26 Commits

Author SHA1 Message Date
akildemir
929e66c607 add swap-to-staked-sri feature 2024-05-16 15:57:03 +03:00
akildemir
904c6ddbe3 Merge branch 'emissions' of https://github.com/akildemir/serai into block-emissions 2024-05-16 11:35:56 +03:00
akildemir
929d0bf48c Merge branch 'develop' of https://github.com/akildemir/serai into emissions 2024-05-16 11:35:28 +03:00
akildemir
b8a9d204db fix clippy 2024-05-10 14:57:19 +03:00
akildemir
317b92983f test whole pre ec security emissions 2024-05-10 14:54:10 +03:00
akildemir
30df83786e add initial reward era test 2024-05-10 12:22:33 +03:00
akildemir
971b93b43d only create the pool when adding liquidity first time 2024-05-10 12:14:07 +03:00
akildemir
1d5a53dad4 add fast-epoch feature 2024-05-05 11:49:37 +03:00
akildemir
3ed6bd3b76 fix licencing 2024-05-05 11:46:37 +03:00
akildemir
33fcd27dd1 Merge branch 'emissions' of https://github.com/akildemir/serai into block-emissions 2024-05-03 13:50:52 +03:00
akildemir
04fcb2bba3 fix rotation test 2024-05-03 13:34:01 +03:00
akildemir
90a5232bbd Merge branch 'develop' of https://github.com/serai-dex/serai into emissions 2024-05-03 12:08:52 +03:00
akildemir
20cf4c930c updato develop latest 2024-04-30 10:00:21 +03:00
akildemir
7ecbfde936 Merge branch 'develop' of https://github.com/serai-dex/serai into emissions 2024-04-30 09:42:04 +03:00
akildemir
926ddd09db add genesis liquidity test & misc fixes 2024-04-29 23:19:55 +03:00
akildemir
826f9986e4 implement setting initial values for coins 2024-04-20 10:53:25 +03:00
akildemir
7041dbeb0b make remove liquidity an authorized call 2024-04-17 13:54:23 +03:00
akildemir
df774d153c Merge branch 'develop' of https://github.com/serai-dex/serai into emissions 2024-04-17 13:34:46 +03:00
akildemir
1cd9868433 implement block emissions 2024-04-09 11:14:07 +03:00
akildemir
8be0538eba fix fmt 2024-04-09 10:51:28 +03:00
akildemir
c32040240c make math safer 2024-04-08 12:08:48 +03:00
akildemir
207f2bd28a minor fixes 2024-03-29 11:38:48 +03:00
akildemir
2b32fe90ca fix CI issues 2024-03-28 11:06:04 +03:00
akildemir
b9df73e418 add missing deposit event 2024-03-27 15:26:14 +03:00
akildemir
da51543588 Merge branch 'develop' of https://github.com/serai-dex/serai into emissions 2024-03-27 15:16:39 +03:00
akildemir
c1bcb0f6c7 add genesis liquidity implementation 2024-03-27 14:46:15 +03:00
512 changed files with 67160 additions and 14752 deletions

View File

@@ -12,7 +12,7 @@ runs:
steps: steps:
- name: Bitcoin Daemon Cache - name: Bitcoin Daemon Cache
id: cache-bitcoind id: cache-bitcoind
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809 uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
with: with:
path: bitcoin.tar.gz path: bitcoin.tar.gz
key: bitcoind-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }} key: bitcoind-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
@@ -37,4 +37,4 @@ runs:
- name: Bitcoin Regtest Daemon - name: Bitcoin Regtest Daemon
shell: bash shell: bash
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/bitcoin/run.sh -daemon run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/bitcoin/run.sh -daemon

View File

@@ -7,20 +7,13 @@ runs:
- name: Remove unused packages - name: Remove unused packages
shell: bash shell: bash
run: | run: |
# Ensure the repositories are synced sudo apt remove -y "*msbuild*" "*powershell*" "*nuget*" "*bazel*" "*ansible*" "*terraform*" "*heroku*" "*aws*" azure-cli
sudo apt update -y
# Actually perform the removals
sudo apt remove -y "*powershell*" "*nuget*" "*bazel*" "*ansible*" "*terraform*" "*heroku*" "*aws*" azure-cli
sudo apt remove -y "*nodejs*" "*npm*" "*yarn*" "*java*" "*kotlin*" "*golang*" "*swift*" "*julia*" "*fortran*" "*android*" sudo apt remove -y "*nodejs*" "*npm*" "*yarn*" "*java*" "*kotlin*" "*golang*" "*swift*" "*julia*" "*fortran*" "*android*"
sudo apt remove -y "*apache2*" "*nginx*" "*firefox*" "*chromium*" "*chrome*" "*edge*" sudo apt remove -y "*apache2*" "*nginx*" "*firefox*" "*chromium*" "*chrome*" "*edge*"
sudo apt remove -y --allow-remove-essential -f shim-signed *python3*
# This removal command requires the prior removals due to unmet dependencies otherwise
sudo apt remove -y "*qemu*" "*sql*" "*texinfo*" "*imagemagick*" sudo apt remove -y "*qemu*" "*sql*" "*texinfo*" "*imagemagick*"
sudo apt autoremove -y
# Reinstall python3 as a general dependency of a functional operating system sudo apt clean
sudo apt install -y python3 --fix-missing docker system prune -a --volumes
if: runner.os == 'Linux' if: runner.os == 'Linux'
- name: Remove unused packages - name: Remove unused packages
@@ -38,48 +31,19 @@ runs:
shell: bash shell: bash
run: | run: |
if [ "$RUNNER_OS" == "Linux" ]; then if [ "$RUNNER_OS" == "Linux" ]; then
sudo apt install -y ca-certificates protobuf-compiler libclang-dev sudo apt install -y ca-certificates protobuf-compiler
elif [ "$RUNNER_OS" == "Windows" ]; then elif [ "$RUNNER_OS" == "Windows" ]; then
choco install protoc choco install protoc
elif [ "$RUNNER_OS" == "macOS" ]; then elif [ "$RUNNER_OS" == "macOS" ]; then
brew install protobuf llvm brew install protobuf
HOMEBREW_ROOT_PATH=/opt/homebrew # Apple Silicon
if [ $(uname -m) = "x86_64" ]; then HOMEBREW_ROOT_PATH=/usr/local; fi # Intel
ls $HOMEBREW_ROOT_PATH/opt/llvm/lib | grep "libclang.dylib" # Make sure this installed `libclang`
echo "DYLD_LIBRARY_PATH=$HOMEBREW_ROOT_PATH/opt/llvm/lib:$DYLD_LIBRARY_PATH" >> "$GITHUB_ENV"
fi fi
- name: Install solc - name: Install solc
shell: bash shell: bash
run: | run: |
cargo +1.89 install svm-rs --version =0.5.18 cargo install svm-rs
svm install 0.8.26 svm install 0.8.25
svm use 0.8.26 svm use 0.8.25
- name: Remove preinstalled Docker
shell: bash
run: |
docker system prune -a --volumes
sudo apt remove -y *docker*
# Install uidmap which will be required for the explicitly installed Docker
sudo apt install uidmap
if: runner.os == 'Linux'
- name: Update system dependencies
shell: bash
run: |
sudo apt update -y
sudo apt upgrade -y
sudo apt autoremove -y
sudo apt clean
if: runner.os == 'Linux'
- name: Install rootless Docker
uses: docker/setup-docker-action@b60f85385d03ac8acfca6d9996982511d8620a19
with:
rootless: true
set-host: true
if: runner.os == 'Linux'
# - name: Cache Rust # - name: Cache Rust
# uses: Swatinem/rust-cache@a95ba195448af2da9b00fb742d14ffaaf3c21f43 # uses: Swatinem/rust-cache@a95ba195448af2da9b00fb742d14ffaaf3c21f43

View File

@@ -5,14 +5,14 @@ inputs:
version: version:
description: "Version to download and run" description: "Version to download and run"
required: false required: false
default: v0.18.3.4 default: v0.18.3.1
runs: runs:
using: "composite" using: "composite"
steps: steps:
- name: Monero Wallet RPC Cache - name: Monero Wallet RPC Cache
id: cache-monero-wallet-rpc id: cache-monero-wallet-rpc
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809 uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
with: with:
path: monero-wallet-rpc path: monero-wallet-rpc
key: monero-wallet-rpc-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }} key: monero-wallet-rpc-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}

View File

@@ -5,14 +5,14 @@ inputs:
version: version:
description: "Version to download and run" description: "Version to download and run"
required: false required: false
default: v0.18.3.4 default: v0.18.3.1
runs: runs:
using: "composite" using: "composite"
steps: steps:
- name: Monero Daemon Cache - name: Monero Daemon Cache
id: cache-monerod id: cache-monerod
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809 uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
with: with:
path: /usr/bin/monerod path: /usr/bin/monerod
key: monerod-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }} key: monerod-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
@@ -43,4 +43,4 @@ runs:
- name: Monero Regtest Daemon - name: Monero Regtest Daemon
shell: bash shell: bash
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/monero/run.sh --detach run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/monero/run.sh --detach

View File

@@ -5,12 +5,12 @@ inputs:
monero-version: monero-version:
description: "Monero version to download and run as a regtest node" description: "Monero version to download and run as a regtest node"
required: false required: false
default: v0.18.3.4 default: v0.18.3.1
bitcoin-version: bitcoin-version:
description: "Bitcoin version to download and run as a regtest node" description: "Bitcoin version to download and run as a regtest node"
required: false required: false
default: "27.1" default: "27.0"
runs: runs:
using: "composite" using: "composite"

View File

@@ -1 +1 @@
nightly-2025-11-01 nightly-2024-05-01

View File

@@ -1,4 +1,4 @@
name: networks/ Tests name: coins/ Tests
on: on:
push: push:
@@ -7,18 +7,18 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
pull_request: pull_request:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
workflow_dispatch: workflow_dispatch:
jobs: jobs:
test-networks: test-coins:
runs-on: ubuntu-latest runs-on: ubuntu-latest
steps: steps:
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac - uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
@@ -32,4 +32,5 @@ jobs:
-p bitcoin-serai \ -p bitcoin-serai \
-p alloy-simple-request-transport \ -p alloy-simple-request-transport \
-p ethereum-serai \ -p ethereum-serai \
-p serai-ethereum-relayer \ -p monero-generators \
-p monero-serai

View File

@@ -27,7 +27,6 @@ jobs:
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \ GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
-p std-shims \ -p std-shims \
-p zalloc \ -p zalloc \
-p patchable-async-sleep \
-p serai-db \ -p serai-db \
-p serai-env \ -p serai-env \
-p simple-request -p simple-request

View File

@@ -7,7 +7,7 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "message-queue/**" - "message-queue/**"
- "coordinator/**" - "coordinator/**"
- "orchestration/**" - "orchestration/**"
@@ -18,7 +18,7 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "message-queue/**" - "message-queue/**"
- "coordinator/**" - "coordinator/**"
- "orchestration/**" - "orchestration/**"
@@ -37,4 +37,4 @@ jobs:
uses: ./.github/actions/build-dependencies uses: ./.github/actions/build-dependencies
- name: Run coordinator Docker tests - name: Run coordinator Docker tests
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-coordinator-tests run: cd tests/coordinator && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features

View File

@@ -32,15 +32,9 @@ jobs:
-p dalek-ff-group \ -p dalek-ff-group \
-p minimal-ed448 \ -p minimal-ed448 \
-p ciphersuite \ -p ciphersuite \
-p ciphersuite-kp256 \
-p multiexp \ -p multiexp \
-p schnorr-signatures \ -p schnorr-signatures \
-p dleq \ -p dleq \
-p dkg \ -p dkg \
-p dkg-recovery \
-p dkg-dealer \
-p dkg-promote \
-p dkg-musig \
-p dkg-pedpop \
-p modular-frost \ -p modular-frost \
-p frost-schnorrkel -p frost-schnorrkel

View File

@@ -12,13 +12,13 @@ jobs:
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac - uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
- name: Advisory Cache - name: Advisory Cache
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809 uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
with: with:
path: ~/.cargo/advisory-db path: ~/.cargo/advisory-db
key: rust-advisory-db key: rust-advisory-db
- name: Install cargo deny - name: Install cargo deny
run: cargo +1.89 install cargo-deny --version =0.18.3 run: cargo install --locked cargo-deny
- name: Run cargo deny - name: Run cargo deny
run: cargo deny -L error --all-features check --hide-inclusion-graph run: cargo deny -L error --all-features check

View File

@@ -19,4 +19,4 @@ jobs:
uses: ./.github/actions/build-dependencies uses: ./.github/actions/build-dependencies
- name: Run Full Stack Docker tests - name: Run Full Stack Docker tests
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-full-stack-tests run: cd tests/full-stack && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features

View File

@@ -11,7 +11,7 @@ jobs:
clippy: clippy:
strategy: strategy:
matrix: matrix:
os: [ubuntu-latest, macos-15-intel, macos-latest, windows-latest] os: [ubuntu-latest, macos-13, macos-14, windows-latest]
runs-on: ${{ matrix.os }} runs-on: ${{ matrix.os }}
steps: steps:
@@ -26,7 +26,7 @@ jobs:
uses: ./.github/actions/build-dependencies uses: ./.github/actions/build-dependencies
- name: Install nightly rust - name: Install nightly rust
run: rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32v1-none -c rust-src -c clippy run: rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32-unknown-unknown -c clippy
- name: Run Clippy - name: Run Clippy
run: cargo +${{ steps.nightly.outputs.version }} clippy --all-features --all-targets -- -D warnings -A clippy::items_after_test_module run: cargo +${{ steps.nightly.outputs.version }} clippy --all-features --all-targets -- -D warnings -A clippy::items_after_test_module
@@ -46,16 +46,16 @@ jobs:
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac - uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
- name: Advisory Cache - name: Advisory Cache
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809 uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
with: with:
path: ~/.cargo/advisory-db path: ~/.cargo/advisory-db
key: rust-advisory-db key: rust-advisory-db
- name: Install cargo deny - name: Install cargo deny
run: cargo +1.89 install cargo-deny --version =0.18.4 run: cargo install --locked cargo-deny
- name: Run cargo deny - name: Run cargo deny
run: cargo deny -L error --all-features check --hide-inclusion-graph run: cargo deny -L error --all-features check
fmt: fmt:
runs-on: ubuntu-latest runs-on: ubuntu-latest
@@ -79,5 +79,5 @@ jobs:
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac - uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
- name: Verify all dependencies are in use - name: Verify all dependencies are in use
run: | run: |
cargo +1.89 install cargo-machete --version =0.8.0 cargo install cargo-machete
cargo +1.89 machete cargo machete

View File

@@ -33,4 +33,4 @@ jobs:
uses: ./.github/actions/build-dependencies uses: ./.github/actions/build-dependencies
- name: Run message-queue Docker tests - name: Run message-queue Docker tests
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-message-queue-tests run: cd tests/message-queue && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features

56
.github/workflows/monero-tests.yaml vendored Normal file
View File

@@ -0,0 +1,56 @@
name: Monero Tests
on:
push:
branches:
- develop
paths:
- "coins/monero/**"
- "processor/**"
pull_request:
paths:
- "coins/monero/**"
- "processor/**"
workflow_dispatch:
jobs:
# Only run these once since they will be consistent regardless of any node
unit-tests:
runs-on: ubuntu-latest
steps:
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
- name: Test Dependencies
uses: ./.github/actions/test-dependencies
- name: Run Unit Tests Without Features
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --lib
# Doesn't run unit tests with features as the tests workflow will
integration-tests:
runs-on: ubuntu-latest
# Test against all supported protocol versions
strategy:
matrix:
version: [v0.17.3.2, v0.18.2.0]
steps:
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
- name: Test Dependencies
uses: ./.github/actions/test-dependencies
with:
monero-version: ${{ matrix.version }}
- name: Run Integration Tests Without Features
# Runs with the binaries feature so the binaries build
# https://github.com/rust-lang/cargo/issues/8396
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --features binaries --test '*'
- name: Run Integration Tests
# Don't run if the the tests workflow also will
if: ${{ matrix.version != 'v0.18.2.0' }}
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --all-features --test '*'

View File

@@ -7,14 +7,14 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "tests/no-std/**" - "tests/no-std/**"
pull_request: pull_request:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "tests/no-std/**" - "tests/no-std/**"
workflow_dispatch: workflow_dispatch:
@@ -32,4 +32,4 @@ jobs:
run: sudo apt update && sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib && rustup target add riscv32imac-unknown-none-elf run: sudo apt update && sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib && rustup target add riscv32imac-unknown-none-elf
- name: Verify no-std builds - name: Verify no-std builds
run: CFLAGS=-I/usr/include cargo build --target riscv32imac-unknown-none-elf -p serai-no-std-tests run: cd tests/no-std && CFLAGS=-I/usr/include cargo build --target riscv32imac-unknown-none-elf

View File

@@ -1,7 +1,6 @@
# MIT License # MIT License
# #
# Copyright (c) 2022 just-the-docs # Copyright (c) 2022 just-the-docs
# Copyright (c) 2022-2024 Luke Parker
# #
# Permission is hereby granted, free of charge, to any person obtaining a copy # Permission is hereby granted, free of charge, to any person obtaining a copy
# of this software and associated documentation files (the "Software"), to deal # of this software and associated documentation files (the "Software"), to deal
@@ -21,21 +20,31 @@
# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
# SOFTWARE. # SOFTWARE.
name: Deploy Rust docs and Jekyll site to Pages # This workflow uses actions that are not certified by GitHub.
# They are provided by a third-party and are governed by
# separate terms of service, privacy policy, and support
# documentation.
# Sample workflow for building and deploying a Jekyll site to GitHub Pages
name: Deploy Jekyll site to Pages
on: on:
push: push:
branches: branches:
- "develop" - "develop"
paths:
- "docs/**"
# Allows you to run this workflow manually from the Actions tab
workflow_dispatch: workflow_dispatch:
# Sets permissions of the GITHUB_TOKEN to allow deployment to GitHub Pages
permissions: permissions:
contents: read contents: read
pages: write pages: write
id-token: write id-token: write
# Only allow one concurrent deployment # Allow one concurrent deployment
concurrency: concurrency:
group: "pages" group: "pages"
cancel-in-progress: true cancel-in-progress: true
@@ -44,37 +53,27 @@ jobs:
# Build job # Build job
build: build:
runs-on: ubuntu-latest runs-on: ubuntu-latest
defaults:
run:
working-directory: docs
steps: steps:
- name: Checkout - name: Checkout
uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac uses: actions/checkout@v3
- name: Setup Ruby - name: Setup Ruby
uses: ruby/setup-ruby@44511735964dcb71245e7e55f72539531f7bc0eb uses: ruby/setup-ruby@v1
with: with:
bundler-cache: true bundler-cache: true
cache-version: 0 cache-version: 0
working-directory: "${{ github.workspace }}/docs" working-directory: "${{ github.workspace }}/docs"
- name: Setup Pages - name: Setup Pages
id: pages id: pages
uses: actions/configure-pages@983d7736d9b0ae728b81ab479565c72886d7745b uses: actions/configure-pages@v3
- name: Build with Jekyll - name: Build with Jekyll
run: cd ${{ github.workspace }}/docs && bundle exec jekyll build --baseurl "${{ steps.pages.outputs.base_path }}" run: bundle exec jekyll build --baseurl "${{ steps.pages.outputs.base_path }}"
env: env:
JEKYLL_ENV: production JEKYLL_ENV: production
- name: Get nightly version to use
id: nightly
shell: bash
run: echo "version=$(cat .github/nightly-version)" >> $GITHUB_OUTPUT
- name: Build Dependencies
uses: ./.github/actions/build-dependencies
- name: Buld Rust docs
run: |
rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32v1-none -c rust-docs
RUSTDOCFLAGS="--cfg docsrs" cargo +${{ steps.nightly.outputs.version }} doc --workspace --no-deps --all-features
mv target/doc docs/_site/rust
- name: Upload artifact - name: Upload artifact
uses: actions/upload-pages-artifact@7b1f4a764d45c48632c6b24a0339c27f5614fb0b uses: actions/upload-pages-artifact@v1
with: with:
path: "docs/_site/" path: "docs/_site/"
@@ -88,4 +87,4 @@ jobs:
steps: steps:
- name: Deploy to GitHub Pages - name: Deploy to GitHub Pages
id: deployment id: deployment
uses: actions/deploy-pages@d6db90164ac5ed86f2b6aed7e0febac5b3c0c03e uses: actions/deploy-pages@v2

View File

@@ -7,7 +7,7 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "message-queue/**" - "message-queue/**"
- "processor/**" - "processor/**"
- "orchestration/**" - "orchestration/**"
@@ -18,7 +18,7 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "message-queue/**" - "message-queue/**"
- "processor/**" - "processor/**"
- "orchestration/**" - "orchestration/**"
@@ -37,4 +37,4 @@ jobs:
uses: ./.github/actions/build-dependencies uses: ./.github/actions/build-dependencies
- name: Run processor Docker tests - name: Run processor Docker tests
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-processor-tests run: cd tests/processor && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features

View File

@@ -33,4 +33,4 @@ jobs:
uses: ./.github/actions/build-dependencies uses: ./.github/actions/build-dependencies
- name: Run Reproducible Runtime tests - name: Run Reproducible Runtime tests
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-reproducible-runtime-tests run: cd tests/reproducible-runtime && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features

View File

@@ -7,7 +7,7 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "message-queue/**" - "message-queue/**"
- "processor/**" - "processor/**"
- "coordinator/**" - "coordinator/**"
@@ -17,7 +17,7 @@ on:
paths: paths:
- "common/**" - "common/**"
- "crypto/**" - "crypto/**"
- "networks/**" - "coins/**"
- "message-queue/**" - "message-queue/**"
- "processor/**" - "processor/**"
- "coordinator/**" - "coordinator/**"
@@ -63,11 +63,6 @@ jobs:
-p serai-dex-pallet \ -p serai-dex-pallet \
-p serai-validator-sets-primitives \ -p serai-validator-sets-primitives \
-p serai-validator-sets-pallet \ -p serai-validator-sets-pallet \
-p serai-genesis-liquidity-primitives \
-p serai-genesis-liquidity-pallet \
-p serai-emissions-primitives \
-p serai-emissions-pallet \
-p serai-economic-security-pallet \
-p serai-in-instructions-primitives \ -p serai-in-instructions-primitives \
-p serai-in-instructions-pallet \ -p serai-in-instructions-pallet \
-p serai-signals-primitives \ -p serai-signals-primitives \

7
.gitignore vendored
View File

@@ -1,14 +1,7 @@
target target
# Don't commit any `Cargo.lock` which aren't the workspace's
Cargo.lock
!./Cargo.lock
# Don't commit any `Dockerfile`, as they're auto-generated, except the only one which isn't
Dockerfile Dockerfile
Dockerfile.fast-epoch Dockerfile.fast-epoch
!orchestration/runtime/Dockerfile !orchestration/runtime/Dockerfile
.test-logs .test-logs
.vscode .vscode

7318
Cargo.lock generated

File diff suppressed because it is too large Load Diff

View File

@@ -1,8 +1,14 @@
[workspace] [workspace]
resolver = "2" resolver = "2"
members = [ members = [
# Version patches
"patches/zstd",
"patches/rocksdb",
"patches/proc-macro-crate",
# std patches # std patches
"patches/matches", "patches/matches",
"patches/is-terminal",
# Rewrites/redirects # Rewrites/redirects
"patches/option-ext", "patches/option-ext",
@@ -10,7 +16,6 @@ members = [
"common/std-shims", "common/std-shims",
"common/zalloc", "common/zalloc",
"common/patchable-async-sleep",
"common/db", "common/db",
"common/env", "common/env",
"common/request", "common/request",
@@ -21,26 +26,20 @@ members = [
"crypto/dalek-ff-group", "crypto/dalek-ff-group",
"crypto/ed448", "crypto/ed448",
"crypto/ciphersuite", "crypto/ciphersuite",
"crypto/ciphersuite/kp256",
"crypto/multiexp", "crypto/multiexp",
"crypto/schnorr", "crypto/schnorr",
"crypto/dleq", "crypto/dleq",
"crypto/dkg", "crypto/dkg",
"crypto/dkg/recovery",
"crypto/dkg/dealer",
"crypto/dkg/promote",
"crypto/dkg/musig",
"crypto/dkg/pedpop",
"crypto/frost", "crypto/frost",
"crypto/schnorrkel", "crypto/schnorrkel",
"networks/bitcoin", "coins/bitcoin",
"coins/ethereum/alloy-simple-request-transport",
"networks/ethereum/alloy-simple-request-transport", "coins/ethereum",
"networks/ethereum", "coins/monero/generators",
"networks/ethereum/relayer", "coins/monero",
"message-queue", "message-queue",
@@ -56,22 +55,12 @@ members = [
"substrate/coins/primitives", "substrate/coins/primitives",
"substrate/coins/pallet", "substrate/coins/pallet",
"substrate/dex/pallet", "substrate/in-instructions/primitives",
"substrate/in-instructions/pallet",
"substrate/validator-sets/primitives", "substrate/validator-sets/primitives",
"substrate/validator-sets/pallet", "substrate/validator-sets/pallet",
"substrate/genesis-liquidity/primitives",
"substrate/genesis-liquidity/pallet",
"substrate/emissions/primitives",
"substrate/emissions/pallet",
"substrate/economic-security/pallet",
"substrate/in-instructions/primitives",
"substrate/in-instructions/pallet",
"substrate/signals/primitives", "substrate/signals/primitives",
"substrate/signals/pallet", "substrate/signals/pallet",
@@ -111,26 +100,29 @@ minimal-ed448 = { opt-level = 3 }
multiexp = { opt-level = 3 } multiexp = { opt-level = 3 }
monero-oxide = { opt-level = 3 } monero-serai = { opt-level = 3 }
[profile.release] [profile.release]
panic = "unwind" panic = "unwind"
overflow-checks = true
[patch.crates-io] [patch.crates-io]
# Dependencies from monero-oxide which originate from within our own tree
std-shims = { path = "common/std-shims" }
simple-request = { path = "common/request" }
dalek-ff-group = { path = "crypto/dalek-ff-group" }
flexible-transcript = { path = "crypto/transcript" }
modular-frost = { path = "crypto/frost" }
# https://github.com/rust-lang-nursery/lazy-static.rs/issues/201 # https://github.com/rust-lang-nursery/lazy-static.rs/issues/201
lazy_static = { git = "https://github.com/rust-lang-nursery/lazy-static.rs", rev = "5735630d46572f1e5377c8f2ba0f79d18f53b10c" } lazy_static = { git = "https://github.com/rust-lang-nursery/lazy-static.rs", rev = "5735630d46572f1e5377c8f2ba0f79d18f53b10c" }
# These have `std` alternatives # Needed due to dockertest's usage of `Rc`s when we need `Arc`s
dockertest = { git = "https://github.com/orcalabs/dockertest-rs", rev = "4dd6ae24738aa6dc5c89444cc822ea4745517493" }
# wasmtime pulls in an old version for this
zstd = { path = "patches/zstd" }
# Needed for WAL compression
rocksdb = { path = "patches/rocksdb" }
# proc-macro-crate 2 binds to an old version of toml for msrv so we patch to 3
proc-macro-crate = { path = "patches/proc-macro-crate" }
# is-terminal now has an std-based solution with an equivalent API
is-terminal = { path = "patches/is-terminal" }
# So does matches
matches = { path = "patches/matches" } matches = { path = "patches/matches" }
home = { path = "patches/home" }
# directories-next was created because directories was unmaintained # directories-next was created because directories was unmaintained
# directories-next is now unmaintained while directories is maintained # directories-next is now unmaintained while directories is maintained
@@ -141,10 +133,7 @@ option-ext = { path = "patches/option-ext" }
directories-next = { path = "patches/directories-next" } directories-next = { path = "patches/directories-next" }
[workspace.lints.clippy] [workspace.lints.clippy]
uninlined_format_args = "allow" # TODO
unwrap_or_default = "allow" unwrap_or_default = "allow"
manual_is_multiple_of = "allow"
incompatible_msrv = "allow" # Manually verified with a GitHub workflow
borrow_as_ptr = "deny" borrow_as_ptr = "deny"
cast_lossless = "deny" cast_lossless = "deny"
cast_possible_truncation = "deny" cast_possible_truncation = "deny"
@@ -169,14 +158,14 @@ large_stack_arrays = "deny"
linkedlist = "deny" linkedlist = "deny"
macro_use_imports = "deny" macro_use_imports = "deny"
manual_instant_elapsed = "deny" manual_instant_elapsed = "deny"
# TODO manual_let_else = "deny" manual_let_else = "deny"
manual_ok_or = "deny" manual_ok_or = "deny"
manual_string_new = "deny" manual_string_new = "deny"
map_unwrap_or = "deny" map_unwrap_or = "deny"
match_bool = "deny" match_bool = "deny"
match_same_arms = "deny" match_same_arms = "deny"
missing_fields_in_debug = "deny" missing_fields_in_debug = "deny"
# TODO needless_continue = "deny" needless_continue = "deny"
needless_pass_by_value = "deny" needless_pass_by_value = "deny"
ptr_cast_constness = "deny" ptr_cast_constness = "deny"
range_minus_one = "deny" range_minus_one = "deny"
@@ -184,7 +173,8 @@ range_plus_one = "deny"
redundant_closure_for_method_calls = "deny" redundant_closure_for_method_calls = "deny"
redundant_else = "deny" redundant_else = "deny"
string_add_assign = "deny" string_add_assign = "deny"
unchecked_time_subtraction = "deny" unchecked_duration_subtraction = "deny"
uninlined_format_args = "deny"
unnecessary_box_returns = "deny" unnecessary_box_returns = "deny"
unnecessary_join = "deny" unnecessary_join = "deny"
unnecessary_wraps = "deny" unnecessary_wraps = "deny"
@@ -192,21 +182,3 @@ unnested_or_patterns = "deny"
unused_async = "deny" unused_async = "deny"
unused_self = "deny" unused_self = "deny"
zero_sized_map_values = "deny" zero_sized_map_values = "deny"
# TODO: These were incurred when updating Rust as necessary for compilation, yet aren't being fixed
# at this time due to the impacts it'd have throughout the repository (when this isn't actively the
# primary branch, `next` is)
needless_continue = "allow"
needless_lifetimes = "allow"
useless_conversion = "allow"
empty_line_after_doc_comments = "allow"
manual_div_ceil = "allow"
manual_let_else = "allow"
unnecessary_map_or = "allow"
result_large_err = "allow"
unneeded_struct_pattern = "allow"
[workspace.lints.rust]
unused = "allow" # TODO: https://github.com/rust-lang/rust/issues/147648
mismatched_lifetime_syntaxes = "allow"
unused_attributes = "allow"
unused_parens = "allow"

View File

@@ -5,4 +5,4 @@ a full copy of the AGPL-3.0 License is included in the root of this repository
as a reference text. This copy should be provided with any distribution of a as a reference text. This copy should be provided with any distribution of a
crate licensed under the AGPL-3.0, as per its terms. crate licensed under the AGPL-3.0, as per its terms.
The GitHub actions/workflows (`.github`) are licensed under the MIT license. The GitHub actions (`.github/actions`) are licensed under the MIT license.

View File

@@ -24,7 +24,7 @@ wallet.
infrastructure, to our IETF-compliant FROST implementation, to a DLEq proof as infrastructure, to our IETF-compliant FROST implementation, to a DLEq proof as
needed for Bitcoin-Monero atomic swaps. needed for Bitcoin-Monero atomic swaps.
- `networks`: Various libraries intended for usage in Serai yet also by the - `coins`: Various coin libraries intended for usage in Serai yet also by the
wider community. This means they will always support the functionality Serai wider community. This means they will always support the functionality Serai
needs, yet won't disadvantage other use cases when possible. needs, yet won't disadvantage other use cases when possible.
@@ -59,6 +59,7 @@ issued at the discretion of the Immunefi program managers.
- [Website](https://serai.exchange/): https://serai.exchange/ - [Website](https://serai.exchange/): https://serai.exchange/
- [Immunefi](https://immunefi.com/bounty/serai/): https://immunefi.com/bounty/serai/ - [Immunefi](https://immunefi.com/bounty/serai/): https://immunefi.com/bounty/serai/
- [Twitter](https://twitter.com/SeraiDEX): https://twitter.com/SeraiDEX - [Twitter](https://twitter.com/SeraiDEX): https://twitter.com/SeraiDEX
- [Mastodon](https://cryptodon.lol/@serai): https://cryptodon.lol/@serai
- [Discord](https://discord.gg/mpEUtJR3vz): https://discord.gg/mpEUtJR3vz - [Discord](https://discord.gg/mpEUtJR3vz): https://discord.gg/mpEUtJR3vz
- [Matrix](https://matrix.to/#/#serai:matrix.org): https://matrix.to/#/#serai:matrix.org - [Matrix](https://matrix.to/#/#serai:matrix.org): https://matrix.to/#/#serai:matrix.org
- [Reddit](https://www.reddit.com/r/SeraiDEX/): https://www.reddit.com/r/SeraiDEX/ - [Reddit](https://www.reddit.com/r/SeraiDEX/): https://www.reddit.com/r/SeraiDEX/

View File

@@ -0,0 +1,6 @@
# Cypher Stack /coins/bitcoin Audit, August 2023
This audit was over the /coins/bitcoin folder. It is encompassing up to commit
5121ca75199dff7bd34230880a1fdd793012068c.
Please see https://github.com/cypherstack/serai-btc-audit for provenance.

View File

@@ -1,7 +0,0 @@
# Cypher Stack /networks/bitcoin Audit, August 2023
This audit was over the `/networks/bitcoin` folder (at the time located at
`/coins/bitcoin`). It is encompassing up to commit
5121ca75199dff7bd34230880a1fdd793012068c.
Please see https://github.com/cypherstack/serai-btc-audit for provenance.

View File

@@ -1,12 +1,12 @@
[package] [package]
name = "bitcoin-serai" name = "bitcoin-serai"
version = "0.4.0" version = "0.3.0"
description = "A Bitcoin library for FROST-signing transactions" description = "A Bitcoin library for FROST-signing transactions"
license = "MIT" license = "MIT"
repository = "https://github.com/serai-dex/serai/tree/develop/networks/bitcoin" repository = "https://github.com/serai-dex/serai/tree/develop/coins/bitcoin"
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Vrx <vrx00@proton.me>"] authors = ["Luke Parker <lukeparker5132@gmail.com>", "Vrx <vrx00@proton.me>"]
edition = "2021" edition = "2021"
rust-version = "1.80" rust-version = "1.74"
[package.metadata.docs.rs] [package.metadata.docs.rs]
all-features = true all-features = true
@@ -20,14 +20,15 @@ std-shims = { version = "0.1.1", path = "../../common/std-shims", default-featur
thiserror = { version = "1", default-features = false, optional = true } thiserror = { version = "1", default-features = false, optional = true }
subtle = { version = "2", default-features = false }
zeroize = { version = "^1.5", default-features = false } zeroize = { version = "^1.5", default-features = false }
rand_core = { version = "0.6", default-features = false } rand_core = { version = "0.6", default-features = false }
bitcoin = { version = "0.32", default-features = false } bitcoin = { version = "0.31", default-features = false, features = ["no-std"] }
k256 = { version = "^0.13.1", default-features = false, features = ["arithmetic", "bits"] } k256 = { version = "^0.13.1", default-features = false, features = ["arithmetic", "bits"] }
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.10", default-features = false, features = ["secp256k1"], optional = true }
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["secp256k1"], optional = true }
hex = { version = "0.4", default-features = false, optional = true } hex = { version = "0.4", default-features = false, optional = true }
serde = { version = "1", default-features = false, features = ["derive"], optional = true } serde = { version = "1", default-features = false, features = ["derive"], optional = true }
@@ -35,7 +36,7 @@ serde_json = { version = "1", default-features = false, optional = true }
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls", "basic-auth"], optional = true } simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls", "basic-auth"], optional = true }
[dev-dependencies] [dev-dependencies]
secp256k1 = { version = "0.29", default-features = false, features = ["std"] } secp256k1 = { version = "0.28", default-features = false, features = ["std"] }
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] } frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
@@ -47,7 +48,6 @@ std = [
"thiserror", "thiserror",
"subtle/std",
"zeroize/std", "zeroize/std",
"rand_core/std", "rand_core/std",
@@ -55,6 +55,8 @@ std = [
"bitcoin/serde", "bitcoin/serde",
"k256/std", "k256/std",
"transcript/std",
"frost", "frost",
"hex/std", "hex/std",

View File

@@ -1,5 +1,3 @@
use subtle::{Choice, ConstantTimeEq, ConditionallySelectable};
use k256::{ use k256::{
elliptic_curve::sec1::{Tag, ToEncodedPoint}, elliptic_curve::sec1::{Tag, ToEncodedPoint},
ProjectivePoint, ProjectivePoint,
@@ -7,24 +5,29 @@ use k256::{
use bitcoin::key::XOnlyPublicKey; use bitcoin::key::XOnlyPublicKey;
/// Get the x coordinate of a non-infinity point. /// Get the x coordinate of a non-infinity, even point. Panics on invalid input.
/// pub fn x(key: &ProjectivePoint) -> [u8; 32] {
/// Panics on invalid input.
fn x(key: &ProjectivePoint) -> [u8; 32] {
let encoded = key.to_encoded_point(true); let encoded = key.to_encoded_point(true);
assert_eq!(encoded.tag(), Tag::CompressedEvenY, "x coordinate of odd key");
(*encoded.x().expect("point at infinity")).into() (*encoded.x().expect("point at infinity")).into()
} }
/// Convert a non-infinity point to a XOnlyPublicKey (dropping its sign). /// Convert a non-infinity even point to a XOnlyPublicKey. Panics on invalid input.
/// pub fn x_only(key: &ProjectivePoint) -> XOnlyPublicKey {
/// Panics on invalid input.
pub(crate) fn x_only(key: &ProjectivePoint) -> XOnlyPublicKey {
XOnlyPublicKey::from_slice(&x(key)).expect("x_only was passed a point which was infinity or odd") XOnlyPublicKey::from_slice(&x(key)).expect("x_only was passed a point which was infinity or odd")
} }
/// Return if a point must be negated to have an even Y coordinate and be eligible for use. /// Make a point even by adding the generator until it is even.
pub(crate) fn needs_negation(key: &ProjectivePoint) -> Choice { ///
u8::from(key.to_encoded_point(true).tag()).ct_eq(&u8::from(Tag::CompressedOddY)) /// Returns the even point and the amount of additions required.
#[cfg(any(feature = "std", feature = "hazmat"))]
pub fn make_even(mut key: ProjectivePoint) -> (ProjectivePoint, u64) {
let mut c = 0;
while key.to_encoded_point(true).tag() == Tag::CompressedOddY {
key += ProjectivePoint::GENERATOR;
c += 1;
}
(key, c)
} }
#[cfg(feature = "std")] #[cfg(feature = "std")]
@@ -37,62 +40,58 @@ mod frost_crypto {
use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256}; use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256};
use transcript::Transcript;
use k256::{elliptic_curve::ops::Reduce, U256, Scalar}; use k256::{elliptic_curve::ops::Reduce, U256, Scalar};
use frost::{ use frost::{
curve::{Ciphersuite, Secp256k1}, curve::{Ciphersuite, Secp256k1},
Participant, ThresholdKeys, ThresholdView, FrostError, Participant, ThresholdKeys, ThresholdView, FrostError,
algorithm::{Hram as HramTrait, Algorithm, IetfSchnorr as FrostSchnorr}, algorithm::{Hram as HramTrait, Algorithm, Schnorr as FrostSchnorr},
}; };
use super::*; use super::*;
/// A BIP-340 compatible HRAm for use with the modular-frost Schnorr Algorithm. /// A BIP-340 compatible HRAm for use with the modular-frost Schnorr Algorithm.
/// ///
/// If passed an odd nonce, the challenge will be negated. /// If passed an odd nonce, it will have the generator added until it is even.
/// ///
/// If either `R` or `A` is the point at infinity, this will panic. /// If the key is odd, this will panic.
#[derive(Clone, Copy, Debug)] #[derive(Clone, Copy, Debug)]
pub struct Hram; pub struct Hram;
#[allow(non_snake_case)] #[allow(non_snake_case)]
impl HramTrait<Secp256k1> for Hram { impl HramTrait<Secp256k1> for Hram {
fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar { fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar {
// Convert the nonce to be even
let (R, _) = make_even(*R);
const TAG_HASH: Sha256 = Sha256::const_hash(b"BIP0340/challenge"); const TAG_HASH: Sha256 = Sha256::const_hash(b"BIP0340/challenge");
let mut data = Sha256::engine(); let mut data = Sha256::engine();
data.input(TAG_HASH.as_ref()); data.input(TAG_HASH.as_ref());
data.input(TAG_HASH.as_ref()); data.input(TAG_HASH.as_ref());
data.input(&x(R)); data.input(&x(&R));
data.input(&x(A)); data.input(&x(A));
data.input(m); data.input(m);
let c = Scalar::reduce(U256::from_be_slice(Sha256::from_engine(data).as_ref())); Scalar::reduce(U256::from_be_slice(Sha256::from_engine(data).as_ref()))
// If the nonce was odd, sign `r - cx` instead of `r + cx`, allowing us to negate `s` at the
// end to sign as `-r + cx`
<_>::conditional_select(&c, &-c, needs_negation(R))
} }
} }
/// BIP-340 Schnorr signature algorithm. /// BIP-340 Schnorr signature algorithm.
/// ///
/// This may panic if called with nonces/a group key which are the point at infinity (which have /// This must be used with a ThresholdKeys whose group key is even. If it is odd, this will panic.
/// a negligible probability for a well-reasoned caller, even with malicious participants
/// present).
///
/// `verify`, `verify_share` MUST be called after `sign_share` is called. Otherwise, this library
/// MAY panic.
#[derive(Clone)] #[derive(Clone)]
pub struct Schnorr(FrostSchnorr<Secp256k1, Hram>); pub struct Schnorr<T: Sync + Clone + Debug + Transcript>(FrostSchnorr<Secp256k1, T, Hram>);
impl Schnorr { impl<T: Sync + Clone + Debug + Transcript> Schnorr<T> {
/// Construct a Schnorr algorithm continuing the specified transcript. /// Construct a Schnorr algorithm continuing the specified transcript.
#[allow(clippy::new_without_default)] pub fn new(transcript: T) -> Schnorr<T> {
pub fn new() -> Schnorr { Schnorr(FrostSchnorr::new(transcript))
Schnorr(FrostSchnorr::ietf())
} }
} }
impl Algorithm<Secp256k1> for Schnorr { impl<T: Sync + Clone + Debug + Transcript> Algorithm<Secp256k1> for Schnorr<T> {
type Transcript = <FrostSchnorr<Secp256k1, Hram> as Algorithm<Secp256k1>>::Transcript; type Transcript = T;
type Addendum = (); type Addendum = ();
type Signature = [u8; 64]; type Signature = [u8; 64];
@@ -143,7 +142,11 @@ mod frost_crypto {
sum: Scalar, sum: Scalar,
) -> Option<Self::Signature> { ) -> Option<Self::Signature> {
self.0.verify(group_key, nonces, sum).map(|mut sig| { self.0.verify(group_key, nonces, sum).map(|mut sig| {
sig.s = <_>::conditional_select(&sum, &-sum, needs_negation(&sig.R)); // Make the R of the final signature even
let offset;
(sig.R, offset) = make_even(sig.R);
// s = r + cx. Since we added to the r, add to s
sig.s += Scalar::from(offset);
// Convert to a Bitcoin signature by dropping the byte for the point's sign bit // Convert to a Bitcoin signature by dropping the byte for the point's sign bit
sig.serialize()[1 ..].try_into().unwrap() sig.serialize()[1 ..].try_into().unwrap()
}) })

View File

@@ -1,4 +1,4 @@
#![cfg_attr(docsrs, feature(doc_cfg))] #![cfg_attr(docsrs, feature(doc_auto_cfg))]
#![doc = include_str!("../README.md")] #![doc = include_str!("../README.md")]
#![cfg_attr(not(feature = "std"), no_std)] #![cfg_attr(not(feature = "std"), no_std)]

View File

@@ -195,13 +195,13 @@ impl Rpc {
// If this was already successfully published, consider this having succeeded // If this was already successfully published, consider this having succeeded
if let RpcError::RequestError(Error { code, .. }) = e { if let RpcError::RequestError(Error { code, .. }) = e {
if code == RPC_VERIFY_ALREADY_IN_CHAIN { if code == RPC_VERIFY_ALREADY_IN_CHAIN {
return Ok(tx.compute_txid()); return Ok(tx.txid());
} }
} }
Err(e)? Err(e)?
} }
}; };
if txid != tx.compute_txid() { if txid != tx.txid() {
Err(RpcError::InvalidResponse("returned TX ID inequals calculated TX ID"))?; Err(RpcError::InvalidResponse("returned TX ID inequals calculated TX ID"))?;
} }
Ok(txid) Ok(txid)
@@ -215,7 +215,7 @@ impl Rpc {
let tx: Transaction = encode::deserialize(&bytes) let tx: Transaction = encode::deserialize(&bytes)
.map_err(|_| RpcError::InvalidResponse("node sent an improperly serialized transaction"))?; .map_err(|_| RpcError::InvalidResponse("node sent an improperly serialized transaction"))?;
let mut tx_hash = *tx.compute_txid().as_raw_hash().as_byte_array(); let mut tx_hash = *tx.txid().as_raw_hash().as_byte_array();
tx_hash.reverse(); tx_hash.reverse();
if hash != &tx_hash { if hash != &tx_hash {
Err(RpcError::InvalidResponse("node replied with a different transaction"))?; Err(RpcError::InvalidResponse("node replied with a different transaction"))?;

View File

@@ -2,6 +2,8 @@ use rand_core::OsRng;
use secp256k1::{Secp256k1 as BContext, Message, schnorr::Signature}; use secp256k1::{Secp256k1 as BContext, Message, schnorr::Signature};
use k256::Scalar;
use transcript::{Transcript, RecommendedTranscript};
use frost::{ use frost::{
curve::Secp256k1, curve::Secp256k1,
Participant, Participant,
@@ -10,8 +12,7 @@ use frost::{
use crate::{ use crate::{
bitcoin::hashes::{Hash as HashTrait, sha256::Hash}, bitcoin::hashes::{Hash as HashTrait, sha256::Hash},
crypto::{x_only, Schnorr}, crypto::{x_only, make_even, Schnorr},
wallet::tweak_keys,
}; };
#[test] #[test]
@@ -20,10 +21,12 @@ fn test_algorithm() {
const MESSAGE: &[u8] = b"Hello, World!"; const MESSAGE: &[u8] = b"Hello, World!";
for keys in keys.values_mut() { for keys in keys.values_mut() {
*keys = tweak_keys(keys.clone()); let (_, offset) = make_even(keys.group_key());
*keys = keys.offset(Scalar::from(offset));
} }
let algo = Schnorr::new(); let algo =
Schnorr::<RecommendedTranscript>::new(RecommendedTranscript::new(b"bitcoin-serai sign test"));
let sig = sign( let sig = sign(
&mut OsRng, &mut OsRng,
&algo, &algo,
@@ -36,7 +39,7 @@ fn test_algorithm() {
.verify_schnorr( .verify_schnorr(
&Signature::from_slice(&sig) &Signature::from_slice(&sig)
.expect("couldn't convert produced signature to secp256k1::Signature"), .expect("couldn't convert produced signature to secp256k1::Signature"),
&Message::from_digest_slice(Hash::hash(MESSAGE).as_ref()).unwrap(), &Message::from(Hash::hash(MESSAGE)),
&x_only(&keys[&Participant::new(1).unwrap()].group_key()), &x_only(&keys[&Participant::new(1).unwrap()].group_key()),
) )
.unwrap() .unwrap()

View File

@@ -4,7 +4,7 @@ use std_shims::{
io::{self, Write}, io::{self, Write},
}; };
#[cfg(feature = "std")] #[cfg(feature = "std")]
use std::io::{Read, BufReader}; use std_shims::io::Read;
use k256::{ use k256::{
elliptic_curve::sec1::{Tag, ToEncodedPoint}, elliptic_curve::sec1::{Tag, ToEncodedPoint},
@@ -18,71 +18,40 @@ use frost::{
}; };
use bitcoin::{ use bitcoin::{
consensus::encode::serialize, key::TweakedPublicKey, OutPoint, ScriptBuf, TxOut, Transaction, consensus::encode::serialize, key::TweakedPublicKey, address::Payload, OutPoint, ScriptBuf,
Block, TxOut, Transaction, Block,
}; };
#[cfg(feature = "std")] #[cfg(feature = "std")]
use bitcoin::{hashes::Hash, consensus::encode::Decodable, TapTweakHash}; use bitcoin::consensus::encode::Decodable;
use crate::crypto::x_only; use crate::crypto::x_only;
#[cfg(feature = "std")] #[cfg(feature = "std")]
use crate::crypto::needs_negation; use crate::crypto::make_even;
#[cfg(feature = "std")] #[cfg(feature = "std")]
mod send; mod send;
#[cfg(feature = "std")] #[cfg(feature = "std")]
pub use send::*; pub use send::*;
/// Tweak keys to ensure they're usable with Bitcoin's Taproot upgrade. /// Tweak keys to ensure they're usable with Bitcoin.
/// ///
/// This adds an unspendable script path to the key, preventing any outputs received to this key /// Taproot keys, which these keys are used as, must be even. This offsets the keys until they're
/// from being spent via a script. To have keys which have spendable script paths, further offsets /// even.
/// from this position must be used.
///
/// After adding an unspendable script path, the key is negated if odd.
///
/// This has a neligible probability of returning keys whose group key is the point at infinity.
#[cfg(feature = "std")] #[cfg(feature = "std")]
pub fn tweak_keys(keys: ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> { pub fn tweak_keys(keys: &ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
// Adds the unspendable script path per let (_, offset) = make_even(keys.group_key());
// https://github.com/bitcoin/bips/blob/master/bip-0341.mediawiki#cite_note-23 keys.offset(Scalar::from(offset))
let keys = {
use k256::elliptic_curve::{
bigint::{Encoding, U256},
ops::Reduce,
group::GroupEncoding,
};
let tweak_hash = TapTweakHash::hash(&keys.group_key().to_bytes().as_slice()[1 ..]);
/*
https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki#cite_ref-13-0 states how the
bias is negligible. This reduction shouldn't ever occur, yet if it did, the script path
would be unusable due to a check the script path hash is less than the order. That doesn't
impact us as we don't want the script path to be usable.
*/
keys.offset(<Secp256k1 as Ciphersuite>::F::reduce(U256::from_be_bytes(
*tweak_hash.to_raw_hash().as_ref(),
)))
};
let needs_negation = needs_negation(&keys.group_key());
keys
.scale(<_ as subtle::ConditionallySelectable>::conditional_select(
&Scalar::ONE,
&-Scalar::ONE,
needs_negation,
))
.expect("scaling keys by 1 or -1 yet interpreted as 0?")
} }
/// Return the Taproot address payload for a public key. /// Return the Taproot address payload for a public key.
/// ///
/// If the key is odd, this will return None. /// If the key is odd, this will return None.
pub fn p2tr_script_buf(key: ProjectivePoint) -> Option<ScriptBuf> { pub fn address_payload(key: ProjectivePoint) -> Option<Payload> {
if key.to_encoded_point(true).tag() != Tag::CompressedEvenY { if key.to_encoded_point(true).tag() != Tag::CompressedEvenY {
return None; return None;
} }
Some(ScriptBuf::new_p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key)))) Some(Payload::p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key))))
} }
/// A spendable output. /// A spendable output.
@@ -120,17 +89,11 @@ impl ReceivedOutput {
/// Read a ReceivedOutput from a generic satisfying Read. /// Read a ReceivedOutput from a generic satisfying Read.
#[cfg(feature = "std")] #[cfg(feature = "std")]
pub fn read<R: Read>(r: &mut R) -> io::Result<ReceivedOutput> { pub fn read<R: Read>(r: &mut R) -> io::Result<ReceivedOutput> {
let offset = Secp256k1::read_F(r)?; Ok(ReceivedOutput {
let output; offset: Secp256k1::read_F(r)?,
let outpoint; output: TxOut::consensus_decode(r).map_err(|_| io::Error::other("invalid TxOut"))?,
{ outpoint: OutPoint::consensus_decode(r).map_err(|_| io::Error::other("invalid OutPoint"))?,
let mut buf_r = BufReader::with_capacity(0, r); })
output =
TxOut::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid TxOut"))?;
outpoint =
OutPoint::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid OutPoint"))?;
}
Ok(ReceivedOutput { offset, output, outpoint })
} }
/// Write a ReceivedOutput to a generic satisfying Write. /// Write a ReceivedOutput to a generic satisfying Write.
@@ -161,7 +124,7 @@ impl Scanner {
/// Returns None if this key can't be scanned for. /// Returns None if this key can't be scanned for.
pub fn new(key: ProjectivePoint) -> Option<Scanner> { pub fn new(key: ProjectivePoint) -> Option<Scanner> {
let mut scripts = HashMap::new(); let mut scripts = HashMap::new();
scripts.insert(p2tr_script_buf(key)?, Scalar::ZERO); scripts.insert(address_payload(key)?.script_pubkey(), Scalar::ZERO);
Some(Scanner { key, scripts }) Some(Scanner { key, scripts })
} }
@@ -173,17 +136,14 @@ impl Scanner {
/// ///
/// This means offsets are surjective, not bijective, and the order offsets are registered in /// This means offsets are surjective, not bijective, and the order offsets are registered in
/// may determine the validity of future offsets. /// may determine the validity of future offsets.
///
/// The offsets registered must be securely generated. Arbitrary offsets may introduce a script
/// path into the output, allowing the output to be spent by satisfaction of an arbitrary script
/// (not by the signature of the key).
pub fn register_offset(&mut self, mut offset: Scalar) -> Option<Scalar> { pub fn register_offset(&mut self, mut offset: Scalar) -> Option<Scalar> {
// This loop will terminate as soon as an even point is found, with any point having a ~50% // This loop will terminate as soon as an even point is found, with any point having a ~50%
// chance of being even // chance of being even
// That means this should terminate within a very small amount of iterations // That means this should terminate within a very small amount of iterations
loop { loop {
match p2tr_script_buf(self.key + (ProjectivePoint::GENERATOR * offset)) { match address_payload(self.key + (ProjectivePoint::GENERATOR * offset)) {
Some(script) => { Some(address) => {
let script = address.script_pubkey();
if self.scripts.contains_key(&script) { if self.scripts.contains_key(&script) {
None?; None?;
} }
@@ -206,7 +166,7 @@ impl Scanner {
res.push(ReceivedOutput { res.push(ReceivedOutput {
offset: *offset, offset: *offset,
output: output.clone(), output: output.clone(),
outpoint: OutPoint::new(tx.compute_txid(), vout), outpoint: OutPoint::new(tx.txid(), vout),
}); });
} }
} }

View File

@@ -7,7 +7,9 @@ use thiserror::Error;
use rand_core::{RngCore, CryptoRng}; use rand_core::{RngCore, CryptoRng};
use k256::Scalar; use transcript::{Transcript, RecommendedTranscript};
use k256::{elliptic_curve::sec1::ToEncodedPoint, Scalar};
use frost::{curve::Secp256k1, Participant, ThresholdKeys, FrostError, sign::*}; use frost::{curve::Secp256k1, Participant, ThresholdKeys, FrostError, sign::*};
use bitcoin::{ use bitcoin::{
@@ -16,12 +18,12 @@ use bitcoin::{
absolute::LockTime, absolute::LockTime,
script::{PushBytesBuf, ScriptBuf}, script::{PushBytesBuf, ScriptBuf},
transaction::{Version, Transaction}, transaction::{Version, Transaction},
OutPoint, Sequence, Witness, TxIn, Amount, TxOut, OutPoint, Sequence, Witness, TxIn, Amount, TxOut, Address,
}; };
use crate::{ use crate::{
crypto::Schnorr, crypto::Schnorr,
wallet::{ReceivedOutput, p2tr_script_buf}, wallet::{ReceivedOutput, address_payload},
}; };
#[rustfmt::skip] #[rustfmt::skip]
@@ -44,7 +46,7 @@ pub enum TransactionError {
#[error("fee was too low to pass the default minimum fee rate")] #[error("fee was too low to pass the default minimum fee rate")]
TooLowFee, TooLowFee,
#[error("not enough funds for these payments")] #[error("not enough funds for these payments")]
NotEnoughFunds { inputs: u64, payments: u64, fee: u64 }, NotEnoughFunds,
#[error("transaction was too large")] #[error("transaction was too large")]
TooLargeTransaction, TooLargeTransaction,
} }
@@ -59,11 +61,7 @@ pub struct SignableTransaction {
} }
impl SignableTransaction { impl SignableTransaction {
fn calculate_weight_vbytes( fn calculate_weight(inputs: usize, payments: &[(Address, u64)], change: Option<&Address>) -> u64 {
inputs: usize,
payments: &[(ScriptBuf, u64)],
change: Option<&ScriptBuf>,
) -> (u64, u64) {
// Expand this a full transaction in order to use the bitcoin library's weight function // Expand this a full transaction in order to use the bitcoin library's weight function
let mut tx = Transaction { let mut tx = Transaction {
version: Version(2), version: Version(2),
@@ -88,42 +86,16 @@ impl SignableTransaction {
// The script pub key is not of a fixed size and does have to be used here // The script pub key is not of a fixed size and does have to be used here
.map(|payment| TxOut { .map(|payment| TxOut {
value: Amount::from_sat(payment.1), value: Amount::from_sat(payment.1),
script_pubkey: payment.0.clone(), script_pubkey: payment.0.script_pubkey(),
}) })
.collect(), .collect(),
}; };
if let Some(change) = change { if let Some(change) = change {
// Use a 0 value since we're currently unsure what the change amount will be, and since // Use a 0 value since we're currently unsure what the change amount will be, and since
// the value is fixed size (so any value could be used here) // the value is fixed size (so any value could be used here)
tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.clone() }); tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.script_pubkey() });
} }
u64::from(tx.weight())
let weight = tx.weight();
// Now calculate the size in vbytes
/*
"Virtual transaction size" is weight ceildiv 4 per
https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04
/src/policy/policy.cpp#L295-L298
implements this almost as expected, with an additional consideration to signature operations
Signature operations (the second argument of the following call) do not count Taproot
signatures per https://github.com/bitcoin/bips/blob/master/bip-0342.mediawiki#cite_ref-11-0
We don't risk running afoul of the Taproot signature limit as it allows at least one per
input, which is all we use
*/
(
weight.to_wu(),
u64::try_from(bitcoin::policy::get_virtual_tx_size(
i64::try_from(weight.to_wu()).unwrap(),
0i64,
))
.unwrap(),
)
} }
/// Returns the fee necessary for this transaction to achieve the fee rate specified at /// Returns the fee necessary for this transaction to achieve the fee rate specified at
@@ -149,10 +121,10 @@ impl SignableTransaction {
/// If data is specified, an OP_RETURN output will be added with it. /// If data is specified, an OP_RETURN output will be added with it.
pub fn new( pub fn new(
mut inputs: Vec<ReceivedOutput>, mut inputs: Vec<ReceivedOutput>,
payments: &[(ScriptBuf, u64)], payments: &[(Address, u64)],
change: Option<ScriptBuf>, change: Option<&Address>,
data: Option<Vec<u8>>, data: Option<Vec<u8>>,
fee_per_vbyte: u64, fee_per_weight: u64,
) -> Result<SignableTransaction, TransactionError> { ) -> Result<SignableTransaction, TransactionError> {
if inputs.is_empty() { if inputs.is_empty() {
Err(TransactionError::NoInputs)?; Err(TransactionError::NoInputs)?;
@@ -187,7 +159,10 @@ impl SignableTransaction {
let payment_sat = payments.iter().map(|payment| payment.1).sum::<u64>(); let payment_sat = payments.iter().map(|payment| payment.1).sum::<u64>();
let mut tx_outs = payments let mut tx_outs = payments
.iter() .iter()
.map(|payment| TxOut { value: Amount::from_sat(payment.1), script_pubkey: payment.0.clone() }) .map(|payment| TxOut {
value: Amount::from_sat(payment.1),
script_pubkey: payment.0.script_pubkey(),
})
.collect::<Vec<_>>(); .collect::<Vec<_>>();
// Add the OP_RETURN output // Add the OP_RETURN output
@@ -201,33 +176,49 @@ impl SignableTransaction {
}) })
} }
let (mut weight, vbytes) = Self::calculate_weight_vbytes(tx_ins.len(), payments, None); let mut weight = Self::calculate_weight(tx_ins.len(), payments, None);
let mut needed_fee = fee_per_weight * weight;
let mut needed_fee = fee_per_vbyte * vbytes; // "Virtual transaction size" is weight ceildiv 4 per
// https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
// https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04/
// src/policy/policy.cpp#L295-L298
// implements this as expected
// Technically, it takes whatever's greater, the weight or the amount of signature operations
// multiplied by DEFAULT_BYTES_PER_SIGOP (20)
// We only use 1 signature per input, and our inputs have a weight exceeding 20
// Accordingly, our inputs' weight will always be greater than the cost of the signature ops
let vsize = weight.div_ceil(4);
debug_assert_eq!(
u64::try_from(bitcoin::policy::get_virtual_tx_size(
weight.try_into().unwrap(),
tx_ins.len().try_into().unwrap()
))
.unwrap(),
vsize
);
// Technically, if there isn't change, this TX may still pay enough of a fee to pass the // Technically, if there isn't change, this TX may still pay enough of a fee to pass the
// minimum fee. Such edge cases aren't worth programming when they go against intent, as the // minimum fee. Such edge cases aren't worth programming when they go against intent, as the
// specified fee rate is too low to be valid // specified fee rate is too low to be valid
// bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE is in sats/kilo-vbyte // bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE is in sats/kilo-vbyte
if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vbytes) / 1000) { if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vsize) / 1000) {
Err(TransactionError::TooLowFee)?; Err(TransactionError::TooLowFee)?;
} }
if input_sat < (payment_sat + needed_fee) { if input_sat < (payment_sat + needed_fee) {
Err(TransactionError::NotEnoughFunds { Err(TransactionError::NotEnoughFunds)?;
inputs: input_sat,
payments: payment_sat,
fee: needed_fee,
})?;
} }
// If there's a change address, check if there's change to give it // If there's a change address, check if there's change to give it
if let Some(change) = change { if let Some(change) = change {
let (weight_with_change, vbytes_with_change) = let weight_with_change = Self::calculate_weight(tx_ins.len(), payments, Some(change));
Self::calculate_weight_vbytes(tx_ins.len(), payments, Some(&change)); let fee_with_change = fee_per_weight * weight_with_change;
let fee_with_change = fee_per_vbyte * vbytes_with_change;
if let Some(value) = input_sat.checked_sub(payment_sat + fee_with_change) { if let Some(value) = input_sat.checked_sub(payment_sat + fee_with_change) {
if value >= DUST { if value >= DUST {
tx_outs.push(TxOut { value: Amount::from_sat(value), script_pubkey: change }); tx_outs
.push(TxOut { value: Amount::from_sat(value), script_pubkey: change.script_pubkey() });
weight = weight_with_change; weight = weight_with_change;
needed_fee = fee_with_change; needed_fee = fee_with_change;
} }
@@ -257,28 +248,54 @@ impl SignableTransaction {
/// Returns the TX ID of the transaction this will create. /// Returns the TX ID of the transaction this will create.
pub fn txid(&self) -> [u8; 32] { pub fn txid(&self) -> [u8; 32] {
let mut res = self.tx.compute_txid().to_byte_array(); let mut res = self.tx.txid().to_byte_array();
res.reverse(); res.reverse();
res res
} }
/// Returns the transaction, sans witness, this will create if signed. /// Returns the outputs this transaction will create.
pub fn transaction(&self) -> &Transaction { pub fn outputs(&self) -> &[TxOut] {
&self.tx &self.tx.output
} }
/// Create a multisig machine for this transaction. /// Create a multisig machine for this transaction.
/// ///
/// Returns None if the wrong keys are used. /// Returns None if the wrong keys are used.
pub fn multisig(self, keys: &ThresholdKeys<Secp256k1>) -> Option<TransactionMachine> { pub fn multisig(
self,
keys: &ThresholdKeys<Secp256k1>,
mut transcript: RecommendedTranscript,
) -> Option<TransactionMachine> {
transcript.domain_separate(b"bitcoin_transaction");
transcript.append_message(b"root_key", keys.group_key().to_encoded_point(true).as_bytes());
// Transcript the inputs and outputs
let tx = &self.tx;
for input in &tx.input {
transcript.append_message(b"input_hash", input.previous_output.txid);
transcript.append_message(b"input_output_index", input.previous_output.vout.to_le_bytes());
}
for payment in &tx.output {
transcript.append_message(b"output_script", payment.script_pubkey.as_bytes());
transcript.append_message(b"output_amount", payment.value.to_sat().to_le_bytes());
}
let mut sigs = vec![]; let mut sigs = vec![];
for i in 0 .. self.tx.input.len() { for i in 0 .. tx.input.len() {
let mut transcript = transcript.clone();
// This unwrap is safe since any transaction with this many inputs violates the maximum
// size allowed under standards, which this lib will error on creation of
transcript.append_message(b"signing_input", u32::try_from(i).unwrap().to_le_bytes());
let offset = keys.clone().offset(self.offsets[i]); let offset = keys.clone().offset(self.offsets[i]);
if p2tr_script_buf(offset.group_key())? != self.prevouts[i].script_pubkey { if address_payload(offset.group_key())?.script_pubkey() != self.prevouts[i].script_pubkey {
None?; None?;
} }
sigs.push(AlgorithmMachine::new(Schnorr::new(), keys.clone().offset(self.offsets[i]))); sigs.push(AlgorithmMachine::new(
Schnorr::new(transcript),
keys.clone().offset(self.offsets[i]),
));
} }
Some(TransactionMachine { tx: self, sigs }) Some(TransactionMachine { tx: self, sigs })
@@ -288,10 +305,10 @@ impl SignableTransaction {
/// A FROST signing machine to produce a Bitcoin transaction. /// A FROST signing machine to produce a Bitcoin transaction.
/// ///
/// This does not support caching its preprocess. When sign is called, the message must be empty. /// This does not support caching its preprocess. When sign is called, the message must be empty.
/// This will panic if either `cache`, `from_cache` is called or the message isn't empty. /// This will panic if either `cache` is called or the message isn't empty.
pub struct TransactionMachine { pub struct TransactionMachine {
tx: SignableTransaction, tx: SignableTransaction,
sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr>>, sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
} }
impl PreprocessMachine for TransactionMachine { impl PreprocessMachine for TransactionMachine {
@@ -320,7 +337,7 @@ impl PreprocessMachine for TransactionMachine {
pub struct TransactionSignMachine { pub struct TransactionSignMachine {
tx: SignableTransaction, tx: SignableTransaction,
sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr>>, sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
} }
impl SignMachine<Transaction> for TransactionSignMachine { impl SignMachine<Transaction> for TransactionSignMachine {
@@ -400,7 +417,7 @@ impl SignMachine<Transaction> for TransactionSignMachine {
pub struct TransactionSignatureMachine { pub struct TransactionSignatureMachine {
tx: Transaction, tx: Transaction,
sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr>>, sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
} }
impl SignatureMachine<Transaction> for TransactionSignatureMachine { impl SignatureMachine<Transaction> for TransactionSignatureMachine {

View File

@@ -1,11 +1,14 @@
use std::sync::LazyLock; use std::sync::OnceLock;
use bitcoin_serai::rpc::Rpc; use bitcoin_serai::rpc::Rpc;
use tokio::sync::Mutex; use tokio::sync::Mutex;
#[allow(dead_code)] static SEQUENTIAL_CELL: OnceLock<Mutex<()>> = OnceLock::new();
pub(crate) static SEQUENTIAL: LazyLock<Mutex<()>> = LazyLock::new(|| Mutex::new(())); #[allow(non_snake_case)]
pub fn SEQUENTIAL() -> &'static Mutex<()> {
SEQUENTIAL_CELL.get_or_init(|| Mutex::new(()))
}
#[allow(dead_code)] #[allow(dead_code)]
pub(crate) async fn rpc() -> Rpc { pub(crate) async fn rpc() -> Rpc {
@@ -31,7 +34,7 @@ macro_rules! async_sequential {
$( $(
#[tokio::test] #[tokio::test]
async fn $name() { async fn $name() {
let guard = runner::SEQUENTIAL.lock().await; let guard = runner::SEQUENTIAL().lock().await;
let local = tokio::task::LocalSet::new(); let local = tokio::task::LocalSet::new();
local.run_until(async move { local.run_until(async move {
if let Err(err) = tokio::task::spawn_local(async move { $body }).await { if let Err(err) = tokio::task::spawn_local(async move { $body }).await {

View File

@@ -2,6 +2,8 @@ use std::collections::HashMap;
use rand_core::{RngCore, OsRng}; use rand_core::{RngCore, OsRng};
use transcript::{Transcript, RecommendedTranscript};
use k256::{ use k256::{
elliptic_curve::{ elliptic_curve::{
group::{ff::Field, Group}, group::{ff::Field, Group},
@@ -20,10 +22,11 @@ use bitcoin_serai::{
hashes::Hash as HashTrait, hashes::Hash as HashTrait,
blockdata::opcodes::all::OP_RETURN, blockdata::opcodes::all::OP_RETURN,
script::{PushBytesBuf, Instruction, Instructions, Script}, script::{PushBytesBuf, Instruction, Instructions, Script},
address::NetworkChecked,
OutPoint, Amount, TxOut, Transaction, Network, Address, OutPoint, Amount, TxOut, Transaction, Network, Address,
}, },
wallet::{ wallet::{
tweak_keys, p2tr_script_buf, ReceivedOutput, Scanner, TransactionError, SignableTransaction, tweak_keys, address_payload, ReceivedOutput, Scanner, TransactionError, SignableTransaction,
}, },
rpc::Rpc, rpc::Rpc,
}; };
@@ -45,7 +48,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
"generatetoaddress", "generatetoaddress",
serde_json::json!([ serde_json::json!([
1, 1,
Address::from_script(&p2tr_script_buf(key).unwrap(), Network::Regtest).unwrap() Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())
]), ]),
) )
.await .await
@@ -66,7 +69,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
assert_eq!(outputs, scanner.scan_transaction(&block.txdata[0])); assert_eq!(outputs, scanner.scan_transaction(&block.txdata[0]));
assert_eq!(outputs.len(), 1); assert_eq!(outputs.len(), 1);
assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].compute_txid(), 0)); assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].txid(), 0));
assert_eq!(outputs[0].value(), block.txdata[0].output[0].value.to_sat()); assert_eq!(outputs[0].value(), block.txdata[0].output[0].value.to_sat());
assert_eq!( assert_eq!(
@@ -80,7 +83,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
fn keys() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, ProjectivePoint) { fn keys() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, ProjectivePoint) {
let mut keys = key_gen(&mut OsRng); let mut keys = key_gen(&mut OsRng);
for keys in keys.values_mut() { for keys in keys.values_mut() {
*keys = tweak_keys(keys.clone()); *keys = tweak_keys(keys);
} }
let key = keys.values().next().unwrap().group_key(); let key = keys.values().next().unwrap().group_key();
(keys, key) (keys, key)
@@ -92,11 +95,46 @@ fn sign(
) -> Transaction { ) -> Transaction {
let mut machines = HashMap::new(); let mut machines = HashMap::new();
for i in (1 ..= THRESHOLD).map(|i| Participant::new(i).unwrap()) { for i in (1 ..= THRESHOLD).map(|i| Participant::new(i).unwrap()) {
machines.insert(i, tx.clone().multisig(&keys[&i].clone()).unwrap()); machines.insert(
i,
tx.clone()
.multisig(&keys[&i].clone(), RecommendedTranscript::new(b"bitcoin-serai Test Transaction"))
.unwrap(),
);
} }
sign_without_caching(&mut OsRng, machines, &[]) sign_without_caching(&mut OsRng, machines, &[])
} }
#[test]
fn test_tweak_keys() {
let mut even = false;
let mut odd = false;
// Generate keys until we get an even set and an odd set
while !(even && odd) {
let mut keys = key_gen(&mut OsRng).drain().next().unwrap().1;
if is_even(keys.group_key()) {
// Tweaking should do nothing
assert_eq!(tweak_keys(&keys).group_key(), keys.group_key());
even = true;
} else {
let tweaked = tweak_keys(&keys).group_key();
assert_ne!(tweaked, keys.group_key());
// Tweaking should produce an even key
assert!(is_even(tweaked));
// Verify it uses the smallest possible offset
while keys.group_key().to_encoded_point(true).tag() == Tag::CompressedOddY {
keys = keys.offset(Scalar::ONE);
}
assert_eq!(tweaked, keys.group_key());
odd = true;
}
}
}
async_sequential! { async_sequential! {
async fn test_scanner() { async fn test_scanner() {
// Test Scanners are creatable for even keys. // Test Scanners are creatable for even keys.
@@ -155,7 +193,7 @@ async_sequential! {
assert_eq!(output.offset(), Scalar::ZERO); assert_eq!(output.offset(), Scalar::ZERO);
let inputs = vec![output]; let inputs = vec![output];
let addr = || p2tr_script_buf(key).unwrap(); let addr = || Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap());
let payments = vec![(addr(), 1000)]; let payments = vec![(addr(), 1000)];
assert!(SignableTransaction::new(inputs.clone(), &payments, None, None, FEE).is_ok()); assert!(SignableTransaction::new(inputs.clone(), &payments, None, None, FEE).is_ok());
@@ -168,7 +206,7 @@ async_sequential! {
// No change // No change
assert!(SignableTransaction::new(inputs.clone(), &[(addr(), 1000)], None, None, FEE).is_ok()); assert!(SignableTransaction::new(inputs.clone(), &[(addr(), 1000)], None, None, FEE).is_ok());
// Consolidation TX // Consolidation TX
assert!(SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, FEE).is_ok()); assert!(SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, FEE).is_ok());
// Data // Data
assert!(SignableTransaction::new(inputs.clone(), &[], None, Some(vec![]), FEE).is_ok()); assert!(SignableTransaction::new(inputs.clone(), &[], None, Some(vec![]), FEE).is_ok());
// No outputs // No outputs
@@ -191,14 +229,14 @@ async_sequential! {
); );
assert_eq!( assert_eq!(
SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, 0), SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, 0),
Err(TransactionError::TooLowFee), Err(TransactionError::TooLowFee),
); );
assert!(matches!( assert_eq!(
SignableTransaction::new(inputs.clone(), &[(addr(), inputs[0].value() * 2)], None, None, FEE), SignableTransaction::new(inputs.clone(), &[(addr(), inputs[0].value() * 2)], None, None, FEE),
Err(TransactionError::NotEnoughFunds { .. }), Err(TransactionError::NotEnoughFunds),
)); );
assert_eq!( assert_eq!(
SignableTransaction::new(inputs, &vec![(addr(), 1000); 10000], None, None, FEE), SignableTransaction::new(inputs, &vec![(addr(), 1000); 10000], None, None, FEE),
@@ -223,19 +261,20 @@ async_sequential! {
// Declare payments, change, fee // Declare payments, change, fee
let payments = [ let payments = [
(p2tr_script_buf(key).unwrap(), 1005), (Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap()), 1005),
(p2tr_script_buf(offset_key).unwrap(), 1007) (Address::<NetworkChecked>::new(Network::Regtest, address_payload(offset_key).unwrap()), 1007)
]; ];
let change_offset = scanner.register_offset(Scalar::random(&mut OsRng)).unwrap(); let change_offset = scanner.register_offset(Scalar::random(&mut OsRng)).unwrap();
let change_key = key + (ProjectivePoint::GENERATOR * change_offset); let change_key = key + (ProjectivePoint::GENERATOR * change_offset);
let change_addr = p2tr_script_buf(change_key).unwrap(); let change_addr =
Address::<NetworkChecked>::new(Network::Regtest, address_payload(change_key).unwrap());
// Create and sign the TX // Create and sign the TX
let tx = SignableTransaction::new( let tx = SignableTransaction::new(
vec![output.clone(), offset_output.clone()], vec![output.clone(), offset_output.clone()],
&payments, &payments,
Some(change_addr.clone()), Some(&change_addr),
None, None,
FEE FEE
).unwrap(); ).unwrap();
@@ -248,7 +287,7 @@ async_sequential! {
// Ensure we can scan it // Ensure we can scan it
let outputs = scanner.scan_transaction(&tx); let outputs = scanner.scan_transaction(&tx);
for (o, output) in outputs.iter().enumerate() { for (o, output) in outputs.iter().enumerate() {
assert_eq!(output.outpoint(), &OutPoint::new(tx.compute_txid(), u32::try_from(o).unwrap())); assert_eq!(output.outpoint(), &OutPoint::new(tx.txid(), u32::try_from(o).unwrap()));
assert_eq!(&ReceivedOutput::read::<&[u8]>(&mut output.serialize().as_ref()).unwrap(), output); assert_eq!(&ReceivedOutput::read::<&[u8]>(&mut output.serialize().as_ref()).unwrap(), output);
} }
@@ -260,13 +299,13 @@ async_sequential! {
for ((output, scanned), payment) in tx.output.iter().zip(outputs.iter()).zip(payments.iter()) { for ((output, scanned), payment) in tx.output.iter().zip(outputs.iter()).zip(payments.iter()) {
assert_eq!( assert_eq!(
output, output,
&TxOut { script_pubkey: payment.0.clone(), value: Amount::from_sat(payment.1) }, &TxOut { script_pubkey: payment.0.script_pubkey(), value: Amount::from_sat(payment.1) },
); );
assert_eq!(scanned.value(), payment.1 ); assert_eq!(scanned.value(), payment.1 );
} }
// Make sure the change is correct // Make sure the change is correct
assert_eq!(needed_fee, u64::try_from(tx.vsize()).unwrap() * FEE); assert_eq!(needed_fee, u64::from(tx.weight()) * FEE);
let input_value = output.value() + offset_output.value(); let input_value = output.value() + offset_output.value();
let output_value = tx.output.iter().map(|output| output.value.to_sat()).sum::<u64>(); let output_value = tx.output.iter().map(|output| output.value.to_sat()).sum::<u64>();
assert_eq!(input_value - output_value, needed_fee); assert_eq!(input_value - output_value, needed_fee);
@@ -275,13 +314,13 @@ async_sequential! {
input_value - payments.iter().map(|payment| payment.1).sum::<u64>() - needed_fee; input_value - payments.iter().map(|payment| payment.1).sum::<u64>() - needed_fee;
assert_eq!( assert_eq!(
tx.output[2], tx.output[2],
TxOut { script_pubkey: change_addr, value: Amount::from_sat(change_amount) }, TxOut { script_pubkey: change_addr.script_pubkey(), value: Amount::from_sat(change_amount) },
); );
// This also tests send_raw_transaction and get_transaction, which the RPC test can't // This also tests send_raw_transaction and get_transaction, which the RPC test can't
// effectively test // effectively test
rpc.send_raw_transaction(&tx).await.unwrap(); rpc.send_raw_transaction(&tx).await.unwrap();
let mut hash = *tx.compute_txid().as_raw_hash().as_byte_array(); let mut hash = *tx.txid().as_raw_hash().as_byte_array();
hash.reverse(); hash.reverse();
assert_eq!(tx, rpc.get_transaction(&hash).await.unwrap()); assert_eq!(tx, rpc.get_transaction(&hash).await.unwrap());
assert_eq!(expected_id, hash); assert_eq!(expected_id, hash);
@@ -305,7 +344,7 @@ async_sequential! {
&SignableTransaction::new( &SignableTransaction::new(
vec![output], vec![output],
&[], &[],
Some(p2tr_script_buf(key).unwrap()), Some(&Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())),
Some(data.clone()), Some(data.clone()),
FEE FEE
).unwrap() ).unwrap()

View File

@@ -3,11 +3,11 @@ name = "ethereum-serai"
version = "0.1.0" version = "0.1.0"
description = "An Ethereum library supporting Schnorr signing and on-chain verification" description = "An Ethereum library supporting Schnorr signing and on-chain verification"
license = "AGPL-3.0-only" license = "AGPL-3.0-only"
repository = "https://github.com/serai-dex/serai/tree/develop/networks/ethereum" repository = "https://github.com/serai-dex/serai/tree/develop/coins/ethereum"
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Elizabeth Binks <elizabethjbinks@gmail.com>"] authors = ["Luke Parker <lukeparker5132@gmail.com>", "Elizabeth Binks <elizabethjbinks@gmail.com>"]
edition = "2021" edition = "2021"
publish = false publish = false
rust-version = "1.79" rust-version = "1.74"
[package.metadata.docs.rs] [package.metadata.docs.rs]
all-features = true all-features = true
@@ -27,23 +27,23 @@ group = { version = "0.13", default-features = false }
k256 = { version = "^0.13.1", default-features = false, features = ["std", "ecdsa", "arithmetic"] } k256 = { version = "^0.13.1", default-features = false, features = ["std", "ecdsa", "arithmetic"] }
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["secp256k1"] } frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["secp256k1"] }
alloy-core = { version = "0.8", default-features = false } alloy-core = { version = "0.7", default-features = false }
alloy-sol-types = { version = "0.8", default-features = false, features = ["json"] } alloy-sol-types = { version = "0.7", default-features = false, features = ["json"] }
alloy-consensus = { version = "0.4", default-features = false, features = ["k256"] } alloy-consensus = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false, features = ["k256"] }
alloy-network = { version = "0.4", default-features = false } alloy-network = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false }
alloy-rpc-types-eth = { version = "0.4", default-features = false } alloy-rpc-types = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false }
alloy-rpc-client = { version = "0.4", default-features = false } alloy-rpc-client = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false }
alloy-simple-request-transport = { path = "./alloy-simple-request-transport", default-features = false } alloy-simple-request-transport = { path = "./alloy-simple-request-transport", default-features = false }
alloy-provider = { version = "0.4", default-features = false } alloy-provider = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false }
alloy-node-bindings = { version = "0.4", default-features = false, optional = true } alloy-node-bindings = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false, optional = true }
[dev-dependencies] [dev-dependencies]
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["tests"] } frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["tests"] }
tokio = { version = "1", features = ["macros"] } tokio = { version = "1", features = ["macros"] }
alloy-node-bindings = { version = "0.4", default-features = false } alloy-node-bindings = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false }
[features] [features]
tests = ["alloy-node-bindings", "frost/tests"] tests = ["alloy-node-bindings"]

15
coins/ethereum/README.md Normal file
View File

@@ -0,0 +1,15 @@
# Ethereum
This package contains Ethereum-related functionality, specifically deploying and
interacting with Serai contracts.
While `monero-serai` and `bitcoin-serai` are general purpose libraries,
`ethereum-serai` is Serai specific. If any of the utilities are generally
desired, please fork and maintain your own copy to ensure the desired
functionality is preserved, or open an issue to request we make this library
general purpose.
### Dependencies
- solc
- [Foundry](https://github.com/foundry-rs/foundry)

View File

@@ -3,7 +3,7 @@ name = "alloy-simple-request-transport"
version = "0.1.0" version = "0.1.0"
description = "A transport for alloy based off simple-request" description = "A transport for alloy based off simple-request"
license = "MIT" license = "MIT"
repository = "https://github.com/serai-dex/serai/tree/develop/networks/ethereum/alloy-simple-request-transport" repository = "https://github.com/serai-dex/serai/tree/develop/coins/ethereum/alloy-simple-request-transport"
authors = ["Luke Parker <lukeparker5132@gmail.com>"] authors = ["Luke Parker <lukeparker5132@gmail.com>"]
edition = "2021" edition = "2021"
rust-version = "1.74" rust-version = "1.74"
@@ -16,13 +16,13 @@ rustdoc-args = ["--cfg", "docsrs"]
workspace = true workspace = true
[dependencies] [dependencies]
tower = "0.5" tower = "0.4"
serde_json = { version = "1", default-features = false } serde_json = { version = "1", default-features = false }
simple-request = { path = "../../../common/request", default-features = false } simple-request = { path = "../../../common/request", default-features = false }
alloy-json-rpc = { version = "0.4", default-features = false } alloy-json-rpc = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false }
alloy-transport = { version = "0.4", default-features = false } alloy-transport = { git = "https://github.com/alloy-rs/alloy", rev = "b79db21734cffddc11753fe62ba571565c896f42", default-features = false }
[features] [features]
default = ["tls"] default = ["tls"]

View File

@@ -1,4 +1,4 @@
#![cfg_attr(docsrs, feature(doc_cfg))] #![cfg_attr(docsrs, feature(doc_auto_cfg))]
#![doc = include_str!("../README.md")] #![doc = include_str!("../README.md")]
use core::task; use core::task;

View File

@@ -10,7 +10,7 @@ fn main() {
{ {
if let Some(version) = line.strip_prefix("Version: ") { if let Some(version) = line.strip_prefix("Version: ") {
let version = version.split('+').next().unwrap(); let version = version.split('+').next().unwrap();
assert_eq!(version, "0.8.26"); assert_eq!(version, "0.8.25");
} }
} }

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,410 @@
pub use schnorr::*;
/// This module was auto-generated with ethers-rs Abigen.
/// More information at: <https://github.com/gakonst/ethers-rs>
#[allow(
clippy::enum_variant_names,
clippy::too_many_arguments,
clippy::upper_case_acronyms,
clippy::type_complexity,
dead_code,
non_camel_case_types,
)]
pub mod schnorr {
#[allow(deprecated)]
fn __abi() -> ::ethers_core::abi::Abi {
::ethers_core::abi::ethabi::Contract {
constructor: ::core::option::Option::None,
functions: ::core::convert::From::from([
(
::std::borrow::ToOwned::to_owned("Q"),
::std::vec![
::ethers_core::abi::ethabi::Function {
name: ::std::borrow::ToOwned::to_owned("Q"),
inputs: ::std::vec![],
outputs: ::std::vec![
::ethers_core::abi::ethabi::Param {
name: ::std::string::String::new(),
kind: ::ethers_core::abi::ethabi::ParamType::Uint(256usize),
internal_type: ::core::option::Option::Some(
::std::borrow::ToOwned::to_owned("uint256"),
),
},
],
constant: ::core::option::Option::None,
state_mutability: ::ethers_core::abi::ethabi::StateMutability::View,
},
],
),
(
::std::borrow::ToOwned::to_owned("verify"),
::std::vec![
::ethers_core::abi::ethabi::Function {
name: ::std::borrow::ToOwned::to_owned("verify"),
inputs: ::std::vec![
::ethers_core::abi::ethabi::Param {
name: ::std::borrow::ToOwned::to_owned("parity"),
kind: ::ethers_core::abi::ethabi::ParamType::Uint(8usize),
internal_type: ::core::option::Option::Some(
::std::borrow::ToOwned::to_owned("uint8"),
),
},
::ethers_core::abi::ethabi::Param {
name: ::std::borrow::ToOwned::to_owned("px"),
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
32usize,
),
internal_type: ::core::option::Option::Some(
::std::borrow::ToOwned::to_owned("bytes32"),
),
},
::ethers_core::abi::ethabi::Param {
name: ::std::borrow::ToOwned::to_owned("message"),
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
32usize,
),
internal_type: ::core::option::Option::Some(
::std::borrow::ToOwned::to_owned("bytes32"),
),
},
::ethers_core::abi::ethabi::Param {
name: ::std::borrow::ToOwned::to_owned("c"),
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
32usize,
),
internal_type: ::core::option::Option::Some(
::std::borrow::ToOwned::to_owned("bytes32"),
),
},
::ethers_core::abi::ethabi::Param {
name: ::std::borrow::ToOwned::to_owned("s"),
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
32usize,
),
internal_type: ::core::option::Option::Some(
::std::borrow::ToOwned::to_owned("bytes32"),
),
},
],
outputs: ::std::vec![
::ethers_core::abi::ethabi::Param {
name: ::std::string::String::new(),
kind: ::ethers_core::abi::ethabi::ParamType::Bool,
internal_type: ::core::option::Option::Some(
::std::borrow::ToOwned::to_owned("bool"),
),
},
],
constant: ::core::option::Option::None,
state_mutability: ::ethers_core::abi::ethabi::StateMutability::View,
},
],
),
]),
events: ::std::collections::BTreeMap::new(),
errors: ::core::convert::From::from([
(
::std::borrow::ToOwned::to_owned("InvalidSOrA"),
::std::vec![
::ethers_core::abi::ethabi::AbiError {
name: ::std::borrow::ToOwned::to_owned("InvalidSOrA"),
inputs: ::std::vec![],
},
],
),
(
::std::borrow::ToOwned::to_owned("InvalidSignature"),
::std::vec![
::ethers_core::abi::ethabi::AbiError {
name: ::std::borrow::ToOwned::to_owned("InvalidSignature"),
inputs: ::std::vec![],
},
],
),
]),
receive: false,
fallback: false,
}
}
///The parsed JSON ABI of the contract.
pub static SCHNORR_ABI: ::ethers_contract::Lazy<::ethers_core::abi::Abi> = ::ethers_contract::Lazy::new(
__abi,
);
pub struct Schnorr<M>(::ethers_contract::Contract<M>);
impl<M> ::core::clone::Clone for Schnorr<M> {
fn clone(&self) -> Self {
Self(::core::clone::Clone::clone(&self.0))
}
}
impl<M> ::core::ops::Deref for Schnorr<M> {
type Target = ::ethers_contract::Contract<M>;
fn deref(&self) -> &Self::Target {
&self.0
}
}
impl<M> ::core::ops::DerefMut for Schnorr<M> {
fn deref_mut(&mut self) -> &mut Self::Target {
&mut self.0
}
}
impl<M> ::core::fmt::Debug for Schnorr<M> {
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
f.debug_tuple(::core::stringify!(Schnorr)).field(&self.address()).finish()
}
}
impl<M: ::ethers_providers::Middleware> Schnorr<M> {
/// Creates a new contract instance with the specified `ethers` client at
/// `address`. The contract derefs to a `ethers::Contract` object.
pub fn new<T: Into<::ethers_core::types::Address>>(
address: T,
client: ::std::sync::Arc<M>,
) -> Self {
Self(
::ethers_contract::Contract::new(
address.into(),
SCHNORR_ABI.clone(),
client,
),
)
}
///Calls the contract's `Q` (0xe493ef8c) function
pub fn q(
&self,
) -> ::ethers_contract::builders::ContractCall<M, ::ethers_core::types::U256> {
self.0
.method_hash([228, 147, 239, 140], ())
.expect("method not found (this should never happen)")
}
///Calls the contract's `verify` (0x9186da4c) function
pub fn verify(
&self,
parity: u8,
px: [u8; 32],
message: [u8; 32],
c: [u8; 32],
s: [u8; 32],
) -> ::ethers_contract::builders::ContractCall<M, bool> {
self.0
.method_hash([145, 134, 218, 76], (parity, px, message, c, s))
.expect("method not found (this should never happen)")
}
}
impl<M: ::ethers_providers::Middleware> From<::ethers_contract::Contract<M>>
for Schnorr<M> {
fn from(contract: ::ethers_contract::Contract<M>) -> Self {
Self::new(contract.address(), contract.client())
}
}
///Custom Error type `InvalidSOrA` with signature `InvalidSOrA()` and selector `0x4e99a12e`
#[derive(
Clone,
::ethers_contract::EthError,
::ethers_contract::EthDisplay,
Default,
Debug,
PartialEq,
Eq,
Hash
)]
#[etherror(name = "InvalidSOrA", abi = "InvalidSOrA()")]
pub struct InvalidSOrA;
///Custom Error type `InvalidSignature` with signature `InvalidSignature()` and selector `0x8baa579f`
#[derive(
Clone,
::ethers_contract::EthError,
::ethers_contract::EthDisplay,
Default,
Debug,
PartialEq,
Eq,
Hash
)]
#[etherror(name = "InvalidSignature", abi = "InvalidSignature()")]
pub struct InvalidSignature;
///Container type for all of the contract's custom errors
#[derive(Clone, ::ethers_contract::EthAbiType, Debug, PartialEq, Eq, Hash)]
pub enum SchnorrErrors {
InvalidSOrA(InvalidSOrA),
InvalidSignature(InvalidSignature),
/// The standard solidity revert string, with selector
/// Error(string) -- 0x08c379a0
RevertString(::std::string::String),
}
impl ::ethers_core::abi::AbiDecode for SchnorrErrors {
fn decode(
data: impl AsRef<[u8]>,
) -> ::core::result::Result<Self, ::ethers_core::abi::AbiError> {
let data = data.as_ref();
if let Ok(decoded) = <::std::string::String as ::ethers_core::abi::AbiDecode>::decode(
data,
) {
return Ok(Self::RevertString(decoded));
}
if let Ok(decoded) = <InvalidSOrA as ::ethers_core::abi::AbiDecode>::decode(
data,
) {
return Ok(Self::InvalidSOrA(decoded));
}
if let Ok(decoded) = <InvalidSignature as ::ethers_core::abi::AbiDecode>::decode(
data,
) {
return Ok(Self::InvalidSignature(decoded));
}
Err(::ethers_core::abi::Error::InvalidData.into())
}
}
impl ::ethers_core::abi::AbiEncode for SchnorrErrors {
fn encode(self) -> ::std::vec::Vec<u8> {
match self {
Self::InvalidSOrA(element) => {
::ethers_core::abi::AbiEncode::encode(element)
}
Self::InvalidSignature(element) => {
::ethers_core::abi::AbiEncode::encode(element)
}
Self::RevertString(s) => ::ethers_core::abi::AbiEncode::encode(s),
}
}
}
impl ::ethers_contract::ContractRevert for SchnorrErrors {
fn valid_selector(selector: [u8; 4]) -> bool {
match selector {
[0x08, 0xc3, 0x79, 0xa0] => true,
_ if selector
== <InvalidSOrA as ::ethers_contract::EthError>::selector() => true,
_ if selector
== <InvalidSignature as ::ethers_contract::EthError>::selector() => {
true
}
_ => false,
}
}
}
impl ::core::fmt::Display for SchnorrErrors {
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
match self {
Self::InvalidSOrA(element) => ::core::fmt::Display::fmt(element, f),
Self::InvalidSignature(element) => ::core::fmt::Display::fmt(element, f),
Self::RevertString(s) => ::core::fmt::Display::fmt(s, f),
}
}
}
impl ::core::convert::From<::std::string::String> for SchnorrErrors {
fn from(value: String) -> Self {
Self::RevertString(value)
}
}
impl ::core::convert::From<InvalidSOrA> for SchnorrErrors {
fn from(value: InvalidSOrA) -> Self {
Self::InvalidSOrA(value)
}
}
impl ::core::convert::From<InvalidSignature> for SchnorrErrors {
fn from(value: InvalidSignature) -> Self {
Self::InvalidSignature(value)
}
}
///Container type for all input parameters for the `Q` function with signature `Q()` and selector `0xe493ef8c`
#[derive(
Clone,
::ethers_contract::EthCall,
::ethers_contract::EthDisplay,
Default,
Debug,
PartialEq,
Eq,
Hash
)]
#[ethcall(name = "Q", abi = "Q()")]
pub struct QCall;
///Container type for all input parameters for the `verify` function with signature `verify(uint8,bytes32,bytes32,bytes32,bytes32)` and selector `0x9186da4c`
#[derive(
Clone,
::ethers_contract::EthCall,
::ethers_contract::EthDisplay,
Default,
Debug,
PartialEq,
Eq,
Hash
)]
#[ethcall(name = "verify", abi = "verify(uint8,bytes32,bytes32,bytes32,bytes32)")]
pub struct VerifyCall {
pub parity: u8,
pub px: [u8; 32],
pub message: [u8; 32],
pub c: [u8; 32],
pub s: [u8; 32],
}
///Container type for all of the contract's call
#[derive(Clone, ::ethers_contract::EthAbiType, Debug, PartialEq, Eq, Hash)]
pub enum SchnorrCalls {
Q(QCall),
Verify(VerifyCall),
}
impl ::ethers_core::abi::AbiDecode for SchnorrCalls {
fn decode(
data: impl AsRef<[u8]>,
) -> ::core::result::Result<Self, ::ethers_core::abi::AbiError> {
let data = data.as_ref();
if let Ok(decoded) = <QCall as ::ethers_core::abi::AbiDecode>::decode(data) {
return Ok(Self::Q(decoded));
}
if let Ok(decoded) = <VerifyCall as ::ethers_core::abi::AbiDecode>::decode(
data,
) {
return Ok(Self::Verify(decoded));
}
Err(::ethers_core::abi::Error::InvalidData.into())
}
}
impl ::ethers_core::abi::AbiEncode for SchnorrCalls {
fn encode(self) -> Vec<u8> {
match self {
Self::Q(element) => ::ethers_core::abi::AbiEncode::encode(element),
Self::Verify(element) => ::ethers_core::abi::AbiEncode::encode(element),
}
}
}
impl ::core::fmt::Display for SchnorrCalls {
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
match self {
Self::Q(element) => ::core::fmt::Display::fmt(element, f),
Self::Verify(element) => ::core::fmt::Display::fmt(element, f),
}
}
}
impl ::core::convert::From<QCall> for SchnorrCalls {
fn from(value: QCall) -> Self {
Self::Q(value)
}
}
impl ::core::convert::From<VerifyCall> for SchnorrCalls {
fn from(value: VerifyCall) -> Self {
Self::Verify(value)
}
}
///Container type for all return fields from the `Q` function with signature `Q()` and selector `0xe493ef8c`
#[derive(
Clone,
::ethers_contract::EthAbiType,
::ethers_contract::EthAbiCodec,
Default,
Debug,
PartialEq,
Eq,
Hash
)]
pub struct QReturn(pub ::ethers_core::types::U256);
///Container type for all return fields from the `verify` function with signature `verify(uint8,bytes32,bytes32,bytes32,bytes32)` and selector `0x9186da4c`
#[derive(
Clone,
::ethers_contract::EthAbiType,
::ethers_contract::EthAbiCodec,
Default,
Debug,
PartialEq,
Eq,
Hash
)]
pub struct VerifyReturn(pub bool);
}

View File

@@ -1,5 +1,3 @@
#![allow(deprecated)]
use group::ff::PrimeField; use group::ff::PrimeField;
use k256::{ use k256::{
elliptic_curve::{ops::Reduce, point::AffineCoordinates, sec1::ToEncodedPoint}, elliptic_curve::{ops::Reduce, point::AffineCoordinates, sec1::ToEncodedPoint},

View File

@@ -5,7 +5,7 @@ use alloy_consensus::{Signed, TxLegacy};
use alloy_sol_types::{SolCall, SolEvent}; use alloy_sol_types::{SolCall, SolEvent};
use alloy_rpc_types_eth::{BlockNumberOrTag, Filter}; use alloy_rpc_types::{BlockNumberOrTag, Filter};
use alloy_simple_request_transport::SimpleRequest; use alloy_simple_request_transport::SimpleRequest;
use alloy_provider::{Provider, RootProvider}; use alloy_provider::{Provider, RootProvider};
@@ -39,7 +39,7 @@ impl Deployer {
nonce: 0, nonce: 0,
gas_price: 100_000_000_000u128, gas_price: 100_000_000_000u128,
// TODO: Use a more accurate gas limit // TODO: Use a more accurate gas limit
gas_limit: 1_000_000, gas_limit: 1_000_000u128,
to: TxKind::Create, to: TxKind::Create,
value: U256::ZERO, value: U256::ZERO,
input: bytecode, input: bytecode,
@@ -58,7 +58,14 @@ impl Deployer {
/// Construct a new view of the `Deployer`. /// Construct a new view of the `Deployer`.
pub async fn new(provider: Arc<RootProvider<SimpleRequest>>) -> Result<Option<Self>, Error> { pub async fn new(provider: Arc<RootProvider<SimpleRequest>>) -> Result<Option<Self>, Error> {
let address = Self::address(); let address = Self::address();
let code = provider.get_code_at(address.into()).await.map_err(|_| Error::ConnectionError)?; #[cfg(not(test))]
let required_block = BlockNumberOrTag::Finalized;
#[cfg(test)]
let required_block = BlockNumberOrTag::Latest;
let code = provider
.get_code_at(address.into(), required_block.into())
.await
.map_err(|_| Error::ConnectionError)?;
// Contract has yet to be deployed // Contract has yet to be deployed
if code.is_empty() { if code.is_empty() {
return Ok(None); return Ok(None);

View File

@@ -4,7 +4,7 @@ use alloy_core::primitives::{Address, B256, U256};
use alloy_sol_types::{SolInterface, SolEvent}; use alloy_sol_types::{SolInterface, SolEvent};
use alloy_rpc_types_eth::Filter; use alloy_rpc_types::Filter;
use alloy_simple_request_transport::SimpleRequest; use alloy_simple_request_transport::SimpleRequest;
use alloy_provider::{Provider, RootProvider}; use alloy_provider::{Provider, RootProvider};

View File

@@ -7,7 +7,7 @@ pub mod alloy {
pub use alloy_consensus as consensus; pub use alloy_consensus as consensus;
pub use alloy_network as network; pub use alloy_network as network;
pub use alloy_rpc_types_eth as rpc_types; pub use alloy_rpc_types as rpc_types;
pub use alloy_simple_request_transport as simple_request_transport; pub use alloy_simple_request_transport as simple_request_transport;
pub use alloy_rpc_client as rpc_client; pub use alloy_rpc_client as rpc_client;
pub use alloy_provider as provider; pub use alloy_provider as provider;

View File

@@ -12,9 +12,9 @@ use alloy_consensus::TxLegacy;
use alloy_sol_types::{SolValue, SolConstructor, SolCall, SolEvent}; use alloy_sol_types::{SolValue, SolConstructor, SolCall, SolEvent};
use alloy_rpc_types_eth::Filter; use alloy_rpc_types::Filter;
#[cfg(test)] #[cfg(test)]
use alloy_rpc_types_eth::{BlockId, TransactionRequest, TransactionInput}; use alloy_rpc_types::{BlockId, TransactionRequest, TransactionInput};
use alloy_simple_request_transport::SimpleRequest; use alloy_simple_request_transport::SimpleRequest;
use alloy_provider::{Provider, RootProvider}; use alloy_provider::{Provider, RootProvider};
@@ -226,7 +226,7 @@ impl Router {
to: TxKind::Call(self.1), to: TxKind::Call(self.1),
input: abi::executeCall::new((outs.to_vec(), sig.into())).abi_encode().into(), input: abi::executeCall::new((outs.to_vec(), sig.into())).abi_encode().into(),
// TODO // TODO
gas_limit: 100_000 + ((200_000 + 10_000) * u64::try_from(outs.len()).unwrap()), gas_limit: 100_000 + ((200_000 + 10_000) * u128::try_from(outs.len()).unwrap()),
..Default::default() ..Default::default()
} }
} }

View File

@@ -1,5 +1,3 @@
#![allow(deprecated)]
use rand_core::OsRng; use rand_core::OsRng;
use group::ff::{Field, PrimeField}; use group::ff::{Field, PrimeField};

View File

@@ -1,5 +1,3 @@
#![allow(deprecated)]
use std::{sync::Arc, collections::HashMap}; use std::{sync::Arc, collections::HashMap};
use rand_core::OsRng; use rand_core::OsRng;
@@ -8,12 +6,12 @@ use k256::{Scalar, ProjectivePoint};
use frost::{curve::Secp256k1, Participant, ThresholdKeys, tests::key_gen as frost_key_gen}; use frost::{curve::Secp256k1, Participant, ThresholdKeys, tests::key_gen as frost_key_gen};
use alloy_core::{ use alloy_core::{
primitives::{Address, U256, Bytes, Signature, TxKind}, primitives::{Address, U256, Bytes, TxKind},
hex::FromHex, hex::FromHex,
}; };
use alloy_consensus::{SignableTransaction, TxLegacy}; use alloy_consensus::{SignableTransaction, TxLegacy};
use alloy_rpc_types_eth::TransactionReceipt; use alloy_rpc_types::{BlockNumberOrTag, TransactionReceipt};
use alloy_simple_request_transport::SimpleRequest; use alloy_simple_request_transport::SimpleRequest;
use alloy_provider::{Provider, RootProvider}; use alloy_provider::{Provider, RootProvider};
@@ -39,7 +37,7 @@ pub fn key_gen() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, PublicKey)
group_key += ProjectivePoint::GENERATOR; group_key += ProjectivePoint::GENERATOR;
} }
for keys in keys.values_mut() { for keys in keys.values_mut() {
*keys = keys.clone().offset(offset); *keys = keys.offset(offset);
} }
let public_key = PublicKey::new(group_key).unwrap(); let public_key = PublicKey::new(group_key).unwrap();
@@ -59,19 +57,20 @@ pub async fn send(
// let chain_id = provider.get_chain_id().await.unwrap(); // let chain_id = provider.get_chain_id().await.unwrap();
// tx.chain_id = Some(chain_id); // tx.chain_id = Some(chain_id);
tx.chain_id = None; tx.chain_id = None;
tx.nonce = provider.get_transaction_count(address).await.unwrap(); tx.nonce =
provider.get_transaction_count(address, BlockNumberOrTag::Latest.into()).await.unwrap();
// 100 gwei // 100 gwei
tx.gas_price = 100_000_000_000u128; tx.gas_price = 100_000_000_000u128;
let sig = wallet.sign_prehash_recoverable(tx.signature_hash().as_ref()).unwrap(); let sig = wallet.sign_prehash_recoverable(tx.signature_hash().as_ref()).unwrap();
assert_eq!(address, tx.clone().into_signed(sig.into()).recover_signer().unwrap()); assert_eq!(address, tx.clone().into_signed(sig.into()).recover_signer().unwrap());
assert!( assert!(
provider.get_balance(address).await.unwrap() > provider.get_balance(address, BlockNumberOrTag::Latest.into()).await.unwrap() >
((U256::from(tx.gas_price) * U256::from(tx.gas_limit)) + tx.value) ((U256::from(tx.gas_price) * U256::from(tx.gas_limit)) + tx.value)
); );
let mut bytes = vec![]; let mut bytes = vec![];
tx.encode_with_signature_fields(&Signature::from(sig), &mut bytes); tx.encode_with_signature_fields(&sig.into(), &mut bytes);
let pending_tx = provider.send_raw_transaction(&bytes).await.ok()?; let pending_tx = provider.send_raw_transaction(&bytes).await.ok()?;
pending_tx.get_receipt().await.ok() pending_tx.get_receipt().await.ok()
} }

View File

@@ -14,7 +14,6 @@ use frost::{
use alloy_core::primitives::{Address, U256}; use alloy_core::primitives::{Address, U256};
use alloy_simple_request_transport::SimpleRequest; use alloy_simple_request_transport::SimpleRequest;
use alloy_rpc_types_eth::BlockTransactionsKind;
use alloy_rpc_client::ClientBuilder; use alloy_rpc_client::ClientBuilder;
use alloy_provider::{Provider, RootProvider}; use alloy_provider::{Provider, RootProvider};
@@ -85,12 +84,13 @@ async fn setup_test() -> (
async fn latest_block_hash(client: &RootProvider<SimpleRequest>) -> [u8; 32] { async fn latest_block_hash(client: &RootProvider<SimpleRequest>) -> [u8; 32] {
client client
.get_block(client.get_block_number().await.unwrap().into(), BlockTransactionsKind::Hashes) .get_block(client.get_block_number().await.unwrap().into(), false)
.await .await
.unwrap() .unwrap()
.unwrap() .unwrap()
.header .header
.hash .hash
.unwrap()
.0 .0
} }

View File

@@ -15,7 +15,7 @@ use alloy_core::primitives::Address;
use alloy_sol_types::SolCall; use alloy_sol_types::SolCall;
use alloy_rpc_types_eth::{TransactionInput, TransactionRequest}; use alloy_rpc_types::{TransactionInput, TransactionRequest};
use alloy_simple_request_transport::SimpleRequest; use alloy_simple_request_transport::SimpleRequest;
use alloy_rpc_client::ClientBuilder; use alloy_rpc_client::ClientBuilder;
use alloy_provider::{Provider, RootProvider}; use alloy_provider::{Provider, RootProvider};

111
coins/monero/Cargo.toml Normal file
View File

@@ -0,0 +1,111 @@
[package]
name = "monero-serai"
version = "0.1.4-alpha"
description = "A modern Monero transaction library"
license = "MIT"
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero"
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
edition = "2021"
rust-version = "1.74"
[package.metadata.docs.rs]
all-features = true
rustdoc-args = ["--cfg", "docsrs"]
[lints]
workspace = true
[dependencies]
std-shims = { path = "../../common/std-shims", version = "^0.1.1", default-features = false }
async-trait = { version = "0.1", default-features = false }
thiserror = { version = "1", default-features = false, optional = true }
zeroize = { version = "^1.5", default-features = false, features = ["zeroize_derive"] }
subtle = { version = "^2.4", default-features = false }
rand_core = { version = "0.6", default-features = false }
# Used to send transactions
rand = { version = "0.8", default-features = false }
rand_chacha = { version = "0.3", default-features = false }
# Used to select decoys
rand_distr = { version = "0.4", default-features = false }
sha3 = { version = "0.10", default-features = false }
pbkdf2 = { version = "0.12", features = ["simple"], default-features = false }
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
# Used for the hash to curve, along with the more complicated proofs
group = { version = "0.13", default-features = false }
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
multiexp = { path = "../../crypto/multiexp", version = "0.4", default-features = false, features = ["batch"] }
# Needed for multisig
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["ed25519"], optional = true }
monero-generators = { path = "generators", version = "0.4", default-features = false }
async-lock = { version = "3", default-features = false, optional = true }
hex-literal = "0.4"
hex = { version = "0.4", default-features = false, features = ["alloc"] }
serde = { version = "1", default-features = false, features = ["derive", "alloc"] }
serde_json = { version = "1", default-features = false, features = ["alloc"] }
base58-monero = { version = "2", default-features = false, features = ["check"] }
# Used for the provided HTTP RPC
digest_auth = { version = "0.3", default-features = false, optional = true }
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls"], optional = true }
tokio = { version = "1", default-features = false, optional = true }
[build-dependencies]
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
monero-generators = { path = "generators", version = "0.4", default-features = false }
[dev-dependencies]
tokio = { version = "1", features = ["sync", "macros"] }
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
[features]
std = [
"std-shims/std",
"thiserror",
"zeroize/std",
"subtle/std",
"rand_core/std",
"rand/std",
"rand_chacha/std",
"rand_distr/std",
"sha3/std",
"pbkdf2/std",
"multiexp/std",
"transcript/std",
"monero-generators/std",
"async-lock?/std",
"hex/std",
"serde/std",
"serde_json/std",
"base58-monero/std",
]
cache-distribution = ["async-lock"]
http-rpc = ["digest_auth", "simple-request", "tokio"]
multisig = ["transcript", "frost", "std"]
binaries = ["tokio/rt-multi-thread", "tokio/macros", "http-rpc"]
experimental = []
default = ["std", "http-rpc"]

View File

@@ -1,6 +1,6 @@
MIT License MIT License
Copyright (c) 2021-2025 Luke Parker Copyright (c) 2022-2023 Luke Parker
Permission is hereby granted, free of charge, to any person obtaining a copy Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal of this software and associated documentation files (the "Software"), to deal

49
coins/monero/README.md Normal file
View File

@@ -0,0 +1,49 @@
# monero-serai
A modern Monero transaction library intended for usage in wallets. It prides
itself on accuracy, correctness, and removing common pit falls developers may
face.
monero-serai also offers the following features:
- Featured Addresses
- A FROST-based multisig orders of magnitude more performant than Monero's
### Purpose and support
monero-serai was written for Serai, a decentralized exchange aiming to support
Monero. Despite this, monero-serai is intended to be a widely usable library,
accurate to Monero. monero-serai guarantees the functionality needed for Serai,
yet will not deprive functionality from other users.
Various legacy transaction formats are not currently implemented, yet we are
willing to add support for them. There aren't active development efforts around
them however.
### Caveats
This library DOES attempt to do the following:
- Create on-chain transactions identical to how wallet2 would (unless told not
to)
- Not be detectable as monero-serai when scanning outputs
- Not reveal spent outputs to the connected RPC node
This library DOES NOT attempt to do the following:
- Have identical RPC behavior when creating transactions
- Be a wallet
This means that monero-serai shouldn't be fingerprintable on-chain. It also
shouldn't be fingerprintable if a targeted attack occurs to detect if the
receiving wallet is monero-serai or wallet2. It also should be generally safe
for usage with remote nodes.
It won't hide from remote nodes it's monero-serai however, potentially
allowing a remote node to profile you. The implications of this are left to the
user to consider.
It also won't act as a wallet, just as a transaction library. wallet2 has
several *non-transaction-level* policies, such as always attempting to use two
inputs to create transactions. These are considered out of scope to
monero-serai.

67
coins/monero/build.rs Normal file
View File

@@ -0,0 +1,67 @@
use std::{
io::Write,
env,
path::Path,
fs::{File, remove_file},
};
use dalek_ff_group::EdwardsPoint;
use monero_generators::bulletproofs_generators;
fn serialize(generators_string: &mut String, points: &[EdwardsPoint]) {
for generator in points {
generators_string.extend(
format!(
"
dalek_ff_group::EdwardsPoint(
curve25519_dalek::edwards::CompressedEdwardsY({:?}).decompress().unwrap()
),
",
generator.compress().to_bytes()
)
.chars(),
);
}
}
fn generators(prefix: &'static str, path: &str) {
let generators = bulletproofs_generators(prefix.as_bytes());
#[allow(non_snake_case)]
let mut G_str = String::new();
serialize(&mut G_str, &generators.G);
#[allow(non_snake_case)]
let mut H_str = String::new();
serialize(&mut H_str, &generators.H);
let path = Path::new(&env::var("OUT_DIR").unwrap()).join(path);
let _ = remove_file(&path);
File::create(&path)
.unwrap()
.write_all(
format!(
"
pub(crate) static GENERATORS_CELL: OnceLock<Generators> = OnceLock::new();
pub fn GENERATORS() -> &'static Generators {{
GENERATORS_CELL.get_or_init(|| Generators {{
G: vec![
{G_str}
],
H: vec![
{H_str}
],
}})
}}
",
)
.as_bytes(),
)
.unwrap();
}
fn main() {
println!("cargo:rerun-if-changed=build.rs");
generators("bulletproof", "generators.rs");
generators("bulletproof_plus", "generators_plus.rs");
}

View File

@@ -0,0 +1,34 @@
[package]
name = "monero-generators"
version = "0.4.0"
description = "Monero's hash_to_point and generators"
license = "MIT"
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero/generators"
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
edition = "2021"
[package.metadata.docs.rs]
all-features = true
rustdoc-args = ["--cfg", "docsrs"]
[lints]
workspace = true
[dependencies]
std-shims = { path = "../../../common/std-shims", version = "^0.1.1", default-features = false }
subtle = { version = "^2.4", default-features = false }
sha3 = { version = "0.10", default-features = false }
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
group = { version = "0.13", default-features = false }
dalek-ff-group = { path = "../../../crypto/dalek-ff-group", version = "0.4", default-features = false }
[dev-dependencies]
hex = "0.4"
[features]
std = ["std-shims/std", "subtle/std", "sha3/std", "dalek-ff-group/std"]
default = ["std"]

View File

@@ -1,6 +1,6 @@
MIT License MIT License
Copyright (c) 2021-2025 Luke Parker Copyright (c) 2022-2023 Luke Parker
Permission is hereby granted, free of charge, to any person obtaining a copy Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal of this software and associated documentation files (the "Software"), to deal

View File

@@ -0,0 +1,7 @@
# Monero Generators
Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
`hash_to_point` here, is included, as needed to generate generators.
This library is usable under no-std when the `std` feature is disabled.

View File

@@ -0,0 +1,60 @@
use subtle::ConditionallySelectable;
use curve25519_dalek::edwards::{EdwardsPoint, CompressedEdwardsY};
use group::ff::{Field, PrimeField};
use dalek_ff_group::FieldElement;
use crate::hash;
/// Decompress canonically encoded ed25519 point
/// It does not check if the point is in the prime order subgroup
pub fn decompress_point(bytes: [u8; 32]) -> Option<EdwardsPoint> {
CompressedEdwardsY(bytes)
.decompress()
// Ban points which are either unreduced or -0
.filter(|point| point.compress().to_bytes() == bytes)
}
/// Monero's hash to point function, as named `hash_to_ec`.
pub fn hash_to_point(bytes: [u8; 32]) -> EdwardsPoint {
#[allow(non_snake_case)]
let A = FieldElement::from(486662u64);
let v = FieldElement::from_square(hash(&bytes)).double();
let w = v + FieldElement::ONE;
let x = w.square() + (-A.square() * v);
// This isn't the complete X, yet its initial value
// We don't calculate the full X, and instead solely calculate Y, letting dalek reconstruct X
// While inefficient, it solves API boundaries and reduces the amount of work done here
#[allow(non_snake_case)]
let X = {
let u = w;
let v = x;
let v3 = v * v * v;
let uv3 = u * v3;
let v7 = v3 * v3 * v;
let uv7 = u * v7;
uv3 * uv7.pow((-FieldElement::from(5u8)) * FieldElement::from(8u8).invert().unwrap())
};
let x = X.square() * x;
let y = w - x;
let non_zero_0 = !y.is_zero();
let y_if_non_zero_0 = w + x;
let sign = non_zero_0 & (!y_if_non_zero_0.is_zero());
let mut z = -A;
z *= FieldElement::conditional_select(&v, &FieldElement::from(1u8), sign);
#[allow(non_snake_case)]
let Z = z + w;
#[allow(non_snake_case)]
let mut Y = z - w;
Y *= Z.invert().unwrap();
let mut bytes = Y.to_repr();
bytes[31] |= sign.unwrap_u8() << 7;
decompress_point(bytes).unwrap().mul_by_cofactor()
}

View File

@@ -0,0 +1,79 @@
//! Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
//!
//! An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
//! `hash_to_point` here, is included, as needed to generate generators.
#![cfg_attr(not(feature = "std"), no_std)]
use std_shims::{sync::OnceLock, vec::Vec};
use sha3::{Digest, Keccak256};
use curve25519_dalek::edwards::{EdwardsPoint as DalekPoint};
use group::{Group, GroupEncoding};
use dalek_ff_group::EdwardsPoint;
mod varint;
use varint::write_varint;
mod hash_to_point;
pub use hash_to_point::{hash_to_point, decompress_point};
#[cfg(test)]
mod tests;
fn hash(data: &[u8]) -> [u8; 32] {
Keccak256::digest(data).into()
}
static H_CELL: OnceLock<DalekPoint> = OnceLock::new();
/// Monero's alternate generator `H`, used for amounts in Pedersen commitments.
#[allow(non_snake_case)]
pub fn H() -> DalekPoint {
*H_CELL.get_or_init(|| {
decompress_point(hash(&EdwardsPoint::generator().to_bytes())).unwrap().mul_by_cofactor()
})
}
static H_POW_2_CELL: OnceLock<[DalekPoint; 64]> = OnceLock::new();
/// Monero's alternate generator `H`, multiplied by 2**i for i in 1 ..= 64.
#[allow(non_snake_case)]
pub fn H_pow_2() -> &'static [DalekPoint; 64] {
H_POW_2_CELL.get_or_init(|| {
let mut res = [H(); 64];
for i in 1 .. 64 {
res[i] = res[i - 1] + res[i - 1];
}
res
})
}
const MAX_M: usize = 16;
const N: usize = 64;
const MAX_MN: usize = MAX_M * N;
/// Container struct for Bulletproofs(+) generators.
#[allow(non_snake_case)]
pub struct Generators {
pub G: Vec<EdwardsPoint>,
pub H: Vec<EdwardsPoint>,
}
/// Generate generators as needed for Bulletproofs(+), as Monero does.
pub fn bulletproofs_generators(dst: &'static [u8]) -> Generators {
let mut res = Generators { G: Vec::with_capacity(MAX_MN), H: Vec::with_capacity(MAX_MN) };
for i in 0 .. MAX_MN {
let i = 2 * i;
let mut even = H().compress().to_bytes().to_vec();
even.extend(dst);
let mut odd = even.clone();
write_varint(&i.try_into().unwrap(), &mut even).unwrap();
write_varint(&(i + 1).try_into().unwrap(), &mut odd).unwrap();
res.H.push(EdwardsPoint(hash_to_point(hash(&even))));
res.G.push(EdwardsPoint(hash_to_point(hash(&odd))));
}
res
}

View File

@@ -0,0 +1,38 @@
use crate::{decompress_point, hash_to_point};
#[test]
fn crypto_tests() {
// tests.txt file copied from monero repo
// https://github.com/monero-project/monero/
// blob/ac02af92867590ca80b2779a7bbeafa99ff94dcb/tests/crypto/tests.txt
let reader = include_str!("./tests.txt");
for line in reader.lines() {
let mut words = line.split_whitespace();
let command = words.next().unwrap();
match command {
"check_key" => {
let key = words.next().unwrap();
let expected = match words.next().unwrap() {
"true" => true,
"false" => false,
_ => unreachable!("invalid result"),
};
let actual = decompress_point(hex::decode(key).unwrap().try_into().unwrap());
assert_eq!(actual.is_some(), expected);
}
"hash_to_ec" => {
let bytes = words.next().unwrap();
let expected = words.next().unwrap();
let actual = hash_to_point(hex::decode(bytes).unwrap().try_into().unwrap());
assert_eq!(hex::encode(actual.compress().to_bytes()), expected);
}
_ => unreachable!("unknown command"),
}
}
}

View File

@@ -0,0 +1 @@
mod hash_to_point;

View File

@@ -0,0 +1,628 @@
check_key c2cb3cf3840aa9893e00ec77093d3d44dba7da840b51c48462072d58d8efd183 false
check_key bd85a61bae0c101d826cbed54b1290f941d26e70607a07fc6f0ad611eb8f70a6 true
check_key 328f81cad4eba24ab2bad7c0e56b1e2e7346e625bcb06ae649aef3ffa0b8bef3 false
check_key 6016a5463b9e5a58c3410d3f892b76278883473c3f0b69459172d3de49e85abe true
check_key 4c71282b2add07cdc6898a2622553f1ca4eb851e5cb121181628be5f3814c5b1 false
check_key 69393c25c3b50e177f81f20f852dd604e768eb30052e23108b3cfa1a73f2736e true
check_key 3d5a89b676cb84c2be3428d20a660dc6a37cae13912e127888a5132e8bac2163 true
check_key 78cd665deb28cebc6208f307734c56fccdf5fa7e2933fadfcdd2b6246e9ae95c false
check_key e03b2414e260580f86ee294cd4c636a5b153e617f704e81dad248fbf715b2ee4 true
check_key 28c3503ce82d7cdc8e0d96c4553bcf0352bbcfc73925495dbe541e7e1df105fc false
check_key 06855c3c3e0d03fec354059bda319b39916bdc10b6581e3f41b335ee7b014fd5 false
check_key 556381485df0d7d5a268ab5ecfb2984b060acc63471183fcf538bf273b0c0cb5 true
check_key c7f76d82ac64b1e7fdc32761ff00d6f0f7ada4cf223aa5a11187e3a02e1d5319 true
check_key cfa85d8bdb6f633fcf031adee3a299ac42eeb6bd707744049f652f6322f5aa47 true
check_key 91e9b63ced2b08979fee713365464cc3417c4f238f9bdd3396efbb3c58e195ee true
check_key 7b56e76fe94bd30b3b2f2c4ba5fe4c504821753a8965eb1cbcf8896e2d6aba19 true
check_key 7338df494bc416cf5edcc02069e067f39cb269ce67bd9faba956021ce3b3de3a false
check_key f9a1f27b1618342a558379f4815fa5039a8fe9d98a09f45c1af857ba99231dc1 false
check_key b2a1f37718180d4448a7fcb5f788048b1a7132dde1cfd25f0b9b01776a21c687 true
check_key 0d3a0f9443a8b24510ad1e76a8117cca03bce416edfe35e3c2a2c2712454f8dc false
check_key d8d3d806a76f120c4027dc9c9d741ad32e06861b9cfbc4ce39289c04e251bb3c false
check_key 1e9e3ba7bc536cd113606842835d1f05b4b9e65875742f3a35bfb2d63164b5d5 true
check_key 5c52d0087997a2cdf1d01ed0560d94b4bfd328cb741cb9a8d46ff50374b35a57 true
check_key bb669d4d7ffc4b91a14defedcdbd96b330108b01adc63aa685e2165284c0033b false
check_key d2709ae751a0a6fd796c98456fa95a7b64b75a3434f1caa3496eeaf5c14109b4 true
check_key e0c238cba781684e655b10a7d4af04ab7ff2e7022182d7ed2279d6adf36b3e7a false
check_key 34ebb4bf871572cee5c6935716fab8c8ec28feef4f039763d8f039b84a50bf4c false
check_key 4730d4f38ec3f3b83e32e6335d2506df4ee39858848842c5a0184417fcc639e4 true
check_key d42cf7fdf5e17e0a8a7f88505a2b7a3d297113bd93d3c20fa87e11509ec905a2 true
check_key b757c95059cefabb0080d3a8ebca82e46efecfd29881be3121857f9d915e388c false
check_key bbe777aaf04d02b96c0632f4b1c6f35f1c7bcbc5f22af192f92c077709a2b50b false
check_key 73518522aabd28566f858c33fccb34b7a4de0e283f6f783f625604ee647afad9 true
check_key f230622c4a8f6e516590466bd10f86b64fbef61695f6a054d37604e0b024d5af false
check_key bc6b9a8379fd6c369f7c3bd9ddce58db6b78f27a41d798bb865c3920824d0943 false
check_key 45a4f87c25898cd6be105fa1602b85c4d862782adaac8b85c996c4a2bcd8af47 true
check_key eb4ad3561d21c4311affbd7cc2c7ff5fd509f72f88ba67dc097a75c31fdbd990 false
check_key 2f34f4630c09a23b7ecc19f02b4190a26df69e07e13de8069ae5ff80d23762fc true
check_key 2ea4e4fb5085eb5c8adee0d5ab7d35c67d74d343bd816cd13924536cffc2527c true
check_key 5d35467ee6705a0d35818aa9ae94e4603c3e5500bfc4cf4c4f77a7160a597aa6 true
check_key 8ff42bc76796e20c99b6e879369bd4b46a256db1366416291de9166e39d5a093 true
check_key 0262ba718850df6c621e8a24cd9e4831c047e38818a89e15c7a06a489a4558e1 false
check_key 58b29b2ba238b534b08fb46f05f430e61cb77dc251b0bb50afec1b6061fd9247 false
check_key 153170e3dc2b0e1b368fc0d0e31053e872f094cdace9a2846367f0d9245a109b false
check_key 40419d309d07522d493bb047ca9b5fb6c401aae226eefae6fd395f5bb9114200 true
check_key 713068818d256ef69c78cd6082492013fbd48de3c9e7e076415dd0a692994504 true
check_key a7218ee08e50781b0c87312d5e0031467e863c10081668e3792d96cbcee4e474 true
check_key 356ce516b00e674ef1729c75b0a68090e7265cef675bbf32bf809495b67e9342 false
check_key 52a5c053293675e3efd2c585047002ea6d77931cbf38f541b9070d319dc0d237 false
check_key 77c0080bf157e069b18c4c604cc9505c5ec6f0f9930e087592d70507ca1b5534 false
check_key e733bc41f880a4cfb1ca6f397916504130807289cacfca10b15f5b8d058ed1bf false
check_key c4f1d3c884908a574ecea8be10e02277de35ef84a1d10f105f2be996f285161f true
check_key aed677f7f69e146aa0863606ac580fc0bbdc22a88c4b4386abaa4bdfff66bcc9 false
check_key 6ad0edf59769599af8caa986f502afc67aecbebb8107aaf5e7d3ae51d5cf8dd8 false
check_key 64a0a70e99be1f775c222ee9cd6f1bee6f632cb9417899af398ff9aff70661c6 true
check_key c63afaa03bb5c4ed7bc77aac175dbfb73f904440b2e3056a65850ac1bd261332 false
check_key a4e89cd2471c26951513b1cfbdcf053a86575e095af52495276aa56ede8ce344 false
check_key 2ce935d97f7c3ddb973de685d20f58ee39938fe557216328045ec2b83f3132be true
check_key 3e3d38b1fca93c1559ac030d586616354c668aa76245a09e3fa6de55ac730973 true
check_key 8b81b9681f76a4254007fd07ed1ded25fc675973ccb23afd06074805194733a4 false
check_key 26d1c15dfc371489439e29bcef2afcf7ed01fac24960fdc2e7c20847a8067588 true
check_key 85c1199b5a4591fc4cc36d23660648c1b9cfbb0e9c47199fa3eea33299a3dcec false
check_key 60830ba5449c1f04ac54675dfc7cac7510106c4b7549852551f8fe65971123e2 false
check_key 3e43c28c024597b3b836e4bc16905047cbf6e841b80e0b8cd6a325049070c2a5 false
check_key 474792c16a0032343a6f28f4cb564747c3b1ea0b6a6b9a42f7c71d7cc3dd3b44 true
check_key c8ec5e67cb5786673085191881950a3ca20dde88f46851b01dd91c695cfbad16 true
check_key 861c4b24b24a87b8559e0bb665f84dcc506c147a909f335ae4573b92299f042f false
check_key 2c9e0fe3e4983d79f86c8c36928528f1bc90d94352ce427032cdef6906d84d0b true
check_key 9293742822c2dff63fdc1bf6645c864fd527cea2ddba6d4f3048d202fc340c9a true
check_key 3956422ad380ef19cb9fe360ef09cc7aaec7163eea4114392a7a0b2e2671914e true
check_key 5ae8e72cadda85e525922fec11bd53a261cf26ee230fe85a1187f831b1b2c258 false
check_key 973feca43a0baf450c30ace5dc19015e19400f0898316e28d9f3c631da31f99a true
check_key dd946c91a2077f45c5c16939e53859d9beabaf065e7b1b993d5e5cd385f8716e true
check_key b3928f2d67e47f6bd6da81f72e64908d8ff391af5689f0202c4c6fec7666ffe8 true
check_key 313382e82083697d7f9d256c3b3800b099b56c3ef33cacdccbd40a65622e25fc false
check_key 7d65380c12144802d39ed9306eed79fe165854273700437c0b4b50559800c058 true
check_key 4db5c20a49422fd27739c9ca80e2271a8a125dfcead22cb8f035d0e1b7b163be true
check_key dd76a9f565ef0e44d1531349ec4c5f7c3c387c2f5823e693b4952f4b0b70808c true
check_key 66430bf628eae23918c3ed17b42138db1f98c24819e55fc4a07452d0c85603eb true
check_key 9f0b677830c3f089c27daf724bb10be848537f8285de83ab0292d35afb617f77 false
check_key cbf98287391fb00b1e68ad64e9fb10198025864c099b8b9334d840457e673874 true
check_key a42552e9446e49a83aed9e3370506671216b2d1471392293b8fc2b81c81a73ee false
check_key fb3de55ac81a923d506a514602d65d004ec9d13e8b47e82d73af06da73006673 false
check_key e17abb78e58a4b72ff4ad7387b290f2811be880b394b8bcaae7748ac09930169 false
check_key 9ffbda7ace69753761cdb5eb01f75433efa5cdb6a4f1b664874182c6a95adcba true
check_key 507123c979179ea0a3f7f67fb485f71c8636ec4ec70aa47b92f3c707e7541a54 false
check_key f1d0b156571994ef578c61cb6545d34f834eb30e4357539a5633c862d4dffa91 false
check_key 3de62311ec14f9ee95828c190b2dc3f03059d6119e8dfccb7323efc640e07c75 false
check_key 5e50bb48bc9f6dd11d52c1f0d10d8ae5674d7a4af89cbbce178dafc8a562e5fe false
check_key 20b2c16497be101995391ceefb979814b0ea76f1ed5b6987985bcdcd17b36a81 false
check_key d63bff73b914ce791c840e99bfae0d47afdb99c2375e33c8f149d0df03d97873 false
check_key 3f24b3d94b5ddd244e4c4e67a6d9f533f0396ca30454aa0ca799f21328b81d47 true
check_key 6a44c016f09225a6d2e830290719d33eb29b53b553eea7737ed3a6e297b2e7d2 true
check_key ff0f34df0c76c207b8340be2009db72f730c69c2bbfeea2013105eaccf1d1f8e true
check_key 4baf559869fe4e915e219c3c8d9a2330fc91e542a5a2a7311d4d59fee996f807 true
check_key 1632207dfef26e97d13b0d0035ea9468fc5a8a89b0990fce77bb143c9d7f3b67 true
check_key fcb3dee3993d1a47630f29410903dd03706bd5e81c5802e6f1b9095cbdb404d3 true
check_key fb527092b9809e3d27d7588c7ef89915a769b99c1e03e7f72bbead9ed837daae false
check_key 902b118d27d40ab9cbd55edd375801ce302cdb59e09c8659a3ea1401918d8bba false
check_key 4d6fbf25ca51e263a700f1abf84f758dde3d11b632e908b3093d64fe2e70ea0a true
check_key f4c3211ec70affc1c9a94a6589460ee8360dad5f8c679152f16994038532e3fc true
check_key c2b3d73ac14956d7fdf12fa92235af1bb09e1566a6a6ffd0025682c750abdd69 false
check_key b7e68c12207d2e2104fb2ca224829b6fccc1c0e2154e8a931e3c837a945f4430 false
check_key 56ca0ca227708f1099bda1463db9559541c8c11ffad7b3d95c717471f25a01bf true
check_key 3eef3a46833e4d851671182a682e344e36bea7211a001f3b8af1093a9c83f1b2 true
check_key bd1f4a4f26cab7c1cbc0e17049b90854d6d28d2d55181e1b5f7a8045fcdfa06e true
check_key 8537b01c87e7c184d9555e8d93363dcd9b60a8acc94cd3e41eb7525fd3e1d35a false
check_key 68ace49179d549bad391d98ab2cc8afee65f98ce14955c3c1b16e850fabec231 true
check_key f9922f8a660e7c3e4f3735a817d18b72f59166a0be2d99795f953cf233a27e24 true
check_key 036b6be3da26e80508d5a5a6a5999a1fe0db1ac4e9ade8f1ea2eaf2ea9b1a70e true
check_key 5e595e886ce16b5ea31f53bcb619f16c8437276618c595739fece6339731feb0 false
check_key 4ee2cebae3476ed2eeb7efef9d20958538b3642f938403302682a04115c0f8ed false
check_key 519eedbd0da8676063ce7d5a605b3fc27afeecded857afa24b894ad248c87b5d false
check_key ce2b627c0accf4a3105796680c37792b30c6337d2d4fea11678282455ff82ff7 false
check_key aa26ed99071a8416215e8e7ded784aa7c2b303aab67e66f7539905d7e922eb4d false
check_key 435ae49c9ca26758aa103bdcca8d51393b1906fe27a61c5245361e554f335ec2 true
check_key 42568af395bd30024f6ccc95205c0e11a6ad1a7ee100f0ec46fcdf0af88e91fb false
check_key 0b4a78d1fde56181445f04ca4780f0725daa9c375b496fab6c037d6b2c2275db true
check_key 2f82d2a3c8ce801e1ad334f9e074a4fbf76ffac4080a7331dc1359c2b4f674a4 false
check_key 24297d8832d733ed052dd102d4c40e813f702006f325644ccf0cb2c31f77953f false
check_key 5231a53f6bea7c75b273bde4a9f673044ed87796f20e0909978f29d98fc8d4f0 true
check_key 94b5affcf78be5cf62765c32a0794bc06b4900e8a47ddba0e166ec20cec05935 true
check_key c14b4d846ea52ffbbb36aa62f059453af3cfae306280dada185d2d385ef8f317 true
check_key cceb34fddf01a6182deb79c6000a998742d4800d23d1d8472e3f43cd61f94508 true
check_key 1faffa33407fba1634d4136cf9447896776c16293b033c6794f06774b514744c true
check_key faaac98f644a2b77fb09ba0ebf5fcddf3ff55f6604c0e9e77f0278063e25113a true
check_key 09e8525b00bea395978279ca979247a76f38f86dce4465eb76c140a7f904c109 true
check_key 2d797fc725e7fb6d3b412694e7386040effe4823cdf01f6ec7edea4bc0e77e20 false
check_key bbb74dabee651a65f46bca472df6a8a749cc4ba5ca35078df5f6d27a772f922a false
check_key 77513ca00f3866607c3eff5c2c011beffa775c0022c5a4e7de1120a27e6687fd true
check_key 10064c14ace2a998fc2843eeeb62884fe3f7ab331ca70613d6a978f44d9868eb false
check_key 026ae84beb5e54c62629a7b63702e85044e38cadfc9a1fcabee6099ba185005c false
check_key aef91536292b7ba34a3e787fb019523c2fa7a0d56fca069cc82ccb6b02a45b14 false
check_key 147bb1a82c623c722540feaad82b7adf4b85c6ec0cbcef3ca52906f3e85617ac true
check_key fc9fb281a0847d58dc9340ef35ef02f7d20671142f12bdd1bfb324ab61d03911 false
check_key b739801b9455ac617ca4a7190e2806669f638d4b2f9288171afb55e1542c8d71 false
check_key 494cc1e2ee997eb1eb051f83c4c89968116714ddf74e460d4fa1c6e7c72e3eb3 true
check_key ed2fbdf2b727ed9284db90ec900a942224787a880bc41d95c4bc4cf136260fd7 true
check_key 02843d3e6fc6835ad03983670a592361a26948eb3e31648d572416a944d4909e true
check_key c14fea556a7e1b6b6c3d4e2e38a4e7e95d834220ff0140d3f7f561a34e460801 true
check_key 5f8f82a35452d0b0d09ffb40a1154641916c31e161ad1a6ab8cfddc2004efdf6 false
check_key 7b93d72429fab07b49956007eba335bb8c5629fbf9e7a601eaa030f196934a56 true
check_key 6a63ed96d2e46c2874beaf82344065d94b1e5c04406997f94caf4ccd97cfbab9 false
check_key c915f409e1e0f776d1f440aa6969cfec97559ef864b07d8c0d7c1163871b4603 true
check_key d06bc33630fc94303c2c369481308f805f5ce53c40141160aa4a1f072967617e false
check_key 1aafb14ca15043c2589bcd32c7c5f29479216a1980e127e9536729faf1c40266 true
check_key 58c115624a20f4b0c152ccd048c54a28a938556863ab8521b154d3165d3649cd false
check_key 9001ba086e8aa8a67e128f36d700cc641071556306db7ec9b8ac12a6256b27b7 false
check_key 898c468541634fb0def11f82c781341fce0def7b15695af4e642e397218c730c true
check_key 47ea6539e65b7b611b0e1ae9ee170adf7c31581ca9f78796d8ebbcc5cd74b712 false
check_key 0c60952a64eeac446652f5d3c136fd36966cf66310c15ee6ab2ecbf981461257 false
check_key 682264c4686dc7736b6e46bdc8ab231239bc5dac3f5cb9681a1e97a527945e8e true
check_key 276006845ca0ea4238b231434e20ad8b8b2a36876effbe1d1e3ffb1f14973397 true
check_key eecd3a49e55e32446f86c045dce123ef6fe2e5c57db1d850644b3c56ec689fce true
check_key a4dced63589118db3d5aebf6b5670e71250f07485ca4bb6dddf9cce3e4c227a1 false
check_key b8ade608ba43d55db7ab481da88b74a9be513fca651c03e04d30cc79f50e0276 false
check_key 0d91de88d007a03fe782f904808b036ff63dec6b73ce080c55231afd4ed261c3 true
check_key 87c59becb52dd16501edadbb0e06b0406d69541c4d46115351e79951a8dd9c28 true
check_key 9aee723be2265171fe10a86d1d3e9cf5a4e46178e859db83f86d1c6db104a247 false
check_key 509d34ae5bf56db011845b8cdf0cc7729ed602fce765e9564cb433b4d4421a43 false
check_key 06e766d9a6640558767c2aab29f73199130bfdc07fd858a73e6ae8e7b7ba23ba false
check_key 801c4fe5ab3e7cf13f7aa2ca3bc57cc8eba587d21f8bc4cd40b1e98db7aec8d9 false
check_key d85ad63aeb7d2faa22e5c9b87cd27f45b01e6d0fdc4c3ddf105584ac0a021465 false
check_key a7ca13051eb2baeb5befa5e236e482e0bb71803ad06a6eae3ae48742393329d2 true
check_key 5a9ba3ec20f116173d933bf5cf35c320ed3751432f3ab453e4a6c51c1d243257 false
check_key a4091add8a6710c03285a422d6e67863a48b818f61c62e989b1e9b2ace240a87 false
check_key bdee0c6442e6808f25bb18e21b19032cf93a55a5f5c6426fba2227a41c748684 true
check_key d4aeb6cdad9667ec3b65c7fbc5bfd1b82bba1939c6bb448a86e40aec42be5f25 false
check_key 73525b30a77f1212f7e339ec11f48c453e476f3669e6e70bebabc2fe9e37c160 true
check_key 45501f2dc4d0a3131f9e0fe37a51c14869ab610abd8bf0158111617924953629 false
check_key 07d0e4c592aa3676adf81cca31a95d50c8c269d995a78cde27b2a9a7a93083a6 false
check_key a1797d6178c18add443d22fdbf45ca5e49ead2f78b70bdf1500f570ee90adca5 true
check_key 0961e82e6e7855d7b7bf96777e14ae729f91c5bbd20f805bd7daac5ccbec4bab false
check_key 57f5ba0ad36e997a4fb585cd2fc81b9cc5418db702c4d1e366639bb432d37c73 true
check_key 82b005be61580856841e042ee8be74ae4ca66bb6733478e81ca1e56213de5c05 false
check_key d7733dcae1874c93e9a2bd46385f720801f913744d60479930dad7d56c767cdc false
check_key b8b8b698609ac3f1bd8f4965151b43b362e6c5e3d1c1feae312c1d43976d59ab true
check_key 4bba7815a9a1b86a5b80b17ac0b514e2faa7a24024f269b330e5b7032ae8c04e true
check_key 0f70da8f8266b58acda259935ef1a947c923f8698622c5503520ff31162e877b false
check_key 233eaa3db80f314c6c895d1328a658a9175158fa2483ed216670c288a04b27bc false
check_key a889f124fabfd7a1e2d176f485be0cbd8b3eeaafeee4f40e99e2a56befb665be true
check_key 2b7b8abc198b11cf7efa21bc63ec436f790fe1f9b8c044440f183ab291af61d6 true
check_key 2491804714f7938cf501fb2adf07597b4899b919cabbaab49518b8f8767fdc6a true
check_key 52744a54fcb00dc930a5d7c2bc866cbfc1e75dd38b38021fd792bb0ca9f43164 true
check_key e42cbf70b81ba318419104dffbb0cdc3b7e7d4698e422206b753a4e2e6fc69bb false
check_key 2faff73e4fed62965f3dbf2e6446b5fea0364666cc8c9450b6ed63bbb6f5f0e7 true
check_key 8b963928d75be661c3c18ddd4f4d1f37ebc095ce1edc13fe8b23784c8f416dfd false
check_key b1162f952808434e4d2562ffda98bd311613d655d8cf85dc86e0a6c59f7158bc true
check_key 5a69adcd9e4f5b0020467e968d85877cb3aa04fa86088d4499b57ca65a665836 true
check_key 61ab47da432c829d0bc9d4fdb59520b135428eec665ad509678188b81c7adf49 false
check_key 154bb547f22f65a87c0c3f56294f5791d04a3c14c8125d256aeed8ec54c4a06e true
check_key 0a78197861c30fd3547b5f2eabd96d3ac22ac0632f03b7afd9d5d2bfc2db352f true
check_key 8bdeadcca1f1f8a4a67b01ed2f10ef31aba7b034e8d1df3a69fe9aebf32454e0 false
check_key f4b17dfca559be7d5cea500ac01e834624fed9befae3af746b39073d5f63190d true
check_key 622c52821e16ddc63b58f3ec2b959fe8c6ea6b1a596d9a58fd81178963f41c01 true
check_key 07bedd5d55c937ef5e23a56c6e58f31adb91224d985285d7fef39ede3a9efb17 false
check_key 5179bf3b7458648e57dc20f003c6bbfd55e8cd7c0a6e90df6ef8e8183b46f99d true
check_key 683c80c3f304f10fdd53a84813b5c25b1627ebd14eb29b258b41cd14396ef41f true
check_key c266244ed597c438170875fe7874f81258a830105ca1108131e6b8fea95eb8ba true
check_key 0c1cdc693df29c2d1e66b2ce3747e34a30287d5eb6c302495634ec856593fe8e true
check_key 28950f508f6a0d4c20ab5e4d55b80565a6a539092e72b7eb0ed9fa5017ecef88 false
check_key 8328a2a5fcfc4433b1c283539a8943e6eb8cc16c59f29dedc3af2c77cfd56f25 true
check_key 5d0f82319676d4d3636ff5dc2a38ea5ec8aeaac4835fdcab983ab35d76b7967b false
check_key cafcc75e94a014115f25c23aaae86e67352f928f468d4312b92240ff0f3a4481 false
check_key 3e5fdd8072574218f389d018e959669e8ca4ef20b114ea7dce7bfb32339f9f42 true
check_key 591763e3390a78ccb529ceea3d3a97165878b179ad2edaa166fd3c78ec69d391 true
check_key 7a0a196935bf79dc2b1c3050e8f2bf0665f7773fc07511b828ec1c4b1451d317 false
check_key 9cf0c034162131fbaa94a608f58546d0acbcc2e67b62a0b2be2ce75fc8c25b9a false
check_key e3840846e3d32644d45654b96def09a5d6968caca9048c13fcaab7ae8851c316 false
check_key a4e330253739af588d70fbda23543f6df7d76d894a486d169e5fedf7ed32d2e2 false
check_key cfb41db7091223865f7ecbdda92b9a6fb08887827831451de5bcb3165395d95d true
check_key 3d10bd023cef8ae30229fdbfa7446a3c218423d00f330857ff6adde080749015 false
check_key 4403b53b8d4112bb1727bb8b5fd63d1f79f107705ffe17867704e70a61875328 false
check_key 121ef0813a9f76b7a9c045058557c5072de6a102f06a9b103ead6af079420c29 true
check_key 386204cf473caf3854351dda55844a41162eb9ce4740e1e31cfef037b41bc56e false
check_key eb5872300dc658161df469364283e4658f37f6a1349976f8973bd6b5d1d57a39 true
check_key b8f32188f0fc62eeb38a561ff7b7f3c94440e6d366a05ef7636958bc97834d02 false
check_key a817f129a8292df79eef8531736fdebb2e985304653e7ef286574d0703b40fb4 false
check_key 2c06595bc103447b9c20a71cd358c704cb43b0b34c23fb768e6730ac9494f39e true
check_key dd84bc4c366ced4f65c50c26beb8a9bc26c88b7d4a77effbb0f7af1b28e25734 false
check_key 76b4d33810eed637f90d49a530ac5415df97cafdac6f17eda1ba7eb9a14e5886 true
check_key 926ce5161c4c92d90ec4efc58e5f449a2c385766c42d2e60af16b7362097aef5 false
check_key 20c661f1e95e94a745eb9ec7a4fa719eff2f64052968e448d4734f90952aefee false
check_key 671b50abbd119c756010416e15fcdcc9a8e92eed0f67cbca240c3a9154db55c0 false
check_key df7aeee8458433e5c68253b8ef006a1c74ce3aef8951056f1fa918a8eb855213 false
check_key 70c81a38b92849cf547e3d5a6570d78e5228d4eaf9c8fdd15959edc9eb750daf false
check_key 55a512100b72d4ae0cfc16c75566fcaa3a7bb9116840db1559c71fd0e961cc36 false
check_key dbfbec4d0d2433a794ad40dc0aea965b6582875805c9a7351b47377403296acd true
check_key 0a7fe09eb9342214f98b38964f72ae3c787c19e5d7e256af9216f108f88b00a3 true
check_key a82e54681475f53ced9730ee9e3a607e341014d9403f5a42f3dbdbe8fc52e842 true
check_key 4d1f90059f7895a3f89abf16162e8d69b399c417f515ccb43b83144bbe8105f6 true
check_key 94e5c5b8486b1f2ff4e98ddf3b9295787eb252ba9b408ca4d7724595861da834 false
check_key d16e3e8dfa6d33d1d2db21c651006ccddbf4ce2e556594de5a22ae433e774ae6 false
check_key a1b203ec5e36098a3af08d6077068fec57eab3a754cbb5f8192983f37191c2df false
check_key 5378bb3ec8b4e49849bd7477356ed86f40757dd1ea3cee1e5183c7e7be4c3406 false
check_key 541a4162edeb57130295441dc1cb604072d7323b6c7dffa02ea5e4fed1d2ee9e true
check_key d8e86e189edcc4b5c262c26004691edd7bd909090997f886b00ed4b6af64d547 false
check_key 18a8731d1983d1df2ce2703b4c85e7357b6356634ac1412e6c2ac33ad35f8364 false
check_key b21212eac1eb11e811022514c5041233c4a07083a5b20acd7d632a938dc627de true
check_key 50efcfac1a55e9829d89334513d6d921abeb237594174015d154512054e4f9d1 true
check_key 9c44e8bcba31ddb4e67808422e42062540742ebd73439da0ba7837bf26649ec4 true
check_key b068a4f90d5bd78fd350daa129de35e5297b0ad6be9c85c7a6f129e3760a1482 false
check_key e9df93932f0096fcf2055564457c6dc685051673a4a6cd87779924be5c4abead true
check_key eddab2fc52dac8ed12914d1eb5b0da9978662c4d35b388d64ddf8f065606acaf true
check_key 54d3e6b3f2143d9083b4c98e4c22d98f99d274228050b2dc11695bf86631e89f true
check_key 6da1d5ef1827de8bbf886623561b058032e196d17f983cbc52199b31b2acc75b true
check_key e2a2df18e2235ebd743c9714e334f415d4ca4baf7ad1b335fb45021353d5117f true
check_key f34cb7d6e861c8bfe6e15ac19de68e74ccc9b345a7b751a10a5c7f85a99dfeb6 false
check_key f36e2f5967eb56244f9e4981a831f4d19c805e31983662641fe384e68176604a true
check_key c7e2dc9e8aa6f9c23d379e0f5e3057a69b931b886bbb74ded9f660c06d457463 true
check_key b97324364941e06f2ab4f5153a368f9b07c524a89e246720099042ad9e8c1c5b false
check_key eff75c70d425f5bba0eef426e116a4697e54feefac870660d9cf24c685078d75 false
check_key 161f3cd1a5873788755437e399136bcbf51ff5534700b3a8064f822995a15d24 false
check_key 63d6d3d2c21e88b06c9ff856809572024d86c85d85d6d62a52105c0672d92e66 false
check_key 1dc19b610b293de602f43dca6c204ce304702e6dc15d2a9337da55961bd26834 false
check_key 28a16d02405f509e1cfef5236c0c5f73c3bcadcd23c8eff377253941f82769db true
check_key 682d9cc3b65d149b8c2e54d6e20101e12b7cf96be90c9458e7a69699ec0c8ed7 false
check_key 0000000000000000000000000000000000000000000000000000000000000000 true
check_key 0000000000000000000000000000000000000000000000000000000000000080 true
check_key 0100000000000000000000000000000000000000000000000000000000000000 true
check_key 0100000000000000000000000000000000000000000000000000000000000080 false
check_key 0200000000000000000000000000000000000000000000000000000000000000 false
check_key 0200000000000000000000000000000000000000000000000000000000000080 false
check_key 0300000000000000000000000000000000000000000000000000000000000000 true
check_key 0300000000000000000000000000000000000000000000000000000000000080 true
check_key 0400000000000000000000000000000000000000000000000000000000000000 true
check_key 0400000000000000000000000000000000000000000000000000000000000080 true
check_key 0500000000000000000000000000000000000000000000000000000000000000 true
check_key 0500000000000000000000000000000000000000000000000000000000000080 true
check_key 0600000000000000000000000000000000000000000000000000000000000000 true
check_key 0600000000000000000000000000000000000000000000000000000000000080 true
check_key 0700000000000000000000000000000000000000000000000000000000000000 false
check_key 0700000000000000000000000000000000000000000000000000000000000080 false
check_key 0800000000000000000000000000000000000000000000000000000000000000 false
check_key 0800000000000000000000000000000000000000000000000000000000000080 false
check_key 0900000000000000000000000000000000000000000000000000000000000000 true
check_key 0900000000000000000000000000000000000000000000000000000000000080 true
check_key 0a00000000000000000000000000000000000000000000000000000000000000 true
check_key 0a00000000000000000000000000000000000000000000000000000000000080 true
check_key 0b00000000000000000000000000000000000000000000000000000000000000 false
check_key 0b00000000000000000000000000000000000000000000000000000000000080 false
check_key 0c00000000000000000000000000000000000000000000000000000000000000 false
check_key 0c00000000000000000000000000000000000000000000000000000000000080 false
check_key 0d00000000000000000000000000000000000000000000000000000000000000 false
check_key 0d00000000000000000000000000000000000000000000000000000000000080 false
check_key 0e00000000000000000000000000000000000000000000000000000000000000 true
check_key 0e00000000000000000000000000000000000000000000000000000000000080 true
check_key 0f00000000000000000000000000000000000000000000000000000000000000 true
check_key 0f00000000000000000000000000000000000000000000000000000000000080 true
check_key 1000000000000000000000000000000000000000000000000000000000000000 true
check_key 1000000000000000000000000000000000000000000000000000000000000080 true
check_key 1100000000000000000000000000000000000000000000000000000000000000 false
check_key 1100000000000000000000000000000000000000000000000000000000000080 false
check_key 1200000000000000000000000000000000000000000000000000000000000000 true
check_key 1200000000000000000000000000000000000000000000000000000000000080 true
check_key 1300000000000000000000000000000000000000000000000000000000000000 true
check_key 1300000000000000000000000000000000000000000000000000000000000080 true
check_key daffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key daffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key dbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key dbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key dcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key dcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key ddffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key ddffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key deffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key deffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key dfffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key dfffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key e0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key e0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key e1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key e1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key e2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key e2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key e3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key e3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key e4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key e4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key e5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key e5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key e6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key e6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key e7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key e7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key e8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key e8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key e9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key e9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key eaffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key eaffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
check_key ebffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key ebffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key ecffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
check_key ecffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key edffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key edffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key eeffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key eeffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key efffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key efffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key f9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key f9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key faffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key faffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key fbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key fbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key fcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key fcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key fdffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key fdffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key feffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key feffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
check_key ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
check_key ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
hash_to_ec da66e9ba613919dec28ef367a125bb310d6d83fb9052e71034164b6dc4f392d0 52b3f38753b4e13b74624862e253072cf12f745d43fcfafbe8c217701a6e5875
hash_to_ec a7fbdeeccb597c2d5fdaf2ea2e10cbfcd26b5740903e7f6d46bcbf9a90384fc6 f055ba2d0d9828ce2e203d9896bfda494d7830e7e3a27fa27d5eaa825a79a19c
hash_to_ec ed6e6579368caba2cc4851672972e949c0ee586fee4d6d6a9476d4a908f64070 da3ceda9a2ef6316bf9272566e6dffd785ac71f57855c0202f422bbb86af4ec0
hash_to_ec 9ae78e5620f1c4e6b29d03da006869465b3b16dae87ab0a51f4e1b74bc8aa48b 72d8720da66f797f55fbb7fa538af0b4a4f5930c8289c991472c37dc5ec16853
hash_to_ec ab49eb4834d24db7f479753217b763f70604ecb79ed37e6c788528720f424e5b 45914ba926a1a22c8146459c7f050a51ef5f560f5b74bae436b93a379866e6b8
hash_to_ec 5b79158ef2341180b8327b976efddbf364620b7e88d2e0707fa56f3b902c34b3 eac991dcbba39cb3bd166906ab48e2c3c3f4cd289a05e1c188486d348ede7c2e
hash_to_ec f21daa7896c81d3a7a2e9df721035d3c3902fe546c9d739d0c334ed894fb1d21 a6bedc5ffcc867d0c13a88a03360c8c83a9e4ddf339851bd3768c53a124378ec
hash_to_ec 3dae79aaca1abe6aecea7b0d38646c6b013d40053c7cdde2bed094497d925d2b 1a442546a35860a4ab697a36b158ded8e001bbfe20aef1c63e2840e87485c613
hash_to_ec 3d219463a55c24ac6f55706a6e46ade3fcd1edc87bade7b967129372036aca63 b252922ab64e32968735b8ade861445aa8dc02b763bd249bff121d10829f7c52
hash_to_ec bc5db69aced2b3197398eaf7cf60fd782379874b5ca27cb21bd23692c3c885cc ae072a43f78a0f29dc9822ae5e70865bbd151236a6d7fe4ae3e8f8961e19b0e5
hash_to_ec 98a6ed760b225976f8ada0579540e35da643089656695b5d0b8c7265a37e2342 6a99dbfa8ead6228910498cc3ff3fb18cb8627c5735e4b8657da846c16d2dcad
hash_to_ec e9cdc9fd9425a4a2389a5d60f76a2d839f0afbf66330f079a88fe23d73eae930 8aa518d091928668f3ca40e71e14b2698f6cae097b8120d7f6ae9afba8fd3d60
hash_to_ec a50c026c0af2f9f9884c2e9b8464724ac83bef546fec2c86b7de0880980d24fb b07433f8df39da2453a1e13fd413123a158feae602d822b724d42ef6c8e443bf
hash_to_ec bf180e20d160fa23ccfa6993febe22b920160efc5a9614245f1a3a360076e87a 9d6454ff69779ce978ea5fb3be88576dc8feaedf151e93b70065f92505f2e800
hash_to_ec b2b64dfeb1d58c6afbf5a56d8c0c42012175ebb4b7df30f26a67b66be8c34614 0523b22e7f220c939b604a15780abc5816709b91b81d9ee1541d44bd2586bbd8
hash_to_ec 463fc877f4279740020d10652c950f088ebdebeae34aa7a366c92c9c8773f63a daa5fa72e70c4d3af407b8f2f3364708029b2d4863bbdde54bd67bd08db0fcad
hash_to_ec 721842f3809982e7b96a806ae1f162d98ae6911d476307ad1e4f24522fd26f55 4397c300a8cfcb42e7cc310bc975dc975ec2d191eaa7e0462998eb2830c34126
hash_to_ec 384da8d9b83972af8cbefc2da5efc744037c8ef40efa4b3bacc3238a6232963d 3c80f107e6868f73ef600ab9229a3f4bbe24f4adce52e6ab3a66d5d510e0670d
hash_to_ec e26f8adef5b6fe5bb01466bff0455ca23fda07e200133697b3b6430ca3332bde e262a58bcc1f8baf1980e00d5d40ba00803690174d14fb4c0f608429ce3df773
hash_to_ec 6e275b4ea4f085a5d3151aa08cf16a8c60b078e70be7ce5dac75b5d7b0eebe7c cb21b5a7744b4fcdc92ead4be0b04bcb9145e7bb4b06eff3bb2f0fe429b85108
hash_to_ec a0dde4561ad9daa796d9cd8a3c34fd41687cee76d128bf2e2252466e3ef3b068 79a2eb06bb7647f5d0aae5da7cf2e2b2d2ce890f25f2b1f81bfc5fef8c87a7d3
hash_to_ec dbaf63830e037b4c329969d1d85e58cb6c4f56014fd08eb38219bd20031ae27c 079c93ae27cd98075a487fd3f7457ad2fb57cdf12ec8651fedd944d765d07549
hash_to_ec 1e87ba8a9acf96948bc199ae55c83ab3277be152c6d0b1d68a07955768d81171 5c6339f834116791f9ea22fcc3970346aaeddacf13fbd0a7d4005fbd469492ca
hash_to_ec 5a544088e63ddf5b9f444ed75a75bc9315c4c50439522f06b4823ecaf5e8a08d e95ca0730d57c6469be3a0f3c94382f8490257e2e546de86c650bdbc6482eaee
hash_to_ec e4e06d92ebb036a5e4bb547dbaa43fd70db3929eef2702649455c86d7e59aa46 e26210ff8ee28e24ef2613df40aa8a874b5e3c1d07ae14acc59220615aa334dc
hash_to_ec 5793b8b32dcc0f204501647f2976493c4f8f1fa5132315226f99f29a5a6fdfce 656e390086906d99852c9696e831f62cb56fc8f85f9a5c936c327f23c7faf4fe
hash_to_ec 84f56fa4d7f12e0efd48b1f7c81c15d6e3843ebb419f4a27ec97028d4f9da19e 0cbd4f0cd288e1e071cce800877de6aef97b63fff867424a4f2b2bab25602608
hash_to_ec 242683ddf0a9fc55f6585de3aa64ea17c9c544896ff7677cd82c98f833bdf2ca 38c36d52314549213df7c7201ab7749a4724cbea92812f583bb48cabc20816ad
hash_to_ec a93ee320dc030aa382168c2eb6d75fce6e5a63a81f15632d514c6de8a7cfa5ee bd0a2facaa95bc95215a94be21996e46f789ee8beb38e75a1173b75fc686c505
hash_to_ec e36136601d84475d25c3f14efe030363d646658937a8a8a19a812d5e6deb5944 2fb93d78fae299c9f6b22346acfb829796ee7a47ec71db5456d8201bec6c35a3
hash_to_ec ba4b67d3d387c66baa4a32ec8b1db7681087e85076e71bab10036388c3aeb011 cc01329ce56f963bf444a124751c45b2c779ccb6dea16ca05251baca246b5401
hash_to_ec 3fbc91896a2585154d6f7094c5ab9c487e29a27951c226eec1235f618e44946b 7d983acbb901bf5497d0708392e5e742ec8c8036cbb0d03403e9929da8cc85a7
hash_to_ec a2da289fed650e9901f69a5f33535eb47c6bd07798633cbf6c00ce3172df76ac dca8a4d30ec2d657fefd0dba9c1c5fd45a79f665048b3cf72ac2c3b7363da1ac
hash_to_ec 99025d2d493f768e273ed66cacd3a5b392761e6bd158ca09c8fba84631ea1534 7ef5af79ab155ab7e1770a47fcd7f194aca43d79ec6e303c7ce18c6a20279b04
hash_to_ec 3cf1d01d0b70fb31f2a2f979c1bae812381430f474247d0b018167f2a2cd9a9f 7c53d799ec938a21bb305a6b5ca0a7a355fa9a68b01d289c4f22b36ce3738f95
hash_to_ec 639c421b49636b2a1f8416c5d6e64425fe51e3b52584c265502379189895668e 0b47216ae5e6e03667143a6cf8894d9d73e3152c64fb455631d81a424410e871
hash_to_ec 4ccf2c973348b7cc4b14f846f9bfcdcb959b7429accf6dede96248946841d990 7fd41f5b97ba42ed03947dd953f8e69770c92cc34b16236edad7ab3c78cbbb2e
hash_to_ec f76ae09fff537f8919fd1a43ff9b8922b6a77e9e30791c82cf2c4b8acb51363e 8e2c6bf86461ad2c230c496ee3896da33c11cc020fd4c70faa3645b329049234
hash_to_ec 98932da7450f15db6c1eef78359904915c31c2aa7572366ec8855180edb81e3a 86180adddfac0b4d1fb41d58e98445dde1da605b380d392e9386bd445f1d821c
hash_to_ec ab26a1660988ec7aba91fc01f7aa9a157bbc12927f5b197062b922a5c0c7f8dd 2c44a43eda0d0aad055f18333e761f2f2ec11c585ec7339081c19266af918e4f
hash_to_ec 4465d0c1b4930cc718252efd87d11d04162d2a321b9b850c4a19a6acdfca24f4 b03806287d804188a4d679a0ecee66f399d7bdc3bd1494f9b2b0772bbb5a034f
hash_to_ec 0f2a7867864ed00e5c40082df0a0b031c89fa5f978d9beb2fde75153f51cfb75 5c471e1b118ef9d76c93aec70e0578f46e8db1d55affd447c1f64c0ad9a5caa5
hash_to_ec 5c2808c07d8175f332cae050ce13bec4254870d76abff68faf34b0b8d3ad5000 eeff1d9a5aa428b7aecc575e63dde17294072eb246568493e1ed88ce5c95b779
hash_to_ec 36300a21601fad00d00da45e27b36c11923b857f97e50303bd01f21998eaef95 b33b077871e6f5dad8ff6bc621c1b6dedcf700777d996c8c02d73f7297108b7e
hash_to_ec 9e1afb76d6c480816d2cedd7f2ab08a36c309efaa3764dcdb51bad6049683805 4cd96ba7b543b1a224b8670bf20b3733e3910711d32456d3e58e920215788adf
hash_to_ec 685f152704664495459b76c81567a4b571e8b307dd0e3c9b08ee95651a006047 80dd6b637580cb3be76025867f1525852b65a7a66066993fda3af7eb187dc1a5
hash_to_ec 0b216444391a1163c14f7b27f9135e9747978c0e426dce1fa65c657f3e9146be 021259695a6854a4a03e8c74d09ab9630a401bfca06172a733fe122f01af90b4
hash_to_ec cfcb35e98f71226c3558eaa9cf620db5ae207ece081ab13ddea4b1f122850a5a 46763d2742e2cdffe80bb3d056f4d3a1565aa83f19aab0a1f89e54ad81ae0814
hash_to_ec 07e7292da8cdcdb58ee30c3fa16f1d609e9b3b1110dd6fa9b2cc18f4103a1c12 fe949ca251ac66f13a8925ae624a09cdbf6696d3c110442338d37700536e8ec7
hash_to_ec 813bc7e3749e658190cf2a4e358bc07a6671f262e2c4eef9f44c66066a72e6a7 6b92fbda984bd0e6f4af7a5e04c2b66b6f0f9d197a9694362a8556e5b7439f8a
hash_to_ec 89c50a1e5497156e0fae20d99f5e33e330362b962c9ca00eaf084fe91aaec71d ef36cb75eb95fb761a8fa8c376e9c4447bcd61421250f7a711bd289e6ed78a9b
hash_to_ec d9bd9ff2dd807eb25de7c5de865dbc43cce2466389cedbc92b90aab0eb014f81 30104771ff961cd1861cd053689feab888c57b8a4a2e3989646ea7dea40f3c04
hash_to_ec b8c837501b6ca3e118db9848717c847c062bf0ebeca5a7c211726c1426878af5 19a1e204b4a32ce9cccf5d96a541eb76a78789dceaf4fe69964e58ff96c29b63
hash_to_ec 84376c5350a42c07ac9f96e8d5c35a8c7f62c639a1834b09e4331b5962ecace8 ba1e4437d5048bd1294eadc502092eafc470b99fde82649e84a52225e68e88f2
hash_to_ec a3345e4a4cfc369bf0e7d11f49aed0d2a6ded00e3ff8c7605db9a919cf730640 0d318705c16e943c0fdcde134aaf6e4ccce9f3d9161d001861656fc7ea77a0b1
hash_to_ec 3c994dfb9c71e4f401e65fd552dc9f49885f88b8b3588e24e1d2e9b8870ffab1 984157de5d7c2c4b43b2bffea171809165d7bb442baea88e83b27f839ebdb939
hash_to_ec 153674c1c1b18a646f564af77c5bd7de452dc3f3e1e2326bfe9c57745b69ec5c e9a4a1e225ae472d1b3168c99f8ba1943ad2ed84ef29598f3f96314f22db9ef2
hash_to_ec 2d46a705d4fe5d8b5a1f4e9ef46d9e06467450eb357b6d39faa000995314e871 b9d1aec540bf6a9c0e1b325ab87d4fbe66b1df48986dde3cb62e66e136eba107
hash_to_ec 6764c3767f16ec8faecc62f9f76735f76b11d7556aeb61066aeaeaad4fc9042f 3a5c68fb94b023488fb5940e07d1005e7c18328e7a84f673ccd536c07560a57b
hash_to_ec c99c6ee5804d4b13a445bc03eaa07a6ef5bcb2fff0f71678dd3bd66b822f8be8 a9e1ce91deed4136e6e53e143d1c0af106abde9d77c066c78ebbf5d227f9dde0
hash_to_ec 3009182e1efac085c7eba24a7d9ef28ace98ebafa72211e73a41c935c37e6768 e55431a4c89d38bd95f8092cdf6e44d164ad5855677aba17ec262abc8c217c86
hash_to_ec e7153acd114a7636a207be0b67fa86fee56dd318f2808a81e35dd13d4251b2d0 ff2b98d257e4d4ff7379e8871441ca7d26e73f78f3f5afcf421d78c9799ba677
hash_to_ec 6378586744b721c5003976e3e18351c49cd28154c821bc45338892e5efedd197 3d765fb7bb4e165a3fa6ea00b5b5e22250f3861f0db0099626d9a9020443dda2
hash_to_ec 5be49aba389b7e3ad6def3ba3c7dbec0a11a3c36fc9d441130ef370b8a8d29c2 2d61faf38062dc98ae1aaafec05e90a925c9769df5b8b8f7090d9e91b2a11151
hash_to_ec f7bc382178d38e1b9a1a995bd8347c1283d8a2e8d150379faa53fd125e903d2b 544c815da65c3c5994b0ac7d6455578d03a2bc7cf558b788bcdb3430e231635a
hash_to_ec c28b5c4b6662eebb3ec358600644849ebeb59d827ed589c161d900ca18715fa8 a2d64db3c0e0353c257aadf9abc12ac779654d364f348b9f8e429aa7571203db
hash_to_ec 3a4792e5df9b2416a785739b9cf4e0d68aef600fa756a399cc949dd1fff5033a 4b54591bd79c30640b700dfb7f20158f692f467b6af70bd8a4e739c14a66c86a
hash_to_ec 002e70f25e1ceaf35cc14b2c6975a4c777b284a695550541e6f5424b962c19f5 73987e9342e338eb57a7a9e03bd33144db37c1091e952a10bd243c5bb295c18a
hash_to_ec 7eb671319f212c9cae0975571b6af109124724ba182937a9066546c92bdeff0c 49b46da3be0df1d141d2a323d5af82202afa2947a95b9f3df47722337f0d5798
hash_to_ec ca093712559c8edd5c51689e2ddcb8641c2960e5d9c8b03a44926bb798a0c8dc b9ef9cf0f8e4a3d123db565afafb1102338bfb75498444ac0a25c5ed70d615da
hash_to_ec cfea0a08a72777ff3aa7be0d8934587fa4127cd49a1a938232815dc3fd8b23ac b4de604b3d712f1ef578195fb0e53c865d41e2dfe425202c6cfe6f10e4404eb5
hash_to_ec aa0122ae258d6db21a26a31c0c92d8a0e3fdb46594aed41d561e069687dedcd6 5247eaec346de1c6cddf0ab04c12cd1d85cdb6d3a2fba2a5f9a5fe461abef5eb
hash_to_ec b3941734f4d3ba34ccaf03c4c737ac5a1e036eb74309300ce44d73aca24fef08 535938985c936e3780c61fe29a4121d6cb89a05080b6c2147031ea0c2b5b9829
hash_to_ec 8c2ee1041a2743b30dcbf413cc9232099b9268f82a5a21a09b63e7aff750882f 6ad0d4b3a65b522dfad0e9ac814b1fb939bc4910bd780943c72f57f362754cca
hash_to_ec 4b6829a2a2d46c8f0d0c23db0f735fcf976524bf39ccb623b919dd3b28ad5193 2e0097d7f92993bc45ba06baf4ca63d64899d86760adc4eb5eeefb4a78561050
hash_to_ec 9c1407cb6bba11e7b4c1d274d772f074f410d6fe9a1ee7a22cddf379257877d9 692261c7d6a9a7031c67d033f6d82a68ef3c27bd51a5666e55972238769821cd
hash_to_ec 638c42e4997abf8a4a9bffd040e31bd695d590cde8afbd7efd16ffdbae63bf66 793024c8ce196a2419f761dde8734734af6bd9eb772b30cc78f2cb89598dce97
hash_to_ec 1fb60d79600de151a1cf8a2334deb5828632cbd91cb5b3d45ae06e08187ae23d ff2542cde5bc2562e69471a31cfc3d0c26e2f6ccc1891a633b07a3968e42521c
hash_to_ec d2fdbbae4e38a1b734151c3df52540feb2d3ff74edfef2f740e49a5c363406ee 344c83ba6ff4e38b257077623d298d2f2b52002645021241bc9389f81b29ad12
hash_to_ec 836c27a6ddfe1a24aba3d6022dff6dfe970f142d8b4ac6afb8efcba5a051942f b8af481d33726b3f875268282d621e4c63f891a09f920b8f2f49080f3a507387
hash_to_ec 46281153ddcdf2e79d459693b6fe318c1969538dd59a750b790bfff6e9481abf 8eaf534919ab6573ba4e0fbde0e370ae01eae0763335177aa429f61c4295e9d4
hash_to_ec d57b789e050bf3db462b79a997dac76aa048d4be05f133c66edee56afd3dbe66 0c5a294cb2cbb6d9d1c0a1d57d938278f674867f612ed89dcbe4533449f1a131
hash_to_ec 548d524d03ac22da18ff4201ce8dbee83ad9af54ee4e26791d26ed2ab8f9bfc7 c6609d9e7d9fd982dec8a166ff4fb6f7d195b413aad2df85f73d555349134f3b
hash_to_ec cc920690422e307357f573b87a6e0e65f432c6ec12a604eb718b66ba18897a56 6f11c466d1c72fccd81e51d9bda03b6e8d6a395e1d931b2a84e392dc9a3efa18
hash_to_ec c7fb8a51f5fcd8824fc0875d4eb57ab4917cb97090a6e2288f852f2bb449edd9 45543fea6eed461016e48598b521f18ff70178afea18032b188deea3e56052fc
hash_to_ec c681bb1b829e24b1c52cb890036b89f0029d261c6a15e5b2c684ee7dfe91e746 263006fe2c6b08f1ab29cdf442472c298e2faf225bbf5c32399d3745cd3904bd
hash_to_ec e06411c542312fdd305e17e46be14c63bab5836dc8751da06164b1ae22d4e20f 901871be7a7ff5aecade2acff869846f3c50de69307ac155f2aa3a74d5472ef2
hash_to_ec 9c725a2acb80fa712f9781da510e5163b1b30f4e1c064c26b5185e537f0614ea 02420d49257846eb39fddd196d3171679f6be21d9adac667786b65a6e90f57b1
hash_to_ec 22792772820feafa85c5cb3fa8f876105251bef08617d389619697f47dff54f2 a3ad444e7811693687f3925e7c315ae55d08d9f4b0a29876bc2a891ab941c1c3
hash_to_ec 0587b790121395d0f4f39093d10b4817f58a1e80621a24eea22b3c127d6ac5a2 86c417c695c64c7becaad0d59ddbb2bca4cb2b409a21253d680aac1a08617095
hash_to_ec fa0b5f28399bef0cd87bfe6b8a2b69e9c5506fb4bacd22deba8049615a5db526 ede0ea240036ff75d075258a053f3ce5d6f77925d358dbe33c06509fc9b12111
hash_to_ec 62a3274fc0bed109d5057b865c2ba6b6a5a417cb90a3425674102fcd457ede2d ff7e46751bb4dcd1e800a8feab7cf6771f42dc0cfed7084c23b8a5d255a6f34e
hash_to_ec a6fcd4aecaaaf281563b9b7cd6fbc7b1829654f644f4165942669a2ef632b2bf 28f136be0eb957a5b36f8ec294399c9f73ad3a3c9bb953ad191758ced554a233
hash_to_ec 01baa4c06d6676c9b286cda76ed949fd80a408b3309500ba84a5bb7e3dce58e2 a943d1afa2efce284740e7db21ea02db70b124808be2ff80cbf9b9cb96c7b73e
hash_to_ec dd9aff9c006ba514cef8fae665657bc9813fe2715467cf479643ea4c4e365d6d 68de2f7d49de4004286ce0989a06a686b15d0f463a02ffd448a18914e1ddf713
hash_to_ec 3df3513d5e539161761ce7992ab9935f649bc934bed0da3c5e1095344b733bb9 e9c2dd747d7b2482474325943cd850102b8093164678362c7621993a790e2a8a
hash_to_ec 7680cfb244dc8ef37c671fff176be1a3dad00e5d283f93145d0cbee74cca2df4 a0fd8c3cca16a130eaa5864cbe8152b7adfbf09e8cf72244b2fc8364c3b20bf4
hash_to_ec 8a547c38bd6b219ea0d612d4a155eba9c56034a1405dcf4b608de787f37e0fd8 76bf0dc40fd0a5508c5e091d8bb7eccfa28b331e72c6a0d4ac0e05a3d651850b
hash_to_ec dd93901621f58465e9791012afa76908f1e80ad80e52b809dc7fc32bb004f0a8 09a0b7ecfe8058b1e9ee01c9b523826867ca97a32efad29ac8ceebca67a4ea00
hash_to_ec b643010220f1f4ee6c7565f6e1b3dc84c18274ede363ac36b6af3707e69a1542 233c9ff8de59e5f96c2f91892a71d9d93fa7316319f30d1615f10ac1e01f9285
hash_to_ec c2637b2299dfc1fd7e953e39a582bafd19e6e7fff3642978eb092b900dbfea80 339587ba1c05e2cba44196a4be1fd218b772199e2c61c3c0ff21dcd54b570c43
hash_to_ec 1f36d3a7e7c468eb000937de138809e381ad2e23414cbbaac49b7f33533ed486 7e5b0a96051c77237a027a79764c2763487af88121c7774645e97827fb744888
hash_to_ec 8c142a55f60b2edbe03335b7f90aa2bd63e567048a65d61c70cb28779c5200af d3d6d5563b3d81c8c91cf9806bb13b2850fb7c162c610fd2f5b83c464add8182
hash_to_ec 99e7b98293c9de1f81aff1376485a990014b8b176521b2a68cdbde6300190398 119cbc01a1d9b9fb4759031d3a70685aebea0f01bc5ee082ce824265fd21b3b4
hash_to_ec 9753bd38be072b51490290be6207ca4545e3541bdf194e0850ae0a9f9e64b8ba 1ad3aa759863153606fa6570f0e1290baded4c8c1f2ba0f67c1911bfc8ccd7a0
hash_to_ec 322703864ceee19b7f17cec2a822f310f0c4da3ff98b0be61a6fd30ac4db649c 89d9e7a5947e1cde874e4030de278070aae363063cd3592ce5411821474f0816
hash_to_ec c1acd01e1e535fad273a8b757d981470f43dd7d95af732901fbba16b6e245761 57e80445248111150da5e63c706b4abbf3eef2cc508bd0347ff6b81e8c59f5bc
hash_to_ec 492473559f181bbe78f60215bc6d3a5168435ea2fc0a508372d6f5ca126e9767 df3965f137cf6f60c56ebd7c8f246281fd6dc92ce23a37e9f846f8452c884e01
hash_to_ec afa9d6e0e2fb972ee806beb450c2c0165e58234b0676a4ec0ca19b6e710d7c35 669a57e69dd2845a5e50ed8e5d8423ac9ae792a43c7738554d6c5e765a7b088a
hash_to_ec 094de050bdadef3b7dbaeeca29381c667e63e71220970149d97b95db8f4db61b 0cf5d03530c5e97850d0964c6a394de9cde1e8e498f8c0e173c518242c07f99a
hash_to_ec 2ce583724bc699ad800b33176a1d983512fe3cb3afa65d99224b23dae223efb7 e1548fd563c75ae5b5366dbab4cb73c54e7d5e087c9e5453125ff8fbe6c83a5c
hash_to_ec 8064974b976ff5ef6adaade6196ab69cda6970cd74f7f5899181805f691ad970 98ae63c47331a4ac433cb2f17230c525982d89d21e2838515a36ec5744ec2d15
hash_to_ec 384911047de609c6ae8438c745897357989363885cef2381a8a00a090cf04a58 4692ec3a0a03263620841c108538d584322fdd24d221a74bf1e1f407f83828af
hash_to_ec 0e1b1ced5ae997ef9c10b72cfc6d8c36d7433c01fc04f4083447f87243282528 6ee443ab0637702b7340bd4a908b9e2e63df0cc423c409fb320eb3f383118b80
hash_to_ec 5a7aea70c85c040af6ff3384bcaa63ec45c015b55b44fffa37ab982a00dc57c5 2df2e20137cefd166c767646ecd2e386d28f405aebe43d739aa55beba04ed407
hash_to_ec 3e878a3567487f20f7c98ea0488a40b87f1ba99e50bbfe9f00a423f927cbd898 697c7e60e4bf8c429ba7ac22b11a4b248d7465fc6abe597ec6d1e1c973330688
hash_to_ec c0bb08350d8a4bb6bf8745f6440e9bd254653102a81c79d6528da2810da758e4 396a872ac9147a69b27223bf4ec4198345b26576b3690f233b832395f2598235
hash_to_ec 6c3026a9284053a4ddb754818f9ae306ffa96eb7003bd03826eeccc9a0cf656e bef73da51d3ba9972a33d1afb7d263094b66ab6dbe3988161b08c17f8c69c2d5
hash_to_ec f80b7d8f5a80d321af3a42130db199d9edcb8f5a82507d8bfca6d002d65458b6 aa59c167ea60ee024421bfbd00adbb3cbfc20e16bd3c9b172a6bef4d47ca7f57
hash_to_ec bc0ffc24615aa02fafef447f17e7b776489cd2cc909f71e8344e01cad9f1610d 5c4195cc8dc3518143f06a9c228ae59ec9a6425a8fab89bfc638ad997cf35220
hash_to_ec b15fad558737229f8816fcba8fbef805bd420c03e392d118c69bdf01890c4924 f5810477e37554728837f097e1b170d1d8c95351c7fff8abbbfc624e1a50c1b9
hash_to_ec ec8c1f10d8e9da9cf0d57c4a1f2c402771bed7970109f3cf21ad32111f1f198f a697e0a3f09827b0cf3a4ffb6386388feda80d30ffffcbd54443dafcba162b28
hash_to_ec a989647bf0d70fdb7533b8c303a2a07f5e42e26a45ffc4e48cff5ba88643a201 450fd73e636f94d0d232600dd39031386b0e2ecde4105124fc451341da9803db
hash_to_ec 7159971b03c365480d91d625a0fadc8e3a632c518acf0dbec87dd659da70e168 377bc43c038ac46cf6565aa0a6d6bf39968c0c1142755dba3141eeebf0acdf5d
hash_to_ec e39089a64fedac4b2c25e36312b33f79d02bf75a883f450f910915b8560a3b06 77efa7db1be020e77596f550de45626824a8268095d56a0991696b211cb329cc
hash_to_ec 2056b3c6347611bb0929dad00ec932a4d9bec0f06b2d57f17e01ffa1528a719e b6072c2be2ce928e8cbbb87e8eb7e06975c0f93b309dd3b6a29edaad2b56f99b
hash_to_ec 2c026793146e81b889fc741d62e06c341ce263560d57cd46d0376f5b29174489 8f1f64b67762aa784969e954c196a2c6610addc3604aa3291eb0b80304dfe9ef
hash_to_ec be6026d6704379c489fa7749832b58bdb1a9685a5ffb68c438537f2f76e0011f 0072569a4090a9ad383a205bb092196c9de871c22506e3bb63d6b9d1b2357c96
hash_to_ec f4db802d5c6b7d7b53663b03d988b4cd0c7cad6c26612c5307754a93ebdc9710 f21bc9be4cb28761f6fe1d0a555ad5e9748375a2e9faea25a1df75cc8d273e18
hash_to_ec c27d79a564c56b00956a55090481e85fbc837fd5fb5e8311ecb436e300c07e3a 1b1891e6abec74621501450cd68bb1eeaa5b2fffff4ec441a55d1235ff3a0842
hash_to_ec a1e2f93c717cad32af386efa624198973df5a710963dd19d4c3ac40032a3a286 69c60571e3f9f63d2bfb359386ae3b8cd9e49a2e9127753002866e85c0443573
hash_to_ec 76920d7b1763474bc94a16433c3c28241a9acdee3ff2b2cb0e6757ba415310aa c1b409169f102b696fc7fa1aa9c48631e58e08b5132b6aadf43407627bb1b499
hash_to_ec 57ac654b29fa227c181fff2121491fcb283af6cbe932c8199c946862c0e90cb2 a204e8d327ea93b0b1bd74a78ffc370b20cea6455e209f2bc258114baa16d728
hash_to_ec 88e66cfaef6432b759c50efce885097d1752252b479dac5ed822fa6c85d56427 6fb84790d3749a5c1088209ee3823848d9c19bf1524215c44031143dd8080d70
hash_to_ec c1e55da929c4f8f793696fc77ff4e1c317c34852d98403bfd15dd388ee7df0df 2f41e76f15c5b480665bd84067e3b543b85ce6de02be9da7a550b5e1ead94d34
hash_to_ec 29e9ace5aa3c5a572b13f4b62b738a764d90c8c293ccb062ad798acbab7c5ef4 bce791aba1edc2a66079628fd838799489ab16b0a475ce7fe62e24cc56fe131c
hash_to_ec f25b2340689dadacaa9a0ef08aee8447d80b982e8a1ea42cf0500a1b9d85b37d f7f53aa117e6772a9abc452b3931b0a99405ac45147e7c550ac9fcf7ffe377b5
hash_to_ec 0cb6c47fc8478063b33f5aed615a05bcc84d782c497b6cc8e76ec1fa11edbfdb 7a0b58b03147e7c9be1d98de49ead2ce738d0071b0af8ca03cc92ceb26fc2246
hash_to_ec 7bd7287d7c4b596fe46fe57a6982c959653487bea843a77dd47d40986200d576 343084618c58284c64a5ff076f891be64885dc2ac73fa1567f7b39fde6b91542
hash_to_ec e4984bf330708152254fb18ecef12d546afd24898a3cf00fba866957b6ee1b82 c70e88b061656181fbd6ff12aca578fb66de5553c756ea4698a248b177185bc6
hash_to_ec cefd6c3cb9754ea632d6aea140af017de5ea12e5184f868936b74d9aa349d603 4b476502a8a483aadd50667f262f95351901628dd3a2aac1a5a41c4ea03f1647
hash_to_ec da5d0f33344ee7f3345204badf183491b9452b84bccc907602c7bad43e5cf43e 9561b9e61241625e028361494d4fa5cd78df4c7219fa64c8fede6d8421b8904a
hash_to_ec d6f0a4f8c770a1274a76fd7ae4e5faf7779249263e1aaecc6f815cf376f5c302 cd5c55820be10f0d38feb81363ede3716a9168601a0dd1ce3109aab81367d698
hash_to_ec b6bf32491d12a41c275d8518fc534d9a0d17aade509e7e8b8409a95c86167307 4aae534abbd67a9a8f2974154606c0e9be8932e920c7a5e931b46a92859acf82
hash_to_ec 0f930beaad041f9cefd867bc194027dd651fb3c9bda5944ececdba8a7136b6d3 521708f8149891b418d0920369569a9d578029c78f8e41c68a0bb68d3ad5df60
hash_to_ec 49b1fe0f97be74b81e0b047027b3e9f726fa5e90a67dafa877309397291c06c5 0852e59dfae5ec32cce606c119376597bce5cd4d04879d329f74e3ec66414cd3
hash_to_ec 4d57647d03f2cfbd4782fcc933e0683b52d35fc8d37283e6c7de522ddfa7e698 cbeb9ebfbbc49ec81fac3b7b063fecac1bb40ea686d3ffb08f82b291715cd87f
hash_to_ec 4ea3238c06fc9346c7421ff85bc0244b893860b94bc437378472814d09b2e99f a1fbae941adc344031bbdf53385dfdc012311490a4eb5e9a2749a21b27ce917a
hash_to_ec 0cd3609f5c78b318cb853d189b73b1ee2d00edd4e5fce2812027daa3fcb1fed1 0c7a7241b16e3c47d41f5abbf205797bd4b63fc425a7120cb2a4bf324e08ae74
hash_to_ec d74ab71428e36943c9868f70d3243469babd27988a1666a06f499a5741a52e3e 65b7c259f3b4547c082b2a7669b2b363668c4d87ac14e80471317b03b34e5216
hash_to_ec f6b151998365e7d69bcbce383dd2e8b5bf93b8b72f029ff942588208c1619591 6ce840ce5dfbca238665c1e6eddb8b045aa85c69b5976fc55ab57e66d3d0a791
hash_to_ec 207751de234b2bd7ec20bdd8326210c23aa68f04875c94ad7e256a96520f25d6 fc8f79ab3af317c38bfb88f40fb84422995a0479cfa6b03fa6df7f4e5f2813fb
hash_to_ec 62291e2873f38c0a234b77d1964205f3f91905c261d3c06f81051a9b0cb787cb 076d1d767457518e6777cb3bd4df22c8a19eb617e4bbccd1b0bd37522d6597a5
hash_to_ec 4b060df2d2854036751d00190ee821cb0066d256d4172539fdfa6fbd1cdfe1f9 59866e927c69e7de5df00dc46c0d2a1ddf799d901128ff040cebb8fd61b95da4
hash_to_ec ac8daf73f9c609bb36bce4fdeec1e50be5f22de38c3904fabcf758f0fc180bc7 7d8dc4e956363b652468a5fecafd7c08d48a2297e93b8edcb38e595fdd5a1fde
hash_to_ec fef7b6563fd27f3aab1d659806b26b8f2ec38bc8feefad50288383c001d1c20f e6e42547f12df431439d45103d2c5a583248f44554a98a3a433cf8c38b11805d
hash_to_ec 40a3d6871c76ecc6bb7b28324478733e196cc11d062dd4c9265cf31be5cf5a97 8c55a3811c241a020b1be202a58d5defbc4c8945d73b132570b47dd7c019ccf0
hash_to_ec 0cd71e7e562b2b47f4bc8640caf20e69d3a62f10231b4c7a372c9691cff9ac3c fb8e4e3de479b3bf1f4f13b4ed5507df1e80bd9250567b9d021b03339d6e7197
hash_to_ec 40a4e62800a99b7a26e0b507ffb29592e5bdba25284dc473048f24b27d25b40a 90ae131d29ee4a71cd764ab26f1ca4e6d09a40db98f8692b345c3a0e130dc860
hash_to_ec 1ddf35193cf52860bfe3e41060a7f44281241c6ae49cd541d24c1aca679b7501 3b4f50013895c522776ced456329c4e727de03575f6b99ae7d238a9f70862121
hash_to_ec 014e0fa8ce9d5df262b9a1765725fde354a855de8aef3fc23684e05dd1ba8d34 3857f57776a3cb68721bcb7f1533a5f9fb416a1dc8824d719399b63a142d24de
hash_to_ec 09987979b0e98d1d5355df8a8698b8f54d3a037d12745c0a4317fe519c3df9cc 32a181e2b754aeced214c73ac459c97d99e63317be3eb923344c64a396173bca
hash_to_ec 51e9e8ec4413e92dbaaba067824c32b018487a8d16412ed310507b4741e18eed 0356b209156b4993fd5d5630308298429a1b0021c19bedecb7719ac607cfa644
hash_to_ec 14d91313dfe46e353310e6a4a23ee15d7a4e1f431700a444be8520e6043d08d9 6f345f4018b5d178d9f61894d9f46ac09ff639483727b0d113943507cee88cfd
hash_to_ec 0d5af9ace87382acfffb9ab1a34b6e921881aa015d4f6d9c73171b2b0a97600d a8dbf36c85bebe6a7b3733e70cd3cd9ed0eb282ca470f344e5fcf9fe959f2e6e
hash_to_ec 996690caac7328b19d20ed28eb0003d675b1a9ff79055ab530e3bf170eb22a94 14340d7d935cffce74b8b2f325c9d92ce0238b51807ef2c1512935bb843194ce
hash_to_ec ad839c4b4c278c8ebe16ff137a558255a1f74646aa87c6cd99e994c7bb97ce8a d4f2da327ffded913b50577be0e583db2b237b5ca74da648e9b985c247073b76
hash_to_ec 26fc2eeeee983e1300d72362fdff42edf08038e4eee277a6e2dbd1bd8c9d6560 3468b8269728c2c0bfc2e53b1575415124798bc0f59b60ea2f14967fc0ca19ce
hash_to_ec db33cecaf4ee6f0ceba338cc5fabfb7462cd952a9c9007357ff3f0ca8336f8bc 0bab38f58686d0ff770f770a297971510bc83e2ff2dfead34823d1c4d67f11af
hash_to_ec a0ee84b3c646526fb8787d26dcd9b7fe9dc713c8a6c1a4ea640465a9f36a64df 4d7a638f6759d3ec45339cd1300e1239cca5f0f658ca3cd29bc9bdb32f44faf0
hash_to_ec 6a702e7899fcf3988e2b6b55654c22e54f43d3fa29de19177bdff5b2295fe27f 145d5748d6054fb586568e276f6925aef593a5b9c8249ad3dbef510af99b4307
hash_to_ec 30ce0fd4f1fac8b62d613b8ee4a66deef6eb7094bd8466531050b837460f6971 f3aa850d593ba7cef01389f7e1916e57617f1d75cd42f64ce8f5f272384b148c
hash_to_ec 3aa31d4ad7046ad13d83eb11c9a6e90eb8483a374a77a9a7b2a7cc0978fefa76 2fe0827dc080d9c1e7ec475a78aa7ae3c86d1a35f4c3f25f4a1f7299cacf018a
hash_to_ec 8562a5a91e763b98014523ebb6e49120979098f89c31df1fde9eb3a49a15b20f ae223bf85e2009a9daf5fd8a14685e2e1e625fc88818b2fd437dd7e109a48f59
hash_to_ec ccf9c313a47b8dbf7ce42c94b785818bc24134d95b6d22acc53c1ec2be29cf27 3e79fce6fe5aa14251b6560df4b76e811d7739eec097f27052c4403a283be71d
hash_to_ec d1e33cd6f8918618d5fb6d67ad8de939db8beaec4f115551eac64479b739b773 613fffcbe1bf48bb2d7bfd64fd97790a06025f8f2429edddb9ac145707847ecf
hash_to_ec 81eaeced34dd44e448d5dafa5715225e4956c90911c964a96ff7aa5b86b969bc 8f81177495d120a1357380164d677509b167f2958eb8b962b616c3951d426d8c
hash_to_ec 2bc001a29f8eab1c7377de69957ba365fb5bdaf9c2c220889709af920dfe27d3 9bcb3010038f366fa4c280eed6e914a23bfc402594d0b83d0e66730a465a565b
hash_to_ec 6feeb703c05e86c58d9fc5623f1af8657ecd1e75a14d18c4eedb642a8a393d16 6544628ba67ed0e14854961739c4d467fcf49d6361e39d32ea73dabeae51e6c3
hash_to_ec e8ff145a7c26897f2c1639edd333a5412f87752f110079f581ccdc87fcce208c d4b5a6e06069c7e012e32119f8eda08ff04a8dfa784e1cf1bced455a4d41d905
hash_to_ec 80488131dcb2018527908dbf8cdf4b823ef0806dc1d360f4da671004ef7ff74d 9984a79d9fd4f317768b442161116eef84e2ca49e938642b268fd64312d59a27
hash_to_ec d8c4ca60446849a784d1462aa26a3b93073ff6841cb2da3ef52ab9785b00b1fd da5ec1562e7de2382d35728312f4eea3608d4dba775c1c108de510e1ce97d059
hash_to_ec 68645728dfc6b9358dfb426493238ba38f24a2f46a3e89edb47d212549939cb7 d3253aa7235113dcc1b577d3bb80be34f528398815a653dbdbacbcbdfd5887a1
hash_to_ec 4e8eb97ba2d1046e1b42e67530a61441e31c84e5e5e448d8e8dbe75d104eaccb de94f73e83222aa0e39b559d4fef70387b0815b9b2f6beff5da67262d8f0eb3e
hash_to_ec 104ff03122ffdf59b22b8c0fe3d8f2ef67d02328e4d5181916d3d2a92f9a0bb7 1517ccf69c0328327e1cf581f16944ff66bc91c37e1cd68a99525415e00b7c9f
hash_to_ec 80f23aae7356ae9a2f9f7504495a731214d26f870fb7df68fdc00b233494156f 7aef046b0a70f84e8d239aa95e192b5a3fffa0fae5090c91273e8996beca9e38
hash_to_ec 2424b33235955a737ebddbf1c6c59cd8778af74da3bd3e658447666a2ab2f557 d19e2be8d482950fbdae429618da7a9daedb8c5944dea19cd1b6b274e792231b
hash_to_ec 0adc839d2b8f099e4341a4763b074c06318d6bcbd1ec558d20a9820c4a426463 cea5da12a84e5c20011726d9224a9930bec30f9571762dd7ca857b86bd37d056
hash_to_ec 46c84d53951f1ba23c46a23d5d96bf019c559aa5d2d79e4535cfcdb36f38ce25 2a913a01a6f7dd78a43cdd5354d1160d9a5f0d824c489a892c80eba798a77567
hash_to_ec 99bdaaf68555ccdc93d97c3a0fb4c126a1aa8b1202194a1a753401a6cae21055 1f645efe173577a092f2d847cc966e28ba3b36397fe84c96dfa4724ed4fcfdf9
hash_to_ec c540ff78f1e063ad26ffa69febb8818c9f2a325072c566091ad816e40fe39af4 de7a762262c91ab4beccc0713233cb91163aec43e34de0dbcfad0c431e8a9722
hash_to_ec de8b1ff8978cd5e02681521542b7b6c3c2f8f4602065059f83594809d04e3dda 290601e75207085bff3e016746e55a80310a76dea9ef566c24181079c76da11c
hash_to_ec d555994c8a022e52602d2a8bdd01fc1bfa6b9ab6734ff72a1bd5f937de4627f8 5f6794e874f48c4b362d0a24207374c2d274e28de86351afc6ddb95d8cc2fd62
hash_to_ec 19db72f703fe6f1b73f21b6ba133ae6b111ae8cc496d3aa32e02411e34c0d8d7 42f159f43d2d62b8cf8a47d5f1340c5cf070e9860fc60de647c55d50fe9f5607
hash_to_ec 23a87a258c2a5d1353aa2d5946f9e5749b92f85e3c58e1d177c3b6c3dcac809c e5685016f79d5e87d1fecb3e2a0fe64e4875f7accd2f6649d7f6b16317549cb1
hash_to_ec 43e1738d7d1b5b565f5fc78e81480f7edf9a4dc18f104fc4be95135b98931b17 650f5b682e45f2d0c5d5e8bcfd9e0cda7d9071b55ecbfaf5e3b59941cd7479f2
hash_to_ec a9d644de0804edf62dee613efa2547e510990a9b7a987ebe55ec74c23873a878 52ad329f88499a4f110e6a6cba1f820012d8db6ccb8f6495ab1e3eb5a24786e1
hash_to_ec 11f2b5d89a0350d7c8727becf0f4dd19bd90f8c94ff207132ab13282dd9b94e6 b798a47bb98dc2a8f99deaf64d27638e33a0d504c5d2fbee477a2bc9b89e2838
hash_to_ec 5e206e3190b3b715d125f1a11fff424fb33e36e534c99ddde2a3517068b7dcc4 2738e9571c96b2ddf93cb5f4a72b1ea78d3731d9555b830494513c0683c950ca
hash_to_ec efc3d65a43d4f10795c7265a76671348f80173e0f507c812f7ae76793b99c529 cf4434d18ce8167b51f117fe930860143c46e1739a8db1fba73b6b0de830d707
hash_to_ec 81f00469788aad6631cf75b585ae06d43ec81c20479925a2009afac9687dff60 c335b5889b36ba4b4175bb0d986807e8eedb6f6b7329b70b922e2ab729c4202a
hash_to_ec 9ef5ff329b525ee8f5c3ac38e1dba7cb19985617341d356707c67ff273aed02d bef9f9e051ba0e24d1fdf72099cf43ecdd250d047fb329855b5372d5c422db9e
hash_to_ec 3fa1401bd63132cf8b385c0fa65f0715ba1fe6161e41d59f8033ae2b22f63fa1 8289a1cb3c2dae48879bb8913fafe2d196cc2fdab5f2a77607910efd33eae6df
hash_to_ec 6559836fd0081fa38a3f8d8408b564e5698b9797cf5e15f7f12a7d2c84511989 28d405a6687d2ecc90c1c66bf0454d58f3fa38835743075e1db58c658e15a104
hash_to_ec 8e0882d45f0e4c2fb2839d3be86ff699d4b2242f5b25ac5a3c2f65297c7d2032 2771fdcf9135a62007adb5f0004d8222f0e42f819c81710aa4dc3ab2042bebf3
hash_to_ec 1d91dc4dd9bd82646029d13aca1af96830c1d8a0400ddebeb14b00c93501c039 7792c62e897f32cbc9c4229f0d28f7882ceeae120329a1cd35f76a75ac704e93
hash_to_ec 09527f9052acbbdd7676cbbd9534780865f04a27aaadad2b7d4f1dac68883cf0 b934220cde1327f2dc6af67bcb4124bf424d5084ef4da945e4daad1717cd0bb8
hash_to_ec 2362e1abe73e64cdd2ca7f6c5ea9f467213747dd3f2b7c6e5df9cb21e03307d7 676b7122b96564358bbaaf77e3a5a4db1767e4f9a50f6ddd1c69df4566755af9
hash_to_ec 26c2dd2356e9b6c68a415b25f91d18614dc8500c66f346d28489da543ee75a94 0f4fd7086acd68eb7c9fa2410e2ecf18e34654eb44e979bc03ce436e992d5feb
hash_to_ec 422dc0a09d6a45a8e0b563eeb6a5ee84b08abd3a8cb34ff93f77ba3b163f4042 631f1b412ff5a0fccbe53a02b4a3deaa93a0418ed9874df401eb698ef75d7441
hash_to_ec ceecdf46f57ef3f36ff30a1a3579b609340282d1b26ab5ddef2f53514e91bab1 9bc6f981fe98d14a2fc5b01a8134b6d35e123ec9ab8a3f303e0a5abb28150e2e
hash_to_ec 024a9e6e0d73f28aa6207fb1e02ce86d444d2d46f8211e8aaab54f459db91a5a 5fb0c1d2c3b30f399102104ea1874099fa83110b3d9c1fcfffb2981c98bf8cdf
hash_to_ec 5b8e45e269c9ccac4c68e532a72b29346d218f4606f37a14064826a62050e3a8 c7be46a871b77fc05ce891d24bd6bd54d9775b7ef573c6bc2d92b67f3604c1d1
hash_to_ec 9a6593a385c266389eef14237874b97bdcd1823c3199311667d4853c2d12aa81 9f55ee9d94102d2b9c5670f30586cf9823bf205b4d4fe088c323e87c4e10f26f
hash_to_ec 27377e2811598c3569b92990865d39b72c7a5533e1be30f77330863187c11875 abd82bc726f2710a8b87e4c1cf5a069f0ae800de614468d3ff35639983020197
hash_to_ec 7cacfaa135fb7d568b8dce8ea9136498b1b28c6d1020af45d376288d78d411f0 229fccd49744c0692508af329224553d21561ee6062b2b8a21f080f73da5bd97
hash_to_ec 52abd90a5542d6496b8dec9567b020f30058e29458d64f2d4f3ad6f3bfc1a5a0 874e82ced7cf77577b3374087fb08a2300b7f403de628310c26bdb3be869d309
hash_to_ec 5c8eebe9d12309187afa8d0d5191de3fdb84e5a05485d7cd62e8804ce7fdc0bc 12b7537643488aa8b9dcc4bae040cd491f8b466163b7988157b0502fb6c9177f
hash_to_ec 6ca3dd5c7a21a6bf65d6eefbe20a66e9b1d6b64196344be0c075f47aea48e3aa 5e1d0705ee24675238293b73ab1d98359119d4b328275be2460cc6ee4d19cc88
hash_to_ec d7e6cd0d39b4308c2a5ee547c4569c8bb3887e49cedece62d218d7c3c5277797 793dc4397112dfd9a8f4e061f457eb6d6fbb1d7a58c40bad5f16002c64914186
hash_to_ec 9cb6de8ba967cca0f0f861c6e20546f8958446595c01c28dae7ba6cfa09d6b14 ba1a2f7502b58fee3499c20e35fa01bb932e7a7c4a925dc04fbf5d90f33cfb5e
hash_to_ec 8ef9c7366733a1edcd116238cdbd177d61222d5c3e05b30ef6b85014cbcb6b79 8fc89664722947164ac9b77086aed319897612068f56ecd57f47029f14671603
hash_to_ec 7f317a34e4fb7de9f69cb107ffc0e57fd9f5c85b85ccb5319d05cebfc169924a 4b71c42339c73db7d710cd63f374d478a6c13bdc352cff40e967282268965ba7
hash_to_ec 15beef8d9687b92918a903b01d594859db4e7128263c8db0cae9d423ff962c1e cd75e6323952f6ac88f138f391b69f38c46d70b7eda61f9e431725b6f1d514a5
hash_to_ec 7a1c04c9af8fc6649833fe81e96f0199fcfe94959256cbe1490075fc5be0904e 0368270cd979439ae0a9552a5d6c9f959e4247fcf920d9e071464582e79c04b1
hash_to_ec c854c583d338615f85f69061e0fa9c9d7c5bbbfe562e8774fef3be556fe8bb63 061620171d7320f64bee98414ff7200a1f481521d202fb281cab06be73b80402
hash_to_ec 0fb8af5aba05ad2503edf1cfad5a451da088e7e974772057cd991a4e0601a3eb d3cbc20384a4420143fcce2cb763b0c15bec4f3267d1bdad3c34c1ee6b790f5e
hash_to_ec 9a251cf59e84a9da5630642f9671c732440caa8fcf4c92446a7e5f5ef99da46c 9b9679086a433f2077f40bcd4c7545fb5cc87e7dbb8bba468d53cb04a74361a0
hash_to_ec 8c632e357cef00e0911eb566f8cc809136b3f5ac1e82d183e4d645cef89fa155 5e06b0f4f278fa1ccb5431866e0b35171cdb814e2e82b9189ce01d8d8a1b2408
hash_to_ec 4aa4c31463475086a5d96b3ff550340567ab3b4a86fa3f01cfe9be18bc4dcb54 76a2916cfc093f27992e1f07b50f431d61d58e255507e208cd29ea4d3bc56623
hash_to_ec 1d33d9aadb949346e3c78d065a0f5262374524f4cb97a7390c8cdaede7ca6578 9ad2f757f499359903031adea6126c577469c4e834a2959e3ac08ee74b13783c
hash_to_ec d9217b9a070df20c4d2f0db42ff0bb36bfba9f51b0b6df8fdfe150405dce4934 65a843c522b4b8ec081a696a0d2dd8dfdfea45db201de7a5889a1446c6dff8c7
hash_to_ec b665b2ca8a285e44ba84e785533b56496a5319730dbb95bc14d3bdfece7544dc 8a804cd13457497b0a29eeca2cecfaa858766ec1d270a0e0c6785b43fd49b824
hash_to_ec 43b5cbcc21b3404bca97fa9a661940fe64d40f3ca569310e50b1bb0173c4d5ee 6c12fffb540d536060bb8b96cf635c1b2cbaa4d875a8d2fb0bf79a690363df19
hash_to_ec 11c58f20562c00dec5bb4456be07cd98186837e9af38d50d45f5e7b6f0f9000d cee76b567586f66dadd38c01213bfc1a17d38e96a495efb4c26063dc498ba209
hash_to_ec b069a980b51d8e030262db0b30069e660f4a3f6f8075d1790c153ba12b879f8b 262391b00bdee71d1d827b2cfe50b46c29e265934dc91959bd369aca0cc6444e
hash_to_ec 75274bfd79bf33eb2f9ab046d34528af9a71811e7e3d55c20eb049c81ac692d8 cb93c850e36896fe6626e97c53652af6736ec3ba0641c7765d0cca2bad2352de
hash_to_ec 5cdb6a24d9736a00f197d9707949fedc5405f367744fe8c83b7cff650302b589 8b4ac03123fab9275dcf340345a1b11fba48ef106d410ba2e0e6f6457037a419
hash_to_ec 07fdc85f809f95a07b59b084402bf91c512ebbe05c7657d6ba27a9e7e121e3e2 61182b3def063630e11de648a278032bcb75949f3a24ef5a133da87830ae5c4e
hash_to_ec a4188ca634cbb796f9927822e343d7b267e0a609c1a0ffa4dcf3726b9ffcc8a2 a911e4899fda28fd6337d708d34553ac5e810ee4938f6f7d9d6e521cab069edb
hash_to_ec 3c128ec5c955ea189a5789df2c892e94193a534a9d5801b8f75df870bc492a69 59eef5ee9df0f681df5b5c67ead1f06b059a8a843837b67f20cce15779608170
hash_to_ec 51a4cc7ec4a14a98c0731e9de7f3ce0779123222d95455e940f2014a23729ec8 105863ccda076af7290d1bf9ec828651dc5811159839044d23f1c3e31a11c5e2
hash_to_ec 1b901a31acbb7807c3309facdc7d04bc3b5a4aa714e6e346bd1c6ad4634e6534 01b3c0000b6c6b471c67c6ab3f9c7a500beaea5edb5c8f2b34df91b69ff67f21
hash_to_ec d2f2c8d79cfa2e7cb2db80568ba62ca0576741acfbe5e2baa0d9b3c424a7c84d 7df9d9088022bd1ce6814d6f8051eef27a650ee38e789b184da2691efd27139d
hash_to_ec 04dcb7644fdfc12d8e34d6e57d7769db939b4a149ed2b81aa51a74ee90babe19 6cff0ab2dd3b32ba1bd1a78e3661722f3f10003a01ce83e430970557decedb2c
hash_to_ec 222798c6841eeaa07e7b7e29686942d7c7f9afc38d09360c8e1f52f2b7debd12 133e3a04ec82aa9b8dbbec18cadbafff446d1270bf7c6f3f97ddd3906dae2468
hash_to_ec 4f7277c3ef247a0689b486ad965f969c433fc63e95d7310e789c4708418ccabc 7e0f2c984dd3cffb35458938c95fe92acf2e697aed060b0e3377c7a07e53c494
hash_to_ec 359b4d6709413243ae2c5409ea02714a9f8961bbbb64a91e81daf01e18c981bf eab69af2cb7f113ad6a27035c0399853d10bd0b99291fad37794d100f7530431
hash_to_ec 6cea3c6a9eb38f60329537170aa4db8dbb869af2040061e53b10c267daf6568c da9a97f4fa96bd05dade5e2704a6a633ba4dbe5080a1e831cda888e9d4f86615
hash_to_ec 3dddecb954ef0209bcf61fd5b46b6c94f2384ef281c48a20ffee74f90788172d af9899c31f944617af54712f93d1a2b4944e48867f480d0d1aec61f3b713e32d
hash_to_ec 9605247462f50bdf7ff57fe966abbefe8b6efa0b65b5116252f0ec723717013f fc8f10904d42a74e09310ccf63db31a90f1dab88b278f15e3364a2356810f7e9
hash_to_ec a005143c4d299933f866db41d0a0b8c67264f5d4ea840dd243cb10c3526bc077 928df1fe9404ffa9c1f4a1c8b2d43ab9b81c5615c8330d2dc2074ac66d4d5200
hash_to_ec f45ce88065c34a163f8e77b6fb583502ed0eb1f490f63f76065a9d97e214e3a9 41bd6784270af4154f2f24f118617e2d7f5b7771a409f08b0f2b7bbcb5e3d666
hash_to_ec 7b40ac30ed02b12ff592a5479c80cf5a7673abfdd4dd38810e40e63275bc2eed 6c6bf5961d83851c9728801093d9af04e5a693bc6cbad237b9ac4b0ed580a771
hash_to_ec 9f985005794d3052a63361413a9820d2ce903198d6d5195b3f20a68f146c6d5c 88bcac53ba5b1c5b44730a24b4cc2cd782298fc70dc9d777b577a2b33b256449
hash_to_ec 31b8e37d01fd5669de4ebf78889d749bc44ffe997186ace56f1fb3e60b8742d2 776366b44170efb130a5045597db5675c6c0b56f3def84863c6b6358aa8dcf40

View File

@@ -0,0 +1,16 @@
use std_shims::io::{self, Write};
const VARINT_CONTINUATION_MASK: u8 = 0b1000_0000;
pub(crate) fn write_varint<W: Write>(varint: &u64, w: &mut W) -> io::Result<()> {
let mut varint = *varint;
while {
let mut b = u8::try_from(varint & u64::from(!VARINT_CONTINUATION_MASK)).unwrap();
varint >>= 7;
if varint != 0 {
b |= VARINT_CONTINUATION_MASK;
}
w.write_all(&[b])?;
varint != 0
} {}
Ok(())
}

View File

@@ -0,0 +1,321 @@
#[cfg(feature = "binaries")]
mod binaries {
pub(crate) use std::sync::Arc;
pub(crate) use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
pub(crate) use multiexp::BatchVerifier;
pub(crate) use serde::Deserialize;
pub(crate) use serde_json::json;
pub(crate) use monero_serai::{
Commitment,
ringct::RctPrunable,
transaction::{Input, Transaction},
block::Block,
rpc::{RpcError, Rpc, HttpRpc},
};
pub(crate) use monero_generators::decompress_point;
pub(crate) use tokio::task::JoinHandle;
pub(crate) async fn check_block(rpc: Arc<Rpc<HttpRpc>>, block_i: usize) {
let hash = loop {
match rpc.get_block_hash(block_i).await {
Ok(hash) => break hash,
Err(RpcError::ConnectionError(e)) => {
println!("get_block_hash ConnectionError: {e}");
continue;
}
Err(e) => panic!("couldn't get block {block_i}'s hash: {e:?}"),
}
};
// TODO: Grab the JSON to also check it was deserialized correctly
#[derive(Deserialize, Debug)]
struct BlockResponse {
blob: String,
}
let res: BlockResponse = loop {
match rpc.json_rpc_call("get_block", Some(json!({ "hash": hex::encode(hash) }))).await {
Ok(res) => break res,
Err(RpcError::ConnectionError(e)) => {
println!("get_block ConnectionError: {e}");
continue;
}
Err(e) => panic!("couldn't get block {block_i} via block.hash(): {e:?}"),
}
};
let blob = hex::decode(res.blob).expect("node returned non-hex block");
let block = Block::read(&mut blob.as_slice())
.unwrap_or_else(|e| panic!("couldn't deserialize block {block_i}: {e}"));
assert_eq!(block.hash(), hash, "hash differs");
assert_eq!(block.serialize(), blob, "serialization differs");
let txs_len = 1 + block.txs.len();
if !block.txs.is_empty() {
#[derive(Deserialize, Debug)]
struct TransactionResponse {
tx_hash: String,
as_hex: String,
}
#[derive(Deserialize, Debug)]
struct TransactionsResponse {
#[serde(default)]
missed_tx: Vec<String>,
txs: Vec<TransactionResponse>,
}
let mut hashes_hex = block.txs.iter().map(hex::encode).collect::<Vec<_>>();
let mut all_txs = vec![];
while !hashes_hex.is_empty() {
let txs: TransactionsResponse = loop {
match rpc
.rpc_call(
"get_transactions",
Some(json!({
"txs_hashes": hashes_hex.drain(.. hashes_hex.len().min(100)).collect::<Vec<_>>(),
})),
)
.await
{
Ok(txs) => break txs,
Err(RpcError::ConnectionError(e)) => {
println!("get_transactions ConnectionError: {e}");
continue;
}
Err(e) => panic!("couldn't call get_transactions: {e:?}"),
}
};
assert!(txs.missed_tx.is_empty());
all_txs.extend(txs.txs);
}
let mut batch = BatchVerifier::new(block.txs.len());
for (tx_hash, tx_res) in block.txs.into_iter().zip(all_txs) {
assert_eq!(
tx_res.tx_hash,
hex::encode(tx_hash),
"node returned a transaction with different hash"
);
let tx = Transaction::read(
&mut hex::decode(&tx_res.as_hex).expect("node returned non-hex transaction").as_slice(),
)
.expect("couldn't deserialize transaction");
assert_eq!(
hex::encode(tx.serialize()),
tx_res.as_hex,
"Transaction serialization was different"
);
assert_eq!(tx.hash(), tx_hash, "Transaction hash was different");
if matches!(tx.rct_signatures.prunable, RctPrunable::Null) {
assert_eq!(tx.prefix.version, 1);
assert!(!tx.signatures.is_empty());
continue;
}
let sig_hash = tx.signature_hash();
// Verify all proofs we support proving for
// This is due to having debug_asserts calling verify within their proving, and CLSAG
// multisig explicitly calling verify as part of its signing process
// Accordingly, making sure our signature_hash algorithm is correct is great, and further
// making sure the verification functions are valid is appreciated
match tx.rct_signatures.prunable {
RctPrunable::Null |
RctPrunable::AggregateMlsagBorromean { .. } |
RctPrunable::MlsagBorromean { .. } => {}
RctPrunable::MlsagBulletproofs { bulletproofs, .. } => {
assert!(bulletproofs.batch_verify(
&mut rand_core::OsRng,
&mut batch,
(),
&tx.rct_signatures.base.commitments
));
}
RctPrunable::Clsag { bulletproofs, clsags, pseudo_outs } => {
assert!(bulletproofs.batch_verify(
&mut rand_core::OsRng,
&mut batch,
(),
&tx.rct_signatures.base.commitments
));
for (i, clsag) in clsags.into_iter().enumerate() {
let (amount, key_offsets, image) = match &tx.prefix.inputs[i] {
Input::Gen(_) => panic!("Input::Gen"),
Input::ToKey { amount, key_offsets, key_image } => (amount, key_offsets, key_image),
};
let mut running_sum = 0;
let mut actual_indexes = vec![];
for offset in key_offsets {
running_sum += offset;
actual_indexes.push(running_sum);
}
async fn get_outs(
rpc: &Rpc<HttpRpc>,
amount: u64,
indexes: &[u64],
) -> Vec<[EdwardsPoint; 2]> {
#[derive(Deserialize, Debug)]
struct Out {
key: String,
mask: String,
}
#[derive(Deserialize, Debug)]
struct Outs {
outs: Vec<Out>,
}
let outs: Outs = loop {
match rpc
.rpc_call(
"get_outs",
Some(json!({
"get_txid": true,
"outputs": indexes.iter().map(|o| json!({
"amount": amount,
"index": o
})).collect::<Vec<_>>()
})),
)
.await
{
Ok(outs) => break outs,
Err(RpcError::ConnectionError(e)) => {
println!("get_outs ConnectionError: {e}");
continue;
}
Err(e) => panic!("couldn't connect to RPC to get outs: {e:?}"),
}
};
let rpc_point = |point: &str| {
decompress_point(
hex::decode(point)
.expect("invalid hex for ring member")
.try_into()
.expect("invalid point len for ring member"),
)
.expect("invalid point for ring member")
};
outs
.outs
.iter()
.map(|out| {
let mask = rpc_point(&out.mask);
if amount != 0 {
assert_eq!(mask, Commitment::new(Scalar::from(1u8), amount).calculate());
}
[rpc_point(&out.key), mask]
})
.collect()
}
clsag
.verify(
&get_outs(&rpc, amount.unwrap_or(0), &actual_indexes).await,
image,
&pseudo_outs[i],
&sig_hash,
)
.unwrap();
}
}
}
}
assert!(batch.verify_vartime());
}
println!("Deserialized, hashed, and reserialized {block_i} with {txs_len} TXs");
}
}
#[cfg(feature = "binaries")]
#[tokio::main]
async fn main() {
use binaries::*;
let args = std::env::args().collect::<Vec<String>>();
// Read start block as the first arg
let mut block_i = args[1].parse::<usize>().expect("invalid start block");
// How many blocks to work on at once
let async_parallelism: usize =
args.get(2).unwrap_or(&"8".to_string()).parse::<usize>().expect("invalid parallelism argument");
// Read further args as RPC URLs
let default_nodes = vec![
"http://xmr-node.cakewallet.com:18081".to_string(),
"https://node.sethforprivacy.com".to_string(),
];
let mut specified_nodes = vec![];
{
let mut i = 0;
loop {
let Some(node) = args.get(3 + i) else { break };
specified_nodes.push(node.clone());
i += 1;
}
}
let nodes = if specified_nodes.is_empty() { default_nodes } else { specified_nodes };
let rpc = |url: String| async move {
HttpRpc::new(url.clone())
.await
.unwrap_or_else(|_| panic!("couldn't create HttpRpc connected to {url}"))
};
let main_rpc = rpc(nodes[0].clone()).await;
let mut rpcs = vec![];
for i in 0 .. async_parallelism {
rpcs.push(Arc::new(rpc(nodes[i % nodes.len()].clone()).await));
}
let mut rpc_i = 0;
let mut handles: Vec<JoinHandle<()>> = vec![];
let mut height = 0;
loop {
let new_height = main_rpc.get_height().await.expect("couldn't call get_height");
if new_height == height {
break;
}
height = new_height;
while block_i < height {
if handles.len() >= async_parallelism {
// Guarantee one handle is complete
handles.swap_remove(0).await.unwrap();
// Remove all of the finished handles
let mut i = 0;
while i < handles.len() {
if handles[i].is_finished() {
handles.swap_remove(i).await.unwrap();
continue;
}
i += 1;
}
}
handles.push(tokio::spawn(check_block(rpcs[rpc_i].clone(), block_i)));
rpc_i = (rpc_i + 1) % rpcs.len();
block_i += 1;
}
}
}
#[cfg(not(feature = "binaries"))]
fn main() {
panic!("To run binaries, please build with `--feature binaries`.");
}

130
coins/monero/src/block.rs Normal file
View File

@@ -0,0 +1,130 @@
use std_shims::{
vec::Vec,
io::{self, Read, Write},
};
use crate::{
hash,
merkle::merkle_root,
serialize::*,
transaction::{Input, Transaction},
};
const CORRECT_BLOCK_HASH_202612: [u8; 32] =
hex_literal::hex!("426d16cff04c71f8b16340b722dc4010a2dd3831c22041431f772547ba6e331a");
const EXISTING_BLOCK_HASH_202612: [u8; 32] =
hex_literal::hex!("bbd604d2ba11ba27935e006ed39c9bfdd99b76bf4a50654bc1e1e61217962698");
#[derive(Clone, PartialEq, Eq, Debug)]
pub struct BlockHeader {
pub major_version: u8,
pub minor_version: u8,
pub timestamp: u64,
pub previous: [u8; 32],
pub nonce: u32,
}
impl BlockHeader {
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
write_varint(&self.major_version, w)?;
write_varint(&self.minor_version, w)?;
write_varint(&self.timestamp, w)?;
w.write_all(&self.previous)?;
w.write_all(&self.nonce.to_le_bytes())
}
pub fn serialize(&self) -> Vec<u8> {
let mut serialized = vec![];
self.write(&mut serialized).unwrap();
serialized
}
pub fn read<R: Read>(r: &mut R) -> io::Result<BlockHeader> {
Ok(BlockHeader {
major_version: read_varint(r)?,
minor_version: read_varint(r)?,
timestamp: read_varint(r)?,
previous: read_bytes(r)?,
nonce: read_bytes(r).map(u32::from_le_bytes)?,
})
}
}
#[derive(Clone, PartialEq, Eq, Debug)]
pub struct Block {
pub header: BlockHeader,
pub miner_tx: Transaction,
pub txs: Vec<[u8; 32]>,
}
impl Block {
pub fn number(&self) -> Option<u64> {
match self.miner_tx.prefix.inputs.first() {
Some(Input::Gen(number)) => Some(*number),
_ => None,
}
}
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
self.header.write(w)?;
self.miner_tx.write(w)?;
write_varint(&self.txs.len(), w)?;
for tx in &self.txs {
w.write_all(tx)?;
}
Ok(())
}
fn tx_merkle_root(&self) -> [u8; 32] {
merkle_root(self.miner_tx.hash(), &self.txs)
}
/// Serialize the block as required for the proof of work hash.
///
/// This is distinct from the serialization required for the block hash. To get the block hash,
/// use the [`Block::hash`] function.
pub fn serialize_hashable(&self) -> Vec<u8> {
let mut blob = self.header.serialize();
blob.extend_from_slice(&self.tx_merkle_root());
write_varint(&(1 + u64::try_from(self.txs.len()).unwrap()), &mut blob).unwrap();
blob
}
pub fn hash(&self) -> [u8; 32] {
let mut hashable = self.serialize_hashable();
// Monero pre-appends a VarInt of the block hashing blobs length before getting the block hash
// but doesn't do this when getting the proof of work hash :)
let mut hashing_blob = Vec::with_capacity(8 + hashable.len());
write_varint(&u64::try_from(hashable.len()).unwrap(), &mut hashing_blob).unwrap();
hashing_blob.append(&mut hashable);
let hash = hash(&hashing_blob);
if hash == CORRECT_BLOCK_HASH_202612 {
return EXISTING_BLOCK_HASH_202612;
};
hash
}
pub fn serialize(&self) -> Vec<u8> {
let mut serialized = vec![];
self.write(&mut serialized).unwrap();
serialized
}
pub fn read<R: Read>(r: &mut R) -> io::Result<Block> {
let header = BlockHeader::read(r)?;
let miner_tx = Transaction::read(r)?;
if !matches!(miner_tx.prefix.inputs.as_slice(), &[Input::Gen(_)]) {
Err(io::Error::other("Miner transaction has incorrect input type."))?;
}
Ok(Block {
header,
miner_tx,
txs: (0_usize .. read_varint(r)?).map(|_| read_bytes(r)).collect::<Result<_, _>>()?,
})
}
}

241
coins/monero/src/lib.rs Normal file
View File

@@ -0,0 +1,241 @@
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
#![doc = include_str!("../README.md")]
#![cfg_attr(not(feature = "std"), no_std)]
#[cfg(not(feature = "std"))]
#[macro_use]
extern crate alloc;
use std_shims::{sync::OnceLock, io};
use rand_core::{RngCore, CryptoRng};
use zeroize::{Zeroize, ZeroizeOnDrop};
use sha3::{Digest, Keccak256};
use curve25519_dalek::{
constants::{ED25519_BASEPOINT_TABLE, ED25519_BASEPOINT_POINT},
scalar::Scalar,
edwards::{EdwardsPoint, VartimeEdwardsPrecomputation},
traits::VartimePrecomputedMultiscalarMul,
};
pub use monero_generators::{H, decompress_point};
mod merkle;
mod serialize;
use serialize::{read_byte, read_u16};
/// UnreducedScalar struct with functionality for recovering incorrectly reduced scalars.
mod unreduced_scalar;
/// Ring Signature structs and functionality.
pub mod ring_signatures;
/// RingCT structs and functionality.
pub mod ringct;
use ringct::RctType;
/// Transaction structs.
pub mod transaction;
/// Block structs.
pub mod block;
/// Monero daemon RPC interface.
pub mod rpc;
/// Wallet functionality, enabling scanning and sending transactions.
pub mod wallet;
#[cfg(test)]
mod tests;
pub const DEFAULT_LOCK_WINDOW: usize = 10;
pub const COINBASE_LOCK_WINDOW: usize = 60;
pub const BLOCK_TIME: usize = 120;
static INV_EIGHT_CELL: OnceLock<Scalar> = OnceLock::new();
#[allow(non_snake_case)]
pub(crate) fn INV_EIGHT() -> Scalar {
*INV_EIGHT_CELL.get_or_init(|| Scalar::from(8u8).invert())
}
static BASEPOINT_PRECOMP_CELL: OnceLock<VartimeEdwardsPrecomputation> = OnceLock::new();
#[allow(non_snake_case)]
pub(crate) fn BASEPOINT_PRECOMP() -> &'static VartimeEdwardsPrecomputation {
BASEPOINT_PRECOMP_CELL
.get_or_init(|| VartimeEdwardsPrecomputation::new([ED25519_BASEPOINT_POINT]))
}
/// Monero protocol version.
///
/// v15 is omitted as v15 was simply v14 and v16 being active at the same time, with regards to the
/// transactions supported. Accordingly, v16 should be used during v15.
#[derive(Clone, Copy, PartialEq, Eq, Debug, Zeroize)]
#[allow(non_camel_case_types)]
pub enum Protocol {
v14,
v16,
Custom {
ring_len: usize,
bp_plus: bool,
optimal_rct_type: RctType,
view_tags: bool,
v16_fee: bool,
},
}
impl Protocol {
/// Amount of ring members under this protocol version.
pub fn ring_len(&self) -> usize {
match self {
Protocol::v14 => 11,
Protocol::v16 => 16,
Protocol::Custom { ring_len, .. } => *ring_len,
}
}
/// Whether or not the specified version uses Bulletproofs or Bulletproofs+.
///
/// This method will likely be reworked when versions not using Bulletproofs at all are added.
pub fn bp_plus(&self) -> bool {
match self {
Protocol::v14 => false,
Protocol::v16 => true,
Protocol::Custom { bp_plus, .. } => *bp_plus,
}
}
// TODO: Make this an Option when we support pre-RCT protocols
pub fn optimal_rct_type(&self) -> RctType {
match self {
Protocol::v14 => RctType::Clsag,
Protocol::v16 => RctType::BulletproofsPlus,
Protocol::Custom { optimal_rct_type, .. } => *optimal_rct_type,
}
}
/// Whether or not the specified version uses view tags.
pub fn view_tags(&self) -> bool {
match self {
Protocol::v14 => false,
Protocol::v16 => true,
Protocol::Custom { view_tags, .. } => *view_tags,
}
}
/// Whether or not the specified version uses the fee algorithm from Monero
/// hard fork version 16 (released in v18 binaries).
pub fn v16_fee(&self) -> bool {
match self {
Protocol::v14 => false,
Protocol::v16 => true,
Protocol::Custom { v16_fee, .. } => *v16_fee,
}
}
pub(crate) fn write<W: io::Write>(&self, w: &mut W) -> io::Result<()> {
match self {
Protocol::v14 => w.write_all(&[0, 14]),
Protocol::v16 => w.write_all(&[0, 16]),
Protocol::Custom { ring_len, bp_plus, optimal_rct_type, view_tags, v16_fee } => {
// Custom, version 0
w.write_all(&[1, 0])?;
w.write_all(&u16::try_from(*ring_len).unwrap().to_le_bytes())?;
w.write_all(&[u8::from(*bp_plus)])?;
w.write_all(&[optimal_rct_type.to_byte()])?;
w.write_all(&[u8::from(*view_tags)])?;
w.write_all(&[u8::from(*v16_fee)])
}
}
}
pub(crate) fn read<R: io::Read>(r: &mut R) -> io::Result<Protocol> {
Ok(match read_byte(r)? {
// Monero protocol
0 => match read_byte(r)? {
14 => Protocol::v14,
16 => Protocol::v16,
_ => Err(io::Error::other("unrecognized monero protocol"))?,
},
// Custom
1 => match read_byte(r)? {
0 => Protocol::Custom {
ring_len: read_u16(r)?.into(),
bp_plus: match read_byte(r)? {
0 => false,
1 => true,
_ => Err(io::Error::other("invalid bool serialization"))?,
},
optimal_rct_type: RctType::from_byte(read_byte(r)?)
.ok_or_else(|| io::Error::other("invalid RctType serialization"))?,
view_tags: match read_byte(r)? {
0 => false,
1 => true,
_ => Err(io::Error::other("invalid bool serialization"))?,
},
v16_fee: match read_byte(r)? {
0 => false,
1 => true,
_ => Err(io::Error::other("invalid bool serialization"))?,
},
},
_ => Err(io::Error::other("unrecognized custom protocol serialization"))?,
},
_ => Err(io::Error::other("unrecognized protocol serialization"))?,
})
}
}
/// Transparent structure representing a Pedersen commitment's contents.
#[allow(non_snake_case)]
#[derive(Clone, PartialEq, Eq, Zeroize, ZeroizeOnDrop)]
pub struct Commitment {
pub mask: Scalar,
pub amount: u64,
}
impl core::fmt::Debug for Commitment {
fn fmt(&self, fmt: &mut core::fmt::Formatter<'_>) -> Result<(), core::fmt::Error> {
fmt.debug_struct("Commitment").field("amount", &self.amount).finish_non_exhaustive()
}
}
impl Commitment {
/// A commitment to zero, defined with a mask of 1 (as to not be the identity).
pub fn zero() -> Commitment {
Commitment { mask: Scalar::ONE, amount: 0 }
}
pub fn new(mask: Scalar, amount: u64) -> Commitment {
Commitment { mask, amount }
}
/// Calculate a Pedersen commitment, as a point, from the transparent structure.
pub fn calculate(&self) -> EdwardsPoint {
(&self.mask * ED25519_BASEPOINT_TABLE) + (Scalar::from(self.amount) * H())
}
}
/// Support generating a random scalar using a modern rand, as dalek's is notoriously dated.
pub fn random_scalar<R: RngCore + CryptoRng>(rng: &mut R) -> Scalar {
let mut r = [0; 64];
rng.fill_bytes(&mut r);
Scalar::from_bytes_mod_order_wide(&r)
}
pub(crate) fn hash(data: &[u8]) -> [u8; 32] {
Keccak256::digest(data).into()
}
/// Hash the provided data to a scalar via keccak256(data) % l.
pub fn hash_to_scalar(data: &[u8]) -> Scalar {
let scalar = Scalar::from_bytes_mod_order(hash(data));
// Monero will explicitly error in this case
// This library acknowledges its practical impossibility of it occurring, and doesn't bother to
// code in logic to handle it. That said, if it ever occurs, something must happen in order to
// not generate/verify a proof we believe to be valid when it isn't
assert!(scalar != Scalar::ZERO, "ZERO HASH: {data:?}");
scalar
}

View File

@@ -0,0 +1,55 @@
use std_shims::vec::Vec;
use crate::hash;
pub(crate) fn merkle_root(root: [u8; 32], leafs: &[[u8; 32]]) -> [u8; 32] {
match leafs.len() {
0 => root,
1 => hash(&[root, leafs[0]].concat()),
_ => {
let mut hashes = Vec::with_capacity(1 + leafs.len());
hashes.push(root);
hashes.extend(leafs);
// Monero preprocess this so the length is a power of 2
let mut high_pow_2 = 4; // 4 is the lowest value this can be
while high_pow_2 < hashes.len() {
high_pow_2 *= 2;
}
let low_pow_2 = high_pow_2 / 2;
// Merge right-most hashes until we're at the low_pow_2
{
let overage = hashes.len() - low_pow_2;
let mut rightmost = hashes.drain((low_pow_2 - overage) ..);
// This is true since we took overage from beneath and above low_pow_2, taking twice as
// many elements as overage
debug_assert_eq!(rightmost.len() % 2, 0);
let mut paired_hashes = Vec::with_capacity(overage);
while let Some(left) = rightmost.next() {
let right = rightmost.next().unwrap();
paired_hashes.push(hash(&[left.as_ref(), &right].concat()));
}
drop(rightmost);
hashes.extend(paired_hashes);
assert_eq!(hashes.len(), low_pow_2);
}
// Do a traditional pairing off
let mut new_hashes = Vec::with_capacity(hashes.len() / 2);
while hashes.len() > 1 {
let mut i = 0;
while i < hashes.len() {
new_hashes.push(hash(&[hashes[i], hashes[i + 1]].concat()));
i += 2;
}
hashes = new_hashes;
new_hashes = Vec::with_capacity(hashes.len() / 2);
}
hashes[0]
}
}
}

View File

@@ -0,0 +1,72 @@
use std_shims::{
io::{self, *},
vec::Vec,
};
use zeroize::Zeroize;
use curve25519_dalek::{EdwardsPoint, Scalar};
use monero_generators::hash_to_point;
use crate::{serialize::*, hash_to_scalar};
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
pub struct Signature {
c: Scalar,
r: Scalar,
}
impl Signature {
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
write_scalar(&self.c, w)?;
write_scalar(&self.r, w)?;
Ok(())
}
pub fn read<R: Read>(r: &mut R) -> io::Result<Signature> {
Ok(Signature { c: read_scalar(r)?, r: read_scalar(r)? })
}
}
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
pub struct RingSignature {
sigs: Vec<Signature>,
}
impl RingSignature {
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
for sig in &self.sigs {
sig.write(w)?;
}
Ok(())
}
pub fn read<R: Read>(members: usize, r: &mut R) -> io::Result<RingSignature> {
Ok(RingSignature { sigs: read_raw_vec(Signature::read, members, r)? })
}
pub fn verify(&self, msg: &[u8; 32], ring: &[EdwardsPoint], key_image: &EdwardsPoint) -> bool {
if ring.len() != self.sigs.len() {
return false;
}
let mut buf = Vec::with_capacity(32 + (32 * 2 * ring.len()));
buf.extend_from_slice(msg);
let mut sum = Scalar::ZERO;
for (ring_member, sig) in ring.iter().zip(&self.sigs) {
#[allow(non_snake_case)]
let Li = EdwardsPoint::vartime_double_scalar_mul_basepoint(&sig.c, ring_member, &sig.r);
buf.extend_from_slice(Li.compress().as_bytes());
#[allow(non_snake_case)]
let Ri = (sig.r * hash_to_point(ring_member.compress().to_bytes())) + (sig.c * key_image);
buf.extend_from_slice(Ri.compress().as_bytes());
sum += sig.c;
}
sum == hash_to_scalar(&buf)
}
}

View File

@@ -0,0 +1,97 @@
use core::fmt::Debug;
use std_shims::io::{self, Read, Write};
use curve25519_dalek::{traits::Identity, Scalar, EdwardsPoint};
use monero_generators::H_pow_2;
use crate::{hash_to_scalar, unreduced_scalar::UnreducedScalar, serialize::*};
/// 64 Borromean ring signatures.
///
/// s0 and s1 are stored as `UnreducedScalar`s due to Monero not requiring they were reduced.
/// `UnreducedScalar` preserves their original byte encoding and implements a custom reduction
/// algorithm which was in use.
#[derive(Clone, PartialEq, Eq, Debug)]
pub struct BorromeanSignatures {
pub s0: [UnreducedScalar; 64],
pub s1: [UnreducedScalar; 64],
pub ee: Scalar,
}
impl BorromeanSignatures {
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanSignatures> {
Ok(BorromeanSignatures {
s0: read_array(UnreducedScalar::read, r)?,
s1: read_array(UnreducedScalar::read, r)?,
ee: read_scalar(r)?,
})
}
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
for s0 in &self.s0 {
s0.write(w)?;
}
for s1 in &self.s1 {
s1.write(w)?;
}
write_scalar(&self.ee, w)
}
fn verify(&self, keys_a: &[EdwardsPoint], keys_b: &[EdwardsPoint]) -> bool {
let mut transcript = [0; 2048];
for i in 0 .. 64 {
#[allow(non_snake_case)]
let LL = EdwardsPoint::vartime_double_scalar_mul_basepoint(
&self.ee,
&keys_a[i],
&self.s0[i].recover_monero_slide_scalar(),
);
#[allow(non_snake_case)]
let LV = EdwardsPoint::vartime_double_scalar_mul_basepoint(
&hash_to_scalar(LL.compress().as_bytes()),
&keys_b[i],
&self.s1[i].recover_monero_slide_scalar(),
);
transcript[(i * 32) .. ((i + 1) * 32)].copy_from_slice(LV.compress().as_bytes());
}
hash_to_scalar(&transcript) == self.ee
}
}
/// A range proof premised on Borromean ring signatures.
#[derive(Clone, PartialEq, Eq, Debug)]
pub struct BorromeanRange {
pub sigs: BorromeanSignatures,
pub bit_commitments: [EdwardsPoint; 64],
}
impl BorromeanRange {
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanRange> {
Ok(BorromeanRange {
sigs: BorromeanSignatures::read(r)?,
bit_commitments: read_array(read_point, r)?,
})
}
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
self.sigs.write(w)?;
write_raw_vec(write_point, &self.bit_commitments, w)
}
pub fn verify(&self, commitment: &EdwardsPoint) -> bool {
if &self.bit_commitments.iter().sum::<EdwardsPoint>() != commitment {
return false;
}
#[allow(non_snake_case)]
let H_pow_2 = H_pow_2();
let mut commitments_sub_one = [EdwardsPoint::identity(); 64];
for i in 0 .. 64 {
commitments_sub_one[i] = self.bit_commitments[i] - H_pow_2[i];
}
self.sigs.verify(&self.bit_commitments, &commitments_sub_one)
}
}

View File

@@ -0,0 +1,151 @@
use std_shims::{vec::Vec, sync::OnceLock};
use rand_core::{RngCore, CryptoRng};
use subtle::{Choice, ConditionallySelectable};
use curve25519_dalek::edwards::EdwardsPoint as DalekPoint;
use group::{ff::Field, Group};
use dalek_ff_group::{Scalar, EdwardsPoint};
use multiexp::multiexp as multiexp_const;
pub(crate) use monero_generators::Generators;
use crate::{INV_EIGHT as DALEK_INV_EIGHT, H as DALEK_H, Commitment, hash_to_scalar as dalek_hash};
pub(crate) use crate::ringct::bulletproofs::scalar_vector::*;
#[inline]
pub(crate) fn INV_EIGHT() -> Scalar {
Scalar(DALEK_INV_EIGHT())
}
#[inline]
pub(crate) fn H() -> EdwardsPoint {
EdwardsPoint(DALEK_H())
}
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
Scalar(dalek_hash(data))
}
// Components common between variants
pub(crate) const MAX_M: usize = 16;
pub(crate) const LOG_N: usize = 6; // 2 << 6 == N
pub(crate) const N: usize = 64;
pub(crate) fn prove_multiexp(pairs: &[(Scalar, EdwardsPoint)]) -> EdwardsPoint {
multiexp_const(pairs) * INV_EIGHT()
}
pub(crate) fn vector_exponent(
generators: &Generators,
a: &ScalarVector,
b: &ScalarVector,
) -> EdwardsPoint {
debug_assert_eq!(a.len(), b.len());
(a * &generators.G[.. a.len()]) + (b * &generators.H[.. b.len()])
}
pub(crate) fn hash_cache(cache: &mut Scalar, mash: &[[u8; 32]]) -> Scalar {
let slice =
&[cache.to_bytes().as_ref(), mash.iter().copied().flatten().collect::<Vec<_>>().as_ref()]
.concat();
*cache = hash_to_scalar(slice);
*cache
}
pub(crate) fn MN(outputs: usize) -> (usize, usize, usize) {
let mut logM = 0;
let mut M;
while {
M = 1 << logM;
(M <= MAX_M) && (M < outputs)
} {
logM += 1;
}
(logM + LOG_N, M, M * N)
}
pub(crate) fn bit_decompose(commitments: &[Commitment]) -> (ScalarVector, ScalarVector) {
let (_, M, MN) = MN(commitments.len());
let sv = commitments.iter().map(|c| Scalar::from(c.amount)).collect::<Vec<_>>();
let mut aL = ScalarVector::new(MN);
let mut aR = ScalarVector::new(MN);
for j in 0 .. M {
for i in (0 .. N).rev() {
let bit =
if j < sv.len() { Choice::from((sv[j][i / 8] >> (i % 8)) & 1) } else { Choice::from(0) };
aL.0[(j * N) + i] = Scalar::conditional_select(&Scalar::ZERO, &Scalar::ONE, bit);
aR.0[(j * N) + i] = Scalar::conditional_select(&-Scalar::ONE, &Scalar::ZERO, bit);
}
}
(aL, aR)
}
pub(crate) fn hash_commitments<C: IntoIterator<Item = DalekPoint>>(
commitments: C,
) -> (Scalar, Vec<EdwardsPoint>) {
let V = commitments.into_iter().map(|c| EdwardsPoint(c) * INV_EIGHT()).collect::<Vec<_>>();
(hash_to_scalar(&V.iter().flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>()), V)
}
pub(crate) fn alpha_rho<R: RngCore + CryptoRng>(
rng: &mut R,
generators: &Generators,
aL: &ScalarVector,
aR: &ScalarVector,
) -> (Scalar, EdwardsPoint) {
let ar = Scalar::random(rng);
(ar, (vector_exponent(generators, aL, aR) + (EdwardsPoint::generator() * ar)) * INV_EIGHT())
}
pub(crate) fn LR_statements(
a: &ScalarVector,
G_i: &[EdwardsPoint],
b: &ScalarVector,
H_i: &[EdwardsPoint],
cL: Scalar,
U: EdwardsPoint,
) -> Vec<(Scalar, EdwardsPoint)> {
let mut res = a
.0
.iter()
.copied()
.zip(G_i.iter().copied())
.chain(b.0.iter().copied().zip(H_i.iter().copied()))
.collect::<Vec<_>>();
res.push((cL, U));
res
}
static TWO_N_CELL: OnceLock<ScalarVector> = OnceLock::new();
pub(crate) fn TWO_N() -> &'static ScalarVector {
TWO_N_CELL.get_or_init(|| ScalarVector::powers(Scalar::from(2u8), N))
}
pub(crate) fn challenge_products(w: &[Scalar], winv: &[Scalar]) -> Vec<Scalar> {
let mut products = vec![Scalar::ZERO; 1 << w.len()];
products[0] = winv[0];
products[1] = w[0];
for j in 1 .. w.len() {
let mut slots = (1 << (j + 1)) - 1;
while slots > 0 {
products[slots] = products[slots / 2] * w[j];
products[slots - 1] = products[slots / 2] * winv[j];
slots = slots.saturating_sub(2);
}
}
// Sanity check as if the above failed to populate, it'd be critical
for w in &products {
debug_assert!(!bool::from(w.is_zero()));
}
products
}

View File

@@ -0,0 +1,229 @@
#![allow(non_snake_case)]
use std_shims::{
vec::Vec,
io::{self, Read, Write},
};
use rand_core::{RngCore, CryptoRng};
use zeroize::{Zeroize, Zeroizing};
use curve25519_dalek::edwards::EdwardsPoint;
use multiexp::BatchVerifier;
use crate::{Commitment, wallet::TransactionError, serialize::*};
pub(crate) mod scalar_vector;
pub(crate) mod core;
use self::core::LOG_N;
pub(crate) mod original;
use self::original::OriginalStruct;
pub(crate) mod plus;
use self::plus::*;
pub(crate) const MAX_OUTPUTS: usize = self::core::MAX_M;
/// Bulletproofs enum, supporting the original and plus formulations.
#[allow(clippy::large_enum_variant)]
#[derive(Clone, PartialEq, Eq, Debug)]
pub enum Bulletproofs {
Original(OriginalStruct),
Plus(AggregateRangeProof),
}
impl Bulletproofs {
fn bp_fields(plus: bool) -> usize {
if plus {
6
} else {
9
}
}
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
// src/cryptonote_basic/cryptonote_format_utils.cpp#L106-L124
pub(crate) fn calculate_bp_clawback(plus: bool, n_outputs: usize) -> (usize, usize) {
#[allow(non_snake_case)]
let mut LR_len = 0;
let mut n_padded_outputs = 1;
while n_padded_outputs < n_outputs {
LR_len += 1;
n_padded_outputs = 1 << LR_len;
}
LR_len += LOG_N;
let mut bp_clawback = 0;
if n_padded_outputs > 2 {
let fields = Bulletproofs::bp_fields(plus);
let base = ((fields + (2 * (LOG_N + 1))) * 32) / 2;
let size = (fields + (2 * LR_len)) * 32;
bp_clawback = ((base * n_padded_outputs) - size) * 4 / 5;
}
(bp_clawback, LR_len)
}
pub(crate) fn fee_weight(plus: bool, outputs: usize) -> usize {
#[allow(non_snake_case)]
let (bp_clawback, LR_len) = Bulletproofs::calculate_bp_clawback(plus, outputs);
32 * (Bulletproofs::bp_fields(plus) + (2 * LR_len)) + 2 + bp_clawback
}
/// Prove the list of commitments are within [0 .. 2^64).
pub fn prove<R: RngCore + CryptoRng>(
rng: &mut R,
outputs: &[Commitment],
plus: bool,
) -> Result<Bulletproofs, TransactionError> {
if outputs.is_empty() {
Err(TransactionError::NoOutputs)?;
}
if outputs.len() > MAX_OUTPUTS {
Err(TransactionError::TooManyOutputs)?;
}
Ok(if !plus {
Bulletproofs::Original(OriginalStruct::prove(rng, outputs))
} else {
use dalek_ff_group::EdwardsPoint as DfgPoint;
Bulletproofs::Plus(
AggregateRangeStatement::new(outputs.iter().map(|com| DfgPoint(com.calculate())).collect())
.unwrap()
.prove(rng, &Zeroizing::new(AggregateRangeWitness::new(outputs.to_vec()).unwrap()))
.unwrap(),
)
})
}
/// Verify the given Bulletproofs.
#[must_use]
pub fn verify<R: RngCore + CryptoRng>(&self, rng: &mut R, commitments: &[EdwardsPoint]) -> bool {
match self {
Bulletproofs::Original(bp) => bp.verify(rng, commitments),
Bulletproofs::Plus(bp) => {
let mut verifier = BatchVerifier::new(1);
// If this commitment is torsioned (which is allowed), this won't be a well-formed
// dfg::EdwardsPoint (expected to be of prime-order)
// The actual BP+ impl will perform a torsion clear though, making this safe
// TODO: Have AggregateRangeStatement take in dalek EdwardsPoint for clarity on this
let Some(statement) = AggregateRangeStatement::new(
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
) else {
return false;
};
if !statement.verify(rng, &mut verifier, (), bp.clone()) {
return false;
}
verifier.verify_vartime()
}
}
}
/// Accumulate the verification for the given Bulletproofs into the specified BatchVerifier.
/// Returns false if the Bulletproofs aren't sane, without mutating the BatchVerifier.
/// Returns true if the Bulletproofs are sane, regardless of their validity.
#[must_use]
pub fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
&self,
rng: &mut R,
verifier: &mut BatchVerifier<ID, dalek_ff_group::EdwardsPoint>,
id: ID,
commitments: &[EdwardsPoint],
) -> bool {
match self {
Bulletproofs::Original(bp) => bp.batch_verify(rng, verifier, id, commitments),
Bulletproofs::Plus(bp) => {
let Some(statement) = AggregateRangeStatement::new(
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
) else {
return false;
};
statement.verify(rng, verifier, id, bp.clone())
}
}
}
fn write_core<W: Write, F: Fn(&[EdwardsPoint], &mut W) -> io::Result<()>>(
&self,
w: &mut W,
specific_write_vec: F,
) -> io::Result<()> {
match self {
Bulletproofs::Original(bp) => {
write_point(&bp.A, w)?;
write_point(&bp.S, w)?;
write_point(&bp.T1, w)?;
write_point(&bp.T2, w)?;
write_scalar(&bp.taux, w)?;
write_scalar(&bp.mu, w)?;
specific_write_vec(&bp.L, w)?;
specific_write_vec(&bp.R, w)?;
write_scalar(&bp.a, w)?;
write_scalar(&bp.b, w)?;
write_scalar(&bp.t, w)
}
Bulletproofs::Plus(bp) => {
write_point(&bp.A.0, w)?;
write_point(&bp.wip.A.0, w)?;
write_point(&bp.wip.B.0, w)?;
write_scalar(&bp.wip.r_answer.0, w)?;
write_scalar(&bp.wip.s_answer.0, w)?;
write_scalar(&bp.wip.delta_answer.0, w)?;
specific_write_vec(&bp.wip.L.iter().copied().map(|L| L.0).collect::<Vec<_>>(), w)?;
specific_write_vec(&bp.wip.R.iter().copied().map(|R| R.0).collect::<Vec<_>>(), w)
}
}
}
pub(crate) fn signature_write<W: Write>(&self, w: &mut W) -> io::Result<()> {
self.write_core(w, |points, w| write_raw_vec(write_point, points, w))
}
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
self.write_core(w, |points, w| write_vec(write_point, points, w))
}
pub fn serialize(&self) -> Vec<u8> {
let mut serialized = vec![];
self.write(&mut serialized).unwrap();
serialized
}
/// Read Bulletproofs.
pub fn read<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
Ok(Bulletproofs::Original(OriginalStruct {
A: read_point(r)?,
S: read_point(r)?,
T1: read_point(r)?,
T2: read_point(r)?,
taux: read_scalar(r)?,
mu: read_scalar(r)?,
L: read_vec(read_point, r)?,
R: read_vec(read_point, r)?,
a: read_scalar(r)?,
b: read_scalar(r)?,
t: read_scalar(r)?,
}))
}
/// Read Bulletproofs+.
pub fn read_plus<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
use dalek_ff_group::{Scalar as DfgScalar, EdwardsPoint as DfgPoint};
Ok(Bulletproofs::Plus(AggregateRangeProof {
A: DfgPoint(read_point(r)?),
wip: WipProof {
A: DfgPoint(read_point(r)?),
B: DfgPoint(read_point(r)?),
r_answer: DfgScalar(read_scalar(r)?),
s_answer: DfgScalar(read_scalar(r)?),
delta_answer: DfgScalar(read_scalar(r)?),
L: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
R: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
},
}))
}
}

View File

@@ -0,0 +1,322 @@
use std_shims::{vec::Vec, sync::OnceLock};
use rand_core::{RngCore, CryptoRng};
use zeroize::Zeroize;
use curve25519_dalek::{scalar::Scalar as DalekScalar, edwards::EdwardsPoint as DalekPoint};
use group::{ff::Field, Group};
use dalek_ff_group::{ED25519_BASEPOINT_POINT as G, Scalar, EdwardsPoint};
use multiexp::{BatchVerifier, multiexp};
use crate::{Commitment, ringct::bulletproofs::core::*};
include!(concat!(env!("OUT_DIR"), "/generators.rs"));
static IP12_CELL: OnceLock<Scalar> = OnceLock::new();
pub(crate) fn IP12() -> Scalar {
*IP12_CELL.get_or_init(|| ScalarVector(vec![Scalar::ONE; N]).inner_product(TWO_N()))
}
pub(crate) fn hadamard_fold(
l: &[EdwardsPoint],
r: &[EdwardsPoint],
a: Scalar,
b: Scalar,
) -> Vec<EdwardsPoint> {
let mut res = Vec::with_capacity(l.len() / 2);
for i in 0 .. l.len() {
res.push(multiexp(&[(a, l[i]), (b, r[i])]));
}
res
}
#[derive(Clone, PartialEq, Eq, Debug)]
pub struct OriginalStruct {
pub(crate) A: DalekPoint,
pub(crate) S: DalekPoint,
pub(crate) T1: DalekPoint,
pub(crate) T2: DalekPoint,
pub(crate) taux: DalekScalar,
pub(crate) mu: DalekScalar,
pub(crate) L: Vec<DalekPoint>,
pub(crate) R: Vec<DalekPoint>,
pub(crate) a: DalekScalar,
pub(crate) b: DalekScalar,
pub(crate) t: DalekScalar,
}
impl OriginalStruct {
pub(crate) fn prove<R: RngCore + CryptoRng>(
rng: &mut R,
commitments: &[Commitment],
) -> OriginalStruct {
let (logMN, M, MN) = MN(commitments.len());
let (aL, aR) = bit_decompose(commitments);
let commitments_points = commitments.iter().map(Commitment::calculate).collect::<Vec<_>>();
let (mut cache, _) = hash_commitments(commitments_points.clone());
let (sL, sR) =
ScalarVector((0 .. (MN * 2)).map(|_| Scalar::random(&mut *rng)).collect::<Vec<_>>()).split();
let generators = GENERATORS();
let (mut alpha, A) = alpha_rho(&mut *rng, generators, &aL, &aR);
let (mut rho, S) = alpha_rho(&mut *rng, generators, &sL, &sR);
let y = hash_cache(&mut cache, &[A.compress().to_bytes(), S.compress().to_bytes()]);
let mut cache = hash_to_scalar(&y.to_bytes());
let z = cache;
let l0 = aL - z;
let l1 = sL;
let mut zero_twos = Vec::with_capacity(MN);
let zpow = ScalarVector::powers(z, M + 2);
for j in 0 .. M {
for i in 0 .. N {
zero_twos.push(zpow[j + 2] * TWO_N()[i]);
}
}
let yMN = ScalarVector::powers(y, MN);
let r0 = ((aR + z) * &yMN) + &ScalarVector(zero_twos);
let r1 = yMN * &sR;
let (T1, T2, x, mut taux) = {
let t1 = l0.clone().inner_product(&r1) + r0.clone().inner_product(&l1);
let t2 = l1.clone().inner_product(&r1);
let mut tau1 = Scalar::random(&mut *rng);
let mut tau2 = Scalar::random(&mut *rng);
let T1 = prove_multiexp(&[(t1, H()), (tau1, EdwardsPoint::generator())]);
let T2 = prove_multiexp(&[(t2, H()), (tau2, EdwardsPoint::generator())]);
let x =
hash_cache(&mut cache, &[z.to_bytes(), T1.compress().to_bytes(), T2.compress().to_bytes()]);
let taux = (tau2 * (x * x)) + (tau1 * x);
tau1.zeroize();
tau2.zeroize();
(T1, T2, x, taux)
};
let mu = (x * rho) + alpha;
alpha.zeroize();
rho.zeroize();
for (i, gamma) in commitments.iter().map(|c| Scalar(c.mask)).enumerate() {
taux += zpow[i + 2] * gamma;
}
let l = l0 + &(l1 * x);
let r = r0 + &(r1 * x);
let t = l.clone().inner_product(&r);
let x_ip =
hash_cache(&mut cache, &[x.to_bytes(), taux.to_bytes(), mu.to_bytes(), t.to_bytes()]);
let mut a = l;
let mut b = r;
let yinv = y.invert().unwrap();
let yinvpow = ScalarVector::powers(yinv, MN);
let mut G_proof = generators.G[.. a.len()].to_vec();
let mut H_proof = generators.H[.. a.len()].to_vec();
H_proof.iter_mut().zip(yinvpow.0.iter()).for_each(|(this_H, yinvpow)| *this_H *= yinvpow);
let U = H() * x_ip;
let mut L = Vec::with_capacity(logMN);
let mut R = Vec::with_capacity(logMN);
while a.len() != 1 {
let (aL, aR) = a.split();
let (bL, bR) = b.split();
let cL = aL.clone().inner_product(&bR);
let cR = aR.clone().inner_product(&bL);
let (G_L, G_R) = G_proof.split_at(aL.len());
let (H_L, H_R) = H_proof.split_at(aL.len());
let L_i = prove_multiexp(&LR_statements(&aL, G_R, &bR, H_L, cL, U));
let R_i = prove_multiexp(&LR_statements(&aR, G_L, &bL, H_R, cR, U));
L.push(L_i);
R.push(R_i);
let w = hash_cache(&mut cache, &[L_i.compress().to_bytes(), R_i.compress().to_bytes()]);
let winv = w.invert().unwrap();
a = (aL * w) + &(aR * winv);
b = (bL * winv) + &(bR * w);
if a.len() != 1 {
G_proof = hadamard_fold(G_L, G_R, winv, w);
H_proof = hadamard_fold(H_L, H_R, w, winv);
}
}
let res = OriginalStruct {
A: *A,
S: *S,
T1: *T1,
T2: *T2,
taux: *taux,
mu: *mu,
L: L.drain(..).map(|L| *L).collect(),
R: R.drain(..).map(|R| *R).collect(),
a: *a[0],
b: *b[0],
t: *t,
};
debug_assert!(res.verify(rng, &commitments_points));
res
}
#[must_use]
fn verify_core<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
&self,
rng: &mut R,
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
id: ID,
commitments: &[DalekPoint],
) -> bool {
// Verify commitments are valid
if commitments.is_empty() || (commitments.len() > MAX_M) {
return false;
}
// Verify L and R are properly sized
if self.L.len() != self.R.len() {
return false;
}
let (logMN, M, MN) = MN(commitments.len());
if self.L.len() != logMN {
return false;
}
// Rebuild all challenges
let (mut cache, commitments) = hash_commitments(commitments.iter().copied());
let y = hash_cache(&mut cache, &[self.A.compress().to_bytes(), self.S.compress().to_bytes()]);
let z = hash_to_scalar(&y.to_bytes());
cache = z;
let x = hash_cache(
&mut cache,
&[z.to_bytes(), self.T1.compress().to_bytes(), self.T2.compress().to_bytes()],
);
let x_ip = hash_cache(
&mut cache,
&[x.to_bytes(), self.taux.to_bytes(), self.mu.to_bytes(), self.t.to_bytes()],
);
let mut w = Vec::with_capacity(logMN);
let mut winv = Vec::with_capacity(logMN);
for (L, R) in self.L.iter().zip(&self.R) {
w.push(hash_cache(&mut cache, &[L.compress().to_bytes(), R.compress().to_bytes()]));
winv.push(cache.invert().unwrap());
}
// Convert the proof from * INV_EIGHT to its actual form
let normalize = |point: &DalekPoint| EdwardsPoint(point.mul_by_cofactor());
let L = self.L.iter().map(normalize).collect::<Vec<_>>();
let R = self.R.iter().map(normalize).collect::<Vec<_>>();
let T1 = normalize(&self.T1);
let T2 = normalize(&self.T2);
let A = normalize(&self.A);
let S = normalize(&self.S);
let commitments = commitments.iter().map(EdwardsPoint::mul_by_cofactor).collect::<Vec<_>>();
// Verify it
let mut proof = Vec::with_capacity(4 + commitments.len());
let zpow = ScalarVector::powers(z, M + 3);
let ip1y = ScalarVector::powers(y, M * N).sum();
let mut k = -(zpow[2] * ip1y);
for j in 1 ..= M {
k -= zpow[j + 2] * IP12();
}
let y1 = Scalar(self.t) - ((z * ip1y) + k);
proof.push((-y1, H()));
proof.push((-Scalar(self.taux), G));
for (j, commitment) in commitments.iter().enumerate() {
proof.push((zpow[j + 2], *commitment));
}
proof.push((x, T1));
proof.push((x * x, T2));
verifier.queue(&mut *rng, id, proof);
proof = Vec::with_capacity(4 + (2 * (MN + logMN)));
let z3 = (Scalar(self.t) - (Scalar(self.a) * Scalar(self.b))) * x_ip;
proof.push((z3, H()));
proof.push((-Scalar(self.mu), G));
proof.push((Scalar::ONE, A));
proof.push((x, S));
{
let ypow = ScalarVector::powers(y, MN);
let yinv = y.invert().unwrap();
let yinvpow = ScalarVector::powers(yinv, MN);
let w_cache = challenge_products(&w, &winv);
let generators = GENERATORS();
for i in 0 .. MN {
let g = (Scalar(self.a) * w_cache[i]) + z;
proof.push((-g, generators.G[i]));
let mut h = Scalar(self.b) * yinvpow[i] * w_cache[(!i) & (MN - 1)];
h -= ((zpow[(i / N) + 2] * TWO_N()[i % N]) + (z * ypow[i])) * yinvpow[i];
proof.push((-h, generators.H[i]));
}
}
for i in 0 .. logMN {
proof.push((w[i] * w[i], L[i]));
proof.push((winv[i] * winv[i], R[i]));
}
verifier.queue(rng, id, proof);
true
}
#[must_use]
pub(crate) fn verify<R: RngCore + CryptoRng>(
&self,
rng: &mut R,
commitments: &[DalekPoint],
) -> bool {
let mut verifier = BatchVerifier::new(1);
if self.verify_core(rng, &mut verifier, (), commitments) {
verifier.verify_vartime()
} else {
false
}
}
#[must_use]
pub(crate) fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
&self,
rng: &mut R,
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
id: ID,
commitments: &[DalekPoint],
) -> bool {
self.verify_core(rng, verifier, id, commitments)
}
}

View File

@@ -0,0 +1,252 @@
use std_shims::vec::Vec;
use rand_core::{RngCore, CryptoRng};
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
use multiexp::{multiexp, multiexp_vartime, BatchVerifier};
use group::{
ff::{Field, PrimeField},
Group, GroupEncoding,
};
use dalek_ff_group::{Scalar, EdwardsPoint};
use crate::{
Commitment,
ringct::{
bulletproofs::core::{MAX_M, N},
bulletproofs::plus::{
ScalarVector, PointVector, GeneratorsList, Generators,
transcript::*,
weighted_inner_product::{WipStatement, WipWitness, WipProof},
padded_pow_of_2, u64_decompose,
},
},
};
// Figure 3 of the Bulletproofs+ Paper
#[derive(Clone, Debug)]
pub(crate) struct AggregateRangeStatement {
generators: Generators,
V: Vec<EdwardsPoint>,
}
impl Zeroize for AggregateRangeStatement {
fn zeroize(&mut self) {
self.V.zeroize();
}
}
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
pub(crate) struct AggregateRangeWitness(Vec<Commitment>);
impl AggregateRangeWitness {
pub(crate) fn new(commitments: Vec<Commitment>) -> Option<Self> {
if commitments.is_empty() || (commitments.len() > MAX_M) {
return None;
}
Some(AggregateRangeWitness(commitments))
}
}
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
pub struct AggregateRangeProof {
pub(crate) A: EdwardsPoint,
pub(crate) wip: WipProof,
}
impl AggregateRangeStatement {
pub(crate) fn new(V: Vec<EdwardsPoint>) -> Option<Self> {
if V.is_empty() || (V.len() > MAX_M) {
return None;
}
Some(Self { generators: Generators::new(), V })
}
fn transcript_A(transcript: &mut Scalar, A: EdwardsPoint) -> (Scalar, Scalar) {
let y = hash_to_scalar(&[transcript.to_repr().as_ref(), A.to_bytes().as_ref()].concat());
let z = hash_to_scalar(y.to_bytes().as_ref());
*transcript = z;
(y, z)
}
fn d_j(j: usize, m: usize) -> ScalarVector {
let mut d_j = Vec::with_capacity(m * N);
for _ in 0 .. (j - 1) * N {
d_j.push(Scalar::ZERO);
}
d_j.append(&mut ScalarVector::powers(Scalar::from(2u8), N).0);
for _ in 0 .. (m - j) * N {
d_j.push(Scalar::ZERO);
}
ScalarVector(d_j)
}
fn compute_A_hat(
mut V: PointVector,
generators: &Generators,
transcript: &mut Scalar,
mut A: EdwardsPoint,
) -> (Scalar, ScalarVector, Scalar, Scalar, ScalarVector, EdwardsPoint) {
let (y, z) = Self::transcript_A(transcript, A);
A = A.mul_by_cofactor();
while V.len() < padded_pow_of_2(V.len()) {
V.0.push(EdwardsPoint::identity());
}
let mn = V.len() * N;
let mut z_pow = Vec::with_capacity(V.len());
let mut d = ScalarVector::new(mn);
for j in 1 ..= V.len() {
z_pow.push(z.pow(Scalar::from(2 * u64::try_from(j).unwrap()))); // TODO: Optimize this
d = d + &(Self::d_j(j, V.len()) * (z_pow[j - 1]));
}
let mut ascending_y = ScalarVector(vec![y]);
for i in 1 .. d.len() {
ascending_y.0.push(ascending_y[i - 1] * y);
}
let y_pows = ascending_y.clone().sum();
let mut descending_y = ascending_y.clone();
descending_y.0.reverse();
let d_descending_y = d.clone() * &descending_y;
let d_descending_y_plus_z = d_descending_y + z;
let y_mn_plus_one = descending_y[0] * y;
let mut commitment_accum = EdwardsPoint::identity();
for (j, commitment) in V.0.iter().enumerate() {
commitment_accum += *commitment * z_pow[j];
}
let neg_z = -z;
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 2);
for (i, d_y_z) in d_descending_y_plus_z.0.iter().enumerate() {
A_terms.push((neg_z, generators.generator(GeneratorsList::GBold1, i)));
A_terms.push((*d_y_z, generators.generator(GeneratorsList::HBold1, i)));
}
A_terms.push((y_mn_plus_one, commitment_accum));
A_terms.push((
((y_pows * z) - (d.sum() * y_mn_plus_one * z) - (y_pows * z.square())),
Generators::g(),
));
(
y,
d_descending_y_plus_z,
y_mn_plus_one,
z,
ScalarVector(z_pow),
A + multiexp_vartime(&A_terms),
)
}
pub(crate) fn prove<R: RngCore + CryptoRng>(
self,
rng: &mut R,
witness: &AggregateRangeWitness,
) -> Option<AggregateRangeProof> {
// Check for consistency with the witness
if self.V.len() != witness.0.len() {
return None;
}
for (commitment, witness) in self.V.iter().zip(witness.0.iter()) {
if witness.calculate() != **commitment {
return None;
}
}
let Self { generators, V } = self;
// Monero expects all of these points to be torsion-free
// Generally, for Bulletproofs, it sends points * INV_EIGHT and then performs a torsion clear
// by multiplying by 8
// This also restores the original value due to the preprocessing
// Commitments aren't transmitted INV_EIGHT though, so this multiplies by INV_EIGHT to enable
// clearing its cofactor without mutating the value
// For some reason, these values are transcripted * INV_EIGHT, not as transmitted
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
let mut transcript = initial_transcript(V.iter());
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
// Pad V
while V.len() < padded_pow_of_2(V.len()) {
V.push(EdwardsPoint::identity());
}
let generators = generators.reduce(V.len() * N);
let mut d_js = Vec::with_capacity(V.len());
let mut a_l = ScalarVector(Vec::with_capacity(V.len() * N));
for j in 1 ..= V.len() {
d_js.push(Self::d_j(j, V.len()));
#[allow(clippy::map_unwrap_or)]
a_l.0.append(
&mut u64_decompose(
*witness.0.get(j - 1).map(|commitment| &commitment.amount).unwrap_or(&0),
)
.0,
);
}
let a_r = a_l.clone() - Scalar::ONE;
let alpha = Scalar::random(&mut *rng);
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 1);
for (i, a_l) in a_l.0.iter().enumerate() {
A_terms.push((*a_l, generators.generator(GeneratorsList::GBold1, i)));
}
for (i, a_r) in a_r.0.iter().enumerate() {
A_terms.push((*a_r, generators.generator(GeneratorsList::HBold1, i)));
}
A_terms.push((alpha, Generators::h()));
let mut A = multiexp(&A_terms);
A_terms.zeroize();
// Multiply by INV_EIGHT per earlier commentary
A.0 *= crate::INV_EIGHT();
let (y, d_descending_y_plus_z, y_mn_plus_one, z, z_pow, A_hat) =
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, A);
let a_l = a_l - z;
let a_r = a_r + &d_descending_y_plus_z;
let mut alpha = alpha;
for j in 1 ..= witness.0.len() {
alpha += z_pow[j - 1] * Scalar(witness.0[j - 1].mask) * y_mn_plus_one;
}
Some(AggregateRangeProof {
A,
wip: WipStatement::new(generators, A_hat, y)
.prove(rng, transcript, &Zeroizing::new(WipWitness::new(a_l, a_r, alpha).unwrap()))
.unwrap(),
})
}
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
self,
rng: &mut R,
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
id: Id,
proof: AggregateRangeProof,
) -> bool {
let Self { generators, V } = self;
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
let mut transcript = initial_transcript(V.iter());
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
let generators = generators.reduce(V.len() * N);
let (y, _, _, _, _, A_hat) =
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, proof.A);
WipStatement::new(generators, A_hat, y).verify(rng, verifier, id, transcript, proof.wip)
}
}

View File

@@ -0,0 +1,85 @@
#![allow(non_snake_case)]
use group::Group;
use dalek_ff_group::{Scalar, EdwardsPoint};
pub(crate) use crate::ringct::bulletproofs::scalar_vector::ScalarVector;
mod point_vector;
pub(crate) use point_vector::PointVector;
pub(crate) mod transcript;
pub(crate) mod weighted_inner_product;
pub(crate) use weighted_inner_product::*;
pub(crate) mod aggregate_range_proof;
pub(crate) use aggregate_range_proof::*;
pub(crate) fn padded_pow_of_2(i: usize) -> usize {
let mut next_pow_of_2 = 1;
while next_pow_of_2 < i {
next_pow_of_2 <<= 1;
}
next_pow_of_2
}
#[derive(Clone, Copy, PartialEq, Eq, Hash, Debug)]
pub(crate) enum GeneratorsList {
GBold1,
HBold1,
}
// TODO: Table these
#[derive(Clone, Debug)]
pub(crate) struct Generators {
g_bold1: &'static [EdwardsPoint],
h_bold1: &'static [EdwardsPoint],
}
mod generators {
use std_shims::sync::OnceLock;
use monero_generators::Generators;
include!(concat!(env!("OUT_DIR"), "/generators_plus.rs"));
}
impl Generators {
#[allow(clippy::new_without_default)]
pub(crate) fn new() -> Self {
let gens = generators::GENERATORS();
Generators { g_bold1: &gens.G, h_bold1: &gens.H }
}
pub(crate) fn len(&self) -> usize {
self.g_bold1.len()
}
pub(crate) fn g() -> EdwardsPoint {
dalek_ff_group::EdwardsPoint(crate::H())
}
pub(crate) fn h() -> EdwardsPoint {
EdwardsPoint::generator()
}
pub(crate) fn generator(&self, list: GeneratorsList, i: usize) -> EdwardsPoint {
match list {
GeneratorsList::GBold1 => self.g_bold1[i],
GeneratorsList::HBold1 => self.h_bold1[i],
}
}
pub(crate) fn reduce(&self, generators: usize) -> Self {
// Round to the nearest power of 2
let generators = padded_pow_of_2(generators);
assert!(generators <= self.g_bold1.len());
Generators { g_bold1: &self.g_bold1[.. generators], h_bold1: &self.h_bold1[.. generators] }
}
}
// Returns the little-endian decomposition.
fn u64_decompose(value: u64) -> ScalarVector {
let mut bits = ScalarVector::new(64);
for bit in 0 .. 64 {
bits[bit] = Scalar::from((value >> bit) & 1);
}
bits
}

View File

@@ -0,0 +1,50 @@
use core::ops::{Index, IndexMut};
use std_shims::vec::Vec;
use zeroize::{Zeroize, ZeroizeOnDrop};
use dalek_ff_group::EdwardsPoint;
#[cfg(test)]
use multiexp::multiexp;
#[cfg(test)]
use crate::ringct::bulletproofs::plus::ScalarVector;
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
pub(crate) struct PointVector(pub(crate) Vec<EdwardsPoint>);
impl Index<usize> for PointVector {
type Output = EdwardsPoint;
fn index(&self, index: usize) -> &EdwardsPoint {
&self.0[index]
}
}
impl IndexMut<usize> for PointVector {
fn index_mut(&mut self, index: usize) -> &mut EdwardsPoint {
&mut self.0[index]
}
}
impl PointVector {
#[cfg(test)]
pub(crate) fn multiexp(&self, vector: &ScalarVector) -> EdwardsPoint {
debug_assert_eq!(self.len(), vector.len());
let mut res = Vec::with_capacity(self.len());
for (point, scalar) in self.0.iter().copied().zip(vector.0.iter().copied()) {
res.push((scalar, point));
}
multiexp(&res)
}
pub(crate) fn len(&self) -> usize {
self.0.len()
}
pub(crate) fn split(mut self) -> (Self, Self) {
debug_assert!(self.len() > 1);
let r = self.0.split_off(self.0.len() / 2);
debug_assert_eq!(self.len(), r.len());
(self, PointVector(r))
}
}

View File

@@ -0,0 +1,24 @@
use std_shims::{sync::OnceLock, vec::Vec};
use dalek_ff_group::{Scalar, EdwardsPoint};
use monero_generators::{hash_to_point as raw_hash_to_point};
use crate::{hash, hash_to_scalar as dalek_hash};
// Monero starts BP+ transcripts with the following constant.
static TRANSCRIPT_CELL: OnceLock<[u8; 32]> = OnceLock::new();
pub(crate) fn TRANSCRIPT() -> [u8; 32] {
// Why this uses a hash_to_point is completely unknown.
*TRANSCRIPT_CELL
.get_or_init(|| raw_hash_to_point(hash(b"bulletproof_plus_transcript")).compress().to_bytes())
}
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
Scalar(dalek_hash(data))
}
pub(crate) fn initial_transcript(commitments: core::slice::Iter<'_, EdwardsPoint>) -> Scalar {
let commitments_hash =
hash_to_scalar(&commitments.flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>());
hash_to_scalar(&[TRANSCRIPT().as_ref(), &commitments_hash.to_bytes()].concat())
}

View File

@@ -0,0 +1,444 @@
use std_shims::vec::Vec;
use rand_core::{RngCore, CryptoRng};
use zeroize::{Zeroize, ZeroizeOnDrop};
use multiexp::{BatchVerifier, multiexp, multiexp_vartime};
use group::{
ff::{Field, PrimeField},
GroupEncoding,
};
use dalek_ff_group::{Scalar, EdwardsPoint};
use crate::ringct::bulletproofs::plus::{
ScalarVector, PointVector, GeneratorsList, Generators, padded_pow_of_2, transcript::*,
};
// Figure 1 of the Bulletproofs+ paper
#[derive(Clone, Debug)]
pub(crate) struct WipStatement {
generators: Generators,
P: EdwardsPoint,
y: ScalarVector,
}
impl Zeroize for WipStatement {
fn zeroize(&mut self) {
self.P.zeroize();
self.y.zeroize();
}
}
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
pub(crate) struct WipWitness {
a: ScalarVector,
b: ScalarVector,
alpha: Scalar,
}
impl WipWitness {
pub(crate) fn new(mut a: ScalarVector, mut b: ScalarVector, alpha: Scalar) -> Option<Self> {
if a.0.is_empty() || (a.len() != b.len()) {
return None;
}
// Pad to the nearest power of 2
let missing = padded_pow_of_2(a.len()) - a.len();
a.0.reserve(missing);
b.0.reserve(missing);
for _ in 0 .. missing {
a.0.push(Scalar::ZERO);
b.0.push(Scalar::ZERO);
}
Some(Self { a, b, alpha })
}
}
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
pub(crate) struct WipProof {
pub(crate) L: Vec<EdwardsPoint>,
pub(crate) R: Vec<EdwardsPoint>,
pub(crate) A: EdwardsPoint,
pub(crate) B: EdwardsPoint,
pub(crate) r_answer: Scalar,
pub(crate) s_answer: Scalar,
pub(crate) delta_answer: Scalar,
}
impl WipStatement {
pub(crate) fn new(generators: Generators, P: EdwardsPoint, y: Scalar) -> Self {
debug_assert_eq!(generators.len(), padded_pow_of_2(generators.len()));
// y ** n
let mut y_vec = ScalarVector::new(generators.len());
y_vec[0] = y;
for i in 1 .. y_vec.len() {
y_vec[i] = y_vec[i - 1] * y;
}
Self { generators, P, y: y_vec }
}
fn transcript_L_R(transcript: &mut Scalar, L: EdwardsPoint, R: EdwardsPoint) -> Scalar {
let e = hash_to_scalar(
&[transcript.to_repr().as_ref(), L.to_bytes().as_ref(), R.to_bytes().as_ref()].concat(),
);
*transcript = e;
e
}
fn transcript_A_B(transcript: &mut Scalar, A: EdwardsPoint, B: EdwardsPoint) -> Scalar {
let e = hash_to_scalar(
&[transcript.to_repr().as_ref(), A.to_bytes().as_ref(), B.to_bytes().as_ref()].concat(),
);
*transcript = e;
e
}
// Prover's variant of the shared code block to calculate G/H/P when n > 1
// Returns each permutation of G/H since the prover needs to do operation on each permutation
// P is dropped as it's unused in the prover's path
// TODO: It'd still probably be faster to keep in terms of the original generators, both between
// the reduced amount of group operations and the potential tabling of the generators under
// multiexp
#[allow(clippy::too_many_arguments)]
fn next_G_H(
transcript: &mut Scalar,
mut g_bold1: PointVector,
mut g_bold2: PointVector,
mut h_bold1: PointVector,
mut h_bold2: PointVector,
L: EdwardsPoint,
R: EdwardsPoint,
y_inv_n_hat: Scalar,
) -> (Scalar, Scalar, Scalar, Scalar, PointVector, PointVector) {
debug_assert_eq!(g_bold1.len(), g_bold2.len());
debug_assert_eq!(h_bold1.len(), h_bold2.len());
debug_assert_eq!(g_bold1.len(), h_bold1.len());
let e = Self::transcript_L_R(transcript, L, R);
let inv_e = e.invert().unwrap();
// This vartime is safe as all of these arguments are public
let mut new_g_bold = Vec::with_capacity(g_bold1.len());
let e_y_inv = e * y_inv_n_hat;
for g_bold in g_bold1.0.drain(..).zip(g_bold2.0.drain(..)) {
new_g_bold.push(multiexp_vartime(&[(inv_e, g_bold.0), (e_y_inv, g_bold.1)]));
}
let mut new_h_bold = Vec::with_capacity(h_bold1.len());
for h_bold in h_bold1.0.drain(..).zip(h_bold2.0.drain(..)) {
new_h_bold.push(multiexp_vartime(&[(e, h_bold.0), (inv_e, h_bold.1)]));
}
let e_square = e.square();
let inv_e_square = inv_e.square();
(e, inv_e, e_square, inv_e_square, PointVector(new_g_bold), PointVector(new_h_bold))
}
/*
This has room for optimization worth investigating further. It currently takes
an iterative approach. It can be optimized further via divide and conquer.
Assume there are 4 challenges.
Iterative approach (current):
1. Do the optimal multiplications across challenge column 0 and 1.
2. Do the optimal multiplications across that result and column 2.
3. Do the optimal multiplications across that result and column 3.
Divide and conquer (worth investigating further):
1. Do the optimal multiplications across challenge column 0 and 1.
2. Do the optimal multiplications across challenge column 2 and 3.
3. Multiply both results together.
When there are 4 challenges (n=16), the iterative approach does 28 multiplications
versus divide and conquer's 24.
*/
fn challenge_products(challenges: &[(Scalar, Scalar)]) -> Vec<Scalar> {
let mut products = vec![Scalar::ONE; 1 << challenges.len()];
if !challenges.is_empty() {
products[0] = challenges[0].1;
products[1] = challenges[0].0;
for (j, challenge) in challenges.iter().enumerate().skip(1) {
let mut slots = (1 << (j + 1)) - 1;
while slots > 0 {
products[slots] = products[slots / 2] * challenge.0;
products[slots - 1] = products[slots / 2] * challenge.1;
slots = slots.saturating_sub(2);
}
}
// Sanity check since if the above failed to populate, it'd be critical
for product in &products {
debug_assert!(!bool::from(product.is_zero()));
}
}
products
}
pub(crate) fn prove<R: RngCore + CryptoRng>(
self,
rng: &mut R,
mut transcript: Scalar,
witness: &WipWitness,
) -> Option<WipProof> {
let WipStatement { generators, P, mut y } = self;
#[cfg(not(debug_assertions))]
let _ = P;
if generators.len() != witness.a.len() {
return None;
}
let (g, h) = (Generators::g(), Generators::h());
let mut g_bold = vec![];
let mut h_bold = vec![];
for i in 0 .. generators.len() {
g_bold.push(generators.generator(GeneratorsList::GBold1, i));
h_bold.push(generators.generator(GeneratorsList::HBold1, i));
}
let mut g_bold = PointVector(g_bold);
let mut h_bold = PointVector(h_bold);
// Check P has the expected relationship
#[cfg(debug_assertions)]
{
let mut P_terms = witness
.a
.0
.iter()
.copied()
.zip(g_bold.0.iter().copied())
.chain(witness.b.0.iter().copied().zip(h_bold.0.iter().copied()))
.collect::<Vec<_>>();
P_terms.push((witness.a.clone().weighted_inner_product(&witness.b, &y), g));
P_terms.push((witness.alpha, h));
debug_assert_eq!(multiexp(&P_terms), P);
P_terms.zeroize();
}
let mut a = witness.a.clone();
let mut b = witness.b.clone();
let mut alpha = witness.alpha;
// From here on, g_bold.len() is used as n
debug_assert_eq!(g_bold.len(), a.len());
let mut L_vec = vec![];
let mut R_vec = vec![];
// else n > 1 case from figure 1
while g_bold.len() > 1 {
let (a1, a2) = a.clone().split();
let (b1, b2) = b.clone().split();
let (g_bold1, g_bold2) = g_bold.split();
let (h_bold1, h_bold2) = h_bold.split();
let n_hat = g_bold1.len();
debug_assert_eq!(a1.len(), n_hat);
debug_assert_eq!(a2.len(), n_hat);
debug_assert_eq!(b1.len(), n_hat);
debug_assert_eq!(b2.len(), n_hat);
debug_assert_eq!(g_bold1.len(), n_hat);
debug_assert_eq!(g_bold2.len(), n_hat);
debug_assert_eq!(h_bold1.len(), n_hat);
debug_assert_eq!(h_bold2.len(), n_hat);
let y_n_hat = y[n_hat - 1];
y.0.truncate(n_hat);
let d_l = Scalar::random(&mut *rng);
let d_r = Scalar::random(&mut *rng);
let c_l = a1.clone().weighted_inner_product(&b2, &y);
let c_r = (a2.clone() * y_n_hat).weighted_inner_product(&b1, &y);
// TODO: Calculate these with a batch inversion
let y_inv_n_hat = y_n_hat.invert().unwrap();
let mut L_terms = (a1.clone() * y_inv_n_hat)
.0
.drain(..)
.zip(g_bold2.0.iter().copied())
.chain(b2.0.iter().copied().zip(h_bold1.0.iter().copied()))
.collect::<Vec<_>>();
L_terms.push((c_l, g));
L_terms.push((d_l, h));
let L = multiexp(&L_terms) * Scalar(crate::INV_EIGHT());
L_vec.push(L);
L_terms.zeroize();
let mut R_terms = (a2.clone() * y_n_hat)
.0
.drain(..)
.zip(g_bold1.0.iter().copied())
.chain(b1.0.iter().copied().zip(h_bold2.0.iter().copied()))
.collect::<Vec<_>>();
R_terms.push((c_r, g));
R_terms.push((d_r, h));
let R = multiexp(&R_terms) * Scalar(crate::INV_EIGHT());
R_vec.push(R);
R_terms.zeroize();
let (e, inv_e, e_square, inv_e_square);
(e, inv_e, e_square, inv_e_square, g_bold, h_bold) =
Self::next_G_H(&mut transcript, g_bold1, g_bold2, h_bold1, h_bold2, L, R, y_inv_n_hat);
a = (a1 * e) + &(a2 * (y_n_hat * inv_e));
b = (b1 * inv_e) + &(b2 * e);
alpha += (d_l * e_square) + (d_r * inv_e_square);
debug_assert_eq!(g_bold.len(), a.len());
debug_assert_eq!(g_bold.len(), h_bold.len());
debug_assert_eq!(g_bold.len(), b.len());
}
// n == 1 case from figure 1
debug_assert_eq!(g_bold.len(), 1);
debug_assert_eq!(h_bold.len(), 1);
debug_assert_eq!(a.len(), 1);
debug_assert_eq!(b.len(), 1);
let r = Scalar::random(&mut *rng);
let s = Scalar::random(&mut *rng);
let delta = Scalar::random(&mut *rng);
let eta = Scalar::random(&mut *rng);
let ry = r * y[0];
let mut A_terms =
vec![(r, g_bold[0]), (s, h_bold[0]), ((ry * b[0]) + (s * y[0] * a[0]), g), (delta, h)];
let A = multiexp(&A_terms) * Scalar(crate::INV_EIGHT());
A_terms.zeroize();
let mut B_terms = vec![(ry * s, g), (eta, h)];
let B = multiexp(&B_terms) * Scalar(crate::INV_EIGHT());
B_terms.zeroize();
let e = Self::transcript_A_B(&mut transcript, A, B);
let r_answer = r + (a[0] * e);
let s_answer = s + (b[0] * e);
let delta_answer = eta + (delta * e) + (alpha * e.square());
Some(WipProof { L: L_vec, R: R_vec, A, B, r_answer, s_answer, delta_answer })
}
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
self,
rng: &mut R,
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
id: Id,
mut transcript: Scalar,
mut proof: WipProof,
) -> bool {
let WipStatement { generators, P, y } = self;
let (g, h) = (Generators::g(), Generators::h());
// Verify the L/R lengths
{
let mut lr_len = 0;
while (1 << lr_len) < generators.len() {
lr_len += 1;
}
if (proof.L.len() != lr_len) ||
(proof.R.len() != lr_len) ||
(generators.len() != (1 << lr_len))
{
return false;
}
}
let inv_y = {
let inv_y = y[0].invert().unwrap();
let mut res = Vec::with_capacity(y.len());
res.push(inv_y);
while res.len() < y.len() {
res.push(inv_y * res.last().unwrap());
}
res
};
let mut P_terms = vec![(Scalar::ONE, P)];
P_terms.reserve(6 + (2 * generators.len()) + proof.L.len());
let mut challenges = Vec::with_capacity(proof.L.len());
let product_cache = {
let mut es = Vec::with_capacity(proof.L.len());
for (L, R) in proof.L.iter_mut().zip(proof.R.iter_mut()) {
es.push(Self::transcript_L_R(&mut transcript, *L, *R));
*L = L.mul_by_cofactor();
*R = R.mul_by_cofactor();
}
let mut inv_es = es.clone();
let mut scratch = vec![Scalar::ZERO; es.len()];
group::ff::BatchInverter::invert_with_external_scratch(&mut inv_es, &mut scratch);
drop(scratch);
debug_assert_eq!(es.len(), inv_es.len());
debug_assert_eq!(es.len(), proof.L.len());
debug_assert_eq!(es.len(), proof.R.len());
for ((e, inv_e), (L, R)) in
es.drain(..).zip(inv_es.drain(..)).zip(proof.L.iter().zip(proof.R.iter()))
{
debug_assert_eq!(e.invert().unwrap(), inv_e);
challenges.push((e, inv_e));
let e_square = e.square();
let inv_e_square = inv_e.square();
P_terms.push((e_square, *L));
P_terms.push((inv_e_square, *R));
}
Self::challenge_products(&challenges)
};
let e = Self::transcript_A_B(&mut transcript, proof.A, proof.B);
proof.A = proof.A.mul_by_cofactor();
proof.B = proof.B.mul_by_cofactor();
let neg_e_square = -e.square();
let mut multiexp = P_terms;
multiexp.reserve(4 + (2 * generators.len()));
for (scalar, _) in &mut multiexp {
*scalar *= neg_e_square;
}
let re = proof.r_answer * e;
for i in 0 .. generators.len() {
let mut scalar = product_cache[i] * re;
if i > 0 {
scalar *= inv_y[i - 1];
}
multiexp.push((scalar, generators.generator(GeneratorsList::GBold1, i)));
}
let se = proof.s_answer * e;
for i in 0 .. generators.len() {
multiexp.push((
se * product_cache[product_cache.len() - 1 - i],
generators.generator(GeneratorsList::HBold1, i),
));
}
multiexp.push((-e, proof.A));
multiexp.push((proof.r_answer * y[0] * proof.s_answer, g));
multiexp.push((proof.delta_answer, h));
multiexp.push((-Scalar::ONE, proof.B));
verifier.queue(rng, id, multiexp);
true
}
}

Some files were not shown because too many files have changed in this diff Show More