStatement<'a> {
|
|||||||
|
|
||||||
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 1);
|
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 1);
|
||||||
for (i, a_l) in a_l.0.iter().enumerate() {
|
for (i, a_l) in a_l.0.iter().enumerate() {
|
||||||
A_terms.push((*a_l, generators.generator(GeneratorsList::GBold, i)));
|
A_terms.push((*a_l, generators.generator(GeneratorsList::GBold1, i)));
|
||||||
}
|
}
|
||||||
for (i, a_r) in a_r.0.iter().enumerate() {
|
for (i, a_r) in a_r.0.iter().enumerate() {
|
||||||
A_terms.push((*a_r, generators.generator(GeneratorsList::HBold, i)));
|
A_terms.push((*a_r, generators.generator(GeneratorsList::HBold1, i)));
|
||||||
}
|
}
|
||||||
A_terms.push((alpha, BpPlusGenerators::h()));
|
A_terms.push((alpha, Generators::h()));
|
||||||
let mut A = multiexp(&A_terms);
|
let mut A = multiexp(&A_terms);
|
||||||
A_terms.zeroize();
|
A_terms.zeroize();
|
||||||
|
|
||||||
// Multiply by INV_EIGHT per earlier commentary
|
// Multiply by INV_EIGHT per earlier commentary
|
||||||
A *= INV_EIGHT();
|
A.0 *= crate::INV_EIGHT();
|
||||||
|
|
||||||
let AHatComputation { y, d_descending_y_plus_z, y_mn_plus_one, z, z_pow, A_hat } =
|
let (y, d_descending_y_plus_z, y_mn_plus_one, z, z_pow, A_hat) =
|
||||||
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, A);
|
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, A);
|
||||||
|
|
||||||
let a_l = a_l - z;
|
let a_l = a_l - z;
|
||||||
let a_r = a_r + &d_descending_y_plus_z;
|
let a_r = a_r + &d_descending_y_plus_z;
|
||||||
let mut alpha = alpha;
|
let mut alpha = alpha;
|
||||||
for j in 1 ..= witness.0.len() {
|
for j in 1 ..= witness.0.len() {
|
||||||
alpha += z_pow[j - 1] * witness.0[j - 1].mask * y_mn_plus_one;
|
alpha += z_pow[j - 1] * Scalar(witness.0[j - 1].mask) * y_mn_plus_one;
|
||||||
}
|
}
|
||||||
|
|
||||||
Some(AggregateRangeProof {
|
Some(AggregateRangeProof {
|
||||||
@@ -234,22 +230,23 @@ impl<'a> AggregateRangeStatement<'a> {
|
|||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn verify<R: RngCore + CryptoRng>(
|
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
self,
|
self,
|
||||||
rng: &mut R,
|
rng: &mut R,
|
||||||
verifier: &mut BulletproofsPlusBatchVerifier,
|
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
|
||||||
|
id: Id,
|
||||||
proof: AggregateRangeProof,
|
proof: AggregateRangeProof,
|
||||||
) -> bool {
|
) -> bool {
|
||||||
let Self { generators, V } = self;
|
let Self { generators, V } = self;
|
||||||
|
|
||||||
let V = V.iter().map(|V| V * INV_EIGHT()).collect::<Vec<_>>();
|
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
|
||||||
let mut transcript = initial_transcript(V.iter());
|
let mut transcript = initial_transcript(V.iter());
|
||||||
let V = V.iter().map(EdwardsPoint::mul_by_cofactor).collect::<Vec<_>>();
|
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
|
||||||
|
|
||||||
let generators = generators.reduce(V.len() * COMMITMENT_BITS);
|
let generators = generators.reduce(V.len() * N);
|
||||||
|
|
||||||
let AHatComputation { y, A_hat, .. } =
|
let (y, _, _, _, _, A_hat) =
|
||||||
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, proof.A);
|
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, proof.A);
|
||||||
WipStatement::new(generators, A_hat, y).verify(rng, verifier, transcript, proof.wip)
|
WipStatement::new(generators, A_hat, y).verify(rng, verifier, id, transcript, proof.wip)
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -1,12 +1,11 @@
|
|||||||
#![allow(non_snake_case)]
|
#![allow(non_snake_case)]
|
||||||
|
|
||||||
use std_shims::sync::LazyLock;
|
use group::Group;
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
use curve25519_dalek::{constants::ED25519_BASEPOINT_POINT, scalar::Scalar, edwards::EdwardsPoint};
|
pub(crate) use crate::ringct::bulletproofs::scalar_vector::ScalarVector;
|
||||||
|
mod point_vector;
|
||||||
use monero_generators::{H, Generators};
|
pub(crate) use point_vector::PointVector;
|
||||||
|
|
||||||
pub(crate) use crate::{scalar_vector::ScalarVector, point_vector::PointVector};
|
|
||||||
|
|
||||||
pub(crate) mod transcript;
|
pub(crate) mod transcript;
|
||||||
pub(crate) mod weighted_inner_product;
|
pub(crate) mod weighted_inner_product;
|
||||||
@@ -24,50 +23,55 @@ pub(crate) fn padded_pow_of_2(i: usize) -> usize {
|
|||||||
|
|
||||||
#[derive(Clone, Copy, PartialEq, Eq, Hash, Debug)]
|
#[derive(Clone, Copy, PartialEq, Eq, Hash, Debug)]
|
||||||
pub(crate) enum GeneratorsList {
|
pub(crate) enum GeneratorsList {
|
||||||
GBold,
|
GBold1,
|
||||||
HBold,
|
HBold1,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// TODO: Table these
|
||||||
#[derive(Clone, Debug)]
|
#[derive(Clone, Debug)]
|
||||||
pub(crate) struct BpPlusGenerators {
|
pub(crate) struct Generators {
|
||||||
g_bold: &'static [EdwardsPoint],
|
g_bold1: &'static [EdwardsPoint],
|
||||||
h_bold: &'static [EdwardsPoint],
|
h_bold1: &'static [EdwardsPoint],
|
||||||
}
|
}
|
||||||
|
|
||||||
include!(concat!(env!("OUT_DIR"), "/generators_plus.rs"));
|
mod generators {
|
||||||
|
use std_shims::sync::OnceLock;
|
||||||
|
use monero_generators::Generators;
|
||||||
|
include!(concat!(env!("OUT_DIR"), "/generators_plus.rs"));
|
||||||
|
}
|
||||||
|
|
||||||
impl BpPlusGenerators {
|
impl Generators {
|
||||||
#[allow(clippy::new_without_default)]
|
#[allow(clippy::new_without_default)]
|
||||||
pub(crate) fn new() -> Self {
|
pub(crate) fn new() -> Self {
|
||||||
let gens = &GENERATORS;
|
let gens = generators::GENERATORS();
|
||||||
BpPlusGenerators { g_bold: &gens.G, h_bold: &gens.H }
|
Generators { g_bold1: &gens.G, h_bold1: &gens.H }
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn len(&self) -> usize {
|
pub(crate) fn len(&self) -> usize {
|
||||||
self.g_bold.len()
|
self.g_bold1.len()
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn g() -> EdwardsPoint {
|
pub(crate) fn g() -> EdwardsPoint {
|
||||||
*H
|
dalek_ff_group::EdwardsPoint(crate::H())
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn h() -> EdwardsPoint {
|
pub(crate) fn h() -> EdwardsPoint {
|
||||||
ED25519_BASEPOINT_POINT
|
EdwardsPoint::generator()
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn generator(&self, list: GeneratorsList, i: usize) -> EdwardsPoint {
|
pub(crate) fn generator(&self, list: GeneratorsList, i: usize) -> EdwardsPoint {
|
||||||
match list {
|
match list {
|
||||||
GeneratorsList::GBold => self.g_bold[i],
|
GeneratorsList::GBold1 => self.g_bold1[i],
|
||||||
GeneratorsList::HBold => self.h_bold[i],
|
GeneratorsList::HBold1 => self.h_bold1[i],
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn reduce(&self, generators: usize) -> Self {
|
pub(crate) fn reduce(&self, generators: usize) -> Self {
|
||||||
// Round to the nearest power of 2
|
// Round to the nearest power of 2
|
||||||
let generators = padded_pow_of_2(generators);
|
let generators = padded_pow_of_2(generators);
|
||||||
assert!(generators <= self.g_bold.len());
|
assert!(generators <= self.g_bold1.len());
|
||||||
|
|
||||||
BpPlusGenerators { g_bold: &self.g_bold[.. generators], h_bold: &self.h_bold[.. generators] }
|
Generators { g_bold1: &self.g_bold1[.. generators], h_bold1: &self.h_bold1[.. generators] }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1,16 +1,16 @@
|
|||||||
use core::ops::{Index, IndexMut};
|
use core::ops::{Index, IndexMut};
|
||||||
use std_shims::vec::Vec;
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
use zeroize::Zeroize;
|
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||||
|
|
||||||
use curve25519_dalek::edwards::EdwardsPoint;
|
use dalek_ff_group::EdwardsPoint;
|
||||||
|
|
||||||
use crate::scalar_vector::ScalarVector;
|
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
use crate::core::multiexp;
|
use multiexp::multiexp;
|
||||||
|
#[cfg(test)]
|
||||||
|
use crate::ringct::bulletproofs::plus::ScalarVector;
|
||||||
|
|
||||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
pub(crate) struct PointVector(pub(crate) Vec<EdwardsPoint>);
|
pub(crate) struct PointVector(pub(crate) Vec<EdwardsPoint>);
|
||||||
|
|
||||||
impl Index<usize> for PointVector {
|
impl Index<usize> for PointVector {
|
||||||
@@ -27,15 +27,6 @@ impl IndexMut<usize> for PointVector {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl PointVector {
|
impl PointVector {
|
||||||
pub(crate) fn mul_vec(&self, vector: &ScalarVector) -> Self {
|
|
||||||
assert_eq!(self.len(), vector.len());
|
|
||||||
let mut res = self.clone();
|
|
||||||
for (i, val) in res.0.iter_mut().enumerate() {
|
|
||||||
*val *= vector.0[i];
|
|
||||||
}
|
|
||||||
res
|
|
||||||
}
|
|
||||||
|
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub(crate) fn multiexp(&self, vector: &ScalarVector) -> EdwardsPoint {
|
pub(crate) fn multiexp(&self, vector: &ScalarVector) -> EdwardsPoint {
|
||||||
debug_assert_eq!(self.len(), vector.len());
|
debug_assert_eq!(self.len(), vector.len());
|
||||||
24
coins/monero/src/ringct/bulletproofs/plus/transcript.rs
Normal file
24
coins/monero/src/ringct/bulletproofs/plus/transcript.rs
Normal file
@@ -0,0 +1,24 @@
|
|||||||
|
use std_shims::{sync::OnceLock, vec::Vec};
|
||||||
|
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use monero_generators::{hash_to_point as raw_hash_to_point};
|
||||||
|
use crate::{hash, hash_to_scalar as dalek_hash};
|
||||||
|
|
||||||
|
// Monero starts BP+ transcripts with the following constant.
|
||||||
|
static TRANSCRIPT_CELL: OnceLock<[u8; 32]> = OnceLock::new();
|
||||||
|
pub(crate) fn TRANSCRIPT() -> [u8; 32] {
|
||||||
|
// Why this uses a hash_to_point is completely unknown.
|
||||||
|
*TRANSCRIPT_CELL
|
||||||
|
.get_or_init(|| raw_hash_to_point(hash(b"bulletproof_plus_transcript")).compress().to_bytes())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||||
|
Scalar(dalek_hash(data))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn initial_transcript(commitments: core::slice::Iter<'_, EdwardsPoint>) -> Scalar {
|
||||||
|
let commitments_hash =
|
||||||
|
hash_to_scalar(&commitments.flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>());
|
||||||
|
hash_to_scalar(&[TRANSCRIPT().as_ref(), &commitments_hash.to_bytes()].concat())
|
||||||
|
}
|
||||||
@@ -1,21 +1,24 @@
|
|||||||
use std_shims::{vec, vec::Vec};
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
use rand_core::{RngCore, CryptoRng};
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
use zeroize::{Zeroize, ZeroizeOnDrop};
|
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||||
|
|
||||||
use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
use multiexp::{BatchVerifier, multiexp, multiexp_vartime};
|
||||||
|
use group::{
|
||||||
|
ff::{Field, PrimeField},
|
||||||
|
GroupEncoding,
|
||||||
|
};
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
use monero_primitives::{INV_EIGHT, keccak256_to_scalar};
|
use crate::ringct::bulletproofs::plus::{
|
||||||
use crate::{
|
ScalarVector, PointVector, GeneratorsList, Generators, padded_pow_of_2, transcript::*,
|
||||||
core::{multiexp, multiexp_vartime, challenge_products},
|
|
||||||
batch_verifier::BulletproofsPlusBatchVerifier,
|
|
||||||
plus::{ScalarVector, PointVector, GeneratorsList, BpPlusGenerators, padded_pow_of_2},
|
|
||||||
};
|
};
|
||||||
|
|
||||||
// Figure 1 of the Bulletproofs+ paper
|
// Figure 1 of the Bulletproofs+ paper
|
||||||
#[derive(Clone, Debug)]
|
#[derive(Clone, Debug)]
|
||||||
pub(crate) struct WipStatement {
|
pub(crate) struct WipStatement {
|
||||||
generators: BpPlusGenerators,
|
generators: Generators,
|
||||||
P: EdwardsPoint,
|
P: EdwardsPoint,
|
||||||
y: ScalarVector,
|
y: ScalarVector,
|
||||||
}
|
}
|
||||||
@@ -65,7 +68,7 @@ pub(crate) struct WipProof {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl WipStatement {
|
impl WipStatement {
|
||||||
pub(crate) fn new(generators: BpPlusGenerators, P: EdwardsPoint, y: Scalar) -> Self {
|
pub(crate) fn new(generators: Generators, P: EdwardsPoint, y: Scalar) -> Self {
|
||||||
debug_assert_eq!(generators.len(), padded_pow_of_2(generators.len()));
|
debug_assert_eq!(generators.len(), padded_pow_of_2(generators.len()));
|
||||||
|
|
||||||
// y ** n
|
// y ** n
|
||||||
@@ -79,26 +82,16 @@ impl WipStatement {
|
|||||||
}
|
}
|
||||||
|
|
||||||
fn transcript_L_R(transcript: &mut Scalar, L: EdwardsPoint, R: EdwardsPoint) -> Scalar {
|
fn transcript_L_R(transcript: &mut Scalar, L: EdwardsPoint, R: EdwardsPoint) -> Scalar {
|
||||||
let e = keccak256_to_scalar(
|
let e = hash_to_scalar(
|
||||||
[
|
&[transcript.to_repr().as_ref(), L.to_bytes().as_ref(), R.to_bytes().as_ref()].concat(),
|
||||||
transcript.to_bytes().as_ref(),
|
|
||||||
L.compress().to_bytes().as_ref(),
|
|
||||||
R.compress().to_bytes().as_ref(),
|
|
||||||
]
|
|
||||||
.concat(),
|
|
||||||
);
|
);
|
||||||
*transcript = e;
|
*transcript = e;
|
||||||
e
|
e
|
||||||
}
|
}
|
||||||
|
|
||||||
fn transcript_A_B(transcript: &mut Scalar, A: EdwardsPoint, B: EdwardsPoint) -> Scalar {
|
fn transcript_A_B(transcript: &mut Scalar, A: EdwardsPoint, B: EdwardsPoint) -> Scalar {
|
||||||
let e = keccak256_to_scalar(
|
let e = hash_to_scalar(
|
||||||
[
|
&[transcript.to_repr().as_ref(), A.to_bytes().as_ref(), B.to_bytes().as_ref()].concat(),
|
||||||
transcript.to_bytes().as_ref(),
|
|
||||||
A.compress().to_bytes().as_ref(),
|
|
||||||
B.compress().to_bytes().as_ref(),
|
|
||||||
]
|
|
||||||
.concat(),
|
|
||||||
);
|
);
|
||||||
*transcript = e;
|
*transcript = e;
|
||||||
e
|
e
|
||||||
@@ -107,6 +100,9 @@ impl WipStatement {
|
|||||||
// Prover's variant of the shared code block to calculate G/H/P when n > 1
|
// Prover's variant of the shared code block to calculate G/H/P when n > 1
|
||||||
// Returns each permutation of G/H since the prover needs to do operation on each permutation
|
// Returns each permutation of G/H since the prover needs to do operation on each permutation
|
||||||
// P is dropped as it's unused in the prover's path
|
// P is dropped as it's unused in the prover's path
|
||||||
|
// TODO: It'd still probably be faster to keep in terms of the original generators, both between
|
||||||
|
// the reduced amount of group operations and the potential tabling of the generators under
|
||||||
|
// multiexp
|
||||||
#[allow(clippy::too_many_arguments)]
|
#[allow(clippy::too_many_arguments)]
|
||||||
fn next_G_H(
|
fn next_G_H(
|
||||||
transcript: &mut Scalar,
|
transcript: &mut Scalar,
|
||||||
@@ -123,7 +119,7 @@ impl WipStatement {
|
|||||||
debug_assert_eq!(g_bold1.len(), h_bold1.len());
|
debug_assert_eq!(g_bold1.len(), h_bold1.len());
|
||||||
|
|
||||||
let e = Self::transcript_L_R(transcript, L, R);
|
let e = Self::transcript_L_R(transcript, L, R);
|
||||||
let inv_e = e.invert();
|
let inv_e = e.invert().unwrap();
|
||||||
|
|
||||||
// This vartime is safe as all of these arguments are public
|
// This vartime is safe as all of these arguments are public
|
||||||
let mut new_g_bold = Vec::with_capacity(g_bold1.len());
|
let mut new_g_bold = Vec::with_capacity(g_bold1.len());
|
||||||
@@ -137,12 +133,57 @@ impl WipStatement {
|
|||||||
new_h_bold.push(multiexp_vartime(&[(e, h_bold.0), (inv_e, h_bold.1)]));
|
new_h_bold.push(multiexp_vartime(&[(e, h_bold.0), (inv_e, h_bold.1)]));
|
||||||
}
|
}
|
||||||
|
|
||||||
let e_square = e * e;
|
let e_square = e.square();
|
||||||
let inv_e_square = inv_e * inv_e;
|
let inv_e_square = inv_e.square();
|
||||||
|
|
||||||
(e, inv_e, e_square, inv_e_square, PointVector(new_g_bold), PointVector(new_h_bold))
|
(e, inv_e, e_square, inv_e_square, PointVector(new_g_bold), PointVector(new_h_bold))
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*
|
||||||
|
This has room for optimization worth investigating further. It currently takes
|
||||||
|
an iterative approach. It can be optimized further via divide and conquer.
|
||||||
|
|
||||||
|
Assume there are 4 challenges.
|
||||||
|
|
||||||
|
Iterative approach (current):
|
||||||
|
1. Do the optimal multiplications across challenge column 0 and 1.
|
||||||
|
2. Do the optimal multiplications across that result and column 2.
|
||||||
|
3. Do the optimal multiplications across that result and column 3.
|
||||||
|
|
||||||
|
Divide and conquer (worth investigating further):
|
||||||
|
1. Do the optimal multiplications across challenge column 0 and 1.
|
||||||
|
2. Do the optimal multiplications across challenge column 2 and 3.
|
||||||
|
3. Multiply both results together.
|
||||||
|
|
||||||
|
When there are 4 challenges (n=16), the iterative approach does 28 multiplications
|
||||||
|
versus divide and conquer's 24.
|
||||||
|
*/
|
||||||
|
fn challenge_products(challenges: &[(Scalar, Scalar)]) -> Vec<Scalar> {
|
||||||
|
let mut products = vec![Scalar::ONE; 1 << challenges.len()];
|
||||||
|
|
||||||
|
if !challenges.is_empty() {
|
||||||
|
products[0] = challenges[0].1;
|
||||||
|
products[1] = challenges[0].0;
|
||||||
|
|
||||||
|
for (j, challenge) in challenges.iter().enumerate().skip(1) {
|
||||||
|
let mut slots = (1 << (j + 1)) - 1;
|
||||||
|
while slots > 0 {
|
||||||
|
products[slots] = products[slots / 2] * challenge.0;
|
||||||
|
products[slots - 1] = products[slots / 2] * challenge.1;
|
||||||
|
|
||||||
|
slots = slots.saturating_sub(2);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Sanity check since if the above failed to populate, it'd be critical
|
||||||
|
for product in &products {
|
||||||
|
debug_assert!(!bool::from(product.is_zero()));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
products
|
||||||
|
}
|
||||||
|
|
||||||
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||||
self,
|
self,
|
||||||
rng: &mut R,
|
rng: &mut R,
|
||||||
@@ -156,27 +197,16 @@ impl WipStatement {
|
|||||||
if generators.len() != witness.a.len() {
|
if generators.len() != witness.a.len() {
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
let (g, h) = (BpPlusGenerators::g(), BpPlusGenerators::h());
|
let (g, h) = (Generators::g(), Generators::h());
|
||||||
let mut g_bold = vec![];
|
let mut g_bold = vec![];
|
||||||
let mut h_bold = vec![];
|
let mut h_bold = vec![];
|
||||||
for i in 0 .. generators.len() {
|
for i in 0 .. generators.len() {
|
||||||
g_bold.push(generators.generator(GeneratorsList::GBold, i));
|
g_bold.push(generators.generator(GeneratorsList::GBold1, i));
|
||||||
h_bold.push(generators.generator(GeneratorsList::HBold, i));
|
h_bold.push(generators.generator(GeneratorsList::HBold1, i));
|
||||||
}
|
}
|
||||||
let mut g_bold = PointVector(g_bold);
|
let mut g_bold = PointVector(g_bold);
|
||||||
let mut h_bold = PointVector(h_bold);
|
let mut h_bold = PointVector(h_bold);
|
||||||
|
|
||||||
let mut y_inv = {
|
|
||||||
let mut i = 1;
|
|
||||||
let mut to_invert = vec![];
|
|
||||||
while i < g_bold.len() {
|
|
||||||
to_invert.push(y[i - 1]);
|
|
||||||
i *= 2;
|
|
||||||
}
|
|
||||||
Scalar::batch_invert(&mut to_invert);
|
|
||||||
to_invert
|
|
||||||
};
|
|
||||||
|
|
||||||
// Check P has the expected relationship
|
// Check P has the expected relationship
|
||||||
#[cfg(debug_assertions)]
|
#[cfg(debug_assertions)]
|
||||||
{
|
{
|
||||||
@@ -230,7 +260,8 @@ impl WipStatement {
|
|||||||
let c_l = a1.clone().weighted_inner_product(&b2, &y);
|
let c_l = a1.clone().weighted_inner_product(&b2, &y);
|
||||||
let c_r = (a2.clone() * y_n_hat).weighted_inner_product(&b1, &y);
|
let c_r = (a2.clone() * y_n_hat).weighted_inner_product(&b1, &y);
|
||||||
|
|
||||||
let y_inv_n_hat = y_inv.pop().unwrap();
|
// TODO: Calculate these with a batch inversion
|
||||||
|
let y_inv_n_hat = y_n_hat.invert().unwrap();
|
||||||
|
|
||||||
let mut L_terms = (a1.clone() * y_inv_n_hat)
|
let mut L_terms = (a1.clone() * y_inv_n_hat)
|
||||||
.0
|
.0
|
||||||
@@ -240,7 +271,7 @@ impl WipStatement {
|
|||||||
.collect::<Vec<_>>();
|
.collect::<Vec<_>>();
|
||||||
L_terms.push((c_l, g));
|
L_terms.push((c_l, g));
|
||||||
L_terms.push((d_l, h));
|
L_terms.push((d_l, h));
|
||||||
let L = multiexp(&L_terms) * INV_EIGHT();
|
let L = multiexp(&L_terms) * Scalar(crate::INV_EIGHT());
|
||||||
L_vec.push(L);
|
L_vec.push(L);
|
||||||
L_terms.zeroize();
|
L_terms.zeroize();
|
||||||
|
|
||||||
@@ -252,7 +283,7 @@ impl WipStatement {
|
|||||||
.collect::<Vec<_>>();
|
.collect::<Vec<_>>();
|
||||||
R_terms.push((c_r, g));
|
R_terms.push((c_r, g));
|
||||||
R_terms.push((d_r, h));
|
R_terms.push((d_r, h));
|
||||||
let R = multiexp(&R_terms) * INV_EIGHT();
|
let R = multiexp(&R_terms) * Scalar(crate::INV_EIGHT());
|
||||||
R_vec.push(R);
|
R_vec.push(R);
|
||||||
R_terms.zeroize();
|
R_terms.zeroize();
|
||||||
|
|
||||||
@@ -285,33 +316,34 @@ impl WipStatement {
|
|||||||
|
|
||||||
let mut A_terms =
|
let mut A_terms =
|
||||||
vec![(r, g_bold[0]), (s, h_bold[0]), ((ry * b[0]) + (s * y[0] * a[0]), g), (delta, h)];
|
vec![(r, g_bold[0]), (s, h_bold[0]), ((ry * b[0]) + (s * y[0] * a[0]), g), (delta, h)];
|
||||||
let A = multiexp(&A_terms) * INV_EIGHT();
|
let A = multiexp(&A_terms) * Scalar(crate::INV_EIGHT());
|
||||||
A_terms.zeroize();
|
A_terms.zeroize();
|
||||||
|
|
||||||
let mut B_terms = vec![(ry * s, g), (eta, h)];
|
let mut B_terms = vec![(ry * s, g), (eta, h)];
|
||||||
let B = multiexp(&B_terms) * INV_EIGHT();
|
let B = multiexp(&B_terms) * Scalar(crate::INV_EIGHT());
|
||||||
B_terms.zeroize();
|
B_terms.zeroize();
|
||||||
|
|
||||||
let e = Self::transcript_A_B(&mut transcript, A, B);
|
let e = Self::transcript_A_B(&mut transcript, A, B);
|
||||||
|
|
||||||
let r_answer = r + (a[0] * e);
|
let r_answer = r + (a[0] * e);
|
||||||
let s_answer = s + (b[0] * e);
|
let s_answer = s + (b[0] * e);
|
||||||
let delta_answer = eta + (delta * e) + (alpha * (e * e));
|
let delta_answer = eta + (delta * e) + (alpha * e.square());
|
||||||
|
|
||||||
Some(WipProof { L: L_vec, R: R_vec, A, B, r_answer, s_answer, delta_answer })
|
Some(WipProof { L: L_vec, R: R_vec, A, B, r_answer, s_answer, delta_answer })
|
||||||
}
|
}
|
||||||
|
|
||||||
pub(crate) fn verify<R: RngCore + CryptoRng>(
|
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
self,
|
self,
|
||||||
rng: &mut R,
|
rng: &mut R,
|
||||||
verifier: &mut BulletproofsPlusBatchVerifier,
|
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
|
||||||
|
id: Id,
|
||||||
mut transcript: Scalar,
|
mut transcript: Scalar,
|
||||||
mut proof: WipProof,
|
mut proof: WipProof,
|
||||||
) -> bool {
|
) -> bool {
|
||||||
let verifier_weight = Scalar::random(rng);
|
|
||||||
|
|
||||||
let WipStatement { generators, P, y } = self;
|
let WipStatement { generators, P, y } = self;
|
||||||
|
|
||||||
|
let (g, h) = (Generators::g(), Generators::h());
|
||||||
|
|
||||||
// Verify the L/R lengths
|
// Verify the L/R lengths
|
||||||
{
|
{
|
||||||
let mut lr_len = 0;
|
let mut lr_len = 0;
|
||||||
@@ -327,7 +359,7 @@ impl WipStatement {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let inv_y = {
|
let inv_y = {
|
||||||
let inv_y = y[0].invert();
|
let inv_y = y[0].invert().unwrap();
|
||||||
let mut res = Vec::with_capacity(y.len());
|
let mut res = Vec::with_capacity(y.len());
|
||||||
res.push(inv_y);
|
res.push(inv_y);
|
||||||
while res.len() < y.len() {
|
while res.len() < y.len() {
|
||||||
@@ -336,49 +368,51 @@ impl WipStatement {
|
|||||||
res
|
res
|
||||||
};
|
};
|
||||||
|
|
||||||
let mut e_is = Vec::with_capacity(proof.L.len());
|
let mut P_terms = vec![(Scalar::ONE, P)];
|
||||||
|
P_terms.reserve(6 + (2 * generators.len()) + proof.L.len());
|
||||||
|
|
||||||
|
let mut challenges = Vec::with_capacity(proof.L.len());
|
||||||
|
let product_cache = {
|
||||||
|
let mut es = Vec::with_capacity(proof.L.len());
|
||||||
for (L, R) in proof.L.iter_mut().zip(proof.R.iter_mut()) {
|
for (L, R) in proof.L.iter_mut().zip(proof.R.iter_mut()) {
|
||||||
e_is.push(Self::transcript_L_R(&mut transcript, *L, *R));
|
es.push(Self::transcript_L_R(&mut transcript, *L, *R));
|
||||||
*L = L.mul_by_cofactor();
|
*L = L.mul_by_cofactor();
|
||||||
*R = R.mul_by_cofactor();
|
*R = R.mul_by_cofactor();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
let mut inv_es = es.clone();
|
||||||
|
let mut scratch = vec![Scalar::ZERO; es.len()];
|
||||||
|
group::ff::BatchInverter::invert_with_external_scratch(&mut inv_es, &mut scratch);
|
||||||
|
drop(scratch);
|
||||||
|
|
||||||
|
debug_assert_eq!(es.len(), inv_es.len());
|
||||||
|
debug_assert_eq!(es.len(), proof.L.len());
|
||||||
|
debug_assert_eq!(es.len(), proof.R.len());
|
||||||
|
for ((e, inv_e), (L, R)) in
|
||||||
|
es.drain(..).zip(inv_es.drain(..)).zip(proof.L.iter().zip(proof.R.iter()))
|
||||||
|
{
|
||||||
|
debug_assert_eq!(e.invert().unwrap(), inv_e);
|
||||||
|
|
||||||
|
challenges.push((e, inv_e));
|
||||||
|
|
||||||
|
let e_square = e.square();
|
||||||
|
let inv_e_square = inv_e.square();
|
||||||
|
P_terms.push((e_square, *L));
|
||||||
|
P_terms.push((inv_e_square, *R));
|
||||||
|
}
|
||||||
|
|
||||||
|
Self::challenge_products(&challenges)
|
||||||
|
};
|
||||||
|
|
||||||
let e = Self::transcript_A_B(&mut transcript, proof.A, proof.B);
|
let e = Self::transcript_A_B(&mut transcript, proof.A, proof.B);
|
||||||
proof.A = proof.A.mul_by_cofactor();
|
proof.A = proof.A.mul_by_cofactor();
|
||||||
proof.B = proof.B.mul_by_cofactor();
|
proof.B = proof.B.mul_by_cofactor();
|
||||||
let neg_e_square = verifier_weight * -(e * e);
|
let neg_e_square = -e.square();
|
||||||
|
|
||||||
verifier.0.other.push((neg_e_square, P));
|
let mut multiexp = P_terms;
|
||||||
|
multiexp.reserve(4 + (2 * generators.len()));
|
||||||
let mut challenges = Vec::with_capacity(proof.L.len());
|
for (scalar, _) in &mut multiexp {
|
||||||
let product_cache = {
|
*scalar *= neg_e_square;
|
||||||
let mut inv_e_is = e_is.clone();
|
|
||||||
Scalar::batch_invert(&mut inv_e_is);
|
|
||||||
|
|
||||||
debug_assert_eq!(e_is.len(), inv_e_is.len());
|
|
||||||
debug_assert_eq!(e_is.len(), proof.L.len());
|
|
||||||
debug_assert_eq!(e_is.len(), proof.R.len());
|
|
||||||
for ((e_i, inv_e_i), (L, R)) in
|
|
||||||
e_is.drain(..).zip(inv_e_is.drain(..)).zip(proof.L.iter().zip(proof.R.iter()))
|
|
||||||
{
|
|
||||||
debug_assert_eq!(e_i.invert(), inv_e_i);
|
|
||||||
|
|
||||||
challenges.push((e_i, inv_e_i));
|
|
||||||
|
|
||||||
let e_i_square = e_i * e_i;
|
|
||||||
let inv_e_i_square = inv_e_i * inv_e_i;
|
|
||||||
verifier.0.other.push((neg_e_square * e_i_square, *L));
|
|
||||||
verifier.0.other.push((neg_e_square * inv_e_i_square, *R));
|
|
||||||
}
|
|
||||||
|
|
||||||
challenge_products(&challenges)
|
|
||||||
};
|
|
||||||
|
|
||||||
while verifier.0.g_bold.len() < generators.len() {
|
|
||||||
verifier.0.g_bold.push(Scalar::ZERO);
|
|
||||||
}
|
|
||||||
while verifier.0.h_bold.len() < generators.len() {
|
|
||||||
verifier.0.h_bold.push(Scalar::ZERO);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
let re = proof.r_answer * e;
|
let re = proof.r_answer * e;
|
||||||
@@ -387,18 +421,23 @@ impl WipStatement {
|
|||||||
if i > 0 {
|
if i > 0 {
|
||||||
scalar *= inv_y[i - 1];
|
scalar *= inv_y[i - 1];
|
||||||
}
|
}
|
||||||
verifier.0.g_bold[i] += verifier_weight * scalar;
|
multiexp.push((scalar, generators.generator(GeneratorsList::GBold1, i)));
|
||||||
}
|
}
|
||||||
|
|
||||||
let se = proof.s_answer * e;
|
let se = proof.s_answer * e;
|
||||||
for i in 0 .. generators.len() {
|
for i in 0 .. generators.len() {
|
||||||
verifier.0.h_bold[i] += verifier_weight * (se * product_cache[product_cache.len() - 1 - i]);
|
multiexp.push((
|
||||||
|
se * product_cache[product_cache.len() - 1 - i],
|
||||||
|
generators.generator(GeneratorsList::HBold1, i),
|
||||||
|
));
|
||||||
}
|
}
|
||||||
|
|
||||||
verifier.0.other.push((verifier_weight * -e, proof.A));
|
multiexp.push((-e, proof.A));
|
||||||
verifier.0.g += verifier_weight * (proof.r_answer * y[0] * proof.s_answer);
|
multiexp.push((proof.r_answer * y[0] * proof.s_answer, g));
|
||||||
verifier.0.h += verifier_weight * proof.delta_answer;
|
multiexp.push((proof.delta_answer, h));
|
||||||
verifier.0.other.push((-verifier_weight, proof.B));
|
multiexp.push((-Scalar::ONE, proof.B));
|
||||||
|
|
||||||
|
verifier.queue(rng, id, multiexp);
|
||||||
|
|
||||||
true
|
true
|
||||||
}
|
}
|
||||||
@@ -2,13 +2,13 @@ use core::{
|
|||||||
borrow::Borrow,
|
borrow::Borrow,
|
||||||
ops::{Index, IndexMut, Add, Sub, Mul},
|
ops::{Index, IndexMut, Add, Sub, Mul},
|
||||||
};
|
};
|
||||||
use std_shims::{vec, vec::Vec};
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
use zeroize::{Zeroize, ZeroizeOnDrop};
|
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||||
|
|
||||||
use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
use group::ff::Field;
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
use crate::core::multiexp;
|
use multiexp::multiexp;
|
||||||
|
|
||||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
pub(crate) struct ScalarVector(pub(crate) Vec<Scalar>);
|
pub(crate) struct ScalarVector(pub(crate) Vec<Scalar>);
|
||||||
@@ -1,12 +1,7 @@
|
|||||||
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
|
|
||||||
#![doc = include_str!("../README.md")]
|
|
||||||
#![deny(missing_docs)]
|
|
||||||
#![cfg_attr(not(feature = "std"), no_std)]
|
|
||||||
#![allow(non_snake_case)]
|
#![allow(non_snake_case)]
|
||||||
|
|
||||||
use core::ops::Deref;
|
use core::ops::Deref;
|
||||||
use std_shims::{
|
use std_shims::{
|
||||||
vec,
|
|
||||||
vec::Vec,
|
vec::Vec,
|
||||||
io::{self, Read, Write},
|
io::{self, Read, Write},
|
||||||
};
|
};
|
||||||
@@ -23,66 +18,64 @@ use curve25519_dalek::{
|
|||||||
edwards::{EdwardsPoint, VartimeEdwardsPrecomputation},
|
edwards::{EdwardsPoint, VartimeEdwardsPrecomputation},
|
||||||
};
|
};
|
||||||
|
|
||||||
use monero_io::*;
|
use crate::{
|
||||||
use monero_generators::hash_to_point;
|
INV_EIGHT, BASEPOINT_PRECOMP, Commitment, random_scalar, hash_to_scalar, wallet::decoys::Decoys,
|
||||||
use monero_primitives::{INV_EIGHT, G_PRECOMP, Commitment, Decoys, keccak256_to_scalar};
|
ringct::hash_to_point, serialize::*,
|
||||||
|
};
|
||||||
|
|
||||||
#[cfg(feature = "multisig")]
|
#[cfg(feature = "multisig")]
|
||||||
mod multisig;
|
mod multisig;
|
||||||
#[cfg(feature = "multisig")]
|
#[cfg(feature = "multisig")]
|
||||||
pub use multisig::{ClsagMultisigMaskSender, ClsagAddendum, ClsagMultisig};
|
pub use multisig::{ClsagDetails, ClsagAddendum, ClsagMultisig};
|
||||||
|
|
||||||
#[cfg(all(feature = "std", test))]
|
/// Errors returned when CLSAG signing fails.
|
||||||
mod tests;
|
#[derive(Clone, Copy, PartialEq, Eq, Debug)]
|
||||||
|
#[cfg_attr(feature = "std", derive(thiserror::Error))]
|
||||||
/// Errors when working with CLSAGs.
|
|
||||||
#[derive(Clone, Copy, PartialEq, Eq, Debug, thiserror::Error)]
|
|
||||||
pub enum ClsagError {
|
pub enum ClsagError {
|
||||||
/// The ring was invalid (such as being too small or too large).
|
#[cfg_attr(feature = "std", error("internal error ({0})"))]
|
||||||
#[error("invalid ring")]
|
InternalError(&'static str),
|
||||||
|
#[cfg_attr(feature = "std", error("invalid ring"))]
|
||||||
InvalidRing,
|
InvalidRing,
|
||||||
/// The discrete logarithm of the key, scaling G, wasn't equivalent to the signing ring member.
|
#[cfg_attr(feature = "std", error("invalid ring member (member {0}, ring size {1})"))]
|
||||||
#[error("invalid commitment")]
|
InvalidRingMember(u8, u8),
|
||||||
InvalidKey,
|
#[cfg_attr(feature = "std", error("invalid commitment"))]
|
||||||
/// The commitment opening provided did not match the ring member's.
|
|
||||||
#[error("invalid commitment")]
|
|
||||||
InvalidCommitment,
|
InvalidCommitment,
|
||||||
/// The key image was invalid (such as being identity or torsioned)
|
#[cfg_attr(feature = "std", error("invalid key image"))]
|
||||||
#[error("invalid key image")]
|
|
||||||
InvalidImage,
|
InvalidImage,
|
||||||
/// The `D` component was invalid.
|
#[cfg_attr(feature = "std", error("invalid D"))]
|
||||||
#[error("invalid D")]
|
|
||||||
InvalidD,
|
InvalidD,
|
||||||
/// The `s` vector was invalid.
|
#[cfg_attr(feature = "std", error("invalid s"))]
|
||||||
#[error("invalid s")]
|
|
||||||
InvalidS,
|
InvalidS,
|
||||||
/// The `c1` variable was invalid.
|
#[cfg_attr(feature = "std", error("invalid c1"))]
|
||||||
#[error("invalid c1")]
|
|
||||||
InvalidC1,
|
InvalidC1,
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Context on the input being signed for.
|
/// Input being signed for.
|
||||||
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
pub struct ClsagContext {
|
pub struct ClsagInput {
|
||||||
// The opening for the commitment of the signing ring member
|
// The actual commitment for the true spend
|
||||||
commitment: Commitment,
|
pub(crate) commitment: Commitment,
|
||||||
// Selected ring members' positions, signer index, and ring
|
// True spend index, offsets, and ring
|
||||||
decoys: Decoys,
|
pub(crate) decoys: Decoys,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl ClsagContext {
|
impl ClsagInput {
|
||||||
/// Create a new context, as necessary for signing.
|
pub fn new(commitment: Commitment, decoys: Decoys) -> Result<ClsagInput, ClsagError> {
|
||||||
pub fn new(decoys: Decoys, commitment: Commitment) -> Result<ClsagContext, ClsagError> {
|
let n = decoys.len();
|
||||||
if decoys.len() > u8::MAX.into() {
|
if n > u8::MAX.into() {
|
||||||
Err(ClsagError::InvalidRing)?;
|
Err(ClsagError::InternalError("max ring size in this library is u8 max"))?;
|
||||||
|
}
|
||||||
|
let n = u8::try_from(n).unwrap();
|
||||||
|
if decoys.i >= n {
|
||||||
|
Err(ClsagError::InvalidRingMember(decoys.i, n))?;
|
||||||
}
|
}
|
||||||
|
|
||||||
// Validate the commitment matches
|
// Validate the commitment matches
|
||||||
if decoys.signer_ring_members()[1] != commitment.calculate() {
|
if decoys.ring[usize::from(decoys.i)][1] != commitment.calculate() {
|
||||||
Err(ClsagError::InvalidCommitment)?;
|
Err(ClsagError::InvalidCommitment)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(ClsagContext { commitment, decoys })
|
Ok(ClsagInput { commitment, decoys })
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -93,7 +86,6 @@ enum Mode {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Core of the CLSAG algorithm, applicable to both sign and verify with minimal differences
|
// Core of the CLSAG algorithm, applicable to both sign and verify with minimal differences
|
||||||
//
|
|
||||||
// Said differences are covered via the above Mode
|
// Said differences are covered via the above Mode
|
||||||
fn core(
|
fn core(
|
||||||
ring: &[[EdwardsPoint; 2]],
|
ring: &[[EdwardsPoint; 2]],
|
||||||
@@ -142,10 +134,10 @@ fn core(
|
|||||||
to_hash.extend(D_INV_EIGHT.compress().to_bytes());
|
to_hash.extend(D_INV_EIGHT.compress().to_bytes());
|
||||||
to_hash.extend(pseudo_out.compress().to_bytes());
|
to_hash.extend(pseudo_out.compress().to_bytes());
|
||||||
// mu_P with agg_0
|
// mu_P with agg_0
|
||||||
let mu_P = keccak256_to_scalar(&to_hash);
|
let mu_P = hash_to_scalar(&to_hash);
|
||||||
// mu_C with agg_1
|
// mu_C with agg_1
|
||||||
to_hash[PREFIX_AGG_0_LEN - 1] = b'1';
|
to_hash[PREFIX_AGG_0_LEN - 1] = b'1';
|
||||||
let mu_C = keccak256_to_scalar(&to_hash);
|
let mu_C = hash_to_scalar(&to_hash);
|
||||||
|
|
||||||
// Truncate it for the round transcript, altering the DST as needed
|
// Truncate it for the round transcript, altering the DST as needed
|
||||||
to_hash.truncate(((2 * n) + 1) * 32);
|
to_hash.truncate(((2 * n) + 1) * 32);
|
||||||
@@ -167,7 +159,7 @@ fn core(
|
|||||||
end = r + n;
|
end = r + n;
|
||||||
to_hash.extend(A.compress().to_bytes());
|
to_hash.extend(A.compress().to_bytes());
|
||||||
to_hash.extend(AH.compress().to_bytes());
|
to_hash.extend(AH.compress().to_bytes());
|
||||||
c = keccak256_to_scalar(&to_hash);
|
c = hash_to_scalar(&to_hash);
|
||||||
}
|
}
|
||||||
|
|
||||||
Mode::Verify(c1) => {
|
Mode::Verify(c1) => {
|
||||||
@@ -189,11 +181,11 @@ fn core(
|
|||||||
EdwardsPoint::multiscalar_mul([s[i], c_p, c_c], [ED25519_BASEPOINT_POINT, P[i], C[i]])
|
EdwardsPoint::multiscalar_mul([s[i], c_p, c_c], [ED25519_BASEPOINT_POINT, P[i], C[i]])
|
||||||
}
|
}
|
||||||
Mode::Verify(..) => {
|
Mode::Verify(..) => {
|
||||||
G_PRECOMP().vartime_mixed_multiscalar_mul([s[i]], [c_p, c_c], [P[i], C[i]])
|
BASEPOINT_PRECOMP().vartime_mixed_multiscalar_mul([s[i]], [c_p, c_c], [P[i], C[i]])
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
let PH = hash_to_point(P[i].compress().0);
|
let PH = hash_to_point(&P[i]);
|
||||||
|
|
||||||
// (c_p * I) + (c_c * D) + (s_i * PH)
|
// (c_p * I) + (c_c * D) + (s_i * PH)
|
||||||
let R = match A_c1 {
|
let R = match A_c1 {
|
||||||
@@ -206,7 +198,7 @@ fn core(
|
|||||||
to_hash.truncate(((2 * n) + 3) * 32);
|
to_hash.truncate(((2 * n) + 3) * 32);
|
||||||
to_hash.extend(L.compress().to_bytes());
|
to_hash.extend(L.compress().to_bytes());
|
||||||
to_hash.extend(R.compress().to_bytes());
|
to_hash.extend(R.compress().to_bytes());
|
||||||
c = keccak256_to_scalar(&to_hash);
|
c = hash_to_scalar(&to_hash);
|
||||||
|
|
||||||
// This will only execute once and shouldn't need to be constant time. Making it constant time
|
// This will only execute once and shouldn't need to be constant time. Making it constant time
|
||||||
// removes the risk of branch prediction creating timing differences depending on ring index
|
// removes the risk of branch prediction creating timing differences depending on ring index
|
||||||
@@ -218,142 +210,91 @@ fn core(
|
|||||||
((D_INV_EIGHT, c * mu_P, c * mu_C), c1)
|
((D_INV_EIGHT, c * mu_P, c * mu_C), c1)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// The CLSAG signature, as used in Monero.
|
/// CLSAG signature, as used in Monero.
|
||||||
#[derive(Clone, PartialEq, Eq, Debug)]
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
pub struct Clsag {
|
pub struct Clsag {
|
||||||
/// The difference of the commitment randomnesses, scaling the key image generator.
|
|
||||||
pub D: EdwardsPoint,
|
pub D: EdwardsPoint,
|
||||||
/// The responses for each ring member.
|
|
||||||
pub s: Vec<Scalar>,
|
pub s: Vec<Scalar>,
|
||||||
/// The first challenge in the ring.
|
|
||||||
pub c1: Scalar,
|
pub c1: Scalar,
|
||||||
}
|
}
|
||||||
|
|
||||||
struct ClsagSignCore {
|
|
||||||
incomplete_clsag: Clsag,
|
|
||||||
pseudo_out: EdwardsPoint,
|
|
||||||
key_challenge: Scalar,
|
|
||||||
challenged_mask: Scalar,
|
|
||||||
}
|
|
||||||
|
|
||||||
impl Clsag {
|
impl Clsag {
|
||||||
// Sign core is the extension of core as needed for signing, yet is shared between single signer
|
// Sign core is the extension of core as needed for signing, yet is shared between single signer
|
||||||
// and multisig, hence why it's still core
|
// and multisig, hence why it's still core
|
||||||
fn sign_core<R: RngCore + CryptoRng>(
|
pub(crate) fn sign_core<R: RngCore + CryptoRng>(
|
||||||
rng: &mut R,
|
rng: &mut R,
|
||||||
I: &EdwardsPoint,
|
I: &EdwardsPoint,
|
||||||
input: &ClsagContext,
|
input: &ClsagInput,
|
||||||
mask: Scalar,
|
mask: Scalar,
|
||||||
msg: &[u8; 32],
|
msg: &[u8; 32],
|
||||||
A: EdwardsPoint,
|
A: EdwardsPoint,
|
||||||
AH: EdwardsPoint,
|
AH: EdwardsPoint,
|
||||||
) -> ClsagSignCore {
|
) -> (Clsag, EdwardsPoint, Scalar, Scalar) {
|
||||||
let r: usize = input.decoys.signer_index().into();
|
let r: usize = input.decoys.i.into();
|
||||||
|
|
||||||
let pseudo_out = Commitment::new(mask, input.commitment.amount).calculate();
|
let pseudo_out = Commitment::new(mask, input.commitment.amount).calculate();
|
||||||
let mask_delta = input.commitment.mask - mask;
|
let z = input.commitment.mask - mask;
|
||||||
|
|
||||||
let H = hash_to_point(input.decoys.ring()[r][0].compress().0);
|
let H = hash_to_point(&input.decoys.ring[r][0]);
|
||||||
let D = H * mask_delta;
|
let D = H * z;
|
||||||
let mut s = Vec::with_capacity(input.decoys.ring().len());
|
let mut s = Vec::with_capacity(input.decoys.ring.len());
|
||||||
for _ in 0 .. input.decoys.ring().len() {
|
for _ in 0 .. input.decoys.ring.len() {
|
||||||
s.push(Scalar::random(rng));
|
s.push(random_scalar(rng));
|
||||||
}
|
}
|
||||||
let ((D, c_p, c_c), c1) =
|
let ((D, p, c), c1) =
|
||||||
core(input.decoys.ring(), I, &pseudo_out, msg, &D, &s, &Mode::Sign(r, A, AH));
|
core(&input.decoys.ring, I, &pseudo_out, msg, &D, &s, &Mode::Sign(r, A, AH));
|
||||||
|
|
||||||
ClsagSignCore {
|
(Clsag { D, s, c1 }, pseudo_out, p, c * z)
|
||||||
incomplete_clsag: Clsag { D, s, c1 },
|
|
||||||
pseudo_out,
|
|
||||||
key_challenge: c_p,
|
|
||||||
challenged_mask: c_c * mask_delta,
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Sign CLSAG signatures for the provided inputs.
|
/// Generate CLSAG signatures for the given inputs.
|
||||||
///
|
/// inputs is of the form (private key, key image, input).
|
||||||
/// Monero ensures the rerandomized input commitments have the same value as the outputs by
|
/// sum_outputs is for the sum of the outputs' commitment masks.
|
||||||
/// checking `sum(rerandomized_input_commitments) - sum(output_commitments) == 0`. This requires
|
|
||||||
/// not only the amounts balance, yet also
|
|
||||||
/// `sum(input_commitment_masks) - sum(output_commitment_masks)`.
|
|
||||||
///
|
|
||||||
/// Monero solves this by following the wallet protocol to determine each output commitment's
|
|
||||||
/// randomness, then using random masks for all but the last input. The last input is
|
|
||||||
/// rerandomized to the necessary mask for the equation to balance.
|
|
||||||
///
|
|
||||||
/// Due to Monero having this behavior, it only makes sense to sign CLSAGs as a list, hence this
|
|
||||||
/// API being the way it is.
|
|
||||||
///
|
|
||||||
/// `inputs` is of the form (discrete logarithm of the key, context).
|
|
||||||
///
|
|
||||||
/// `sum_outputs` is for the sum of the output commitments' masks.
|
|
||||||
pub fn sign<R: RngCore + CryptoRng>(
|
pub fn sign<R: RngCore + CryptoRng>(
|
||||||
rng: &mut R,
|
rng: &mut R,
|
||||||
mut inputs: Vec<(Zeroizing<Scalar>, ClsagContext)>,
|
mut inputs: Vec<(Zeroizing<Scalar>, EdwardsPoint, ClsagInput)>,
|
||||||
sum_outputs: Scalar,
|
sum_outputs: Scalar,
|
||||||
msg: [u8; 32],
|
msg: [u8; 32],
|
||||||
) -> Result<Vec<(Clsag, EdwardsPoint)>, ClsagError> {
|
) -> Vec<(Clsag, EdwardsPoint)> {
|
||||||
// Create the key images
|
|
||||||
let mut key_image_generators = vec![];
|
|
||||||
let mut key_images = vec![];
|
|
||||||
for input in &inputs {
|
|
||||||
let key = input.1.decoys.signer_ring_members()[0];
|
|
||||||
|
|
||||||
// Check the key is consistent
|
|
||||||
if (ED25519_BASEPOINT_TABLE * input.0.deref()) != key {
|
|
||||||
Err(ClsagError::InvalidKey)?;
|
|
||||||
}
|
|
||||||
|
|
||||||
let key_image_generator = hash_to_point(key.compress().0);
|
|
||||||
key_image_generators.push(key_image_generator);
|
|
||||||
key_images.push(key_image_generator * input.0.deref());
|
|
||||||
}
|
|
||||||
|
|
||||||
let mut res = Vec::with_capacity(inputs.len());
|
let mut res = Vec::with_capacity(inputs.len());
|
||||||
let mut sum_pseudo_outs = Scalar::ZERO;
|
let mut sum_pseudo_outs = Scalar::ZERO;
|
||||||
for i in 0 .. inputs.len() {
|
for i in 0 .. inputs.len() {
|
||||||
let mask;
|
let mut mask = random_scalar(rng);
|
||||||
// If this is the last input, set the mask as described above
|
|
||||||
if i == (inputs.len() - 1) {
|
if i == (inputs.len() - 1) {
|
||||||
mask = sum_outputs - sum_pseudo_outs;
|
mask = sum_outputs - sum_pseudo_outs;
|
||||||
} else {
|
} else {
|
||||||
mask = Scalar::random(rng);
|
|
||||||
sum_pseudo_outs += mask;
|
sum_pseudo_outs += mask;
|
||||||
}
|
}
|
||||||
|
|
||||||
let mut nonce = Zeroizing::new(Scalar::random(rng));
|
let mut nonce = Zeroizing::new(random_scalar(rng));
|
||||||
let ClsagSignCore { mut incomplete_clsag, pseudo_out, key_challenge, challenged_mask } =
|
let (mut clsag, pseudo_out, p, c) = Clsag::sign_core(
|
||||||
Clsag::sign_core(
|
|
||||||
rng,
|
rng,
|
||||||
&key_images[i],
|
|
||||||
&inputs[i].1,
|
&inputs[i].1,
|
||||||
|
&inputs[i].2,
|
||||||
mask,
|
mask,
|
||||||
&msg,
|
&msg,
|
||||||
nonce.deref() * ED25519_BASEPOINT_TABLE,
|
nonce.deref() * ED25519_BASEPOINT_TABLE,
|
||||||
nonce.deref() * key_image_generators[i],
|
nonce.deref() *
|
||||||
|
hash_to_point(&inputs[i].2.decoys.ring[usize::from(inputs[i].2.decoys.i)][0]),
|
||||||
);
|
);
|
||||||
// Effectively r - c x, except c x is (c_p x) + (c_c z), where z is the delta between the
|
// Effectively r - cx, except cx is (c_p x) + (c_c z), where z is the delta between a ring
|
||||||
// ring member's commitment and our pseudo-out commitment (which will only have a known
|
// member's commitment and our input commitment (which will only have a known discrete log
|
||||||
// discrete log over G if the amounts cancel out)
|
// over G if the amounts cancel out)
|
||||||
incomplete_clsag.s[usize::from(inputs[i].1.decoys.signer_index())] =
|
clsag.s[usize::from(inputs[i].2.decoys.i)] = nonce.deref() - ((p * inputs[i].0.deref()) + c);
|
||||||
nonce.deref() - ((key_challenge * inputs[i].0.deref()) + challenged_mask);
|
|
||||||
let clsag = incomplete_clsag;
|
|
||||||
|
|
||||||
// Zeroize private keys and nonces.
|
|
||||||
inputs[i].0.zeroize();
|
inputs[i].0.zeroize();
|
||||||
nonce.zeroize();
|
nonce.zeroize();
|
||||||
|
|
||||||
debug_assert!(clsag
|
debug_assert!(clsag
|
||||||
.verify(inputs[i].1.decoys.ring(), &key_images[i], &pseudo_out, &msg)
|
.verify(&inputs[i].2.decoys.ring, &inputs[i].1, &pseudo_out, &msg)
|
||||||
.is_ok());
|
.is_ok());
|
||||||
|
|
||||||
res.push((clsag, pseudo_out));
|
res.push((clsag, pseudo_out));
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(res)
|
res
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Verify a CLSAG signature for the provided context.
|
/// Verify the CLSAG signature against the given Transaction data.
|
||||||
pub fn verify(
|
pub fn verify(
|
||||||
&self,
|
&self,
|
||||||
ring: &[[EdwardsPoint; 2]],
|
ring: &[[EdwardsPoint; 2]],
|
||||||
@@ -361,15 +302,15 @@ impl Clsag {
|
|||||||
pseudo_out: &EdwardsPoint,
|
pseudo_out: &EdwardsPoint,
|
||||||
msg: &[u8; 32],
|
msg: &[u8; 32],
|
||||||
) -> Result<(), ClsagError> {
|
) -> Result<(), ClsagError> {
|
||||||
// Preliminary checks
|
// Preliminary checks. s, c1, and points must also be encoded canonically, which isn't checked
|
||||||
// s, c1, and points must also be encoded canonically, which is checked at time of decode
|
// here
|
||||||
if ring.is_empty() {
|
if ring.is_empty() {
|
||||||
Err(ClsagError::InvalidRing)?;
|
Err(ClsagError::InvalidRing)?;
|
||||||
}
|
}
|
||||||
if ring.len() != self.s.len() {
|
if ring.len() != self.s.len() {
|
||||||
Err(ClsagError::InvalidS)?;
|
Err(ClsagError::InvalidS)?;
|
||||||
}
|
}
|
||||||
if I.is_identity() || (!I.is_torsion_free()) {
|
if I.is_identity() {
|
||||||
Err(ClsagError::InvalidImage)?;
|
Err(ClsagError::InvalidImage)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -385,14 +326,16 @@ impl Clsag {
|
|||||||
Ok(())
|
Ok(())
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Write a CLSAG.
|
pub(crate) fn fee_weight(ring_len: usize) -> usize {
|
||||||
|
(ring_len * 32) + 32 + 32
|
||||||
|
}
|
||||||
|
|
||||||
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
write_raw_vec(write_scalar, &self.s, w)?;
|
write_raw_vec(write_scalar, &self.s, w)?;
|
||||||
w.write_all(&self.c1.to_bytes())?;
|
w.write_all(&self.c1.to_bytes())?;
|
||||||
write_point(&self.D, w)
|
write_point(&self.D, w)
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Read a CLSAG.
|
|
||||||
pub fn read<R: Read>(decoys: usize, r: &mut R) -> io::Result<Clsag> {
|
pub fn read<R: Read>(decoys: usize, r: &mut R) -> io::Result<Clsag> {
|
||||||
Ok(Clsag { s: read_raw_vec(read_scalar, decoys, r)?, c1: read_scalar(r)?, D: read_point(r)? })
|
Ok(Clsag { s: read_raw_vec(read_scalar, decoys, r)?, c1: read_scalar(r)?, D: read_point(r)? })
|
||||||
}
|
}
|
||||||
@@ -1,14 +1,14 @@
|
|||||||
use core::{ops::Deref, fmt::Debug};
|
use core::{ops::Deref, fmt::Debug};
|
||||||
use std_shims::{
|
use std_shims::{
|
||||||
sync::{Arc, Mutex},
|
|
||||||
io::{self, Read, Write},
|
io::{self, Read, Write},
|
||||||
collections::HashMap,
|
collections::HashMap,
|
||||||
};
|
};
|
||||||
|
use std::sync::{Arc, RwLock};
|
||||||
|
|
||||||
use rand_core::{RngCore, CryptoRng, SeedableRng};
|
use rand_core::{RngCore, CryptoRng, SeedableRng};
|
||||||
use rand_chacha::ChaCha20Rng;
|
use rand_chacha::ChaCha20Rng;
|
||||||
|
|
||||||
use zeroize::{Zeroize, Zeroizing};
|
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
|
||||||
|
|
||||||
use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
||||||
|
|
||||||
@@ -20,27 +20,29 @@ use group::{
|
|||||||
use transcript::{Transcript, RecommendedTranscript};
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
use dalek_ff_group as dfg;
|
use dalek_ff_group as dfg;
|
||||||
use frost::{
|
use frost::{
|
||||||
|
dkg::lagrange,
|
||||||
curve::Ed25519,
|
curve::Ed25519,
|
||||||
Participant, FrostError, ThresholdKeys, ThresholdView,
|
Participant, FrostError, ThresholdKeys, ThresholdView,
|
||||||
algorithm::{WriteAddendum, Algorithm},
|
algorithm::{WriteAddendum, Algorithm},
|
||||||
};
|
};
|
||||||
|
|
||||||
use monero_generators::hash_to_point;
|
use crate::ringct::{
|
||||||
|
hash_to_point,
|
||||||
|
clsag::{ClsagInput, Clsag},
|
||||||
|
};
|
||||||
|
|
||||||
use crate::{ClsagContext, Clsag};
|
impl ClsagInput {
|
||||||
|
|
||||||
impl ClsagContext {
|
|
||||||
fn transcript<T: Transcript>(&self, transcript: &mut T) {
|
fn transcript<T: Transcript>(&self, transcript: &mut T) {
|
||||||
// Doesn't domain separate as this is considered part of the larger CLSAG proof
|
// Doesn't domain separate as this is considered part of the larger CLSAG proof
|
||||||
|
|
||||||
// Ring index
|
// Ring index
|
||||||
transcript.append_message(b"signer_index", [self.decoys.signer_index()]);
|
transcript.append_message(b"real_spend", [self.decoys.i]);
|
||||||
|
|
||||||
// Ring
|
// Ring
|
||||||
for (i, pair) in self.decoys.ring().iter().enumerate() {
|
for (i, pair) in self.decoys.ring.iter().enumerate() {
|
||||||
// Doesn't include global output indexes as CLSAG doesn't care/won't be affected by it
|
// Doesn't include global output indexes as CLSAG doesn't care and won't be affected by it
|
||||||
// They're just a unreliable reference to this data which will be included in the message
|
// They're just a unreliable reference to this data which will be included in the message
|
||||||
// if somehow relevant
|
// if in use
|
||||||
transcript.append_message(b"member", [u8::try_from(i).expect("ring size exceeded 255")]);
|
transcript.append_message(b"member", [u8::try_from(i).expect("ring size exceeded 255")]);
|
||||||
// This also transcripts the key image generator since it's derived from this key
|
// This also transcripts the key image generator since it's derived from this key
|
||||||
transcript.append_message(b"key", pair[0].compress().to_bytes());
|
transcript.append_message(b"key", pair[0].compress().to_bytes());
|
||||||
@@ -48,56 +50,33 @@ impl ClsagContext {
|
|||||||
}
|
}
|
||||||
|
|
||||||
// Doesn't include the commitment's parts as the above ring + index includes the commitment
|
// Doesn't include the commitment's parts as the above ring + index includes the commitment
|
||||||
// The only potential malleability would be if the G/H relationship is known, breaking the
|
// The only potential malleability would be if the G/H relationship is known breaking the
|
||||||
// discrete log problem, which breaks everything already
|
// discrete log problem, which breaks everything already
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A channel to send the mask to use for the pseudo-out (rerandomized commitment) with.
|
/// CLSAG input and the mask to use for it.
|
||||||
///
|
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
/// A mask must be sent along this channel before any preprocess addendums are handled. Breaking
|
pub struct ClsagDetails {
|
||||||
/// this rule will cause a panic.
|
input: ClsagInput,
|
||||||
#[derive(Clone, Debug)]
|
mask: Scalar,
|
||||||
pub struct ClsagMultisigMaskSender {
|
|
||||||
buf: Arc<Mutex<Option<Scalar>>>,
|
|
||||||
}
|
}
|
||||||
#[derive(Clone, Debug)]
|
|
||||||
struct ClsagMultisigMaskReceiver {
|
|
||||||
buf: Arc<Mutex<Option<Scalar>>>,
|
|
||||||
}
|
|
||||||
impl ClsagMultisigMaskSender {
|
|
||||||
fn new() -> (ClsagMultisigMaskSender, ClsagMultisigMaskReceiver) {
|
|
||||||
let buf = Arc::new(Mutex::new(None));
|
|
||||||
(ClsagMultisigMaskSender { buf: buf.clone() }, ClsagMultisigMaskReceiver { buf })
|
|
||||||
}
|
|
||||||
|
|
||||||
/// Send a mask to a CLSAG multisig instance.
|
impl ClsagDetails {
|
||||||
pub fn send(self, mask: Scalar) {
|
pub fn new(input: ClsagInput, mask: Scalar) -> ClsagDetails {
|
||||||
*self.buf.lock() = Some(mask);
|
ClsagDetails { input, mask }
|
||||||
}
|
|
||||||
}
|
|
||||||
impl ClsagMultisigMaskReceiver {
|
|
||||||
fn recv(self) -> Scalar {
|
|
||||||
self.buf.lock().unwrap()
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Addendum produced during the signing process.
|
/// Addendum produced during the FROST signing process with relevant data.
|
||||||
#[derive(Clone, PartialEq, Eq, Zeroize, Debug)]
|
#[derive(Clone, PartialEq, Eq, Zeroize, Debug)]
|
||||||
pub struct ClsagAddendum {
|
pub struct ClsagAddendum {
|
||||||
key_image_share: dfg::EdwardsPoint,
|
pub(crate) key_image: dfg::EdwardsPoint,
|
||||||
}
|
|
||||||
|
|
||||||
impl ClsagAddendum {
|
|
||||||
/// The key image share within this addendum.
|
|
||||||
pub fn key_image_share(&self) -> dfg::EdwardsPoint {
|
|
||||||
self.key_image_share
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
impl WriteAddendum for ClsagAddendum {
|
impl WriteAddendum for ClsagAddendum {
|
||||||
fn write<W: Write>(&self, writer: &mut W) -> io::Result<()> {
|
fn write<W: Write>(&self, writer: &mut W) -> io::Result<()> {
|
||||||
writer.write_all(self.key_image_share.compress().to_bytes().as_ref())
|
writer.write_all(self.key_image.compress().to_bytes().as_ref())
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -111,83 +90,66 @@ struct Interim {
|
|||||||
pseudo_out: EdwardsPoint,
|
pseudo_out: EdwardsPoint,
|
||||||
}
|
}
|
||||||
|
|
||||||
/// FROST-inspired algorithm for producing a CLSAG signature.
|
/// FROST algorithm for producing a CLSAG signature.
|
||||||
///
|
|
||||||
/// Before this has its `process_addendum` called, a mask must be set. Else this will panic.
|
|
||||||
///
|
|
||||||
/// The message signed is expected to be a 32-byte value. Per Monero, it's the keccak256 hash of
|
|
||||||
/// the transaction data which is signed. This will panic if the message is not a 32-byte value.
|
|
||||||
#[allow(non_snake_case)]
|
#[allow(non_snake_case)]
|
||||||
#[derive(Clone, Debug)]
|
#[derive(Clone, Debug)]
|
||||||
pub struct ClsagMultisig {
|
pub struct ClsagMultisig {
|
||||||
transcript: RecommendedTranscript,
|
transcript: RecommendedTranscript,
|
||||||
|
|
||||||
key_image_generator: EdwardsPoint,
|
pub(crate) H: EdwardsPoint,
|
||||||
key_image_shares: HashMap<[u8; 32], dfg::EdwardsPoint>,
|
key_image_shares: HashMap<[u8; 32], dfg::EdwardsPoint>,
|
||||||
image: Option<dfg::EdwardsPoint>,
|
image: Option<dfg::EdwardsPoint>,
|
||||||
|
|
||||||
context: ClsagContext,
|
details: Arc<RwLock<Option<ClsagDetails>>>,
|
||||||
|
|
||||||
mask_recv: Option<ClsagMultisigMaskReceiver>,
|
|
||||||
mask: Option<Scalar>,
|
|
||||||
|
|
||||||
msg: Option<[u8; 32]>,
|
msg: Option<[u8; 32]>,
|
||||||
interim: Option<Interim>,
|
interim: Option<Interim>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl ClsagMultisig {
|
impl ClsagMultisig {
|
||||||
/// Construct a new instance of multisignature CLSAG signing.
|
|
||||||
pub fn new(
|
pub fn new(
|
||||||
transcript: RecommendedTranscript,
|
transcript: RecommendedTranscript,
|
||||||
context: ClsagContext,
|
output_key: EdwardsPoint,
|
||||||
) -> (ClsagMultisig, ClsagMultisigMaskSender) {
|
details: Arc<RwLock<Option<ClsagDetails>>>,
|
||||||
let (mask_send, mask_recv) = ClsagMultisigMaskSender::new();
|
) -> ClsagMultisig {
|
||||||
(
|
|
||||||
ClsagMultisig {
|
ClsagMultisig {
|
||||||
transcript,
|
transcript,
|
||||||
|
|
||||||
key_image_generator: hash_to_point(context.decoys.signer_ring_members()[0].compress().0),
|
H: hash_to_point(&output_key),
|
||||||
key_image_shares: HashMap::new(),
|
key_image_shares: HashMap::new(),
|
||||||
image: None,
|
image: None,
|
||||||
|
|
||||||
context,
|
details,
|
||||||
|
|
||||||
mask_recv: Some(mask_recv),
|
|
||||||
mask: None,
|
|
||||||
|
|
||||||
msg: None,
|
msg: None,
|
||||||
interim: None,
|
interim: None,
|
||||||
},
|
}
|
||||||
mask_send,
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// The key image generator used by the signer.
|
fn input(&self) -> ClsagInput {
|
||||||
pub fn key_image_generator(&self) -> EdwardsPoint {
|
(*self.details.read().unwrap()).as_ref().unwrap().input.clone()
|
||||||
self.key_image_generator
|
}
|
||||||
|
|
||||||
|
fn mask(&self) -> Scalar {
|
||||||
|
(*self.details.read().unwrap()).as_ref().unwrap().mask
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Algorithm<Ed25519> for ClsagMultisig {
|
impl Algorithm<Ed25519> for ClsagMultisig {
|
||||||
type Transcript = RecommendedTranscript;
|
type Transcript = RecommendedTranscript;
|
||||||
type Addendum = ClsagAddendum;
|
type Addendum = ClsagAddendum;
|
||||||
// We output the CLSAG and the key image, which requires an interactive protocol to obtain
|
|
||||||
type Signature = (Clsag, EdwardsPoint);
|
type Signature = (Clsag, EdwardsPoint);
|
||||||
|
|
||||||
// We need the nonce represented against both G and the key image generator
|
|
||||||
fn nonces(&self) -> Vec<Vec<dfg::EdwardsPoint>> {
|
fn nonces(&self) -> Vec<Vec<dfg::EdwardsPoint>> {
|
||||||
vec![vec![dfg::EdwardsPoint::generator(), dfg::EdwardsPoint(self.key_image_generator)]]
|
vec![vec![dfg::EdwardsPoint::generator(), dfg::EdwardsPoint(self.H)]]
|
||||||
}
|
}
|
||||||
|
|
||||||
// We also publish our share of the key image
|
|
||||||
fn preprocess_addendum<R: RngCore + CryptoRng>(
|
fn preprocess_addendum<R: RngCore + CryptoRng>(
|
||||||
&mut self,
|
&mut self,
|
||||||
_rng: &mut R,
|
_rng: &mut R,
|
||||||
keys: &ThresholdKeys<Ed25519>,
|
keys: &ThresholdKeys<Ed25519>,
|
||||||
) -> ClsagAddendum {
|
) -> ClsagAddendum {
|
||||||
ClsagAddendum {
|
ClsagAddendum { key_image: dfg::EdwardsPoint(self.H) * keys.secret_share().deref() }
|
||||||
key_image_share: dfg::EdwardsPoint(self.key_image_generator) * keys.secret_share().deref(),
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
fn read_addendum<R: Read>(&self, reader: &mut R) -> io::Result<ClsagAddendum> {
|
fn read_addendum<R: Read>(&self, reader: &mut R) -> io::Result<ClsagAddendum> {
|
||||||
@@ -201,7 +163,7 @@ impl Algorithm<Ed25519> for ClsagMultisig {
|
|||||||
Err(io::Error::other("non-canonical key image"))?;
|
Err(io::Error::other("non-canonical key image"))?;
|
||||||
}
|
}
|
||||||
|
|
||||||
Ok(ClsagAddendum { key_image_share: xH })
|
Ok(ClsagAddendum { key_image: xH })
|
||||||
}
|
}
|
||||||
|
|
||||||
fn process_addendum(
|
fn process_addendum(
|
||||||
@@ -213,29 +175,21 @@ impl Algorithm<Ed25519> for ClsagMultisig {
|
|||||||
if self.image.is_none() {
|
if self.image.is_none() {
|
||||||
self.transcript.domain_separate(b"CLSAG");
|
self.transcript.domain_separate(b"CLSAG");
|
||||||
// Transcript the ring
|
// Transcript the ring
|
||||||
self.context.transcript(&mut self.transcript);
|
self.input().transcript(&mut self.transcript);
|
||||||
// Fetch the mask from the Mutex
|
|
||||||
// We set it to a variable to ensure our view of it is consistent
|
|
||||||
// It was this or a mpsc channel... std doesn't have oneshot :/
|
|
||||||
self.mask = Some(self.mask_recv.take().unwrap().recv());
|
|
||||||
// Transcript the mask
|
// Transcript the mask
|
||||||
self.transcript.append_message(b"mask", self.mask.expect("mask wasn't set").to_bytes());
|
self.transcript.append_message(b"mask", self.mask().to_bytes());
|
||||||
|
|
||||||
// Init the image to the offset
|
// Init the image to the offset
|
||||||
self.image = Some(dfg::EdwardsPoint(self.key_image_generator) * view.offset());
|
self.image = Some(dfg::EdwardsPoint(self.H) * view.offset());
|
||||||
}
|
}
|
||||||
|
|
||||||
// Transcript this participant's contribution
|
// Transcript this participant's contribution
|
||||||
self.transcript.append_message(b"participant", l.to_bytes());
|
self.transcript.append_message(b"participant", l.to_bytes());
|
||||||
self
|
self.transcript.append_message(b"key_image_share", addendum.key_image.compress().to_bytes());
|
||||||
.transcript
|
|
||||||
.append_message(b"key_image_share", addendum.key_image_share.compress().to_bytes());
|
|
||||||
|
|
||||||
// Accumulate the interpolated share
|
// Accumulate the interpolated share
|
||||||
let interpolated_key_image_share = addendum.key_image_share *
|
let interpolated_key_image_share =
|
||||||
view
|
addendum.key_image * lagrange::<dfg::Scalar>(l, view.included());
|
||||||
.interpolation_factor(l)
|
|
||||||
.ok_or(FrostError::InternalError("processing addendum of non-participant"))?;
|
|
||||||
*self.image.as_mut().unwrap() += interpolated_key_image_share;
|
*self.image.as_mut().unwrap() += interpolated_key_image_share;
|
||||||
|
|
||||||
self
|
self
|
||||||
@@ -257,34 +211,28 @@ impl Algorithm<Ed25519> for ClsagMultisig {
|
|||||||
msg: &[u8],
|
msg: &[u8],
|
||||||
) -> dfg::Scalar {
|
) -> dfg::Scalar {
|
||||||
// Use the transcript to get a seeded random number generator
|
// Use the transcript to get a seeded random number generator
|
||||||
//
|
|
||||||
// The transcript contains private data, preventing passive adversaries from recreating this
|
// The transcript contains private data, preventing passive adversaries from recreating this
|
||||||
// process even if they have access to the commitments/key image share broadcast so far
|
// process even if they have access to commitments (specifically, the ring index being signed
|
||||||
//
|
// for, along with the mask which should not only require knowing the shared keys yet also the
|
||||||
// Specifically, the transcript contains the signer's index within the ring, along with the
|
// input commitment masks)
|
||||||
// opening of the commitment being re-randomized (and what it's re-randomized to)
|
|
||||||
let mut rng = ChaCha20Rng::from_seed(self.transcript.rng_seed(b"decoy_responses"));
|
let mut rng = ChaCha20Rng::from_seed(self.transcript.rng_seed(b"decoy_responses"));
|
||||||
|
|
||||||
self.msg = Some(msg.try_into().expect("CLSAG message should be 32-bytes"));
|
self.msg = Some(msg.try_into().expect("CLSAG message should be 32-bytes"));
|
||||||
|
|
||||||
let sign_core = Clsag::sign_core(
|
#[allow(non_snake_case)]
|
||||||
|
let (clsag, pseudo_out, p, c) = Clsag::sign_core(
|
||||||
&mut rng,
|
&mut rng,
|
||||||
&self.image.expect("verifying a share despite never processing any addendums").0,
|
&self.image.expect("verifying a share despite never processing any addendums").0,
|
||||||
&self.context,
|
&self.input(),
|
||||||
self.mask.expect("mask wasn't set"),
|
self.mask(),
|
||||||
self.msg.as_ref().unwrap(),
|
self.msg.as_ref().unwrap(),
|
||||||
nonce_sums[0][0].0,
|
nonce_sums[0][0].0,
|
||||||
nonce_sums[0][1].0,
|
nonce_sums[0][1].0,
|
||||||
);
|
);
|
||||||
self.interim = Some(Interim {
|
self.interim = Some(Interim { p, c, clsag, pseudo_out });
|
||||||
p: sign_core.key_challenge,
|
|
||||||
c: sign_core.challenged_mask,
|
|
||||||
clsag: sign_core.incomplete_clsag,
|
|
||||||
pseudo_out: sign_core.pseudo_out,
|
|
||||||
});
|
|
||||||
|
|
||||||
// r - p x, where p is the challenge for the keys
|
// r - p x, where p is the challenge for the keys
|
||||||
*nonces[0] - dfg::Scalar(sign_core.key_challenge) * view.secret_share().deref()
|
*nonces[0] - dfg::Scalar(p) * view.secret_share().deref()
|
||||||
}
|
}
|
||||||
|
|
||||||
#[must_use]
|
#[must_use]
|
||||||
@@ -296,12 +244,12 @@ impl Algorithm<Ed25519> for ClsagMultisig {
|
|||||||
) -> Option<Self::Signature> {
|
) -> Option<Self::Signature> {
|
||||||
let interim = self.interim.as_ref().unwrap();
|
let interim = self.interim.as_ref().unwrap();
|
||||||
let mut clsag = interim.clsag.clone();
|
let mut clsag = interim.clsag.clone();
|
||||||
// We produced shares as `r - p x`, yet the signature is actually `r - p x - c x`
|
// We produced shares as `r - p x`, yet the signature is `r - p x - c x`
|
||||||
// Substract `c x` (saved as `c`) now
|
// Substract `c x` (saved as `c`) now
|
||||||
clsag.s[usize::from(self.context.decoys.signer_index())] = sum.0 - interim.c;
|
clsag.s[usize::from(self.input().decoys.i)] = sum.0 - interim.c;
|
||||||
if clsag
|
if clsag
|
||||||
.verify(
|
.verify(
|
||||||
self.context.decoys.ring(),
|
&self.input().decoys.ring,
|
||||||
&self.image.expect("verifying a signature despite never processing any addendums").0,
|
&self.image.expect("verifying a signature despite never processing any addendums").0,
|
||||||
&interim.pseudo_out,
|
&interim.pseudo_out,
|
||||||
self.msg.as_ref().unwrap(),
|
self.msg.as_ref().unwrap(),
|
||||||
@@ -345,11 +293,11 @@ impl Algorithm<Ed25519> for ClsagMultisig {
|
|||||||
|
|
||||||
let key_image_share = self.key_image_shares[&verification_share.to_bytes()];
|
let key_image_share = self.key_image_shares[&verification_share.to_bytes()];
|
||||||
|
|
||||||
// Hash every variable relevant here, using the hash output as the random weight
|
// Hash every variable relevant here, using the hahs output as the random weight
|
||||||
let mut weight_transcript =
|
let mut weight_transcript =
|
||||||
RecommendedTranscript::new(b"monero-serai v0.1 ClsagMultisig::verify_share");
|
RecommendedTranscript::new(b"monero-serai v0.1 ClsagMultisig::verify_share");
|
||||||
weight_transcript.append_message(b"G", dfg::EdwardsPoint::generator().to_bytes());
|
weight_transcript.append_message(b"G", dfg::EdwardsPoint::generator().to_bytes());
|
||||||
weight_transcript.append_message(b"H", self.key_image_generator.to_bytes());
|
weight_transcript.append_message(b"H", self.H.to_bytes());
|
||||||
weight_transcript.append_message(b"xG", verification_share.to_bytes());
|
weight_transcript.append_message(b"xG", verification_share.to_bytes());
|
||||||
weight_transcript.append_message(b"xH", key_image_share.to_bytes());
|
weight_transcript.append_message(b"xH", key_image_share.to_bytes());
|
||||||
weight_transcript.append_message(b"rG", nonces[0][0].to_bytes());
|
weight_transcript.append_message(b"rG", nonces[0][0].to_bytes());
|
||||||
@@ -367,7 +315,7 @@ impl Algorithm<Ed25519> for ClsagMultisig {
|
|||||||
];
|
];
|
||||||
|
|
||||||
let mut part_two = vec![
|
let mut part_two = vec![
|
||||||
(weight * share, dfg::EdwardsPoint(self.key_image_generator)),
|
(weight * share, dfg::EdwardsPoint(self.H)),
|
||||||
// -(R.1 - pK) == -R.1 + pK
|
// -(R.1 - pK) == -R.1 + pK
|
||||||
(-weight, nonces[0][1]),
|
(-weight, nonces[0][1]),
|
||||||
(weight * dfg::Scalar(interim.p), key_image_share),
|
(weight * dfg::Scalar(interim.p), key_image_share),
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user