mirror of
https://github.com/serai-dex/serai.git
synced 2025-12-12 14:09:25 +00:00
Compare commits
13 Commits
develop
...
20cf4c930c
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
20cf4c930c | ||
|
|
7ecbfde936 | ||
|
|
926ddd09db | ||
|
|
826f9986e4 | ||
|
|
7041dbeb0b | ||
|
|
df774d153c | ||
|
|
8be0538eba | ||
|
|
c32040240c | ||
|
|
207f2bd28a | ||
|
|
2b32fe90ca | ||
|
|
b9df73e418 | ||
|
|
da51543588 | ||
|
|
c1bcb0f6c7 |
4
.github/actions/bitcoin/action.yml
vendored
4
.github/actions/bitcoin/action.yml
vendored
@@ -12,7 +12,7 @@ runs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Bitcoin Daemon Cache
|
- name: Bitcoin Daemon Cache
|
||||||
id: cache-bitcoind
|
id: cache-bitcoind
|
||||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||||
with:
|
with:
|
||||||
path: bitcoin.tar.gz
|
path: bitcoin.tar.gz
|
||||||
key: bitcoind-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
key: bitcoind-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
||||||
@@ -37,4 +37,4 @@ runs:
|
|||||||
|
|
||||||
- name: Bitcoin Regtest Daemon
|
- name: Bitcoin Regtest Daemon
|
||||||
shell: bash
|
shell: bash
|
||||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/bitcoin/run.sh -daemon
|
run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/bitcoin/run.sh -daemon
|
||||||
|
|||||||
54
.github/actions/build-dependencies/action.yml
vendored
54
.github/actions/build-dependencies/action.yml
vendored
@@ -7,20 +7,13 @@ runs:
|
|||||||
- name: Remove unused packages
|
- name: Remove unused packages
|
||||||
shell: bash
|
shell: bash
|
||||||
run: |
|
run: |
|
||||||
# Ensure the repositories are synced
|
sudo apt remove -y "*msbuild*" "*powershell*" "*nuget*" "*bazel*" "*ansible*" "*terraform*" "*heroku*" "*aws*" azure-cli
|
||||||
sudo apt update -y
|
|
||||||
|
|
||||||
# Actually perform the removals
|
|
||||||
sudo apt remove -y "*powershell*" "*nuget*" "*bazel*" "*ansible*" "*terraform*" "*heroku*" "*aws*" azure-cli
|
|
||||||
sudo apt remove -y "*nodejs*" "*npm*" "*yarn*" "*java*" "*kotlin*" "*golang*" "*swift*" "*julia*" "*fortran*" "*android*"
|
sudo apt remove -y "*nodejs*" "*npm*" "*yarn*" "*java*" "*kotlin*" "*golang*" "*swift*" "*julia*" "*fortran*" "*android*"
|
||||||
sudo apt remove -y "*apache2*" "*nginx*" "*firefox*" "*chromium*" "*chrome*" "*edge*"
|
sudo apt remove -y "*apache2*" "*nginx*" "*firefox*" "*chromium*" "*chrome*" "*edge*"
|
||||||
|
|
||||||
sudo apt remove -y --allow-remove-essential -f shim-signed *python3*
|
|
||||||
# This removal command requires the prior removals due to unmet dependencies otherwise
|
|
||||||
sudo apt remove -y "*qemu*" "*sql*" "*texinfo*" "*imagemagick*"
|
sudo apt remove -y "*qemu*" "*sql*" "*texinfo*" "*imagemagick*"
|
||||||
|
sudo apt autoremove -y
|
||||||
# Reinstall python3 as a general dependency of a functional operating system
|
sudo apt clean
|
||||||
sudo apt install -y python3 --fix-missing
|
docker system prune -a --volumes
|
||||||
if: runner.os == 'Linux'
|
if: runner.os == 'Linux'
|
||||||
|
|
||||||
- name: Remove unused packages
|
- name: Remove unused packages
|
||||||
@@ -38,48 +31,19 @@ runs:
|
|||||||
shell: bash
|
shell: bash
|
||||||
run: |
|
run: |
|
||||||
if [ "$RUNNER_OS" == "Linux" ]; then
|
if [ "$RUNNER_OS" == "Linux" ]; then
|
||||||
sudo apt install -y ca-certificates protobuf-compiler libclang-dev
|
sudo apt install -y ca-certificates protobuf-compiler
|
||||||
elif [ "$RUNNER_OS" == "Windows" ]; then
|
elif [ "$RUNNER_OS" == "Windows" ]; then
|
||||||
choco install protoc
|
choco install protoc
|
||||||
elif [ "$RUNNER_OS" == "macOS" ]; then
|
elif [ "$RUNNER_OS" == "macOS" ]; then
|
||||||
brew install protobuf llvm
|
brew install protobuf
|
||||||
HOMEBREW_ROOT_PATH=/opt/homebrew # Apple Silicon
|
|
||||||
if [ $(uname -m) = "x86_64" ]; then HOMEBREW_ROOT_PATH=/usr/local; fi # Intel
|
|
||||||
ls $HOMEBREW_ROOT_PATH/opt/llvm/lib | grep "libclang.dylib" # Make sure this installed `libclang`
|
|
||||||
echo "DYLD_LIBRARY_PATH=$HOMEBREW_ROOT_PATH/opt/llvm/lib:$DYLD_LIBRARY_PATH" >> "$GITHUB_ENV"
|
|
||||||
fi
|
fi
|
||||||
|
|
||||||
- name: Install solc
|
- name: Install solc
|
||||||
shell: bash
|
shell: bash
|
||||||
run: |
|
run: |
|
||||||
cargo +1.89 install svm-rs --version =0.5.18
|
cargo install svm-rs
|
||||||
svm install 0.8.26
|
svm install 0.8.25
|
||||||
svm use 0.8.26
|
svm use 0.8.25
|
||||||
|
|
||||||
- name: Remove preinstalled Docker
|
|
||||||
shell: bash
|
|
||||||
run: |
|
|
||||||
docker system prune -a --volumes
|
|
||||||
sudo apt remove -y *docker*
|
|
||||||
# Install uidmap which will be required for the explicitly installed Docker
|
|
||||||
sudo apt install uidmap
|
|
||||||
if: runner.os == 'Linux'
|
|
||||||
|
|
||||||
- name: Update system dependencies
|
|
||||||
shell: bash
|
|
||||||
run: |
|
|
||||||
sudo apt update -y
|
|
||||||
sudo apt upgrade -y
|
|
||||||
sudo apt autoremove -y
|
|
||||||
sudo apt clean
|
|
||||||
if: runner.os == 'Linux'
|
|
||||||
|
|
||||||
- name: Install rootless Docker
|
|
||||||
uses: docker/setup-docker-action@b60f85385d03ac8acfca6d9996982511d8620a19
|
|
||||||
with:
|
|
||||||
rootless: true
|
|
||||||
set-host: true
|
|
||||||
if: runner.os == 'Linux'
|
|
||||||
|
|
||||||
# - name: Cache Rust
|
# - name: Cache Rust
|
||||||
# uses: Swatinem/rust-cache@a95ba195448af2da9b00fb742d14ffaaf3c21f43
|
# uses: Swatinem/rust-cache@a95ba195448af2da9b00fb742d14ffaaf3c21f43
|
||||||
|
|||||||
4
.github/actions/monero-wallet-rpc/action.yml
vendored
4
.github/actions/monero-wallet-rpc/action.yml
vendored
@@ -5,14 +5,14 @@ inputs:
|
|||||||
version:
|
version:
|
||||||
description: "Version to download and run"
|
description: "Version to download and run"
|
||||||
required: false
|
required: false
|
||||||
default: v0.18.3.4
|
default: v0.18.3.1
|
||||||
|
|
||||||
runs:
|
runs:
|
||||||
using: "composite"
|
using: "composite"
|
||||||
steps:
|
steps:
|
||||||
- name: Monero Wallet RPC Cache
|
- name: Monero Wallet RPC Cache
|
||||||
id: cache-monero-wallet-rpc
|
id: cache-monero-wallet-rpc
|
||||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||||
with:
|
with:
|
||||||
path: monero-wallet-rpc
|
path: monero-wallet-rpc
|
||||||
key: monero-wallet-rpc-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
key: monero-wallet-rpc-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
||||||
|
|||||||
6
.github/actions/monero/action.yml
vendored
6
.github/actions/monero/action.yml
vendored
@@ -5,14 +5,14 @@ inputs:
|
|||||||
version:
|
version:
|
||||||
description: "Version to download and run"
|
description: "Version to download and run"
|
||||||
required: false
|
required: false
|
||||||
default: v0.18.3.4
|
default: v0.18.3.1
|
||||||
|
|
||||||
runs:
|
runs:
|
||||||
using: "composite"
|
using: "composite"
|
||||||
steps:
|
steps:
|
||||||
- name: Monero Daemon Cache
|
- name: Monero Daemon Cache
|
||||||
id: cache-monerod
|
id: cache-monerod
|
||||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||||
with:
|
with:
|
||||||
path: /usr/bin/monerod
|
path: /usr/bin/monerod
|
||||||
key: monerod-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
key: monerod-${{ runner.os }}-${{ runner.arch }}-${{ inputs.version }}
|
||||||
@@ -43,4 +43,4 @@ runs:
|
|||||||
|
|
||||||
- name: Monero Regtest Daemon
|
- name: Monero Regtest Daemon
|
||||||
shell: bash
|
shell: bash
|
||||||
run: PATH=$PATH:/usr/bin ./orchestration/dev/networks/monero/run.sh --detach
|
run: PATH=$PATH:/usr/bin ./orchestration/dev/coins/monero/run.sh --detach
|
||||||
|
|||||||
4
.github/actions/test-dependencies/action.yml
vendored
4
.github/actions/test-dependencies/action.yml
vendored
@@ -5,12 +5,12 @@ inputs:
|
|||||||
monero-version:
|
monero-version:
|
||||||
description: "Monero version to download and run as a regtest node"
|
description: "Monero version to download and run as a regtest node"
|
||||||
required: false
|
required: false
|
||||||
default: v0.18.3.4
|
default: v0.18.3.1
|
||||||
|
|
||||||
bitcoin-version:
|
bitcoin-version:
|
||||||
description: "Bitcoin version to download and run as a regtest node"
|
description: "Bitcoin version to download and run as a regtest node"
|
||||||
required: false
|
required: false
|
||||||
default: "27.1"
|
default: "27.0"
|
||||||
|
|
||||||
runs:
|
runs:
|
||||||
using: "composite"
|
using: "composite"
|
||||||
|
|||||||
2
.github/nightly-version
vendored
2
.github/nightly-version
vendored
@@ -1 +1 @@
|
|||||||
nightly-2025-11-01
|
nightly-2024-04-23
|
||||||
|
|||||||
@@ -1,4 +1,4 @@
|
|||||||
name: networks/ Tests
|
name: coins/ Tests
|
||||||
|
|
||||||
on:
|
on:
|
||||||
push:
|
push:
|
||||||
@@ -7,18 +7,18 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
|
|
||||||
pull_request:
|
pull_request:
|
||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
|
|
||||||
workflow_dispatch:
|
workflow_dispatch:
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
test-networks:
|
test-coins:
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
@@ -32,4 +32,5 @@ jobs:
|
|||||||
-p bitcoin-serai \
|
-p bitcoin-serai \
|
||||||
-p alloy-simple-request-transport \
|
-p alloy-simple-request-transport \
|
||||||
-p ethereum-serai \
|
-p ethereum-serai \
|
||||||
-p serai-ethereum-relayer \
|
-p monero-generators \
|
||||||
|
-p monero-serai
|
||||||
1
.github/workflows/common-tests.yml
vendored
1
.github/workflows/common-tests.yml
vendored
@@ -27,7 +27,6 @@ jobs:
|
|||||||
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features \
|
||||||
-p std-shims \
|
-p std-shims \
|
||||||
-p zalloc \
|
-p zalloc \
|
||||||
-p patchable-async-sleep \
|
|
||||||
-p serai-db \
|
-p serai-db \
|
||||||
-p serai-env \
|
-p serai-env \
|
||||||
-p simple-request
|
-p simple-request
|
||||||
|
|||||||
6
.github/workflows/coordinator-tests.yml
vendored
6
.github/workflows/coordinator-tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -18,7 +18,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -37,4 +37,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run coordinator Docker tests
|
- name: Run coordinator Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-coordinator-tests
|
run: cd tests/coordinator && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
6
.github/workflows/crypto-tests.yml
vendored
6
.github/workflows/crypto-tests.yml
vendored
@@ -32,15 +32,9 @@ jobs:
|
|||||||
-p dalek-ff-group \
|
-p dalek-ff-group \
|
||||||
-p minimal-ed448 \
|
-p minimal-ed448 \
|
||||||
-p ciphersuite \
|
-p ciphersuite \
|
||||||
-p ciphersuite-kp256 \
|
|
||||||
-p multiexp \
|
-p multiexp \
|
||||||
-p schnorr-signatures \
|
-p schnorr-signatures \
|
||||||
-p dleq \
|
-p dleq \
|
||||||
-p dkg \
|
-p dkg \
|
||||||
-p dkg-recovery \
|
|
||||||
-p dkg-dealer \
|
|
||||||
-p dkg-promote \
|
|
||||||
-p dkg-musig \
|
|
||||||
-p dkg-pedpop \
|
|
||||||
-p modular-frost \
|
-p modular-frost \
|
||||||
-p frost-schnorrkel
|
-p frost-schnorrkel
|
||||||
|
|||||||
6
.github/workflows/daily-deny.yml
vendored
6
.github/workflows/daily-deny.yml
vendored
@@ -12,13 +12,13 @@ jobs:
|
|||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
|
|
||||||
- name: Advisory Cache
|
- name: Advisory Cache
|
||||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||||
with:
|
with:
|
||||||
path: ~/.cargo/advisory-db
|
path: ~/.cargo/advisory-db
|
||||||
key: rust-advisory-db
|
key: rust-advisory-db
|
||||||
|
|
||||||
- name: Install cargo deny
|
- name: Install cargo deny
|
||||||
run: cargo +1.89 install cargo-deny --version =0.18.3
|
run: cargo install --locked cargo-deny
|
||||||
|
|
||||||
- name: Run cargo deny
|
- name: Run cargo deny
|
||||||
run: cargo deny -L error --all-features check --hide-inclusion-graph
|
run: cargo deny -L error --all-features check
|
||||||
|
|||||||
2
.github/workflows/full-stack-tests.yml
vendored
2
.github/workflows/full-stack-tests.yml
vendored
@@ -19,4 +19,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run Full Stack Docker tests
|
- name: Run Full Stack Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-full-stack-tests
|
run: cd tests/full-stack && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
14
.github/workflows/lint.yml
vendored
14
.github/workflows/lint.yml
vendored
@@ -11,7 +11,7 @@ jobs:
|
|||||||
clippy:
|
clippy:
|
||||||
strategy:
|
strategy:
|
||||||
matrix:
|
matrix:
|
||||||
os: [ubuntu-latest, macos-15-intel, macos-latest, windows-latest]
|
os: [ubuntu-latest, macos-13, macos-14, windows-latest]
|
||||||
runs-on: ${{ matrix.os }}
|
runs-on: ${{ matrix.os }}
|
||||||
|
|
||||||
steps:
|
steps:
|
||||||
@@ -26,7 +26,7 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Install nightly rust
|
- name: Install nightly rust
|
||||||
run: rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32v1-none -c rust-src -c clippy
|
run: rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32-unknown-unknown -c clippy
|
||||||
|
|
||||||
- name: Run Clippy
|
- name: Run Clippy
|
||||||
run: cargo +${{ steps.nightly.outputs.version }} clippy --all-features --all-targets -- -D warnings -A clippy::items_after_test_module
|
run: cargo +${{ steps.nightly.outputs.version }} clippy --all-features --all-targets -- -D warnings -A clippy::items_after_test_module
|
||||||
@@ -46,16 +46,16 @@ jobs:
|
|||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
|
|
||||||
- name: Advisory Cache
|
- name: Advisory Cache
|
||||||
uses: actions/cache@0400d5f644dc74513175e3cd8d07132dd4860809
|
uses: actions/cache@13aacd865c20de90d75de3b17ebe84f7a17d57d2
|
||||||
with:
|
with:
|
||||||
path: ~/.cargo/advisory-db
|
path: ~/.cargo/advisory-db
|
||||||
key: rust-advisory-db
|
key: rust-advisory-db
|
||||||
|
|
||||||
- name: Install cargo deny
|
- name: Install cargo deny
|
||||||
run: cargo +1.89 install cargo-deny --version =0.18.4
|
run: cargo install --locked cargo-deny
|
||||||
|
|
||||||
- name: Run cargo deny
|
- name: Run cargo deny
|
||||||
run: cargo deny -L error --all-features check --hide-inclusion-graph
|
run: cargo deny -L error --all-features check
|
||||||
|
|
||||||
fmt:
|
fmt:
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
@@ -79,5 +79,5 @@ jobs:
|
|||||||
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
- name: Verify all dependencies are in use
|
- name: Verify all dependencies are in use
|
||||||
run: |
|
run: |
|
||||||
cargo +1.89 install cargo-machete --version =0.8.0
|
cargo install cargo-machete
|
||||||
cargo +1.89 machete
|
cargo machete
|
||||||
|
|||||||
2
.github/workflows/message-queue-tests.yml
vendored
2
.github/workflows/message-queue-tests.yml
vendored
@@ -33,4 +33,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run message-queue Docker tests
|
- name: Run message-queue Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-message-queue-tests
|
run: cd tests/message-queue && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
56
.github/workflows/monero-tests.yaml
vendored
Normal file
56
.github/workflows/monero-tests.yaml
vendored
Normal file
@@ -0,0 +1,56 @@
|
|||||||
|
name: Monero Tests
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- develop
|
||||||
|
paths:
|
||||||
|
- "coins/monero/**"
|
||||||
|
- "processor/**"
|
||||||
|
|
||||||
|
pull_request:
|
||||||
|
paths:
|
||||||
|
- "coins/monero/**"
|
||||||
|
- "processor/**"
|
||||||
|
|
||||||
|
workflow_dispatch:
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
# Only run these once since they will be consistent regardless of any node
|
||||||
|
unit-tests:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
|
|
||||||
|
- name: Test Dependencies
|
||||||
|
uses: ./.github/actions/test-dependencies
|
||||||
|
|
||||||
|
- name: Run Unit Tests Without Features
|
||||||
|
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --lib
|
||||||
|
|
||||||
|
# Doesn't run unit tests with features as the tests workflow will
|
||||||
|
|
||||||
|
integration-tests:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
# Test against all supported protocol versions
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
version: [v0.17.3.2, v0.18.2.0]
|
||||||
|
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
||||||
|
|
||||||
|
- name: Test Dependencies
|
||||||
|
uses: ./.github/actions/test-dependencies
|
||||||
|
with:
|
||||||
|
monero-version: ${{ matrix.version }}
|
||||||
|
|
||||||
|
- name: Run Integration Tests Without Features
|
||||||
|
# Runs with the binaries feature so the binaries build
|
||||||
|
# https://github.com/rust-lang/cargo/issues/8396
|
||||||
|
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --features binaries --test '*'
|
||||||
|
|
||||||
|
- name: Run Integration Tests
|
||||||
|
# Don't run if the the tests workflow also will
|
||||||
|
if: ${{ matrix.version != 'v0.18.2.0' }}
|
||||||
|
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --package monero-serai --all-features --test '*'
|
||||||
6
.github/workflows/no-std.yml
vendored
6
.github/workflows/no-std.yml
vendored
@@ -7,14 +7,14 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "tests/no-std/**"
|
- "tests/no-std/**"
|
||||||
|
|
||||||
pull_request:
|
pull_request:
|
||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "tests/no-std/**"
|
- "tests/no-std/**"
|
||||||
|
|
||||||
workflow_dispatch:
|
workflow_dispatch:
|
||||||
@@ -32,4 +32,4 @@ jobs:
|
|||||||
run: sudo apt update && sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib && rustup target add riscv32imac-unknown-none-elf
|
run: sudo apt update && sudo apt install -y gcc-riscv64-unknown-elf gcc-multilib && rustup target add riscv32imac-unknown-none-elf
|
||||||
|
|
||||||
- name: Verify no-std builds
|
- name: Verify no-std builds
|
||||||
run: CFLAGS=-I/usr/include cargo build --target riscv32imac-unknown-none-elf -p serai-no-std-tests
|
run: cd tests/no-std && CFLAGS=-I/usr/include cargo build --target riscv32imac-unknown-none-elf
|
||||||
|
|||||||
43
.github/workflows/pages.yml
vendored
43
.github/workflows/pages.yml
vendored
@@ -1,7 +1,6 @@
|
|||||||
# MIT License
|
# MIT License
|
||||||
#
|
#
|
||||||
# Copyright (c) 2022 just-the-docs
|
# Copyright (c) 2022 just-the-docs
|
||||||
# Copyright (c) 2022-2024 Luke Parker
|
|
||||||
#
|
#
|
||||||
# Permission is hereby granted, free of charge, to any person obtaining a copy
|
# Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
# of this software and associated documentation files (the "Software"), to deal
|
# of this software and associated documentation files (the "Software"), to deal
|
||||||
@@ -21,21 +20,31 @@
|
|||||||
# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||||
# SOFTWARE.
|
# SOFTWARE.
|
||||||
|
|
||||||
name: Deploy Rust docs and Jekyll site to Pages
|
# This workflow uses actions that are not certified by GitHub.
|
||||||
|
# They are provided by a third-party and are governed by
|
||||||
|
# separate terms of service, privacy policy, and support
|
||||||
|
# documentation.
|
||||||
|
|
||||||
|
# Sample workflow for building and deploying a Jekyll site to GitHub Pages
|
||||||
|
name: Deploy Jekyll site to Pages
|
||||||
|
|
||||||
on:
|
on:
|
||||||
push:
|
push:
|
||||||
branches:
|
branches:
|
||||||
- "develop"
|
- "develop"
|
||||||
|
paths:
|
||||||
|
- "docs/**"
|
||||||
|
|
||||||
|
# Allows you to run this workflow manually from the Actions tab
|
||||||
workflow_dispatch:
|
workflow_dispatch:
|
||||||
|
|
||||||
|
# Sets permissions of the GITHUB_TOKEN to allow deployment to GitHub Pages
|
||||||
permissions:
|
permissions:
|
||||||
contents: read
|
contents: read
|
||||||
pages: write
|
pages: write
|
||||||
id-token: write
|
id-token: write
|
||||||
|
|
||||||
# Only allow one concurrent deployment
|
# Allow one concurrent deployment
|
||||||
concurrency:
|
concurrency:
|
||||||
group: "pages"
|
group: "pages"
|
||||||
cancel-in-progress: true
|
cancel-in-progress: true
|
||||||
@@ -44,37 +53,27 @@ jobs:
|
|||||||
# Build job
|
# Build job
|
||||||
build:
|
build:
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
|
defaults:
|
||||||
|
run:
|
||||||
|
working-directory: docs
|
||||||
steps:
|
steps:
|
||||||
- name: Checkout
|
- name: Checkout
|
||||||
uses: actions/checkout@3df4ab11eba7bda6032a0b82a6bb43b11571feac
|
uses: actions/checkout@v3
|
||||||
- name: Setup Ruby
|
- name: Setup Ruby
|
||||||
uses: ruby/setup-ruby@44511735964dcb71245e7e55f72539531f7bc0eb
|
uses: ruby/setup-ruby@v1
|
||||||
with:
|
with:
|
||||||
bundler-cache: true
|
bundler-cache: true
|
||||||
cache-version: 0
|
cache-version: 0
|
||||||
working-directory: "${{ github.workspace }}/docs"
|
working-directory: "${{ github.workspace }}/docs"
|
||||||
- name: Setup Pages
|
- name: Setup Pages
|
||||||
id: pages
|
id: pages
|
||||||
uses: actions/configure-pages@983d7736d9b0ae728b81ab479565c72886d7745b
|
uses: actions/configure-pages@v3
|
||||||
- name: Build with Jekyll
|
- name: Build with Jekyll
|
||||||
run: cd ${{ github.workspace }}/docs && bundle exec jekyll build --baseurl "${{ steps.pages.outputs.base_path }}"
|
run: bundle exec jekyll build --baseurl "${{ steps.pages.outputs.base_path }}"
|
||||||
env:
|
env:
|
||||||
JEKYLL_ENV: production
|
JEKYLL_ENV: production
|
||||||
|
|
||||||
- name: Get nightly version to use
|
|
||||||
id: nightly
|
|
||||||
shell: bash
|
|
||||||
run: echo "version=$(cat .github/nightly-version)" >> $GITHUB_OUTPUT
|
|
||||||
- name: Build Dependencies
|
|
||||||
uses: ./.github/actions/build-dependencies
|
|
||||||
- name: Buld Rust docs
|
|
||||||
run: |
|
|
||||||
rustup toolchain install ${{ steps.nightly.outputs.version }} --profile minimal -t wasm32v1-none -c rust-docs
|
|
||||||
RUSTDOCFLAGS="--cfg docsrs" cargo +${{ steps.nightly.outputs.version }} doc --workspace --no-deps --all-features
|
|
||||||
mv target/doc docs/_site/rust
|
|
||||||
|
|
||||||
- name: Upload artifact
|
- name: Upload artifact
|
||||||
uses: actions/upload-pages-artifact@7b1f4a764d45c48632c6b24a0339c27f5614fb0b
|
uses: actions/upload-pages-artifact@v1
|
||||||
with:
|
with:
|
||||||
path: "docs/_site/"
|
path: "docs/_site/"
|
||||||
|
|
||||||
@@ -88,4 +87,4 @@ jobs:
|
|||||||
steps:
|
steps:
|
||||||
- name: Deploy to GitHub Pages
|
- name: Deploy to GitHub Pages
|
||||||
id: deployment
|
id: deployment
|
||||||
uses: actions/deploy-pages@d6db90164ac5ed86f2b6aed7e0febac5b3c0c03e
|
uses: actions/deploy-pages@v2
|
||||||
|
|||||||
6
.github/workflows/processor-tests.yml
vendored
6
.github/workflows/processor-tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -18,7 +18,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "orchestration/**"
|
- "orchestration/**"
|
||||||
@@ -37,4 +37,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run processor Docker tests
|
- name: Run processor Docker tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-processor-tests
|
run: cd tests/processor && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
2
.github/workflows/reproducible-runtime.yml
vendored
2
.github/workflows/reproducible-runtime.yml
vendored
@@ -33,4 +33,4 @@ jobs:
|
|||||||
uses: ./.github/actions/build-dependencies
|
uses: ./.github/actions/build-dependencies
|
||||||
|
|
||||||
- name: Run Reproducible Runtime tests
|
- name: Run Reproducible Runtime tests
|
||||||
run: GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features -p serai-reproducible-runtime-tests
|
run: cd tests/reproducible-runtime && GITHUB_CI=true RUST_BACKTRACE=1 cargo test --all-features
|
||||||
|
|||||||
9
.github/workflows/tests.yml
vendored
9
.github/workflows/tests.yml
vendored
@@ -7,7 +7,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
@@ -17,7 +17,7 @@ on:
|
|||||||
paths:
|
paths:
|
||||||
- "common/**"
|
- "common/**"
|
||||||
- "crypto/**"
|
- "crypto/**"
|
||||||
- "networks/**"
|
- "coins/**"
|
||||||
- "message-queue/**"
|
- "message-queue/**"
|
||||||
- "processor/**"
|
- "processor/**"
|
||||||
- "coordinator/**"
|
- "coordinator/**"
|
||||||
@@ -63,11 +63,6 @@ jobs:
|
|||||||
-p serai-dex-pallet \
|
-p serai-dex-pallet \
|
||||||
-p serai-validator-sets-primitives \
|
-p serai-validator-sets-primitives \
|
||||||
-p serai-validator-sets-pallet \
|
-p serai-validator-sets-pallet \
|
||||||
-p serai-genesis-liquidity-primitives \
|
|
||||||
-p serai-genesis-liquidity-pallet \
|
|
||||||
-p serai-emissions-primitives \
|
|
||||||
-p serai-emissions-pallet \
|
|
||||||
-p serai-economic-security-pallet \
|
|
||||||
-p serai-in-instructions-primitives \
|
-p serai-in-instructions-primitives \
|
||||||
-p serai-in-instructions-pallet \
|
-p serai-in-instructions-pallet \
|
||||||
-p serai-signals-primitives \
|
-p serai-signals-primitives \
|
||||||
|
|||||||
7
.gitignore
vendored
7
.gitignore
vendored
@@ -1,14 +1,7 @@
|
|||||||
target
|
target
|
||||||
|
|
||||||
# Don't commit any `Cargo.lock` which aren't the workspace's
|
|
||||||
Cargo.lock
|
|
||||||
!./Cargo.lock
|
|
||||||
|
|
||||||
# Don't commit any `Dockerfile`, as they're auto-generated, except the only one which isn't
|
|
||||||
Dockerfile
|
Dockerfile
|
||||||
Dockerfile.fast-epoch
|
Dockerfile.fast-epoch
|
||||||
!orchestration/runtime/Dockerfile
|
!orchestration/runtime/Dockerfile
|
||||||
|
|
||||||
.test-logs
|
.test-logs
|
||||||
|
|
||||||
.vscode
|
.vscode
|
||||||
|
|||||||
7379
Cargo.lock
generated
7379
Cargo.lock
generated
File diff suppressed because it is too large
Load Diff
90
Cargo.toml
90
Cargo.toml
@@ -1,8 +1,14 @@
|
|||||||
[workspace]
|
[workspace]
|
||||||
resolver = "2"
|
resolver = "2"
|
||||||
members = [
|
members = [
|
||||||
|
# Version patches
|
||||||
|
"patches/zstd",
|
||||||
|
"patches/rocksdb",
|
||||||
|
"patches/proc-macro-crate",
|
||||||
|
|
||||||
# std patches
|
# std patches
|
||||||
"patches/matches",
|
"patches/matches",
|
||||||
|
"patches/is-terminal",
|
||||||
|
|
||||||
# Rewrites/redirects
|
# Rewrites/redirects
|
||||||
"patches/option-ext",
|
"patches/option-ext",
|
||||||
@@ -10,7 +16,6 @@ members = [
|
|||||||
|
|
||||||
"common/std-shims",
|
"common/std-shims",
|
||||||
"common/zalloc",
|
"common/zalloc",
|
||||||
"common/patchable-async-sleep",
|
|
||||||
"common/db",
|
"common/db",
|
||||||
"common/env",
|
"common/env",
|
||||||
"common/request",
|
"common/request",
|
||||||
@@ -21,26 +26,20 @@ members = [
|
|||||||
"crypto/dalek-ff-group",
|
"crypto/dalek-ff-group",
|
||||||
"crypto/ed448",
|
"crypto/ed448",
|
||||||
"crypto/ciphersuite",
|
"crypto/ciphersuite",
|
||||||
"crypto/ciphersuite/kp256",
|
|
||||||
|
|
||||||
"crypto/multiexp",
|
"crypto/multiexp",
|
||||||
|
|
||||||
"crypto/schnorr",
|
"crypto/schnorr",
|
||||||
"crypto/dleq",
|
"crypto/dleq",
|
||||||
"crypto/dkg",
|
"crypto/dkg",
|
||||||
"crypto/dkg/recovery",
|
|
||||||
"crypto/dkg/dealer",
|
|
||||||
"crypto/dkg/promote",
|
|
||||||
"crypto/dkg/musig",
|
|
||||||
"crypto/dkg/pedpop",
|
|
||||||
"crypto/frost",
|
"crypto/frost",
|
||||||
"crypto/schnorrkel",
|
"crypto/schnorrkel",
|
||||||
|
|
||||||
"networks/bitcoin",
|
"coins/bitcoin",
|
||||||
|
"coins/ethereum/alloy-simple-request-transport",
|
||||||
"networks/ethereum/alloy-simple-request-transport",
|
"coins/ethereum",
|
||||||
"networks/ethereum",
|
"coins/monero/generators",
|
||||||
"networks/ethereum/relayer",
|
"coins/monero",
|
||||||
|
|
||||||
"message-queue",
|
"message-queue",
|
||||||
|
|
||||||
@@ -56,22 +55,12 @@ members = [
|
|||||||
"substrate/coins/primitives",
|
"substrate/coins/primitives",
|
||||||
"substrate/coins/pallet",
|
"substrate/coins/pallet",
|
||||||
|
|
||||||
"substrate/dex/pallet",
|
"substrate/in-instructions/primitives",
|
||||||
|
"substrate/in-instructions/pallet",
|
||||||
|
|
||||||
"substrate/validator-sets/primitives",
|
"substrate/validator-sets/primitives",
|
||||||
"substrate/validator-sets/pallet",
|
"substrate/validator-sets/pallet",
|
||||||
|
|
||||||
"substrate/genesis-liquidity/primitives",
|
|
||||||
"substrate/genesis-liquidity/pallet",
|
|
||||||
|
|
||||||
"substrate/emissions/primitives",
|
|
||||||
"substrate/emissions/pallet",
|
|
||||||
|
|
||||||
"substrate/economic-security/pallet",
|
|
||||||
|
|
||||||
"substrate/in-instructions/primitives",
|
|
||||||
"substrate/in-instructions/pallet",
|
|
||||||
|
|
||||||
"substrate/signals/primitives",
|
"substrate/signals/primitives",
|
||||||
"substrate/signals/pallet",
|
"substrate/signals/pallet",
|
||||||
|
|
||||||
@@ -111,26 +100,29 @@ minimal-ed448 = { opt-level = 3 }
|
|||||||
|
|
||||||
multiexp = { opt-level = 3 }
|
multiexp = { opt-level = 3 }
|
||||||
|
|
||||||
monero-oxide = { opt-level = 3 }
|
monero-serai = { opt-level = 3 }
|
||||||
|
|
||||||
[profile.release]
|
[profile.release]
|
||||||
panic = "unwind"
|
panic = "unwind"
|
||||||
overflow-checks = true
|
|
||||||
|
|
||||||
[patch.crates-io]
|
[patch.crates-io]
|
||||||
# Dependencies from monero-oxide which originate from within our own tree
|
|
||||||
std-shims = { path = "common/std-shims" }
|
|
||||||
simple-request = { path = "common/request" }
|
|
||||||
dalek-ff-group = { path = "crypto/dalek-ff-group" }
|
|
||||||
flexible-transcript = { path = "crypto/transcript" }
|
|
||||||
modular-frost = { path = "crypto/frost" }
|
|
||||||
|
|
||||||
# https://github.com/rust-lang-nursery/lazy-static.rs/issues/201
|
# https://github.com/rust-lang-nursery/lazy-static.rs/issues/201
|
||||||
lazy_static = { git = "https://github.com/rust-lang-nursery/lazy-static.rs", rev = "5735630d46572f1e5377c8f2ba0f79d18f53b10c" }
|
lazy_static = { git = "https://github.com/rust-lang-nursery/lazy-static.rs", rev = "5735630d46572f1e5377c8f2ba0f79d18f53b10c" }
|
||||||
|
|
||||||
# These have `std` alternatives
|
# Needed due to dockertest's usage of `Rc`s when we need `Arc`s
|
||||||
|
dockertest = { git = "https://github.com/kayabaNerve/dockertest-rs", branch = "arc" }
|
||||||
|
|
||||||
|
# wasmtime pulls in an old version for this
|
||||||
|
zstd = { path = "patches/zstd" }
|
||||||
|
# Needed for WAL compression
|
||||||
|
rocksdb = { path = "patches/rocksdb" }
|
||||||
|
# proc-macro-crate 2 binds to an old version of toml for msrv so we patch to 3
|
||||||
|
proc-macro-crate = { path = "patches/proc-macro-crate" }
|
||||||
|
|
||||||
|
# is-terminal now has an std-based solution with an equivalent API
|
||||||
|
is-terminal = { path = "patches/is-terminal" }
|
||||||
|
# So does matches
|
||||||
matches = { path = "patches/matches" }
|
matches = { path = "patches/matches" }
|
||||||
home = { path = "patches/home" }
|
|
||||||
|
|
||||||
# directories-next was created because directories was unmaintained
|
# directories-next was created because directories was unmaintained
|
||||||
# directories-next is now unmaintained while directories is maintained
|
# directories-next is now unmaintained while directories is maintained
|
||||||
@@ -141,10 +133,7 @@ option-ext = { path = "patches/option-ext" }
|
|||||||
directories-next = { path = "patches/directories-next" }
|
directories-next = { path = "patches/directories-next" }
|
||||||
|
|
||||||
[workspace.lints.clippy]
|
[workspace.lints.clippy]
|
||||||
uninlined_format_args = "allow" # TODO
|
|
||||||
unwrap_or_default = "allow"
|
unwrap_or_default = "allow"
|
||||||
manual_is_multiple_of = "allow"
|
|
||||||
incompatible_msrv = "allow" # Manually verified with a GitHub workflow
|
|
||||||
borrow_as_ptr = "deny"
|
borrow_as_ptr = "deny"
|
||||||
cast_lossless = "deny"
|
cast_lossless = "deny"
|
||||||
cast_possible_truncation = "deny"
|
cast_possible_truncation = "deny"
|
||||||
@@ -169,14 +158,14 @@ large_stack_arrays = "deny"
|
|||||||
linkedlist = "deny"
|
linkedlist = "deny"
|
||||||
macro_use_imports = "deny"
|
macro_use_imports = "deny"
|
||||||
manual_instant_elapsed = "deny"
|
manual_instant_elapsed = "deny"
|
||||||
# TODO manual_let_else = "deny"
|
manual_let_else = "deny"
|
||||||
manual_ok_or = "deny"
|
manual_ok_or = "deny"
|
||||||
manual_string_new = "deny"
|
manual_string_new = "deny"
|
||||||
map_unwrap_or = "deny"
|
map_unwrap_or = "deny"
|
||||||
match_bool = "deny"
|
match_bool = "deny"
|
||||||
match_same_arms = "deny"
|
match_same_arms = "deny"
|
||||||
missing_fields_in_debug = "deny"
|
missing_fields_in_debug = "deny"
|
||||||
# TODO needless_continue = "deny"
|
needless_continue = "deny"
|
||||||
needless_pass_by_value = "deny"
|
needless_pass_by_value = "deny"
|
||||||
ptr_cast_constness = "deny"
|
ptr_cast_constness = "deny"
|
||||||
range_minus_one = "deny"
|
range_minus_one = "deny"
|
||||||
@@ -184,7 +173,8 @@ range_plus_one = "deny"
|
|||||||
redundant_closure_for_method_calls = "deny"
|
redundant_closure_for_method_calls = "deny"
|
||||||
redundant_else = "deny"
|
redundant_else = "deny"
|
||||||
string_add_assign = "deny"
|
string_add_assign = "deny"
|
||||||
unchecked_time_subtraction = "deny"
|
unchecked_duration_subtraction = "deny"
|
||||||
|
uninlined_format_args = "deny"
|
||||||
unnecessary_box_returns = "deny"
|
unnecessary_box_returns = "deny"
|
||||||
unnecessary_join = "deny"
|
unnecessary_join = "deny"
|
||||||
unnecessary_wraps = "deny"
|
unnecessary_wraps = "deny"
|
||||||
@@ -192,21 +182,3 @@ unnested_or_patterns = "deny"
|
|||||||
unused_async = "deny"
|
unused_async = "deny"
|
||||||
unused_self = "deny"
|
unused_self = "deny"
|
||||||
zero_sized_map_values = "deny"
|
zero_sized_map_values = "deny"
|
||||||
|
|
||||||
# TODO: These were incurred when updating Rust as necessary for compilation, yet aren't being fixed
|
|
||||||
# at this time due to the impacts it'd have throughout the repository (when this isn't actively the
|
|
||||||
# primary branch, `next` is)
|
|
||||||
needless_continue = "allow"
|
|
||||||
needless_lifetimes = "allow"
|
|
||||||
useless_conversion = "allow"
|
|
||||||
empty_line_after_doc_comments = "allow"
|
|
||||||
manual_div_ceil = "allow"
|
|
||||||
manual_let_else = "allow"
|
|
||||||
unnecessary_map_or = "allow"
|
|
||||||
result_large_err = "allow"
|
|
||||||
unneeded_struct_pattern = "allow"
|
|
||||||
[workspace.lints.rust]
|
|
||||||
unused = "allow" # TODO: https://github.com/rust-lang/rust/issues/147648
|
|
||||||
mismatched_lifetime_syntaxes = "allow"
|
|
||||||
unused_attributes = "allow"
|
|
||||||
unused_parens = "allow"
|
|
||||||
|
|||||||
2
LICENSE
2
LICENSE
@@ -5,4 +5,4 @@ a full copy of the AGPL-3.0 License is included in the root of this repository
|
|||||||
as a reference text. This copy should be provided with any distribution of a
|
as a reference text. This copy should be provided with any distribution of a
|
||||||
crate licensed under the AGPL-3.0, as per its terms.
|
crate licensed under the AGPL-3.0, as per its terms.
|
||||||
|
|
||||||
The GitHub actions/workflows (`.github`) are licensed under the MIT license.
|
The GitHub actions (`.github/actions`) are licensed under the MIT license.
|
||||||
|
|||||||
@@ -24,7 +24,7 @@ wallet.
|
|||||||
infrastructure, to our IETF-compliant FROST implementation, to a DLEq proof as
|
infrastructure, to our IETF-compliant FROST implementation, to a DLEq proof as
|
||||||
needed for Bitcoin-Monero atomic swaps.
|
needed for Bitcoin-Monero atomic swaps.
|
||||||
|
|
||||||
- `networks`: Various libraries intended for usage in Serai yet also by the
|
- `coins`: Various coin libraries intended for usage in Serai yet also by the
|
||||||
wider community. This means they will always support the functionality Serai
|
wider community. This means they will always support the functionality Serai
|
||||||
needs, yet won't disadvantage other use cases when possible.
|
needs, yet won't disadvantage other use cases when possible.
|
||||||
|
|
||||||
@@ -59,6 +59,7 @@ issued at the discretion of the Immunefi program managers.
|
|||||||
- [Website](https://serai.exchange/): https://serai.exchange/
|
- [Website](https://serai.exchange/): https://serai.exchange/
|
||||||
- [Immunefi](https://immunefi.com/bounty/serai/): https://immunefi.com/bounty/serai/
|
- [Immunefi](https://immunefi.com/bounty/serai/): https://immunefi.com/bounty/serai/
|
||||||
- [Twitter](https://twitter.com/SeraiDEX): https://twitter.com/SeraiDEX
|
- [Twitter](https://twitter.com/SeraiDEX): https://twitter.com/SeraiDEX
|
||||||
|
- [Mastodon](https://cryptodon.lol/@serai): https://cryptodon.lol/@serai
|
||||||
- [Discord](https://discord.gg/mpEUtJR3vz): https://discord.gg/mpEUtJR3vz
|
- [Discord](https://discord.gg/mpEUtJR3vz): https://discord.gg/mpEUtJR3vz
|
||||||
- [Matrix](https://matrix.to/#/#serai:matrix.org): https://matrix.to/#/#serai:matrix.org
|
- [Matrix](https://matrix.to/#/#serai:matrix.org): https://matrix.to/#/#serai:matrix.org
|
||||||
- [Reddit](https://www.reddit.com/r/SeraiDEX/): https://www.reddit.com/r/SeraiDEX/
|
- [Reddit](https://www.reddit.com/r/SeraiDEX/): https://www.reddit.com/r/SeraiDEX/
|
||||||
|
|||||||
6
audits/Cypher Stack coins bitcoin August 2023/README.md
Normal file
6
audits/Cypher Stack coins bitcoin August 2023/README.md
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
# Cypher Stack /coins/bitcoin Audit, August 2023
|
||||||
|
|
||||||
|
This audit was over the /coins/bitcoin folder. It is encompassing up to commit
|
||||||
|
5121ca75199dff7bd34230880a1fdd793012068c.
|
||||||
|
|
||||||
|
Please see https://github.com/cypherstack/serai-btc-audit for provenance.
|
||||||
@@ -1,7 +0,0 @@
|
|||||||
# Cypher Stack /networks/bitcoin Audit, August 2023
|
|
||||||
|
|
||||||
This audit was over the `/networks/bitcoin` folder (at the time located at
|
|
||||||
`/coins/bitcoin`). It is encompassing up to commit
|
|
||||||
5121ca75199dff7bd34230880a1fdd793012068c.
|
|
||||||
|
|
||||||
Please see https://github.com/cypherstack/serai-btc-audit for provenance.
|
|
||||||
@@ -1,12 +1,12 @@
|
|||||||
[package]
|
[package]
|
||||||
name = "bitcoin-serai"
|
name = "bitcoin-serai"
|
||||||
version = "0.4.0"
|
version = "0.3.0"
|
||||||
description = "A Bitcoin library for FROST-signing transactions"
|
description = "A Bitcoin library for FROST-signing transactions"
|
||||||
license = "MIT"
|
license = "MIT"
|
||||||
repository = "https://github.com/serai-dex/serai/tree/develop/networks/bitcoin"
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/bitcoin"
|
||||||
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Vrx <vrx00@proton.me>"]
|
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Vrx <vrx00@proton.me>"]
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
rust-version = "1.80"
|
rust-version = "1.74"
|
||||||
|
|
||||||
[package.metadata.docs.rs]
|
[package.metadata.docs.rs]
|
||||||
all-features = true
|
all-features = true
|
||||||
@@ -20,14 +20,15 @@ std-shims = { version = "0.1.1", path = "../../common/std-shims", default-featur
|
|||||||
|
|
||||||
thiserror = { version = "1", default-features = false, optional = true }
|
thiserror = { version = "1", default-features = false, optional = true }
|
||||||
|
|
||||||
subtle = { version = "2", default-features = false }
|
|
||||||
zeroize = { version = "^1.5", default-features = false }
|
zeroize = { version = "^1.5", default-features = false }
|
||||||
rand_core = { version = "0.6", default-features = false }
|
rand_core = { version = "0.6", default-features = false }
|
||||||
|
|
||||||
bitcoin = { version = "0.32", default-features = false }
|
bitcoin = { version = "0.31", default-features = false, features = ["no-std"] }
|
||||||
|
|
||||||
k256 = { version = "^0.13.1", default-features = false, features = ["arithmetic", "bits"] }
|
k256 = { version = "^0.13.1", default-features = false, features = ["arithmetic", "bits"] }
|
||||||
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.10", default-features = false, features = ["secp256k1"], optional = true }
|
|
||||||
|
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
|
||||||
|
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["secp256k1"], optional = true }
|
||||||
|
|
||||||
hex = { version = "0.4", default-features = false, optional = true }
|
hex = { version = "0.4", default-features = false, optional = true }
|
||||||
serde = { version = "1", default-features = false, features = ["derive"], optional = true }
|
serde = { version = "1", default-features = false, features = ["derive"], optional = true }
|
||||||
@@ -35,7 +36,7 @@ serde_json = { version = "1", default-features = false, optional = true }
|
|||||||
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls", "basic-auth"], optional = true }
|
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls", "basic-auth"], optional = true }
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
secp256k1 = { version = "0.29", default-features = false, features = ["std"] }
|
secp256k1 = { version = "0.28", default-features = false, features = ["std"] }
|
||||||
|
|
||||||
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
||||||
|
|
||||||
@@ -47,7 +48,6 @@ std = [
|
|||||||
|
|
||||||
"thiserror",
|
"thiserror",
|
||||||
|
|
||||||
"subtle/std",
|
|
||||||
"zeroize/std",
|
"zeroize/std",
|
||||||
"rand_core/std",
|
"rand_core/std",
|
||||||
|
|
||||||
@@ -55,6 +55,8 @@ std = [
|
|||||||
"bitcoin/serde",
|
"bitcoin/serde",
|
||||||
|
|
||||||
"k256/std",
|
"k256/std",
|
||||||
|
|
||||||
|
"transcript/std",
|
||||||
"frost",
|
"frost",
|
||||||
|
|
||||||
"hex/std",
|
"hex/std",
|
||||||
@@ -1,5 +1,3 @@
|
|||||||
use subtle::{Choice, ConstantTimeEq, ConditionallySelectable};
|
|
||||||
|
|
||||||
use k256::{
|
use k256::{
|
||||||
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
||||||
ProjectivePoint,
|
ProjectivePoint,
|
||||||
@@ -7,24 +5,29 @@ use k256::{
|
|||||||
|
|
||||||
use bitcoin::key::XOnlyPublicKey;
|
use bitcoin::key::XOnlyPublicKey;
|
||||||
|
|
||||||
/// Get the x coordinate of a non-infinity point.
|
/// Get the x coordinate of a non-infinity, even point. Panics on invalid input.
|
||||||
///
|
pub fn x(key: &ProjectivePoint) -> [u8; 32] {
|
||||||
/// Panics on invalid input.
|
|
||||||
fn x(key: &ProjectivePoint) -> [u8; 32] {
|
|
||||||
let encoded = key.to_encoded_point(true);
|
let encoded = key.to_encoded_point(true);
|
||||||
|
assert_eq!(encoded.tag(), Tag::CompressedEvenY, "x coordinate of odd key");
|
||||||
(*encoded.x().expect("point at infinity")).into()
|
(*encoded.x().expect("point at infinity")).into()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Convert a non-infinity point to a XOnlyPublicKey (dropping its sign).
|
/// Convert a non-infinity even point to a XOnlyPublicKey. Panics on invalid input.
|
||||||
///
|
pub fn x_only(key: &ProjectivePoint) -> XOnlyPublicKey {
|
||||||
/// Panics on invalid input.
|
|
||||||
pub(crate) fn x_only(key: &ProjectivePoint) -> XOnlyPublicKey {
|
|
||||||
XOnlyPublicKey::from_slice(&x(key)).expect("x_only was passed a point which was infinity or odd")
|
XOnlyPublicKey::from_slice(&x(key)).expect("x_only was passed a point which was infinity or odd")
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return if a point must be negated to have an even Y coordinate and be eligible for use.
|
/// Make a point even by adding the generator until it is even.
|
||||||
pub(crate) fn needs_negation(key: &ProjectivePoint) -> Choice {
|
///
|
||||||
u8::from(key.to_encoded_point(true).tag()).ct_eq(&u8::from(Tag::CompressedOddY))
|
/// Returns the even point and the amount of additions required.
|
||||||
|
#[cfg(any(feature = "std", feature = "hazmat"))]
|
||||||
|
pub fn make_even(mut key: ProjectivePoint) -> (ProjectivePoint, u64) {
|
||||||
|
let mut c = 0;
|
||||||
|
while key.to_encoded_point(true).tag() == Tag::CompressedOddY {
|
||||||
|
key += ProjectivePoint::GENERATOR;
|
||||||
|
c += 1;
|
||||||
|
}
|
||||||
|
(key, c)
|
||||||
}
|
}
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
@@ -37,62 +40,58 @@ mod frost_crypto {
|
|||||||
|
|
||||||
use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256};
|
use bitcoin::hashes::{HashEngine, Hash, sha256::Hash as Sha256};
|
||||||
|
|
||||||
|
use transcript::Transcript;
|
||||||
|
|
||||||
use k256::{elliptic_curve::ops::Reduce, U256, Scalar};
|
use k256::{elliptic_curve::ops::Reduce, U256, Scalar};
|
||||||
|
|
||||||
use frost::{
|
use frost::{
|
||||||
curve::{Ciphersuite, Secp256k1},
|
curve::{Ciphersuite, Secp256k1},
|
||||||
Participant, ThresholdKeys, ThresholdView, FrostError,
|
Participant, ThresholdKeys, ThresholdView, FrostError,
|
||||||
algorithm::{Hram as HramTrait, Algorithm, IetfSchnorr as FrostSchnorr},
|
algorithm::{Hram as HramTrait, Algorithm, Schnorr as FrostSchnorr},
|
||||||
};
|
};
|
||||||
|
|
||||||
use super::*;
|
use super::*;
|
||||||
|
|
||||||
/// A BIP-340 compatible HRAm for use with the modular-frost Schnorr Algorithm.
|
/// A BIP-340 compatible HRAm for use with the modular-frost Schnorr Algorithm.
|
||||||
///
|
///
|
||||||
/// If passed an odd nonce, the challenge will be negated.
|
/// If passed an odd nonce, it will have the generator added until it is even.
|
||||||
///
|
///
|
||||||
/// If either `R` or `A` is the point at infinity, this will panic.
|
/// If the key is odd, this will panic.
|
||||||
#[derive(Clone, Copy, Debug)]
|
#[derive(Clone, Copy, Debug)]
|
||||||
pub struct Hram;
|
pub struct Hram;
|
||||||
#[allow(non_snake_case)]
|
#[allow(non_snake_case)]
|
||||||
impl HramTrait<Secp256k1> for Hram {
|
impl HramTrait<Secp256k1> for Hram {
|
||||||
fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar {
|
fn hram(R: &ProjectivePoint, A: &ProjectivePoint, m: &[u8]) -> Scalar {
|
||||||
|
// Convert the nonce to be even
|
||||||
|
let (R, _) = make_even(*R);
|
||||||
|
|
||||||
const TAG_HASH: Sha256 = Sha256::const_hash(b"BIP0340/challenge");
|
const TAG_HASH: Sha256 = Sha256::const_hash(b"BIP0340/challenge");
|
||||||
|
|
||||||
let mut data = Sha256::engine();
|
let mut data = Sha256::engine();
|
||||||
data.input(TAG_HASH.as_ref());
|
data.input(TAG_HASH.as_ref());
|
||||||
data.input(TAG_HASH.as_ref());
|
data.input(TAG_HASH.as_ref());
|
||||||
data.input(&x(R));
|
data.input(&x(&R));
|
||||||
data.input(&x(A));
|
data.input(&x(A));
|
||||||
data.input(m);
|
data.input(m);
|
||||||
|
|
||||||
let c = Scalar::reduce(U256::from_be_slice(Sha256::from_engine(data).as_ref()));
|
Scalar::reduce(U256::from_be_slice(Sha256::from_engine(data).as_ref()))
|
||||||
// If the nonce was odd, sign `r - cx` instead of `r + cx`, allowing us to negate `s` at the
|
|
||||||
// end to sign as `-r + cx`
|
|
||||||
<_>::conditional_select(&c, &-c, needs_negation(R))
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/// BIP-340 Schnorr signature algorithm.
|
/// BIP-340 Schnorr signature algorithm.
|
||||||
///
|
///
|
||||||
/// This may panic if called with nonces/a group key which are the point at infinity (which have
|
/// This must be used with a ThresholdKeys whose group key is even. If it is odd, this will panic.
|
||||||
/// a negligible probability for a well-reasoned caller, even with malicious participants
|
|
||||||
/// present).
|
|
||||||
///
|
|
||||||
/// `verify`, `verify_share` MUST be called after `sign_share` is called. Otherwise, this library
|
|
||||||
/// MAY panic.
|
|
||||||
#[derive(Clone)]
|
#[derive(Clone)]
|
||||||
pub struct Schnorr(FrostSchnorr<Secp256k1, Hram>);
|
pub struct Schnorr<T: Sync + Clone + Debug + Transcript>(FrostSchnorr<Secp256k1, T, Hram>);
|
||||||
impl Schnorr {
|
impl<T: Sync + Clone + Debug + Transcript> Schnorr<T> {
|
||||||
/// Construct a Schnorr algorithm continuing the specified transcript.
|
/// Construct a Schnorr algorithm continuing the specified transcript.
|
||||||
#[allow(clippy::new_without_default)]
|
pub fn new(transcript: T) -> Schnorr<T> {
|
||||||
pub fn new() -> Schnorr {
|
Schnorr(FrostSchnorr::new(transcript))
|
||||||
Schnorr(FrostSchnorr::ietf())
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
impl Algorithm<Secp256k1> for Schnorr {
|
impl<T: Sync + Clone + Debug + Transcript> Algorithm<Secp256k1> for Schnorr<T> {
|
||||||
type Transcript = <FrostSchnorr<Secp256k1, Hram> as Algorithm<Secp256k1>>::Transcript;
|
type Transcript = T;
|
||||||
type Addendum = ();
|
type Addendum = ();
|
||||||
type Signature = [u8; 64];
|
type Signature = [u8; 64];
|
||||||
|
|
||||||
@@ -143,7 +142,11 @@ mod frost_crypto {
|
|||||||
sum: Scalar,
|
sum: Scalar,
|
||||||
) -> Option<Self::Signature> {
|
) -> Option<Self::Signature> {
|
||||||
self.0.verify(group_key, nonces, sum).map(|mut sig| {
|
self.0.verify(group_key, nonces, sum).map(|mut sig| {
|
||||||
sig.s = <_>::conditional_select(&sum, &-sum, needs_negation(&sig.R));
|
// Make the R of the final signature even
|
||||||
|
let offset;
|
||||||
|
(sig.R, offset) = make_even(sig.R);
|
||||||
|
// s = r + cx. Since we added to the r, add to s
|
||||||
|
sig.s += Scalar::from(offset);
|
||||||
// Convert to a Bitcoin signature by dropping the byte for the point's sign bit
|
// Convert to a Bitcoin signature by dropping the byte for the point's sign bit
|
||||||
sig.serialize()[1 ..].try_into().unwrap()
|
sig.serialize()[1 ..].try_into().unwrap()
|
||||||
})
|
})
|
||||||
@@ -1,4 +1,4 @@
|
|||||||
#![cfg_attr(docsrs, feature(doc_cfg))]
|
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
|
||||||
#![doc = include_str!("../README.md")]
|
#![doc = include_str!("../README.md")]
|
||||||
#![cfg_attr(not(feature = "std"), no_std)]
|
#![cfg_attr(not(feature = "std"), no_std)]
|
||||||
|
|
||||||
@@ -195,13 +195,13 @@ impl Rpc {
|
|||||||
// If this was already successfully published, consider this having succeeded
|
// If this was already successfully published, consider this having succeeded
|
||||||
if let RpcError::RequestError(Error { code, .. }) = e {
|
if let RpcError::RequestError(Error { code, .. }) = e {
|
||||||
if code == RPC_VERIFY_ALREADY_IN_CHAIN {
|
if code == RPC_VERIFY_ALREADY_IN_CHAIN {
|
||||||
return Ok(tx.compute_txid());
|
return Ok(tx.txid());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
Err(e)?
|
Err(e)?
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
if txid != tx.compute_txid() {
|
if txid != tx.txid() {
|
||||||
Err(RpcError::InvalidResponse("returned TX ID inequals calculated TX ID"))?;
|
Err(RpcError::InvalidResponse("returned TX ID inequals calculated TX ID"))?;
|
||||||
}
|
}
|
||||||
Ok(txid)
|
Ok(txid)
|
||||||
@@ -215,7 +215,7 @@ impl Rpc {
|
|||||||
let tx: Transaction = encode::deserialize(&bytes)
|
let tx: Transaction = encode::deserialize(&bytes)
|
||||||
.map_err(|_| RpcError::InvalidResponse("node sent an improperly serialized transaction"))?;
|
.map_err(|_| RpcError::InvalidResponse("node sent an improperly serialized transaction"))?;
|
||||||
|
|
||||||
let mut tx_hash = *tx.compute_txid().as_raw_hash().as_byte_array();
|
let mut tx_hash = *tx.txid().as_raw_hash().as_byte_array();
|
||||||
tx_hash.reverse();
|
tx_hash.reverse();
|
||||||
if hash != &tx_hash {
|
if hash != &tx_hash {
|
||||||
Err(RpcError::InvalidResponse("node replied with a different transaction"))?;
|
Err(RpcError::InvalidResponse("node replied with a different transaction"))?;
|
||||||
@@ -2,6 +2,8 @@ use rand_core::OsRng;
|
|||||||
|
|
||||||
use secp256k1::{Secp256k1 as BContext, Message, schnorr::Signature};
|
use secp256k1::{Secp256k1 as BContext, Message, schnorr::Signature};
|
||||||
|
|
||||||
|
use k256::Scalar;
|
||||||
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
use frost::{
|
use frost::{
|
||||||
curve::Secp256k1,
|
curve::Secp256k1,
|
||||||
Participant,
|
Participant,
|
||||||
@@ -10,8 +12,7 @@ use frost::{
|
|||||||
|
|
||||||
use crate::{
|
use crate::{
|
||||||
bitcoin::hashes::{Hash as HashTrait, sha256::Hash},
|
bitcoin::hashes::{Hash as HashTrait, sha256::Hash},
|
||||||
crypto::{x_only, Schnorr},
|
crypto::{x_only, make_even, Schnorr},
|
||||||
wallet::tweak_keys,
|
|
||||||
};
|
};
|
||||||
|
|
||||||
#[test]
|
#[test]
|
||||||
@@ -20,10 +21,12 @@ fn test_algorithm() {
|
|||||||
const MESSAGE: &[u8] = b"Hello, World!";
|
const MESSAGE: &[u8] = b"Hello, World!";
|
||||||
|
|
||||||
for keys in keys.values_mut() {
|
for keys in keys.values_mut() {
|
||||||
*keys = tweak_keys(keys.clone());
|
let (_, offset) = make_even(keys.group_key());
|
||||||
|
*keys = keys.offset(Scalar::from(offset));
|
||||||
}
|
}
|
||||||
|
|
||||||
let algo = Schnorr::new();
|
let algo =
|
||||||
|
Schnorr::<RecommendedTranscript>::new(RecommendedTranscript::new(b"bitcoin-serai sign test"));
|
||||||
let sig = sign(
|
let sig = sign(
|
||||||
&mut OsRng,
|
&mut OsRng,
|
||||||
&algo,
|
&algo,
|
||||||
@@ -36,7 +39,7 @@ fn test_algorithm() {
|
|||||||
.verify_schnorr(
|
.verify_schnorr(
|
||||||
&Signature::from_slice(&sig)
|
&Signature::from_slice(&sig)
|
||||||
.expect("couldn't convert produced signature to secp256k1::Signature"),
|
.expect("couldn't convert produced signature to secp256k1::Signature"),
|
||||||
&Message::from_digest_slice(Hash::hash(MESSAGE).as_ref()).unwrap(),
|
&Message::from(Hash::hash(MESSAGE)),
|
||||||
&x_only(&keys[&Participant::new(1).unwrap()].group_key()),
|
&x_only(&keys[&Participant::new(1).unwrap()].group_key()),
|
||||||
)
|
)
|
||||||
.unwrap()
|
.unwrap()
|
||||||
@@ -4,7 +4,7 @@ use std_shims::{
|
|||||||
io::{self, Write},
|
io::{self, Write},
|
||||||
};
|
};
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
use std::io::{Read, BufReader};
|
use std_shims::io::Read;
|
||||||
|
|
||||||
use k256::{
|
use k256::{
|
||||||
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
elliptic_curve::sec1::{Tag, ToEncodedPoint},
|
||||||
@@ -18,71 +18,40 @@ use frost::{
|
|||||||
};
|
};
|
||||||
|
|
||||||
use bitcoin::{
|
use bitcoin::{
|
||||||
consensus::encode::serialize, key::TweakedPublicKey, OutPoint, ScriptBuf, TxOut, Transaction,
|
consensus::encode::serialize, key::TweakedPublicKey, address::Payload, OutPoint, ScriptBuf,
|
||||||
Block,
|
TxOut, Transaction, Block,
|
||||||
};
|
};
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
use bitcoin::{hashes::Hash, consensus::encode::Decodable, TapTweakHash};
|
use bitcoin::consensus::encode::Decodable;
|
||||||
|
|
||||||
use crate::crypto::x_only;
|
use crate::crypto::x_only;
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
use crate::crypto::needs_negation;
|
use crate::crypto::make_even;
|
||||||
|
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
mod send;
|
mod send;
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
pub use send::*;
|
pub use send::*;
|
||||||
|
|
||||||
/// Tweak keys to ensure they're usable with Bitcoin's Taproot upgrade.
|
/// Tweak keys to ensure they're usable with Bitcoin.
|
||||||
///
|
///
|
||||||
/// This adds an unspendable script path to the key, preventing any outputs received to this key
|
/// Taproot keys, which these keys are used as, must be even. This offsets the keys until they're
|
||||||
/// from being spent via a script. To have keys which have spendable script paths, further offsets
|
/// even.
|
||||||
/// from this position must be used.
|
|
||||||
///
|
|
||||||
/// After adding an unspendable script path, the key is negated if odd.
|
|
||||||
///
|
|
||||||
/// This has a neligible probability of returning keys whose group key is the point at infinity.
|
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
pub fn tweak_keys(keys: ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
|
pub fn tweak_keys(keys: &ThresholdKeys<Secp256k1>) -> ThresholdKeys<Secp256k1> {
|
||||||
// Adds the unspendable script path per
|
let (_, offset) = make_even(keys.group_key());
|
||||||
// https://github.com/bitcoin/bips/blob/master/bip-0341.mediawiki#cite_note-23
|
keys.offset(Scalar::from(offset))
|
||||||
let keys = {
|
|
||||||
use k256::elliptic_curve::{
|
|
||||||
bigint::{Encoding, U256},
|
|
||||||
ops::Reduce,
|
|
||||||
group::GroupEncoding,
|
|
||||||
};
|
|
||||||
let tweak_hash = TapTweakHash::hash(&keys.group_key().to_bytes().as_slice()[1 ..]);
|
|
||||||
/*
|
|
||||||
https://github.com/bitcoin/bips/blob/master/bip-0340.mediawiki#cite_ref-13-0 states how the
|
|
||||||
bias is negligible. This reduction shouldn't ever occur, yet if it did, the script path
|
|
||||||
would be unusable due to a check the script path hash is less than the order. That doesn't
|
|
||||||
impact us as we don't want the script path to be usable.
|
|
||||||
*/
|
|
||||||
keys.offset(<Secp256k1 as Ciphersuite>::F::reduce(U256::from_be_bytes(
|
|
||||||
*tweak_hash.to_raw_hash().as_ref(),
|
|
||||||
)))
|
|
||||||
};
|
|
||||||
|
|
||||||
let needs_negation = needs_negation(&keys.group_key());
|
|
||||||
keys
|
|
||||||
.scale(<_ as subtle::ConditionallySelectable>::conditional_select(
|
|
||||||
&Scalar::ONE,
|
|
||||||
&-Scalar::ONE,
|
|
||||||
needs_negation,
|
|
||||||
))
|
|
||||||
.expect("scaling keys by 1 or -1 yet interpreted as 0?")
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Return the Taproot address payload for a public key.
|
/// Return the Taproot address payload for a public key.
|
||||||
///
|
///
|
||||||
/// If the key is odd, this will return None.
|
/// If the key is odd, this will return None.
|
||||||
pub fn p2tr_script_buf(key: ProjectivePoint) -> Option<ScriptBuf> {
|
pub fn address_payload(key: ProjectivePoint) -> Option<Payload> {
|
||||||
if key.to_encoded_point(true).tag() != Tag::CompressedEvenY {
|
if key.to_encoded_point(true).tag() != Tag::CompressedEvenY {
|
||||||
return None;
|
return None;
|
||||||
}
|
}
|
||||||
|
|
||||||
Some(ScriptBuf::new_p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key))))
|
Some(Payload::p2tr_tweaked(TweakedPublicKey::dangerous_assume_tweaked(x_only(&key))))
|
||||||
}
|
}
|
||||||
|
|
||||||
/// A spendable output.
|
/// A spendable output.
|
||||||
@@ -120,17 +89,11 @@ impl ReceivedOutput {
|
|||||||
/// Read a ReceivedOutput from a generic satisfying Read.
|
/// Read a ReceivedOutput from a generic satisfying Read.
|
||||||
#[cfg(feature = "std")]
|
#[cfg(feature = "std")]
|
||||||
pub fn read<R: Read>(r: &mut R) -> io::Result<ReceivedOutput> {
|
pub fn read<R: Read>(r: &mut R) -> io::Result<ReceivedOutput> {
|
||||||
let offset = Secp256k1::read_F(r)?;
|
Ok(ReceivedOutput {
|
||||||
let output;
|
offset: Secp256k1::read_F(r)?,
|
||||||
let outpoint;
|
output: TxOut::consensus_decode(r).map_err(|_| io::Error::other("invalid TxOut"))?,
|
||||||
{
|
outpoint: OutPoint::consensus_decode(r).map_err(|_| io::Error::other("invalid OutPoint"))?,
|
||||||
let mut buf_r = BufReader::with_capacity(0, r);
|
})
|
||||||
output =
|
|
||||||
TxOut::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid TxOut"))?;
|
|
||||||
outpoint =
|
|
||||||
OutPoint::consensus_decode(&mut buf_r).map_err(|_| io::Error::other("invalid OutPoint"))?;
|
|
||||||
}
|
|
||||||
Ok(ReceivedOutput { offset, output, outpoint })
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Write a ReceivedOutput to a generic satisfying Write.
|
/// Write a ReceivedOutput to a generic satisfying Write.
|
||||||
@@ -161,7 +124,7 @@ impl Scanner {
|
|||||||
/// Returns None if this key can't be scanned for.
|
/// Returns None if this key can't be scanned for.
|
||||||
pub fn new(key: ProjectivePoint) -> Option<Scanner> {
|
pub fn new(key: ProjectivePoint) -> Option<Scanner> {
|
||||||
let mut scripts = HashMap::new();
|
let mut scripts = HashMap::new();
|
||||||
scripts.insert(p2tr_script_buf(key)?, Scalar::ZERO);
|
scripts.insert(address_payload(key)?.script_pubkey(), Scalar::ZERO);
|
||||||
Some(Scanner { key, scripts })
|
Some(Scanner { key, scripts })
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -173,17 +136,14 @@ impl Scanner {
|
|||||||
///
|
///
|
||||||
/// This means offsets are surjective, not bijective, and the order offsets are registered in
|
/// This means offsets are surjective, not bijective, and the order offsets are registered in
|
||||||
/// may determine the validity of future offsets.
|
/// may determine the validity of future offsets.
|
||||||
///
|
|
||||||
/// The offsets registered must be securely generated. Arbitrary offsets may introduce a script
|
|
||||||
/// path into the output, allowing the output to be spent by satisfaction of an arbitrary script
|
|
||||||
/// (not by the signature of the key).
|
|
||||||
pub fn register_offset(&mut self, mut offset: Scalar) -> Option<Scalar> {
|
pub fn register_offset(&mut self, mut offset: Scalar) -> Option<Scalar> {
|
||||||
// This loop will terminate as soon as an even point is found, with any point having a ~50%
|
// This loop will terminate as soon as an even point is found, with any point having a ~50%
|
||||||
// chance of being even
|
// chance of being even
|
||||||
// That means this should terminate within a very small amount of iterations
|
// That means this should terminate within a very small amount of iterations
|
||||||
loop {
|
loop {
|
||||||
match p2tr_script_buf(self.key + (ProjectivePoint::GENERATOR * offset)) {
|
match address_payload(self.key + (ProjectivePoint::GENERATOR * offset)) {
|
||||||
Some(script) => {
|
Some(address) => {
|
||||||
|
let script = address.script_pubkey();
|
||||||
if self.scripts.contains_key(&script) {
|
if self.scripts.contains_key(&script) {
|
||||||
None?;
|
None?;
|
||||||
}
|
}
|
||||||
@@ -206,7 +166,7 @@ impl Scanner {
|
|||||||
res.push(ReceivedOutput {
|
res.push(ReceivedOutput {
|
||||||
offset: *offset,
|
offset: *offset,
|
||||||
output: output.clone(),
|
output: output.clone(),
|
||||||
outpoint: OutPoint::new(tx.compute_txid(), vout),
|
outpoint: OutPoint::new(tx.txid(), vout),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -7,7 +7,9 @@ use thiserror::Error;
|
|||||||
|
|
||||||
use rand_core::{RngCore, CryptoRng};
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
use k256::Scalar;
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
|
|
||||||
|
use k256::{elliptic_curve::sec1::ToEncodedPoint, Scalar};
|
||||||
use frost::{curve::Secp256k1, Participant, ThresholdKeys, FrostError, sign::*};
|
use frost::{curve::Secp256k1, Participant, ThresholdKeys, FrostError, sign::*};
|
||||||
|
|
||||||
use bitcoin::{
|
use bitcoin::{
|
||||||
@@ -16,12 +18,12 @@ use bitcoin::{
|
|||||||
absolute::LockTime,
|
absolute::LockTime,
|
||||||
script::{PushBytesBuf, ScriptBuf},
|
script::{PushBytesBuf, ScriptBuf},
|
||||||
transaction::{Version, Transaction},
|
transaction::{Version, Transaction},
|
||||||
OutPoint, Sequence, Witness, TxIn, Amount, TxOut,
|
OutPoint, Sequence, Witness, TxIn, Amount, TxOut, Address,
|
||||||
};
|
};
|
||||||
|
|
||||||
use crate::{
|
use crate::{
|
||||||
crypto::Schnorr,
|
crypto::Schnorr,
|
||||||
wallet::{ReceivedOutput, p2tr_script_buf},
|
wallet::{ReceivedOutput, address_payload},
|
||||||
};
|
};
|
||||||
|
|
||||||
#[rustfmt::skip]
|
#[rustfmt::skip]
|
||||||
@@ -44,7 +46,7 @@ pub enum TransactionError {
|
|||||||
#[error("fee was too low to pass the default minimum fee rate")]
|
#[error("fee was too low to pass the default minimum fee rate")]
|
||||||
TooLowFee,
|
TooLowFee,
|
||||||
#[error("not enough funds for these payments")]
|
#[error("not enough funds for these payments")]
|
||||||
NotEnoughFunds { inputs: u64, payments: u64, fee: u64 },
|
NotEnoughFunds,
|
||||||
#[error("transaction was too large")]
|
#[error("transaction was too large")]
|
||||||
TooLargeTransaction,
|
TooLargeTransaction,
|
||||||
}
|
}
|
||||||
@@ -59,11 +61,7 @@ pub struct SignableTransaction {
|
|||||||
}
|
}
|
||||||
|
|
||||||
impl SignableTransaction {
|
impl SignableTransaction {
|
||||||
fn calculate_weight_vbytes(
|
fn calculate_weight(inputs: usize, payments: &[(Address, u64)], change: Option<&Address>) -> u64 {
|
||||||
inputs: usize,
|
|
||||||
payments: &[(ScriptBuf, u64)],
|
|
||||||
change: Option<&ScriptBuf>,
|
|
||||||
) -> (u64, u64) {
|
|
||||||
// Expand this a full transaction in order to use the bitcoin library's weight function
|
// Expand this a full transaction in order to use the bitcoin library's weight function
|
||||||
let mut tx = Transaction {
|
let mut tx = Transaction {
|
||||||
version: Version(2),
|
version: Version(2),
|
||||||
@@ -88,42 +86,16 @@ impl SignableTransaction {
|
|||||||
// The script pub key is not of a fixed size and does have to be used here
|
// The script pub key is not of a fixed size and does have to be used here
|
||||||
.map(|payment| TxOut {
|
.map(|payment| TxOut {
|
||||||
value: Amount::from_sat(payment.1),
|
value: Amount::from_sat(payment.1),
|
||||||
script_pubkey: payment.0.clone(),
|
script_pubkey: payment.0.script_pubkey(),
|
||||||
})
|
})
|
||||||
.collect(),
|
.collect(),
|
||||||
};
|
};
|
||||||
if let Some(change) = change {
|
if let Some(change) = change {
|
||||||
// Use a 0 value since we're currently unsure what the change amount will be, and since
|
// Use a 0 value since we're currently unsure what the change amount will be, and since
|
||||||
// the value is fixed size (so any value could be used here)
|
// the value is fixed size (so any value could be used here)
|
||||||
tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.clone() });
|
tx.output.push(TxOut { value: Amount::ZERO, script_pubkey: change.script_pubkey() });
|
||||||
}
|
}
|
||||||
|
u64::from(tx.weight())
|
||||||
let weight = tx.weight();
|
|
||||||
|
|
||||||
// Now calculate the size in vbytes
|
|
||||||
|
|
||||||
/*
|
|
||||||
"Virtual transaction size" is weight ceildiv 4 per
|
|
||||||
https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
|
|
||||||
|
|
||||||
https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04
|
|
||||||
/src/policy/policy.cpp#L295-L298
|
|
||||||
implements this almost as expected, with an additional consideration to signature operations
|
|
||||||
|
|
||||||
Signature operations (the second argument of the following call) do not count Taproot
|
|
||||||
signatures per https://github.com/bitcoin/bips/blob/master/bip-0342.mediawiki#cite_ref-11-0
|
|
||||||
|
|
||||||
We don't risk running afoul of the Taproot signature limit as it allows at least one per
|
|
||||||
input, which is all we use
|
|
||||||
*/
|
|
||||||
(
|
|
||||||
weight.to_wu(),
|
|
||||||
u64::try_from(bitcoin::policy::get_virtual_tx_size(
|
|
||||||
i64::try_from(weight.to_wu()).unwrap(),
|
|
||||||
0i64,
|
|
||||||
))
|
|
||||||
.unwrap(),
|
|
||||||
)
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns the fee necessary for this transaction to achieve the fee rate specified at
|
/// Returns the fee necessary for this transaction to achieve the fee rate specified at
|
||||||
@@ -149,10 +121,10 @@ impl SignableTransaction {
|
|||||||
/// If data is specified, an OP_RETURN output will be added with it.
|
/// If data is specified, an OP_RETURN output will be added with it.
|
||||||
pub fn new(
|
pub fn new(
|
||||||
mut inputs: Vec<ReceivedOutput>,
|
mut inputs: Vec<ReceivedOutput>,
|
||||||
payments: &[(ScriptBuf, u64)],
|
payments: &[(Address, u64)],
|
||||||
change: Option<ScriptBuf>,
|
change: Option<&Address>,
|
||||||
data: Option<Vec<u8>>,
|
data: Option<Vec<u8>>,
|
||||||
fee_per_vbyte: u64,
|
fee_per_weight: u64,
|
||||||
) -> Result<SignableTransaction, TransactionError> {
|
) -> Result<SignableTransaction, TransactionError> {
|
||||||
if inputs.is_empty() {
|
if inputs.is_empty() {
|
||||||
Err(TransactionError::NoInputs)?;
|
Err(TransactionError::NoInputs)?;
|
||||||
@@ -187,7 +159,10 @@ impl SignableTransaction {
|
|||||||
let payment_sat = payments.iter().map(|payment| payment.1).sum::<u64>();
|
let payment_sat = payments.iter().map(|payment| payment.1).sum::<u64>();
|
||||||
let mut tx_outs = payments
|
let mut tx_outs = payments
|
||||||
.iter()
|
.iter()
|
||||||
.map(|payment| TxOut { value: Amount::from_sat(payment.1), script_pubkey: payment.0.clone() })
|
.map(|payment| TxOut {
|
||||||
|
value: Amount::from_sat(payment.1),
|
||||||
|
script_pubkey: payment.0.script_pubkey(),
|
||||||
|
})
|
||||||
.collect::<Vec<_>>();
|
.collect::<Vec<_>>();
|
||||||
|
|
||||||
// Add the OP_RETURN output
|
// Add the OP_RETURN output
|
||||||
@@ -201,33 +176,49 @@ impl SignableTransaction {
|
|||||||
})
|
})
|
||||||
}
|
}
|
||||||
|
|
||||||
let (mut weight, vbytes) = Self::calculate_weight_vbytes(tx_ins.len(), payments, None);
|
let mut weight = Self::calculate_weight(tx_ins.len(), payments, None);
|
||||||
|
let mut needed_fee = fee_per_weight * weight;
|
||||||
|
|
||||||
let mut needed_fee = fee_per_vbyte * vbytes;
|
// "Virtual transaction size" is weight ceildiv 4 per
|
||||||
|
// https://github.com/bitcoin/bips/blob/master/bip-0141.mediawiki
|
||||||
|
|
||||||
|
// https://github.com/bitcoin/bitcoin/blob/306ccd4927a2efe325c8d84be1bdb79edeb29b04/
|
||||||
|
// src/policy/policy.cpp#L295-L298
|
||||||
|
// implements this as expected
|
||||||
|
|
||||||
|
// Technically, it takes whatever's greater, the weight or the amount of signature operations
|
||||||
|
// multiplied by DEFAULT_BYTES_PER_SIGOP (20)
|
||||||
|
// We only use 1 signature per input, and our inputs have a weight exceeding 20
|
||||||
|
// Accordingly, our inputs' weight will always be greater than the cost of the signature ops
|
||||||
|
let vsize = weight.div_ceil(4);
|
||||||
|
debug_assert_eq!(
|
||||||
|
u64::try_from(bitcoin::policy::get_virtual_tx_size(
|
||||||
|
weight.try_into().unwrap(),
|
||||||
|
tx_ins.len().try_into().unwrap()
|
||||||
|
))
|
||||||
|
.unwrap(),
|
||||||
|
vsize
|
||||||
|
);
|
||||||
// Technically, if there isn't change, this TX may still pay enough of a fee to pass the
|
// Technically, if there isn't change, this TX may still pay enough of a fee to pass the
|
||||||
// minimum fee. Such edge cases aren't worth programming when they go against intent, as the
|
// minimum fee. Such edge cases aren't worth programming when they go against intent, as the
|
||||||
// specified fee rate is too low to be valid
|
// specified fee rate is too low to be valid
|
||||||
// bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE is in sats/kilo-vbyte
|
// bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE is in sats/kilo-vbyte
|
||||||
if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vbytes) / 1000) {
|
if needed_fee < ((u64::from(bitcoin::policy::DEFAULT_MIN_RELAY_TX_FEE) * vsize) / 1000) {
|
||||||
Err(TransactionError::TooLowFee)?;
|
Err(TransactionError::TooLowFee)?;
|
||||||
}
|
}
|
||||||
|
|
||||||
if input_sat < (payment_sat + needed_fee) {
|
if input_sat < (payment_sat + needed_fee) {
|
||||||
Err(TransactionError::NotEnoughFunds {
|
Err(TransactionError::NotEnoughFunds)?;
|
||||||
inputs: input_sat,
|
|
||||||
payments: payment_sat,
|
|
||||||
fee: needed_fee,
|
|
||||||
})?;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
// If there's a change address, check if there's change to give it
|
// If there's a change address, check if there's change to give it
|
||||||
if let Some(change) = change {
|
if let Some(change) = change {
|
||||||
let (weight_with_change, vbytes_with_change) =
|
let weight_with_change = Self::calculate_weight(tx_ins.len(), payments, Some(change));
|
||||||
Self::calculate_weight_vbytes(tx_ins.len(), payments, Some(&change));
|
let fee_with_change = fee_per_weight * weight_with_change;
|
||||||
let fee_with_change = fee_per_vbyte * vbytes_with_change;
|
|
||||||
if let Some(value) = input_sat.checked_sub(payment_sat + fee_with_change) {
|
if let Some(value) = input_sat.checked_sub(payment_sat + fee_with_change) {
|
||||||
if value >= DUST {
|
if value >= DUST {
|
||||||
tx_outs.push(TxOut { value: Amount::from_sat(value), script_pubkey: change });
|
tx_outs
|
||||||
|
.push(TxOut { value: Amount::from_sat(value), script_pubkey: change.script_pubkey() });
|
||||||
weight = weight_with_change;
|
weight = weight_with_change;
|
||||||
needed_fee = fee_with_change;
|
needed_fee = fee_with_change;
|
||||||
}
|
}
|
||||||
@@ -257,28 +248,54 @@ impl SignableTransaction {
|
|||||||
|
|
||||||
/// Returns the TX ID of the transaction this will create.
|
/// Returns the TX ID of the transaction this will create.
|
||||||
pub fn txid(&self) -> [u8; 32] {
|
pub fn txid(&self) -> [u8; 32] {
|
||||||
let mut res = self.tx.compute_txid().to_byte_array();
|
let mut res = self.tx.txid().to_byte_array();
|
||||||
res.reverse();
|
res.reverse();
|
||||||
res
|
res
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Returns the transaction, sans witness, this will create if signed.
|
/// Returns the outputs this transaction will create.
|
||||||
pub fn transaction(&self) -> &Transaction {
|
pub fn outputs(&self) -> &[TxOut] {
|
||||||
&self.tx
|
&self.tx.output
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Create a multisig machine for this transaction.
|
/// Create a multisig machine for this transaction.
|
||||||
///
|
///
|
||||||
/// Returns None if the wrong keys are used.
|
/// Returns None if the wrong keys are used.
|
||||||
pub fn multisig(self, keys: &ThresholdKeys<Secp256k1>) -> Option<TransactionMachine> {
|
pub fn multisig(
|
||||||
|
self,
|
||||||
|
keys: &ThresholdKeys<Secp256k1>,
|
||||||
|
mut transcript: RecommendedTranscript,
|
||||||
|
) -> Option<TransactionMachine> {
|
||||||
|
transcript.domain_separate(b"bitcoin_transaction");
|
||||||
|
transcript.append_message(b"root_key", keys.group_key().to_encoded_point(true).as_bytes());
|
||||||
|
|
||||||
|
// Transcript the inputs and outputs
|
||||||
|
let tx = &self.tx;
|
||||||
|
for input in &tx.input {
|
||||||
|
transcript.append_message(b"input_hash", input.previous_output.txid);
|
||||||
|
transcript.append_message(b"input_output_index", input.previous_output.vout.to_le_bytes());
|
||||||
|
}
|
||||||
|
for payment in &tx.output {
|
||||||
|
transcript.append_message(b"output_script", payment.script_pubkey.as_bytes());
|
||||||
|
transcript.append_message(b"output_amount", payment.value.to_sat().to_le_bytes());
|
||||||
|
}
|
||||||
|
|
||||||
let mut sigs = vec![];
|
let mut sigs = vec![];
|
||||||
for i in 0 .. self.tx.input.len() {
|
for i in 0 .. tx.input.len() {
|
||||||
|
let mut transcript = transcript.clone();
|
||||||
|
// This unwrap is safe since any transaction with this many inputs violates the maximum
|
||||||
|
// size allowed under standards, which this lib will error on creation of
|
||||||
|
transcript.append_message(b"signing_input", u32::try_from(i).unwrap().to_le_bytes());
|
||||||
|
|
||||||
let offset = keys.clone().offset(self.offsets[i]);
|
let offset = keys.clone().offset(self.offsets[i]);
|
||||||
if p2tr_script_buf(offset.group_key())? != self.prevouts[i].script_pubkey {
|
if address_payload(offset.group_key())?.script_pubkey() != self.prevouts[i].script_pubkey {
|
||||||
None?;
|
None?;
|
||||||
}
|
}
|
||||||
|
|
||||||
sigs.push(AlgorithmMachine::new(Schnorr::new(), keys.clone().offset(self.offsets[i])));
|
sigs.push(AlgorithmMachine::new(
|
||||||
|
Schnorr::new(transcript),
|
||||||
|
keys.clone().offset(self.offsets[i]),
|
||||||
|
));
|
||||||
}
|
}
|
||||||
|
|
||||||
Some(TransactionMachine { tx: self, sigs })
|
Some(TransactionMachine { tx: self, sigs })
|
||||||
@@ -288,10 +305,10 @@ impl SignableTransaction {
|
|||||||
/// A FROST signing machine to produce a Bitcoin transaction.
|
/// A FROST signing machine to produce a Bitcoin transaction.
|
||||||
///
|
///
|
||||||
/// This does not support caching its preprocess. When sign is called, the message must be empty.
|
/// This does not support caching its preprocess. When sign is called, the message must be empty.
|
||||||
/// This will panic if either `cache`, `from_cache` is called or the message isn't empty.
|
/// This will panic if either `cache` is called or the message isn't empty.
|
||||||
pub struct TransactionMachine {
|
pub struct TransactionMachine {
|
||||||
tx: SignableTransaction,
|
tx: SignableTransaction,
|
||||||
sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr>>,
|
sigs: Vec<AlgorithmMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl PreprocessMachine for TransactionMachine {
|
impl PreprocessMachine for TransactionMachine {
|
||||||
@@ -320,7 +337,7 @@ impl PreprocessMachine for TransactionMachine {
|
|||||||
|
|
||||||
pub struct TransactionSignMachine {
|
pub struct TransactionSignMachine {
|
||||||
tx: SignableTransaction,
|
tx: SignableTransaction,
|
||||||
sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr>>,
|
sigs: Vec<AlgorithmSignMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl SignMachine<Transaction> for TransactionSignMachine {
|
impl SignMachine<Transaction> for TransactionSignMachine {
|
||||||
@@ -400,7 +417,7 @@ impl SignMachine<Transaction> for TransactionSignMachine {
|
|||||||
|
|
||||||
pub struct TransactionSignatureMachine {
|
pub struct TransactionSignatureMachine {
|
||||||
tx: Transaction,
|
tx: Transaction,
|
||||||
sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr>>,
|
sigs: Vec<AlgorithmSignatureMachine<Secp256k1, Schnorr<RecommendedTranscript>>>,
|
||||||
}
|
}
|
||||||
|
|
||||||
impl SignatureMachine<Transaction> for TransactionSignatureMachine {
|
impl SignatureMachine<Transaction> for TransactionSignatureMachine {
|
||||||
@@ -1,11 +1,14 @@
|
|||||||
use std::sync::LazyLock;
|
use std::sync::OnceLock;
|
||||||
|
|
||||||
use bitcoin_serai::rpc::Rpc;
|
use bitcoin_serai::rpc::Rpc;
|
||||||
|
|
||||||
use tokio::sync::Mutex;
|
use tokio::sync::Mutex;
|
||||||
|
|
||||||
#[allow(dead_code)]
|
static SEQUENTIAL_CELL: OnceLock<Mutex<()>> = OnceLock::new();
|
||||||
pub(crate) static SEQUENTIAL: LazyLock<Mutex<()>> = LazyLock::new(|| Mutex::new(()));
|
#[allow(non_snake_case)]
|
||||||
|
pub fn SEQUENTIAL() -> &'static Mutex<()> {
|
||||||
|
SEQUENTIAL_CELL.get_or_init(|| Mutex::new(()))
|
||||||
|
}
|
||||||
|
|
||||||
#[allow(dead_code)]
|
#[allow(dead_code)]
|
||||||
pub(crate) async fn rpc() -> Rpc {
|
pub(crate) async fn rpc() -> Rpc {
|
||||||
@@ -31,7 +34,7 @@ macro_rules! async_sequential {
|
|||||||
$(
|
$(
|
||||||
#[tokio::test]
|
#[tokio::test]
|
||||||
async fn $name() {
|
async fn $name() {
|
||||||
let guard = runner::SEQUENTIAL.lock().await;
|
let guard = runner::SEQUENTIAL().lock().await;
|
||||||
let local = tokio::task::LocalSet::new();
|
let local = tokio::task::LocalSet::new();
|
||||||
local.run_until(async move {
|
local.run_until(async move {
|
||||||
if let Err(err) = tokio::task::spawn_local(async move { $body }).await {
|
if let Err(err) = tokio::task::spawn_local(async move { $body }).await {
|
||||||
@@ -2,6 +2,8 @@ use std::collections::HashMap;
|
|||||||
|
|
||||||
use rand_core::{RngCore, OsRng};
|
use rand_core::{RngCore, OsRng};
|
||||||
|
|
||||||
|
use transcript::{Transcript, RecommendedTranscript};
|
||||||
|
|
||||||
use k256::{
|
use k256::{
|
||||||
elliptic_curve::{
|
elliptic_curve::{
|
||||||
group::{ff::Field, Group},
|
group::{ff::Field, Group},
|
||||||
@@ -20,10 +22,11 @@ use bitcoin_serai::{
|
|||||||
hashes::Hash as HashTrait,
|
hashes::Hash as HashTrait,
|
||||||
blockdata::opcodes::all::OP_RETURN,
|
blockdata::opcodes::all::OP_RETURN,
|
||||||
script::{PushBytesBuf, Instruction, Instructions, Script},
|
script::{PushBytesBuf, Instruction, Instructions, Script},
|
||||||
|
address::NetworkChecked,
|
||||||
OutPoint, Amount, TxOut, Transaction, Network, Address,
|
OutPoint, Amount, TxOut, Transaction, Network, Address,
|
||||||
},
|
},
|
||||||
wallet::{
|
wallet::{
|
||||||
tweak_keys, p2tr_script_buf, ReceivedOutput, Scanner, TransactionError, SignableTransaction,
|
tweak_keys, address_payload, ReceivedOutput, Scanner, TransactionError, SignableTransaction,
|
||||||
},
|
},
|
||||||
rpc::Rpc,
|
rpc::Rpc,
|
||||||
};
|
};
|
||||||
@@ -45,7 +48,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
|||||||
"generatetoaddress",
|
"generatetoaddress",
|
||||||
serde_json::json!([
|
serde_json::json!([
|
||||||
1,
|
1,
|
||||||
Address::from_script(&p2tr_script_buf(key).unwrap(), Network::Regtest).unwrap()
|
Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())
|
||||||
]),
|
]),
|
||||||
)
|
)
|
||||||
.await
|
.await
|
||||||
@@ -66,7 +69,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
|||||||
assert_eq!(outputs, scanner.scan_transaction(&block.txdata[0]));
|
assert_eq!(outputs, scanner.scan_transaction(&block.txdata[0]));
|
||||||
|
|
||||||
assert_eq!(outputs.len(), 1);
|
assert_eq!(outputs.len(), 1);
|
||||||
assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].compute_txid(), 0));
|
assert_eq!(outputs[0].outpoint(), &OutPoint::new(block.txdata[0].txid(), 0));
|
||||||
assert_eq!(outputs[0].value(), block.txdata[0].output[0].value.to_sat());
|
assert_eq!(outputs[0].value(), block.txdata[0].output[0].value.to_sat());
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
@@ -80,7 +83,7 @@ async fn send_and_get_output(rpc: &Rpc, scanner: &Scanner, key: ProjectivePoint)
|
|||||||
fn keys() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, ProjectivePoint) {
|
fn keys() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, ProjectivePoint) {
|
||||||
let mut keys = key_gen(&mut OsRng);
|
let mut keys = key_gen(&mut OsRng);
|
||||||
for keys in keys.values_mut() {
|
for keys in keys.values_mut() {
|
||||||
*keys = tweak_keys(keys.clone());
|
*keys = tweak_keys(keys);
|
||||||
}
|
}
|
||||||
let key = keys.values().next().unwrap().group_key();
|
let key = keys.values().next().unwrap().group_key();
|
||||||
(keys, key)
|
(keys, key)
|
||||||
@@ -92,11 +95,46 @@ fn sign(
|
|||||||
) -> Transaction {
|
) -> Transaction {
|
||||||
let mut machines = HashMap::new();
|
let mut machines = HashMap::new();
|
||||||
for i in (1 ..= THRESHOLD).map(|i| Participant::new(i).unwrap()) {
|
for i in (1 ..= THRESHOLD).map(|i| Participant::new(i).unwrap()) {
|
||||||
machines.insert(i, tx.clone().multisig(&keys[&i].clone()).unwrap());
|
machines.insert(
|
||||||
|
i,
|
||||||
|
tx.clone()
|
||||||
|
.multisig(&keys[&i].clone(), RecommendedTranscript::new(b"bitcoin-serai Test Transaction"))
|
||||||
|
.unwrap(),
|
||||||
|
);
|
||||||
}
|
}
|
||||||
sign_without_caching(&mut OsRng, machines, &[])
|
sign_without_caching(&mut OsRng, machines, &[])
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn test_tweak_keys() {
|
||||||
|
let mut even = false;
|
||||||
|
let mut odd = false;
|
||||||
|
|
||||||
|
// Generate keys until we get an even set and an odd set
|
||||||
|
while !(even && odd) {
|
||||||
|
let mut keys = key_gen(&mut OsRng).drain().next().unwrap().1;
|
||||||
|
if is_even(keys.group_key()) {
|
||||||
|
// Tweaking should do nothing
|
||||||
|
assert_eq!(tweak_keys(&keys).group_key(), keys.group_key());
|
||||||
|
|
||||||
|
even = true;
|
||||||
|
} else {
|
||||||
|
let tweaked = tweak_keys(&keys).group_key();
|
||||||
|
assert_ne!(tweaked, keys.group_key());
|
||||||
|
// Tweaking should produce an even key
|
||||||
|
assert!(is_even(tweaked));
|
||||||
|
|
||||||
|
// Verify it uses the smallest possible offset
|
||||||
|
while keys.group_key().to_encoded_point(true).tag() == Tag::CompressedOddY {
|
||||||
|
keys = keys.offset(Scalar::ONE);
|
||||||
|
}
|
||||||
|
assert_eq!(tweaked, keys.group_key());
|
||||||
|
|
||||||
|
odd = true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
async_sequential! {
|
async_sequential! {
|
||||||
async fn test_scanner() {
|
async fn test_scanner() {
|
||||||
// Test Scanners are creatable for even keys.
|
// Test Scanners are creatable for even keys.
|
||||||
@@ -155,7 +193,7 @@ async_sequential! {
|
|||||||
assert_eq!(output.offset(), Scalar::ZERO);
|
assert_eq!(output.offset(), Scalar::ZERO);
|
||||||
|
|
||||||
let inputs = vec![output];
|
let inputs = vec![output];
|
||||||
let addr = || p2tr_script_buf(key).unwrap();
|
let addr = || Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap());
|
||||||
let payments = vec![(addr(), 1000)];
|
let payments = vec![(addr(), 1000)];
|
||||||
|
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &payments, None, None, FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &payments, None, None, FEE).is_ok());
|
||||||
@@ -168,7 +206,7 @@ async_sequential! {
|
|||||||
// No change
|
// No change
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &[(addr(), 1000)], None, None, FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &[(addr(), 1000)], None, None, FEE).is_ok());
|
||||||
// Consolidation TX
|
// Consolidation TX
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, FEE).is_ok());
|
||||||
// Data
|
// Data
|
||||||
assert!(SignableTransaction::new(inputs.clone(), &[], None, Some(vec![]), FEE).is_ok());
|
assert!(SignableTransaction::new(inputs.clone(), &[], None, Some(vec![]), FEE).is_ok());
|
||||||
// No outputs
|
// No outputs
|
||||||
@@ -191,14 +229,14 @@ async_sequential! {
|
|||||||
);
|
);
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
SignableTransaction::new(inputs.clone(), &[], Some(addr()), None, 0),
|
SignableTransaction::new(inputs.clone(), &[], Some(&addr()), None, 0),
|
||||||
Err(TransactionError::TooLowFee),
|
Err(TransactionError::TooLowFee),
|
||||||
);
|
);
|
||||||
|
|
||||||
assert!(matches!(
|
assert_eq!(
|
||||||
SignableTransaction::new(inputs.clone(), &[(addr(), inputs[0].value() * 2)], None, None, FEE),
|
SignableTransaction::new(inputs.clone(), &[(addr(), inputs[0].value() * 2)], None, None, FEE),
|
||||||
Err(TransactionError::NotEnoughFunds { .. }),
|
Err(TransactionError::NotEnoughFunds),
|
||||||
));
|
);
|
||||||
|
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
SignableTransaction::new(inputs, &vec![(addr(), 1000); 10000], None, None, FEE),
|
SignableTransaction::new(inputs, &vec![(addr(), 1000); 10000], None, None, FEE),
|
||||||
@@ -223,19 +261,20 @@ async_sequential! {
|
|||||||
|
|
||||||
// Declare payments, change, fee
|
// Declare payments, change, fee
|
||||||
let payments = [
|
let payments = [
|
||||||
(p2tr_script_buf(key).unwrap(), 1005),
|
(Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap()), 1005),
|
||||||
(p2tr_script_buf(offset_key).unwrap(), 1007)
|
(Address::<NetworkChecked>::new(Network::Regtest, address_payload(offset_key).unwrap()), 1007)
|
||||||
];
|
];
|
||||||
|
|
||||||
let change_offset = scanner.register_offset(Scalar::random(&mut OsRng)).unwrap();
|
let change_offset = scanner.register_offset(Scalar::random(&mut OsRng)).unwrap();
|
||||||
let change_key = key + (ProjectivePoint::GENERATOR * change_offset);
|
let change_key = key + (ProjectivePoint::GENERATOR * change_offset);
|
||||||
let change_addr = p2tr_script_buf(change_key).unwrap();
|
let change_addr =
|
||||||
|
Address::<NetworkChecked>::new(Network::Regtest, address_payload(change_key).unwrap());
|
||||||
|
|
||||||
// Create and sign the TX
|
// Create and sign the TX
|
||||||
let tx = SignableTransaction::new(
|
let tx = SignableTransaction::new(
|
||||||
vec![output.clone(), offset_output.clone()],
|
vec![output.clone(), offset_output.clone()],
|
||||||
&payments,
|
&payments,
|
||||||
Some(change_addr.clone()),
|
Some(&change_addr),
|
||||||
None,
|
None,
|
||||||
FEE
|
FEE
|
||||||
).unwrap();
|
).unwrap();
|
||||||
@@ -248,7 +287,7 @@ async_sequential! {
|
|||||||
// Ensure we can scan it
|
// Ensure we can scan it
|
||||||
let outputs = scanner.scan_transaction(&tx);
|
let outputs = scanner.scan_transaction(&tx);
|
||||||
for (o, output) in outputs.iter().enumerate() {
|
for (o, output) in outputs.iter().enumerate() {
|
||||||
assert_eq!(output.outpoint(), &OutPoint::new(tx.compute_txid(), u32::try_from(o).unwrap()));
|
assert_eq!(output.outpoint(), &OutPoint::new(tx.txid(), u32::try_from(o).unwrap()));
|
||||||
assert_eq!(&ReceivedOutput::read::<&[u8]>(&mut output.serialize().as_ref()).unwrap(), output);
|
assert_eq!(&ReceivedOutput::read::<&[u8]>(&mut output.serialize().as_ref()).unwrap(), output);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -260,13 +299,13 @@ async_sequential! {
|
|||||||
for ((output, scanned), payment) in tx.output.iter().zip(outputs.iter()).zip(payments.iter()) {
|
for ((output, scanned), payment) in tx.output.iter().zip(outputs.iter()).zip(payments.iter()) {
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
output,
|
output,
|
||||||
&TxOut { script_pubkey: payment.0.clone(), value: Amount::from_sat(payment.1) },
|
&TxOut { script_pubkey: payment.0.script_pubkey(), value: Amount::from_sat(payment.1) },
|
||||||
);
|
);
|
||||||
assert_eq!(scanned.value(), payment.1 );
|
assert_eq!(scanned.value(), payment.1 );
|
||||||
}
|
}
|
||||||
|
|
||||||
// Make sure the change is correct
|
// Make sure the change is correct
|
||||||
assert_eq!(needed_fee, u64::try_from(tx.vsize()).unwrap() * FEE);
|
assert_eq!(needed_fee, u64::from(tx.weight()) * FEE);
|
||||||
let input_value = output.value() + offset_output.value();
|
let input_value = output.value() + offset_output.value();
|
||||||
let output_value = tx.output.iter().map(|output| output.value.to_sat()).sum::<u64>();
|
let output_value = tx.output.iter().map(|output| output.value.to_sat()).sum::<u64>();
|
||||||
assert_eq!(input_value - output_value, needed_fee);
|
assert_eq!(input_value - output_value, needed_fee);
|
||||||
@@ -275,13 +314,13 @@ async_sequential! {
|
|||||||
input_value - payments.iter().map(|payment| payment.1).sum::<u64>() - needed_fee;
|
input_value - payments.iter().map(|payment| payment.1).sum::<u64>() - needed_fee;
|
||||||
assert_eq!(
|
assert_eq!(
|
||||||
tx.output[2],
|
tx.output[2],
|
||||||
TxOut { script_pubkey: change_addr, value: Amount::from_sat(change_amount) },
|
TxOut { script_pubkey: change_addr.script_pubkey(), value: Amount::from_sat(change_amount) },
|
||||||
);
|
);
|
||||||
|
|
||||||
// This also tests send_raw_transaction and get_transaction, which the RPC test can't
|
// This also tests send_raw_transaction and get_transaction, which the RPC test can't
|
||||||
// effectively test
|
// effectively test
|
||||||
rpc.send_raw_transaction(&tx).await.unwrap();
|
rpc.send_raw_transaction(&tx).await.unwrap();
|
||||||
let mut hash = *tx.compute_txid().as_raw_hash().as_byte_array();
|
let mut hash = *tx.txid().as_raw_hash().as_byte_array();
|
||||||
hash.reverse();
|
hash.reverse();
|
||||||
assert_eq!(tx, rpc.get_transaction(&hash).await.unwrap());
|
assert_eq!(tx, rpc.get_transaction(&hash).await.unwrap());
|
||||||
assert_eq!(expected_id, hash);
|
assert_eq!(expected_id, hash);
|
||||||
@@ -305,7 +344,7 @@ async_sequential! {
|
|||||||
&SignableTransaction::new(
|
&SignableTransaction::new(
|
||||||
vec![output],
|
vec![output],
|
||||||
&[],
|
&[],
|
||||||
Some(p2tr_script_buf(key).unwrap()),
|
Some(&Address::<NetworkChecked>::new(Network::Regtest, address_payload(key).unwrap())),
|
||||||
Some(data.clone()),
|
Some(data.clone()),
|
||||||
FEE
|
FEE
|
||||||
).unwrap()
|
).unwrap()
|
||||||
@@ -3,11 +3,11 @@ name = "ethereum-serai"
|
|||||||
version = "0.1.0"
|
version = "0.1.0"
|
||||||
description = "An Ethereum library supporting Schnorr signing and on-chain verification"
|
description = "An Ethereum library supporting Schnorr signing and on-chain verification"
|
||||||
license = "AGPL-3.0-only"
|
license = "AGPL-3.0-only"
|
||||||
repository = "https://github.com/serai-dex/serai/tree/develop/networks/ethereum"
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/ethereum"
|
||||||
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Elizabeth Binks <elizabethjbinks@gmail.com>"]
|
authors = ["Luke Parker <lukeparker5132@gmail.com>", "Elizabeth Binks <elizabethjbinks@gmail.com>"]
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
publish = false
|
publish = false
|
||||||
rust-version = "1.79"
|
rust-version = "1.74"
|
||||||
|
|
||||||
[package.metadata.docs.rs]
|
[package.metadata.docs.rs]
|
||||||
all-features = true
|
all-features = true
|
||||||
@@ -27,23 +27,20 @@ group = { version = "0.13", default-features = false }
|
|||||||
k256 = { version = "^0.13.1", default-features = false, features = ["std", "ecdsa", "arithmetic"] }
|
k256 = { version = "^0.13.1", default-features = false, features = ["std", "ecdsa", "arithmetic"] }
|
||||||
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["secp256k1"] }
|
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["secp256k1"] }
|
||||||
|
|
||||||
alloy-core = { version = "0.8", default-features = false }
|
alloy-core = { version = "0.7", default-features = false }
|
||||||
alloy-sol-types = { version = "0.8", default-features = false, features = ["json"] }
|
alloy-sol-types = { version = "0.7", default-features = false, features = ["json"] }
|
||||||
alloy-consensus = { version = "0.4", default-features = false, features = ["k256"] }
|
alloy-consensus = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false, features = ["k256"] }
|
||||||
alloy-network = { version = "0.4", default-features = false }
|
alloy-rpc-types = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
alloy-rpc-types-eth = { version = "0.4", default-features = false }
|
alloy-rpc-client = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
alloy-rpc-client = { version = "0.4", default-features = false }
|
|
||||||
alloy-simple-request-transport = { path = "./alloy-simple-request-transport", default-features = false }
|
alloy-simple-request-transport = { path = "./alloy-simple-request-transport", default-features = false }
|
||||||
alloy-provider = { version = "0.4", default-features = false }
|
alloy-provider = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
|
||||||
alloy-node-bindings = { version = "0.4", default-features = false, optional = true }
|
|
||||||
|
|
||||||
[dev-dependencies]
|
[dev-dependencies]
|
||||||
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["tests"] }
|
frost = { package = "modular-frost", path = "../../crypto/frost", default-features = false, features = ["tests"] }
|
||||||
|
|
||||||
tokio = { version = "1", features = ["macros"] }
|
tokio = { version = "1", features = ["macros"] }
|
||||||
|
|
||||||
alloy-node-bindings = { version = "0.4", default-features = false }
|
alloy-node-bindings = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
tests = ["alloy-node-bindings", "frost/tests"]
|
tests = []
|
||||||
15
coins/ethereum/README.md
Normal file
15
coins/ethereum/README.md
Normal file
@@ -0,0 +1,15 @@
|
|||||||
|
# Ethereum
|
||||||
|
|
||||||
|
This package contains Ethereum-related functionality, specifically deploying and
|
||||||
|
interacting with Serai contracts.
|
||||||
|
|
||||||
|
While `monero-serai` and `bitcoin-serai` are general purpose libraries,
|
||||||
|
`ethereum-serai` is Serai specific. If any of the utilities are generally
|
||||||
|
desired, please fork and maintain your own copy to ensure the desired
|
||||||
|
functionality is preserved, or open an issue to request we make this library
|
||||||
|
general purpose.
|
||||||
|
|
||||||
|
### Dependencies
|
||||||
|
|
||||||
|
- solc
|
||||||
|
- [Foundry](https://github.com/foundry-rs/foundry)
|
||||||
@@ -3,7 +3,7 @@ name = "alloy-simple-request-transport"
|
|||||||
version = "0.1.0"
|
version = "0.1.0"
|
||||||
description = "A transport for alloy based off simple-request"
|
description = "A transport for alloy based off simple-request"
|
||||||
license = "MIT"
|
license = "MIT"
|
||||||
repository = "https://github.com/serai-dex/serai/tree/develop/networks/ethereum/alloy-simple-request-transport"
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/ethereum/alloy-simple-request-transport"
|
||||||
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||||
edition = "2021"
|
edition = "2021"
|
||||||
rust-version = "1.74"
|
rust-version = "1.74"
|
||||||
@@ -16,13 +16,13 @@ rustdoc-args = ["--cfg", "docsrs"]
|
|||||||
workspace = true
|
workspace = true
|
||||||
|
|
||||||
[dependencies]
|
[dependencies]
|
||||||
tower = "0.5"
|
tower = "0.4"
|
||||||
|
|
||||||
serde_json = { version = "1", default-features = false }
|
serde_json = { version = "1", default-features = false }
|
||||||
simple-request = { path = "../../../common/request", default-features = false }
|
simple-request = { path = "../../../common/request", default-features = false }
|
||||||
|
|
||||||
alloy-json-rpc = { version = "0.4", default-features = false }
|
alloy-json-rpc = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
alloy-transport = { version = "0.4", default-features = false }
|
alloy-transport = { git = "https://github.com/alloy-rs/alloy", rev = "037dd4b20ec8533d6b6d5cf5e9489bbb182c18c6", default-features = false }
|
||||||
|
|
||||||
[features]
|
[features]
|
||||||
default = ["tls"]
|
default = ["tls"]
|
||||||
@@ -1,4 +1,4 @@
|
|||||||
#![cfg_attr(docsrs, feature(doc_cfg))]
|
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
|
||||||
#![doc = include_str!("../README.md")]
|
#![doc = include_str!("../README.md")]
|
||||||
|
|
||||||
use core::task;
|
use core::task;
|
||||||
@@ -10,7 +10,7 @@ fn main() {
|
|||||||
{
|
{
|
||||||
if let Some(version) = line.strip_prefix("Version: ") {
|
if let Some(version) = line.strip_prefix("Version: ") {
|
||||||
let version = version.split('+').next().unwrap();
|
let version = version.split('+').next().unwrap();
|
||||||
assert_eq!(version, "0.8.26");
|
assert_eq!(version, "0.8.25");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
1164
coins/ethereum/src/abi/router.rs
Normal file
1164
coins/ethereum/src/abi/router.rs
Normal file
File diff suppressed because it is too large
Load Diff
410
coins/ethereum/src/abi/schnorr.rs
Normal file
410
coins/ethereum/src/abi/schnorr.rs
Normal file
@@ -0,0 +1,410 @@
|
|||||||
|
pub use schnorr::*;
|
||||||
|
/// This module was auto-generated with ethers-rs Abigen.
|
||||||
|
/// More information at: <https://github.com/gakonst/ethers-rs>
|
||||||
|
#[allow(
|
||||||
|
clippy::enum_variant_names,
|
||||||
|
clippy::too_many_arguments,
|
||||||
|
clippy::upper_case_acronyms,
|
||||||
|
clippy::type_complexity,
|
||||||
|
dead_code,
|
||||||
|
non_camel_case_types,
|
||||||
|
)]
|
||||||
|
pub mod schnorr {
|
||||||
|
#[allow(deprecated)]
|
||||||
|
fn __abi() -> ::ethers_core::abi::Abi {
|
||||||
|
::ethers_core::abi::ethabi::Contract {
|
||||||
|
constructor: ::core::option::Option::None,
|
||||||
|
functions: ::core::convert::From::from([
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("Q"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Function {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("Q"),
|
||||||
|
inputs: ::std::vec![],
|
||||||
|
outputs: ::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::string::String::new(),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::Uint(256usize),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("uint256"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
constant: ::core::option::Option::None,
|
||||||
|
state_mutability: ::ethers_core::abi::ethabi::StateMutability::View,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("verify"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Function {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("verify"),
|
||||||
|
inputs: ::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("parity"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::Uint(8usize),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("uint8"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("px"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("message"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("c"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("s"),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::FixedBytes(
|
||||||
|
32usize,
|
||||||
|
),
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bytes32"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
outputs: ::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::Param {
|
||||||
|
name: ::std::string::String::new(),
|
||||||
|
kind: ::ethers_core::abi::ethabi::ParamType::Bool,
|
||||||
|
internal_type: ::core::option::Option::Some(
|
||||||
|
::std::borrow::ToOwned::to_owned("bool"),
|
||||||
|
),
|
||||||
|
},
|
||||||
|
],
|
||||||
|
constant: ::core::option::Option::None,
|
||||||
|
state_mutability: ::ethers_core::abi::ethabi::StateMutability::View,
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
]),
|
||||||
|
events: ::std::collections::BTreeMap::new(),
|
||||||
|
errors: ::core::convert::From::from([
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("InvalidSOrA"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::AbiError {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("InvalidSOrA"),
|
||||||
|
inputs: ::std::vec![],
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
(
|
||||||
|
::std::borrow::ToOwned::to_owned("InvalidSignature"),
|
||||||
|
::std::vec![
|
||||||
|
::ethers_core::abi::ethabi::AbiError {
|
||||||
|
name: ::std::borrow::ToOwned::to_owned("InvalidSignature"),
|
||||||
|
inputs: ::std::vec![],
|
||||||
|
},
|
||||||
|
],
|
||||||
|
),
|
||||||
|
]),
|
||||||
|
receive: false,
|
||||||
|
fallback: false,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///The parsed JSON ABI of the contract.
|
||||||
|
pub static SCHNORR_ABI: ::ethers_contract::Lazy<::ethers_core::abi::Abi> = ::ethers_contract::Lazy::new(
|
||||||
|
__abi,
|
||||||
|
);
|
||||||
|
pub struct Schnorr<M>(::ethers_contract::Contract<M>);
|
||||||
|
impl<M> ::core::clone::Clone for Schnorr<M> {
|
||||||
|
fn clone(&self) -> Self {
|
||||||
|
Self(::core::clone::Clone::clone(&self.0))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M> ::core::ops::Deref for Schnorr<M> {
|
||||||
|
type Target = ::ethers_contract::Contract<M>;
|
||||||
|
fn deref(&self) -> &Self::Target {
|
||||||
|
&self.0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M> ::core::ops::DerefMut for Schnorr<M> {
|
||||||
|
fn deref_mut(&mut self) -> &mut Self::Target {
|
||||||
|
&mut self.0
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M> ::core::fmt::Debug for Schnorr<M> {
|
||||||
|
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
|
||||||
|
f.debug_tuple(::core::stringify!(Schnorr)).field(&self.address()).finish()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M: ::ethers_providers::Middleware> Schnorr<M> {
|
||||||
|
/// Creates a new contract instance with the specified `ethers` client at
|
||||||
|
/// `address`. The contract derefs to a `ethers::Contract` object.
|
||||||
|
pub fn new<T: Into<::ethers_core::types::Address>>(
|
||||||
|
address: T,
|
||||||
|
client: ::std::sync::Arc<M>,
|
||||||
|
) -> Self {
|
||||||
|
Self(
|
||||||
|
::ethers_contract::Contract::new(
|
||||||
|
address.into(),
|
||||||
|
SCHNORR_ABI.clone(),
|
||||||
|
client,
|
||||||
|
),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
///Calls the contract's `Q` (0xe493ef8c) function
|
||||||
|
pub fn q(
|
||||||
|
&self,
|
||||||
|
) -> ::ethers_contract::builders::ContractCall<M, ::ethers_core::types::U256> {
|
||||||
|
self.0
|
||||||
|
.method_hash([228, 147, 239, 140], ())
|
||||||
|
.expect("method not found (this should never happen)")
|
||||||
|
}
|
||||||
|
///Calls the contract's `verify` (0x9186da4c) function
|
||||||
|
pub fn verify(
|
||||||
|
&self,
|
||||||
|
parity: u8,
|
||||||
|
px: [u8; 32],
|
||||||
|
message: [u8; 32],
|
||||||
|
c: [u8; 32],
|
||||||
|
s: [u8; 32],
|
||||||
|
) -> ::ethers_contract::builders::ContractCall<M, bool> {
|
||||||
|
self.0
|
||||||
|
.method_hash([145, 134, 218, 76], (parity, px, message, c, s))
|
||||||
|
.expect("method not found (this should never happen)")
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl<M: ::ethers_providers::Middleware> From<::ethers_contract::Contract<M>>
|
||||||
|
for Schnorr<M> {
|
||||||
|
fn from(contract: ::ethers_contract::Contract<M>) -> Self {
|
||||||
|
Self::new(contract.address(), contract.client())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///Custom Error type `InvalidSOrA` with signature `InvalidSOrA()` and selector `0x4e99a12e`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthError,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[etherror(name = "InvalidSOrA", abi = "InvalidSOrA()")]
|
||||||
|
pub struct InvalidSOrA;
|
||||||
|
///Custom Error type `InvalidSignature` with signature `InvalidSignature()` and selector `0x8baa579f`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthError,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[etherror(name = "InvalidSignature", abi = "InvalidSignature()")]
|
||||||
|
pub struct InvalidSignature;
|
||||||
|
///Container type for all of the contract's custom errors
|
||||||
|
#[derive(Clone, ::ethers_contract::EthAbiType, Debug, PartialEq, Eq, Hash)]
|
||||||
|
pub enum SchnorrErrors {
|
||||||
|
InvalidSOrA(InvalidSOrA),
|
||||||
|
InvalidSignature(InvalidSignature),
|
||||||
|
/// The standard solidity revert string, with selector
|
||||||
|
/// Error(string) -- 0x08c379a0
|
||||||
|
RevertString(::std::string::String),
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiDecode for SchnorrErrors {
|
||||||
|
fn decode(
|
||||||
|
data: impl AsRef<[u8]>,
|
||||||
|
) -> ::core::result::Result<Self, ::ethers_core::abi::AbiError> {
|
||||||
|
let data = data.as_ref();
|
||||||
|
if let Ok(decoded) = <::std::string::String as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::RevertString(decoded));
|
||||||
|
}
|
||||||
|
if let Ok(decoded) = <InvalidSOrA as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::InvalidSOrA(decoded));
|
||||||
|
}
|
||||||
|
if let Ok(decoded) = <InvalidSignature as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::InvalidSignature(decoded));
|
||||||
|
}
|
||||||
|
Err(::ethers_core::abi::Error::InvalidData.into())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiEncode for SchnorrErrors {
|
||||||
|
fn encode(self) -> ::std::vec::Vec<u8> {
|
||||||
|
match self {
|
||||||
|
Self::InvalidSOrA(element) => {
|
||||||
|
::ethers_core::abi::AbiEncode::encode(element)
|
||||||
|
}
|
||||||
|
Self::InvalidSignature(element) => {
|
||||||
|
::ethers_core::abi::AbiEncode::encode(element)
|
||||||
|
}
|
||||||
|
Self::RevertString(s) => ::ethers_core::abi::AbiEncode::encode(s),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::ethers_contract::ContractRevert for SchnorrErrors {
|
||||||
|
fn valid_selector(selector: [u8; 4]) -> bool {
|
||||||
|
match selector {
|
||||||
|
[0x08, 0xc3, 0x79, 0xa0] => true,
|
||||||
|
_ if selector
|
||||||
|
== <InvalidSOrA as ::ethers_contract::EthError>::selector() => true,
|
||||||
|
_ if selector
|
||||||
|
== <InvalidSignature as ::ethers_contract::EthError>::selector() => {
|
||||||
|
true
|
||||||
|
}
|
||||||
|
_ => false,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::fmt::Display for SchnorrErrors {
|
||||||
|
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::InvalidSOrA(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
Self::InvalidSignature(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
Self::RevertString(s) => ::core::fmt::Display::fmt(s, f),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<::std::string::String> for SchnorrErrors {
|
||||||
|
fn from(value: String) -> Self {
|
||||||
|
Self::RevertString(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<InvalidSOrA> for SchnorrErrors {
|
||||||
|
fn from(value: InvalidSOrA) -> Self {
|
||||||
|
Self::InvalidSOrA(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<InvalidSignature> for SchnorrErrors {
|
||||||
|
fn from(value: InvalidSignature) -> Self {
|
||||||
|
Self::InvalidSignature(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///Container type for all input parameters for the `Q` function with signature `Q()` and selector `0xe493ef8c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthCall,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[ethcall(name = "Q", abi = "Q()")]
|
||||||
|
pub struct QCall;
|
||||||
|
///Container type for all input parameters for the `verify` function with signature `verify(uint8,bytes32,bytes32,bytes32,bytes32)` and selector `0x9186da4c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthCall,
|
||||||
|
::ethers_contract::EthDisplay,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
#[ethcall(name = "verify", abi = "verify(uint8,bytes32,bytes32,bytes32,bytes32)")]
|
||||||
|
pub struct VerifyCall {
|
||||||
|
pub parity: u8,
|
||||||
|
pub px: [u8; 32],
|
||||||
|
pub message: [u8; 32],
|
||||||
|
pub c: [u8; 32],
|
||||||
|
pub s: [u8; 32],
|
||||||
|
}
|
||||||
|
///Container type for all of the contract's call
|
||||||
|
#[derive(Clone, ::ethers_contract::EthAbiType, Debug, PartialEq, Eq, Hash)]
|
||||||
|
pub enum SchnorrCalls {
|
||||||
|
Q(QCall),
|
||||||
|
Verify(VerifyCall),
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiDecode for SchnorrCalls {
|
||||||
|
fn decode(
|
||||||
|
data: impl AsRef<[u8]>,
|
||||||
|
) -> ::core::result::Result<Self, ::ethers_core::abi::AbiError> {
|
||||||
|
let data = data.as_ref();
|
||||||
|
if let Ok(decoded) = <QCall as ::ethers_core::abi::AbiDecode>::decode(data) {
|
||||||
|
return Ok(Self::Q(decoded));
|
||||||
|
}
|
||||||
|
if let Ok(decoded) = <VerifyCall as ::ethers_core::abi::AbiDecode>::decode(
|
||||||
|
data,
|
||||||
|
) {
|
||||||
|
return Ok(Self::Verify(decoded));
|
||||||
|
}
|
||||||
|
Err(::ethers_core::abi::Error::InvalidData.into())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::ethers_core::abi::AbiEncode for SchnorrCalls {
|
||||||
|
fn encode(self) -> Vec<u8> {
|
||||||
|
match self {
|
||||||
|
Self::Q(element) => ::ethers_core::abi::AbiEncode::encode(element),
|
||||||
|
Self::Verify(element) => ::ethers_core::abi::AbiEncode::encode(element),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::fmt::Display for SchnorrCalls {
|
||||||
|
fn fmt(&self, f: &mut ::core::fmt::Formatter<'_>) -> ::core::fmt::Result {
|
||||||
|
match self {
|
||||||
|
Self::Q(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
Self::Verify(element) => ::core::fmt::Display::fmt(element, f),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<QCall> for SchnorrCalls {
|
||||||
|
fn from(value: QCall) -> Self {
|
||||||
|
Self::Q(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
impl ::core::convert::From<VerifyCall> for SchnorrCalls {
|
||||||
|
fn from(value: VerifyCall) -> Self {
|
||||||
|
Self::Verify(value)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
///Container type for all return fields from the `Q` function with signature `Q()` and selector `0xe493ef8c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthAbiType,
|
||||||
|
::ethers_contract::EthAbiCodec,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
pub struct QReturn(pub ::ethers_core::types::U256);
|
||||||
|
///Container type for all return fields from the `verify` function with signature `verify(uint8,bytes32,bytes32,bytes32,bytes32)` and selector `0x9186da4c`
|
||||||
|
#[derive(
|
||||||
|
Clone,
|
||||||
|
::ethers_contract::EthAbiType,
|
||||||
|
::ethers_contract::EthAbiCodec,
|
||||||
|
Default,
|
||||||
|
Debug,
|
||||||
|
PartialEq,
|
||||||
|
Eq,
|
||||||
|
Hash
|
||||||
|
)]
|
||||||
|
pub struct VerifyReturn(pub bool);
|
||||||
|
}
|
||||||
@@ -1,5 +1,3 @@
|
|||||||
#![allow(deprecated)]
|
|
||||||
|
|
||||||
use group::ff::PrimeField;
|
use group::ff::PrimeField;
|
||||||
use k256::{
|
use k256::{
|
||||||
elliptic_curve::{ops::Reduce, point::AffineCoordinates, sec1::ToEncodedPoint},
|
elliptic_curve::{ops::Reduce, point::AffineCoordinates, sec1::ToEncodedPoint},
|
||||||
@@ -33,10 +31,7 @@ pub fn address(point: &ProjectivePoint) -> [u8; 20] {
|
|||||||
keccak256(&encoded_point.as_ref()[1 .. 65])[12 ..].try_into().unwrap()
|
keccak256(&encoded_point.as_ref()[1 .. 65])[12 ..].try_into().unwrap()
|
||||||
}
|
}
|
||||||
|
|
||||||
/// Deterministically sign a transaction.
|
pub(crate) fn deterministically_sign(tx: &TxLegacy) -> Signed<TxLegacy> {
|
||||||
///
|
|
||||||
/// This function panics if passed a transaction with a non-None chain ID.
|
|
||||||
pub fn deterministically_sign(tx: &TxLegacy) -> Signed<TxLegacy> {
|
|
||||||
assert!(
|
assert!(
|
||||||
tx.chain_id.is_none(),
|
tx.chain_id.is_none(),
|
||||||
"chain ID was Some when deterministically signing a TX (causing a non-deterministic signer)"
|
"chain ID was Some when deterministically signing a TX (causing a non-deterministic signer)"
|
||||||
@@ -5,7 +5,7 @@ use alloy_consensus::{Signed, TxLegacy};
|
|||||||
|
|
||||||
use alloy_sol_types::{SolCall, SolEvent};
|
use alloy_sol_types::{SolCall, SolEvent};
|
||||||
|
|
||||||
use alloy_rpc_types_eth::{BlockNumberOrTag, Filter};
|
use alloy_rpc_types::{BlockNumberOrTag, Filter};
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
@@ -39,7 +39,7 @@ impl Deployer {
|
|||||||
nonce: 0,
|
nonce: 0,
|
||||||
gas_price: 100_000_000_000u128,
|
gas_price: 100_000_000_000u128,
|
||||||
// TODO: Use a more accurate gas limit
|
// TODO: Use a more accurate gas limit
|
||||||
gas_limit: 1_000_000,
|
gas_limit: 1_000_000u128,
|
||||||
to: TxKind::Create,
|
to: TxKind::Create,
|
||||||
value: U256::ZERO,
|
value: U256::ZERO,
|
||||||
input: bytecode,
|
input: bytecode,
|
||||||
@@ -58,7 +58,14 @@ impl Deployer {
|
|||||||
/// Construct a new view of the `Deployer`.
|
/// Construct a new view of the `Deployer`.
|
||||||
pub async fn new(provider: Arc<RootProvider<SimpleRequest>>) -> Result<Option<Self>, Error> {
|
pub async fn new(provider: Arc<RootProvider<SimpleRequest>>) -> Result<Option<Self>, Error> {
|
||||||
let address = Self::address();
|
let address = Self::address();
|
||||||
let code = provider.get_code_at(address.into()).await.map_err(|_| Error::ConnectionError)?;
|
#[cfg(not(test))]
|
||||||
|
let required_block = BlockNumberOrTag::Finalized;
|
||||||
|
#[cfg(test)]
|
||||||
|
let required_block = BlockNumberOrTag::Latest;
|
||||||
|
let code = provider
|
||||||
|
.get_code_at(address.into(), required_block.into())
|
||||||
|
.await
|
||||||
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
// Contract has yet to be deployed
|
// Contract has yet to be deployed
|
||||||
if code.is_empty() {
|
if code.is_empty() {
|
||||||
return Ok(None);
|
return Ok(None);
|
||||||
@@ -4,7 +4,7 @@ use alloy_core::primitives::{Address, B256, U256};
|
|||||||
|
|
||||||
use alloy_sol_types::{SolInterface, SolEvent};
|
use alloy_sol_types::{SolInterface, SolEvent};
|
||||||
|
|
||||||
use alloy_rpc_types_eth::Filter;
|
use alloy_rpc_types::{BlockNumberOrTag, Filter};
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
@@ -25,8 +25,22 @@ pub struct TopLevelErc20Transfer {
|
|||||||
pub struct Erc20(Arc<RootProvider<SimpleRequest>>, Address);
|
pub struct Erc20(Arc<RootProvider<SimpleRequest>>, Address);
|
||||||
impl Erc20 {
|
impl Erc20 {
|
||||||
/// Construct a new view of the specified ERC20 contract.
|
/// Construct a new view of the specified ERC20 contract.
|
||||||
pub fn new(provider: Arc<RootProvider<SimpleRequest>>, address: [u8; 20]) -> Self {
|
///
|
||||||
Self(provider, Address::from(&address))
|
/// This checks a contract is deployed at that address yet does not check the contract is
|
||||||
|
/// actually an ERC20.
|
||||||
|
pub async fn new(
|
||||||
|
provider: Arc<RootProvider<SimpleRequest>>,
|
||||||
|
address: [u8; 20],
|
||||||
|
) -> Result<Option<Self>, Error> {
|
||||||
|
let code = provider
|
||||||
|
.get_code_at(address.into(), BlockNumberOrTag::Finalized.into())
|
||||||
|
.await
|
||||||
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
|
// Contract has yet to be deployed
|
||||||
|
if code.is_empty() {
|
||||||
|
return Ok(None);
|
||||||
|
}
|
||||||
|
Ok(Some(Self(provider.clone(), Address::from(&address))))
|
||||||
}
|
}
|
||||||
|
|
||||||
pub async fn top_level_transfers(
|
pub async fn top_level_transfers(
|
||||||
@@ -51,8 +65,7 @@ impl Erc20 {
|
|||||||
}
|
}
|
||||||
|
|
||||||
let tx_id = log.transaction_hash.ok_or(Error::ConnectionError)?;
|
let tx_id = log.transaction_hash.ok_or(Error::ConnectionError)?;
|
||||||
let tx =
|
let tx = self.0.get_transaction_by_hash(tx_id).await.map_err(|_| Error::ConnectionError)?;
|
||||||
self.0.get_transaction_by_hash(tx_id).await.ok().flatten().ok_or(Error::ConnectionError)?;
|
|
||||||
|
|
||||||
// If this is a top-level call...
|
// If this is a top-level call...
|
||||||
if tx.to == Some(self.1) {
|
if tx.to == Some(self.1) {
|
||||||
30
coins/ethereum/src/lib.rs
Normal file
30
coins/ethereum/src/lib.rs
Normal file
@@ -0,0 +1,30 @@
|
|||||||
|
use thiserror::Error;
|
||||||
|
|
||||||
|
pub use alloy_core;
|
||||||
|
pub use alloy_consensus;
|
||||||
|
|
||||||
|
pub use alloy_rpc_types;
|
||||||
|
pub use alloy_simple_request_transport;
|
||||||
|
pub use alloy_rpc_client;
|
||||||
|
pub use alloy_provider;
|
||||||
|
|
||||||
|
pub mod crypto;
|
||||||
|
|
||||||
|
pub(crate) mod abi;
|
||||||
|
|
||||||
|
pub mod erc20;
|
||||||
|
pub mod deployer;
|
||||||
|
pub mod router;
|
||||||
|
|
||||||
|
pub mod machine;
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod tests;
|
||||||
|
|
||||||
|
#[derive(Clone, Copy, PartialEq, Eq, Debug, Error)]
|
||||||
|
pub enum Error {
|
||||||
|
#[error("failed to verify Schnorr signature")]
|
||||||
|
InvalidSignature,
|
||||||
|
#[error("couldn't make call/send TX")]
|
||||||
|
ConnectionError,
|
||||||
|
}
|
||||||
@@ -12,9 +12,9 @@ use alloy_consensus::TxLegacy;
|
|||||||
|
|
||||||
use alloy_sol_types::{SolValue, SolConstructor, SolCall, SolEvent};
|
use alloy_sol_types::{SolValue, SolConstructor, SolCall, SolEvent};
|
||||||
|
|
||||||
use alloy_rpc_types_eth::Filter;
|
use alloy_rpc_types::Filter;
|
||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
use alloy_rpc_types_eth::{BlockId, TransactionRequest, TransactionInput};
|
use alloy_rpc_types::{BlockId, TransactionRequest, TransactionInput};
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
@@ -159,12 +159,11 @@ impl Router {
|
|||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub async fn serai_key(&self, at: [u8; 32]) -> Result<PublicKey, Error> {
|
pub async fn serai_key(&self, at: [u8; 32]) -> Result<PublicKey, Error> {
|
||||||
let call = TransactionRequest::default()
|
let call = TransactionRequest::default()
|
||||||
.to(self.1)
|
.to(Some(self.1))
|
||||||
.input(TransactionInput::new(abi::seraiKeyCall::new(()).abi_encode().into()));
|
.input(TransactionInput::new(abi::seraiKeyCall::new(()).abi_encode().into()));
|
||||||
let bytes = self
|
let bytes = self
|
||||||
.0
|
.0
|
||||||
.call(&call)
|
.call(&call, Some(BlockId::Hash(B256::from(at).into())))
|
||||||
.block(BlockId::Hash(B256::from(at).into()))
|
|
||||||
.await
|
.await
|
||||||
.map_err(|_| Error::ConnectionError)?;
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
let res =
|
let res =
|
||||||
@@ -198,12 +197,11 @@ impl Router {
|
|||||||
#[cfg(test)]
|
#[cfg(test)]
|
||||||
pub async fn nonce(&self, at: [u8; 32]) -> Result<U256, Error> {
|
pub async fn nonce(&self, at: [u8; 32]) -> Result<U256, Error> {
|
||||||
let call = TransactionRequest::default()
|
let call = TransactionRequest::default()
|
||||||
.to(self.1)
|
.to(Some(self.1))
|
||||||
.input(TransactionInput::new(abi::nonceCall::new(()).abi_encode().into()));
|
.input(TransactionInput::new(abi::nonceCall::new(()).abi_encode().into()));
|
||||||
let bytes = self
|
let bytes = self
|
||||||
.0
|
.0
|
||||||
.call(&call)
|
.call(&call, Some(BlockId::Hash(B256::from(at).into())))
|
||||||
.block(BlockId::Hash(B256::from(at).into()))
|
|
||||||
.await
|
.await
|
||||||
.map_err(|_| Error::ConnectionError)?;
|
.map_err(|_| Error::ConnectionError)?;
|
||||||
let res =
|
let res =
|
||||||
@@ -226,18 +224,15 @@ impl Router {
|
|||||||
to: TxKind::Call(self.1),
|
to: TxKind::Call(self.1),
|
||||||
input: abi::executeCall::new((outs.to_vec(), sig.into())).abi_encode().into(),
|
input: abi::executeCall::new((outs.to_vec(), sig.into())).abi_encode().into(),
|
||||||
// TODO
|
// TODO
|
||||||
gas_limit: 100_000 + ((200_000 + 10_000) * u64::try_from(outs.len()).unwrap()),
|
gas_limit: 100_000 + ((200_000 + 10_000) * u128::try_from(outs.len()).unwrap()),
|
||||||
..Default::default()
|
..Default::default()
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
pub async fn key_at_end_of_block(&self, block: u64) -> Result<Option<ProjectivePoint>, Error> {
|
pub async fn key_at_end_of_block(&self, block: u64) -> Result<ProjectivePoint, Error> {
|
||||||
let filter = Filter::new().from_block(0).to_block(block).address(self.1);
|
let filter = Filter::new().from_block(0).to_block(block).address(self.1);
|
||||||
let filter = filter.event_signature(SeraiKeyUpdated::SIGNATURE_HASH);
|
let filter = filter.event_signature(SeraiKeyUpdated::SIGNATURE_HASH);
|
||||||
let all_keys = self.0.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
let all_keys = self.0.get_logs(&filter).await.map_err(|_| Error::ConnectionError)?;
|
||||||
if all_keys.is_empty() {
|
|
||||||
return Ok(None);
|
|
||||||
};
|
|
||||||
|
|
||||||
let last_key_x_coordinate_log = all_keys.last().ok_or(Error::ConnectionError)?;
|
let last_key_x_coordinate_log = all_keys.last().ok_or(Error::ConnectionError)?;
|
||||||
let last_key_x_coordinate = last_key_x_coordinate_log
|
let last_key_x_coordinate = last_key_x_coordinate_log
|
||||||
@@ -251,9 +246,7 @@ impl Router {
|
|||||||
compressed_point[0] = u8::from(sec1::Tag::CompressedEvenY);
|
compressed_point[0] = u8::from(sec1::Tag::CompressedEvenY);
|
||||||
compressed_point[1 ..].copy_from_slice(last_key_x_coordinate.as_slice());
|
compressed_point[1 ..].copy_from_slice(last_key_x_coordinate.as_slice());
|
||||||
|
|
||||||
let key =
|
Option::from(ProjectivePoint::from_bytes(&compressed_point)).ok_or(Error::ConnectionError)
|
||||||
Option::from(ProjectivePoint::from_bytes(&compressed_point)).ok_or(Error::ConnectionError)?;
|
|
||||||
Ok(Some(key))
|
|
||||||
}
|
}
|
||||||
|
|
||||||
pub async fn in_instructions(
|
pub async fn in_instructions(
|
||||||
@@ -261,9 +254,7 @@ impl Router {
|
|||||||
block: u64,
|
block: u64,
|
||||||
allowed_tokens: &HashSet<[u8; 20]>,
|
allowed_tokens: &HashSet<[u8; 20]>,
|
||||||
) -> Result<Vec<InInstruction>, Error> {
|
) -> Result<Vec<InInstruction>, Error> {
|
||||||
let Some(key_at_end_of_block) = self.key_at_end_of_block(block).await? else {
|
let key_at_end_of_block = self.key_at_end_of_block(block).await?;
|
||||||
return Ok(vec![]);
|
|
||||||
};
|
|
||||||
|
|
||||||
let filter = Filter::new().from_block(block).to_block(block).address(self.1);
|
let filter = Filter::new().from_block(block).to_block(block).address(self.1);
|
||||||
let filter = filter.event_signature(InInstructionEvent::SIGNATURE_HASH);
|
let filter = filter.event_signature(InInstructionEvent::SIGNATURE_HASH);
|
||||||
@@ -283,13 +274,7 @@ impl Router {
|
|||||||
);
|
);
|
||||||
|
|
||||||
let tx_hash = log.transaction_hash.ok_or(Error::ConnectionError)?;
|
let tx_hash = log.transaction_hash.ok_or(Error::ConnectionError)?;
|
||||||
let tx = self
|
let tx = self.0.get_transaction_by_hash(tx_hash).await.map_err(|_| Error::ConnectionError)?;
|
||||||
.0
|
|
||||||
.get_transaction_by_hash(tx_hash)
|
|
||||||
.await
|
|
||||||
.ok()
|
|
||||||
.flatten()
|
|
||||||
.ok_or(Error::ConnectionError)?;
|
|
||||||
|
|
||||||
let log =
|
let log =
|
||||||
log.log_decode::<InInstructionEvent>().map_err(|_| Error::ConnectionError)?.inner.data;
|
log.log_decode::<InInstructionEvent>().map_err(|_| Error::ConnectionError)?.inner.data;
|
||||||
@@ -1,5 +1,3 @@
|
|||||||
#![allow(deprecated)]
|
|
||||||
|
|
||||||
use rand_core::OsRng;
|
use rand_core::OsRng;
|
||||||
|
|
||||||
use group::ff::{Field, PrimeField};
|
use group::ff::{Field, PrimeField};
|
||||||
@@ -1,5 +1,3 @@
|
|||||||
#![allow(deprecated)]
|
|
||||||
|
|
||||||
use std::{sync::Arc, collections::HashMap};
|
use std::{sync::Arc, collections::HashMap};
|
||||||
|
|
||||||
use rand_core::OsRng;
|
use rand_core::OsRng;
|
||||||
@@ -8,25 +6,21 @@ use k256::{Scalar, ProjectivePoint};
|
|||||||
use frost::{curve::Secp256k1, Participant, ThresholdKeys, tests::key_gen as frost_key_gen};
|
use frost::{curve::Secp256k1, Participant, ThresholdKeys, tests::key_gen as frost_key_gen};
|
||||||
|
|
||||||
use alloy_core::{
|
use alloy_core::{
|
||||||
primitives::{Address, U256, Bytes, Signature, TxKind},
|
primitives::{Address, U256, Bytes, TxKind},
|
||||||
hex::FromHex,
|
hex::FromHex,
|
||||||
};
|
};
|
||||||
use alloy_consensus::{SignableTransaction, TxLegacy};
|
use alloy_consensus::{SignableTransaction, TxLegacy};
|
||||||
|
|
||||||
use alloy_rpc_types_eth::TransactionReceipt;
|
use alloy_rpc_types::TransactionReceipt;
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
use crate::crypto::{address, deterministically_sign, PublicKey};
|
use crate::crypto::{address, deterministically_sign, PublicKey};
|
||||||
|
|
||||||
#[cfg(test)]
|
|
||||||
mod crypto;
|
mod crypto;
|
||||||
|
|
||||||
#[cfg(test)]
|
|
||||||
mod abi;
|
mod abi;
|
||||||
#[cfg(test)]
|
|
||||||
mod schnorr;
|
mod schnorr;
|
||||||
#[cfg(test)]
|
|
||||||
mod router;
|
mod router;
|
||||||
|
|
||||||
pub fn key_gen() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, PublicKey) {
|
pub fn key_gen() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, PublicKey) {
|
||||||
@@ -39,7 +33,7 @@ pub fn key_gen() -> (HashMap<Participant, ThresholdKeys<Secp256k1>>, PublicKey)
|
|||||||
group_key += ProjectivePoint::GENERATOR;
|
group_key += ProjectivePoint::GENERATOR;
|
||||||
}
|
}
|
||||||
for keys in keys.values_mut() {
|
for keys in keys.values_mut() {
|
||||||
*keys = keys.clone().offset(offset);
|
*keys = keys.offset(offset);
|
||||||
}
|
}
|
||||||
let public_key = PublicKey::new(group_key).unwrap();
|
let public_key = PublicKey::new(group_key).unwrap();
|
||||||
|
|
||||||
@@ -59,19 +53,19 @@ pub async fn send(
|
|||||||
// let chain_id = provider.get_chain_id().await.unwrap();
|
// let chain_id = provider.get_chain_id().await.unwrap();
|
||||||
// tx.chain_id = Some(chain_id);
|
// tx.chain_id = Some(chain_id);
|
||||||
tx.chain_id = None;
|
tx.chain_id = None;
|
||||||
tx.nonce = provider.get_transaction_count(address).await.unwrap();
|
tx.nonce = provider.get_transaction_count(address, None).await.unwrap();
|
||||||
// 100 gwei
|
// 100 gwei
|
||||||
tx.gas_price = 100_000_000_000u128;
|
tx.gas_price = 100_000_000_000u128;
|
||||||
|
|
||||||
let sig = wallet.sign_prehash_recoverable(tx.signature_hash().as_ref()).unwrap();
|
let sig = wallet.sign_prehash_recoverable(tx.signature_hash().as_ref()).unwrap();
|
||||||
assert_eq!(address, tx.clone().into_signed(sig.into()).recover_signer().unwrap());
|
assert_eq!(address, tx.clone().into_signed(sig.into()).recover_signer().unwrap());
|
||||||
assert!(
|
assert!(
|
||||||
provider.get_balance(address).await.unwrap() >
|
provider.get_balance(address, None).await.unwrap() >
|
||||||
((U256::from(tx.gas_price) * U256::from(tx.gas_limit)) + tx.value)
|
((U256::from(tx.gas_price) * U256::from(tx.gas_limit)) + tx.value)
|
||||||
);
|
);
|
||||||
|
|
||||||
let mut bytes = vec![];
|
let mut bytes = vec![];
|
||||||
tx.encode_with_signature_fields(&Signature::from(sig), &mut bytes);
|
tx.encode_with_signature_fields(&sig.into(), &mut bytes);
|
||||||
let pending_tx = provider.send_raw_transaction(&bytes).await.ok()?;
|
let pending_tx = provider.send_raw_transaction(&bytes).await.ok()?;
|
||||||
pending_tx.get_receipt().await.ok()
|
pending_tx.get_receipt().await.ok()
|
||||||
}
|
}
|
||||||
@@ -14,7 +14,6 @@ use frost::{
|
|||||||
use alloy_core::primitives::{Address, U256};
|
use alloy_core::primitives::{Address, U256};
|
||||||
|
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_rpc_types_eth::BlockTransactionsKind;
|
|
||||||
use alloy_rpc_client::ClientBuilder;
|
use alloy_rpc_client::ClientBuilder;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
|
|
||||||
@@ -85,12 +84,13 @@ async fn setup_test() -> (
|
|||||||
|
|
||||||
async fn latest_block_hash(client: &RootProvider<SimpleRequest>) -> [u8; 32] {
|
async fn latest_block_hash(client: &RootProvider<SimpleRequest>) -> [u8; 32] {
|
||||||
client
|
client
|
||||||
.get_block(client.get_block_number().await.unwrap().into(), BlockTransactionsKind::Hashes)
|
.get_block(client.get_block_number().await.unwrap().into(), false)
|
||||||
.await
|
.await
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.unwrap()
|
.unwrap()
|
||||||
.header
|
.header
|
||||||
.hash
|
.hash
|
||||||
|
.unwrap()
|
||||||
.0
|
.0
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -15,7 +15,7 @@ use alloy_core::primitives::Address;
|
|||||||
|
|
||||||
use alloy_sol_types::SolCall;
|
use alloy_sol_types::SolCall;
|
||||||
|
|
||||||
use alloy_rpc_types_eth::{TransactionInput, TransactionRequest};
|
use alloy_rpc_types::{TransactionInput, TransactionRequest};
|
||||||
use alloy_simple_request_transport::SimpleRequest;
|
use alloy_simple_request_transport::SimpleRequest;
|
||||||
use alloy_rpc_client::ClientBuilder;
|
use alloy_rpc_client::ClientBuilder;
|
||||||
use alloy_provider::{Provider, RootProvider};
|
use alloy_provider::{Provider, RootProvider};
|
||||||
@@ -56,12 +56,12 @@ pub async fn call_verify(
|
|||||||
let px: [u8; 32] = public_key.px.to_repr().into();
|
let px: [u8; 32] = public_key.px.to_repr().into();
|
||||||
let c_bytes: [u8; 32] = signature.c.to_repr().into();
|
let c_bytes: [u8; 32] = signature.c.to_repr().into();
|
||||||
let s_bytes: [u8; 32] = signature.s.to_repr().into();
|
let s_bytes: [u8; 32] = signature.s.to_repr().into();
|
||||||
let call = TransactionRequest::default().to(contract).input(TransactionInput::new(
|
let call = TransactionRequest::default().to(Some(contract)).input(TransactionInput::new(
|
||||||
abi::verifyCall::new((px.into(), message.to_vec().into(), c_bytes.into(), s_bytes.into()))
|
abi::verifyCall::new((px.into(), message.to_vec().into(), c_bytes.into(), s_bytes.into()))
|
||||||
.abi_encode()
|
.abi_encode()
|
||||||
.into(),
|
.into(),
|
||||||
));
|
));
|
||||||
let bytes = provider.call(&call).await.map_err(|_| Error::ConnectionError)?;
|
let bytes = provider.call(&call, None).await.map_err(|_| Error::ConnectionError)?;
|
||||||
let res =
|
let res =
|
||||||
abi::verifyCall::abi_decode_returns(&bytes, true).map_err(|_| Error::ConnectionError)?;
|
abi::verifyCall::abi_decode_returns(&bytes, true).map_err(|_| Error::ConnectionError)?;
|
||||||
|
|
||||||
111
coins/monero/Cargo.toml
Normal file
111
coins/monero/Cargo.toml
Normal file
@@ -0,0 +1,111 @@
|
|||||||
|
[package]
|
||||||
|
name = "monero-serai"
|
||||||
|
version = "0.1.4-alpha"
|
||||||
|
description = "A modern Monero transaction library"
|
||||||
|
license = "MIT"
|
||||||
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero"
|
||||||
|
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||||
|
edition = "2021"
|
||||||
|
rust-version = "1.74"
|
||||||
|
|
||||||
|
[package.metadata.docs.rs]
|
||||||
|
all-features = true
|
||||||
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|
||||||
|
[lints]
|
||||||
|
workspace = true
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
std-shims = { path = "../../common/std-shims", version = "^0.1.1", default-features = false }
|
||||||
|
|
||||||
|
async-trait = { version = "0.1", default-features = false }
|
||||||
|
thiserror = { version = "1", default-features = false, optional = true }
|
||||||
|
|
||||||
|
zeroize = { version = "^1.5", default-features = false, features = ["zeroize_derive"] }
|
||||||
|
subtle = { version = "^2.4", default-features = false }
|
||||||
|
|
||||||
|
rand_core = { version = "0.6", default-features = false }
|
||||||
|
# Used to send transactions
|
||||||
|
rand = { version = "0.8", default-features = false }
|
||||||
|
rand_chacha = { version = "0.3", default-features = false }
|
||||||
|
# Used to select decoys
|
||||||
|
rand_distr = { version = "0.4", default-features = false }
|
||||||
|
|
||||||
|
sha3 = { version = "0.10", default-features = false }
|
||||||
|
pbkdf2 = { version = "0.12", features = ["simple"], default-features = false }
|
||||||
|
|
||||||
|
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
|
||||||
|
|
||||||
|
# Used for the hash to curve, along with the more complicated proofs
|
||||||
|
group = { version = "0.13", default-features = false }
|
||||||
|
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||||
|
multiexp = { path = "../../crypto/multiexp", version = "0.4", default-features = false, features = ["batch"] }
|
||||||
|
|
||||||
|
# Needed for multisig
|
||||||
|
transcript = { package = "flexible-transcript", path = "../../crypto/transcript", version = "0.3", default-features = false, features = ["recommended"], optional = true }
|
||||||
|
frost = { package = "modular-frost", path = "../../crypto/frost", version = "0.8", default-features = false, features = ["ed25519"], optional = true }
|
||||||
|
|
||||||
|
monero-generators = { path = "generators", version = "0.4", default-features = false }
|
||||||
|
|
||||||
|
async-lock = { version = "3", default-features = false, optional = true }
|
||||||
|
|
||||||
|
hex-literal = "0.4"
|
||||||
|
hex = { version = "0.4", default-features = false, features = ["alloc"] }
|
||||||
|
serde = { version = "1", default-features = false, features = ["derive", "alloc"] }
|
||||||
|
serde_json = { version = "1", default-features = false, features = ["alloc"] }
|
||||||
|
|
||||||
|
base58-monero = { version = "2", default-features = false, features = ["check"] }
|
||||||
|
|
||||||
|
# Used for the provided HTTP RPC
|
||||||
|
digest_auth = { version = "0.3", default-features = false, optional = true }
|
||||||
|
simple-request = { path = "../../common/request", version = "0.1", default-features = false, features = ["tls"], optional = true }
|
||||||
|
tokio = { version = "1", default-features = false, optional = true }
|
||||||
|
|
||||||
|
[build-dependencies]
|
||||||
|
dalek-ff-group = { path = "../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||||
|
monero-generators = { path = "generators", version = "0.4", default-features = false }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
tokio = { version = "1", features = ["sync", "macros"] }
|
||||||
|
|
||||||
|
frost = { package = "modular-frost", path = "../../crypto/frost", features = ["tests"] }
|
||||||
|
|
||||||
|
[features]
|
||||||
|
std = [
|
||||||
|
"std-shims/std",
|
||||||
|
|
||||||
|
"thiserror",
|
||||||
|
|
||||||
|
"zeroize/std",
|
||||||
|
"subtle/std",
|
||||||
|
|
||||||
|
"rand_core/std",
|
||||||
|
"rand/std",
|
||||||
|
"rand_chacha/std",
|
||||||
|
"rand_distr/std",
|
||||||
|
|
||||||
|
"sha3/std",
|
||||||
|
"pbkdf2/std",
|
||||||
|
|
||||||
|
"multiexp/std",
|
||||||
|
|
||||||
|
"transcript/std",
|
||||||
|
|
||||||
|
"monero-generators/std",
|
||||||
|
|
||||||
|
"async-lock?/std",
|
||||||
|
|
||||||
|
"hex/std",
|
||||||
|
"serde/std",
|
||||||
|
"serde_json/std",
|
||||||
|
|
||||||
|
"base58-monero/std",
|
||||||
|
]
|
||||||
|
|
||||||
|
cache-distribution = ["async-lock"]
|
||||||
|
http-rpc = ["digest_auth", "simple-request", "tokio"]
|
||||||
|
multisig = ["transcript", "frost", "std"]
|
||||||
|
binaries = ["tokio/rt-multi-thread", "tokio/macros", "http-rpc"]
|
||||||
|
experimental = []
|
||||||
|
|
||||||
|
default = ["std", "http-rpc"]
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
MIT License
|
MIT License
|
||||||
|
|
||||||
Copyright (c) 2021-2025 Luke Parker
|
Copyright (c) 2022-2023 Luke Parker
|
||||||
|
|
||||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
of this software and associated documentation files (the "Software"), to deal
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
49
coins/monero/README.md
Normal file
49
coins/monero/README.md
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
# monero-serai
|
||||||
|
|
||||||
|
A modern Monero transaction library intended for usage in wallets. It prides
|
||||||
|
itself on accuracy, correctness, and removing common pit falls developers may
|
||||||
|
face.
|
||||||
|
|
||||||
|
monero-serai also offers the following features:
|
||||||
|
|
||||||
|
- Featured Addresses
|
||||||
|
- A FROST-based multisig orders of magnitude more performant than Monero's
|
||||||
|
|
||||||
|
### Purpose and support
|
||||||
|
|
||||||
|
monero-serai was written for Serai, a decentralized exchange aiming to support
|
||||||
|
Monero. Despite this, monero-serai is intended to be a widely usable library,
|
||||||
|
accurate to Monero. monero-serai guarantees the functionality needed for Serai,
|
||||||
|
yet will not deprive functionality from other users.
|
||||||
|
|
||||||
|
Various legacy transaction formats are not currently implemented, yet we are
|
||||||
|
willing to add support for them. There aren't active development efforts around
|
||||||
|
them however.
|
||||||
|
|
||||||
|
### Caveats
|
||||||
|
|
||||||
|
This library DOES attempt to do the following:
|
||||||
|
|
||||||
|
- Create on-chain transactions identical to how wallet2 would (unless told not
|
||||||
|
to)
|
||||||
|
- Not be detectable as monero-serai when scanning outputs
|
||||||
|
- Not reveal spent outputs to the connected RPC node
|
||||||
|
|
||||||
|
This library DOES NOT attempt to do the following:
|
||||||
|
|
||||||
|
- Have identical RPC behavior when creating transactions
|
||||||
|
- Be a wallet
|
||||||
|
|
||||||
|
This means that monero-serai shouldn't be fingerprintable on-chain. It also
|
||||||
|
shouldn't be fingerprintable if a targeted attack occurs to detect if the
|
||||||
|
receiving wallet is monero-serai or wallet2. It also should be generally safe
|
||||||
|
for usage with remote nodes.
|
||||||
|
|
||||||
|
It won't hide from remote nodes it's monero-serai however, potentially
|
||||||
|
allowing a remote node to profile you. The implications of this are left to the
|
||||||
|
user to consider.
|
||||||
|
|
||||||
|
It also won't act as a wallet, just as a transaction library. wallet2 has
|
||||||
|
several *non-transaction-level* policies, such as always attempting to use two
|
||||||
|
inputs to create transactions. These are considered out of scope to
|
||||||
|
monero-serai.
|
||||||
67
coins/monero/build.rs
Normal file
67
coins/monero/build.rs
Normal file
@@ -0,0 +1,67 @@
|
|||||||
|
use std::{
|
||||||
|
io::Write,
|
||||||
|
env,
|
||||||
|
path::Path,
|
||||||
|
fs::{File, remove_file},
|
||||||
|
};
|
||||||
|
|
||||||
|
use dalek_ff_group::EdwardsPoint;
|
||||||
|
|
||||||
|
use monero_generators::bulletproofs_generators;
|
||||||
|
|
||||||
|
fn serialize(generators_string: &mut String, points: &[EdwardsPoint]) {
|
||||||
|
for generator in points {
|
||||||
|
generators_string.extend(
|
||||||
|
format!(
|
||||||
|
"
|
||||||
|
dalek_ff_group::EdwardsPoint(
|
||||||
|
curve25519_dalek::edwards::CompressedEdwardsY({:?}).decompress().unwrap()
|
||||||
|
),
|
||||||
|
",
|
||||||
|
generator.compress().to_bytes()
|
||||||
|
)
|
||||||
|
.chars(),
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn generators(prefix: &'static str, path: &str) {
|
||||||
|
let generators = bulletproofs_generators(prefix.as_bytes());
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let mut G_str = String::new();
|
||||||
|
serialize(&mut G_str, &generators.G);
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let mut H_str = String::new();
|
||||||
|
serialize(&mut H_str, &generators.H);
|
||||||
|
|
||||||
|
let path = Path::new(&env::var("OUT_DIR").unwrap()).join(path);
|
||||||
|
let _ = remove_file(&path);
|
||||||
|
File::create(&path)
|
||||||
|
.unwrap()
|
||||||
|
.write_all(
|
||||||
|
format!(
|
||||||
|
"
|
||||||
|
pub(crate) static GENERATORS_CELL: OnceLock<Generators> = OnceLock::new();
|
||||||
|
pub fn GENERATORS() -> &'static Generators {{
|
||||||
|
GENERATORS_CELL.get_or_init(|| Generators {{
|
||||||
|
G: vec![
|
||||||
|
{G_str}
|
||||||
|
],
|
||||||
|
H: vec![
|
||||||
|
{H_str}
|
||||||
|
],
|
||||||
|
}})
|
||||||
|
}}
|
||||||
|
",
|
||||||
|
)
|
||||||
|
.as_bytes(),
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
}
|
||||||
|
|
||||||
|
fn main() {
|
||||||
|
println!("cargo:rerun-if-changed=build.rs");
|
||||||
|
|
||||||
|
generators("bulletproof", "generators.rs");
|
||||||
|
generators("bulletproof_plus", "generators_plus.rs");
|
||||||
|
}
|
||||||
34
coins/monero/generators/Cargo.toml
Normal file
34
coins/monero/generators/Cargo.toml
Normal file
@@ -0,0 +1,34 @@
|
|||||||
|
[package]
|
||||||
|
name = "monero-generators"
|
||||||
|
version = "0.4.0"
|
||||||
|
description = "Monero's hash_to_point and generators"
|
||||||
|
license = "MIT"
|
||||||
|
repository = "https://github.com/serai-dex/serai/tree/develop/coins/monero/generators"
|
||||||
|
authors = ["Luke Parker <lukeparker5132@gmail.com>"]
|
||||||
|
edition = "2021"
|
||||||
|
|
||||||
|
[package.metadata.docs.rs]
|
||||||
|
all-features = true
|
||||||
|
rustdoc-args = ["--cfg", "docsrs"]
|
||||||
|
|
||||||
|
[lints]
|
||||||
|
workspace = true
|
||||||
|
|
||||||
|
[dependencies]
|
||||||
|
std-shims = { path = "../../../common/std-shims", version = "^0.1.1", default-features = false }
|
||||||
|
|
||||||
|
subtle = { version = "^2.4", default-features = false }
|
||||||
|
|
||||||
|
sha3 = { version = "0.10", default-features = false }
|
||||||
|
|
||||||
|
curve25519-dalek = { version = "4", default-features = false, features = ["alloc", "zeroize", "precomputed-tables"] }
|
||||||
|
|
||||||
|
group = { version = "0.13", default-features = false }
|
||||||
|
dalek-ff-group = { path = "../../../crypto/dalek-ff-group", version = "0.4", default-features = false }
|
||||||
|
|
||||||
|
[dev-dependencies]
|
||||||
|
hex = "0.4"
|
||||||
|
|
||||||
|
[features]
|
||||||
|
std = ["std-shims/std", "subtle/std", "sha3/std", "dalek-ff-group/std"]
|
||||||
|
default = ["std"]
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
MIT License
|
MIT License
|
||||||
|
|
||||||
Copyright (c) 2021-2025 Luke Parker
|
Copyright (c) 2022-2023 Luke Parker
|
||||||
|
|
||||||
Permission is hereby granted, free of charge, to any person obtaining a copy
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
of this software and associated documentation files (the "Software"), to deal
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
7
coins/monero/generators/README.md
Normal file
7
coins/monero/generators/README.md
Normal file
@@ -0,0 +1,7 @@
|
|||||||
|
# Monero Generators
|
||||||
|
|
||||||
|
Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
|
||||||
|
An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
|
||||||
|
`hash_to_point` here, is included, as needed to generate generators.
|
||||||
|
|
||||||
|
This library is usable under no-std when the `std` feature is disabled.
|
||||||
60
coins/monero/generators/src/hash_to_point.rs
Normal file
60
coins/monero/generators/src/hash_to_point.rs
Normal file
@@ -0,0 +1,60 @@
|
|||||||
|
use subtle::ConditionallySelectable;
|
||||||
|
|
||||||
|
use curve25519_dalek::edwards::{EdwardsPoint, CompressedEdwardsY};
|
||||||
|
|
||||||
|
use group::ff::{Field, PrimeField};
|
||||||
|
use dalek_ff_group::FieldElement;
|
||||||
|
|
||||||
|
use crate::hash;
|
||||||
|
|
||||||
|
/// Decompress canonically encoded ed25519 point
|
||||||
|
/// It does not check if the point is in the prime order subgroup
|
||||||
|
pub fn decompress_point(bytes: [u8; 32]) -> Option<EdwardsPoint> {
|
||||||
|
CompressedEdwardsY(bytes)
|
||||||
|
.decompress()
|
||||||
|
// Ban points which are either unreduced or -0
|
||||||
|
.filter(|point| point.compress().to_bytes() == bytes)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Monero's hash to point function, as named `hash_to_ec`.
|
||||||
|
pub fn hash_to_point(bytes: [u8; 32]) -> EdwardsPoint {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let A = FieldElement::from(486662u64);
|
||||||
|
|
||||||
|
let v = FieldElement::from_square(hash(&bytes)).double();
|
||||||
|
let w = v + FieldElement::ONE;
|
||||||
|
let x = w.square() + (-A.square() * v);
|
||||||
|
|
||||||
|
// This isn't the complete X, yet its initial value
|
||||||
|
// We don't calculate the full X, and instead solely calculate Y, letting dalek reconstruct X
|
||||||
|
// While inefficient, it solves API boundaries and reduces the amount of work done here
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let X = {
|
||||||
|
let u = w;
|
||||||
|
let v = x;
|
||||||
|
let v3 = v * v * v;
|
||||||
|
let uv3 = u * v3;
|
||||||
|
let v7 = v3 * v3 * v;
|
||||||
|
let uv7 = u * v7;
|
||||||
|
uv3 * uv7.pow((-FieldElement::from(5u8)) * FieldElement::from(8u8).invert().unwrap())
|
||||||
|
};
|
||||||
|
let x = X.square() * x;
|
||||||
|
|
||||||
|
let y = w - x;
|
||||||
|
let non_zero_0 = !y.is_zero();
|
||||||
|
let y_if_non_zero_0 = w + x;
|
||||||
|
let sign = non_zero_0 & (!y_if_non_zero_0.is_zero());
|
||||||
|
|
||||||
|
let mut z = -A;
|
||||||
|
z *= FieldElement::conditional_select(&v, &FieldElement::from(1u8), sign);
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let Z = z + w;
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let mut Y = z - w;
|
||||||
|
|
||||||
|
Y *= Z.invert().unwrap();
|
||||||
|
let mut bytes = Y.to_repr();
|
||||||
|
bytes[31] |= sign.unwrap_u8() << 7;
|
||||||
|
|
||||||
|
decompress_point(bytes).unwrap().mul_by_cofactor()
|
||||||
|
}
|
||||||
79
coins/monero/generators/src/lib.rs
Normal file
79
coins/monero/generators/src/lib.rs
Normal file
@@ -0,0 +1,79 @@
|
|||||||
|
//! Generators used by Monero in both its Pedersen commitments and Bulletproofs(+).
|
||||||
|
//!
|
||||||
|
//! An implementation of Monero's `ge_fromfe_frombytes_vartime`, simply called
|
||||||
|
//! `hash_to_point` here, is included, as needed to generate generators.
|
||||||
|
|
||||||
|
#![cfg_attr(not(feature = "std"), no_std)]
|
||||||
|
|
||||||
|
use std_shims::{sync::OnceLock, vec::Vec};
|
||||||
|
|
||||||
|
use sha3::{Digest, Keccak256};
|
||||||
|
|
||||||
|
use curve25519_dalek::edwards::{EdwardsPoint as DalekPoint};
|
||||||
|
|
||||||
|
use group::{Group, GroupEncoding};
|
||||||
|
use dalek_ff_group::EdwardsPoint;
|
||||||
|
|
||||||
|
mod varint;
|
||||||
|
use varint::write_varint;
|
||||||
|
|
||||||
|
mod hash_to_point;
|
||||||
|
pub use hash_to_point::{hash_to_point, decompress_point};
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod tests;
|
||||||
|
|
||||||
|
fn hash(data: &[u8]) -> [u8; 32] {
|
||||||
|
Keccak256::digest(data).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
static H_CELL: OnceLock<DalekPoint> = OnceLock::new();
|
||||||
|
/// Monero's alternate generator `H`, used for amounts in Pedersen commitments.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub fn H() -> DalekPoint {
|
||||||
|
*H_CELL.get_or_init(|| {
|
||||||
|
decompress_point(hash(&EdwardsPoint::generator().to_bytes())).unwrap().mul_by_cofactor()
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
static H_POW_2_CELL: OnceLock<[DalekPoint; 64]> = OnceLock::new();
|
||||||
|
/// Monero's alternate generator `H`, multiplied by 2**i for i in 1 ..= 64.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub fn H_pow_2() -> &'static [DalekPoint; 64] {
|
||||||
|
H_POW_2_CELL.get_or_init(|| {
|
||||||
|
let mut res = [H(); 64];
|
||||||
|
for i in 1 .. 64 {
|
||||||
|
res[i] = res[i - 1] + res[i - 1];
|
||||||
|
}
|
||||||
|
res
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
const MAX_M: usize = 16;
|
||||||
|
const N: usize = 64;
|
||||||
|
const MAX_MN: usize = MAX_M * N;
|
||||||
|
|
||||||
|
/// Container struct for Bulletproofs(+) generators.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub struct Generators {
|
||||||
|
pub G: Vec<EdwardsPoint>,
|
||||||
|
pub H: Vec<EdwardsPoint>,
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Generate generators as needed for Bulletproofs(+), as Monero does.
|
||||||
|
pub fn bulletproofs_generators(dst: &'static [u8]) -> Generators {
|
||||||
|
let mut res = Generators { G: Vec::with_capacity(MAX_MN), H: Vec::with_capacity(MAX_MN) };
|
||||||
|
for i in 0 .. MAX_MN {
|
||||||
|
let i = 2 * i;
|
||||||
|
|
||||||
|
let mut even = H().compress().to_bytes().to_vec();
|
||||||
|
even.extend(dst);
|
||||||
|
let mut odd = even.clone();
|
||||||
|
|
||||||
|
write_varint(&i.try_into().unwrap(), &mut even).unwrap();
|
||||||
|
write_varint(&(i + 1).try_into().unwrap(), &mut odd).unwrap();
|
||||||
|
res.H.push(EdwardsPoint(hash_to_point(hash(&even))));
|
||||||
|
res.G.push(EdwardsPoint(hash_to_point(hash(&odd))));
|
||||||
|
}
|
||||||
|
res
|
||||||
|
}
|
||||||
38
coins/monero/generators/src/tests/hash_to_point.rs
Normal file
38
coins/monero/generators/src/tests/hash_to_point.rs
Normal file
@@ -0,0 +1,38 @@
|
|||||||
|
use crate::{decompress_point, hash_to_point};
|
||||||
|
|
||||||
|
#[test]
|
||||||
|
fn crypto_tests() {
|
||||||
|
// tests.txt file copied from monero repo
|
||||||
|
// https://github.com/monero-project/monero/
|
||||||
|
// blob/ac02af92867590ca80b2779a7bbeafa99ff94dcb/tests/crypto/tests.txt
|
||||||
|
let reader = include_str!("./tests.txt");
|
||||||
|
|
||||||
|
for line in reader.lines() {
|
||||||
|
let mut words = line.split_whitespace();
|
||||||
|
let command = words.next().unwrap();
|
||||||
|
|
||||||
|
match command {
|
||||||
|
"check_key" => {
|
||||||
|
let key = words.next().unwrap();
|
||||||
|
let expected = match words.next().unwrap() {
|
||||||
|
"true" => true,
|
||||||
|
"false" => false,
|
||||||
|
_ => unreachable!("invalid result"),
|
||||||
|
};
|
||||||
|
|
||||||
|
let actual = decompress_point(hex::decode(key).unwrap().try_into().unwrap());
|
||||||
|
|
||||||
|
assert_eq!(actual.is_some(), expected);
|
||||||
|
}
|
||||||
|
"hash_to_ec" => {
|
||||||
|
let bytes = words.next().unwrap();
|
||||||
|
let expected = words.next().unwrap();
|
||||||
|
|
||||||
|
let actual = hash_to_point(hex::decode(bytes).unwrap().try_into().unwrap());
|
||||||
|
|
||||||
|
assert_eq!(hex::encode(actual.compress().to_bytes()), expected);
|
||||||
|
}
|
||||||
|
_ => unreachable!("unknown command"),
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
1
coins/monero/generators/src/tests/mod.rs
Normal file
1
coins/monero/generators/src/tests/mod.rs
Normal file
@@ -0,0 +1 @@
|
|||||||
|
mod hash_to_point;
|
||||||
628
coins/monero/generators/src/tests/tests.txt
Normal file
628
coins/monero/generators/src/tests/tests.txt
Normal file
@@ -0,0 +1,628 @@
|
|||||||
|
check_key c2cb3cf3840aa9893e00ec77093d3d44dba7da840b51c48462072d58d8efd183 false
|
||||||
|
check_key bd85a61bae0c101d826cbed54b1290f941d26e70607a07fc6f0ad611eb8f70a6 true
|
||||||
|
check_key 328f81cad4eba24ab2bad7c0e56b1e2e7346e625bcb06ae649aef3ffa0b8bef3 false
|
||||||
|
check_key 6016a5463b9e5a58c3410d3f892b76278883473c3f0b69459172d3de49e85abe true
|
||||||
|
check_key 4c71282b2add07cdc6898a2622553f1ca4eb851e5cb121181628be5f3814c5b1 false
|
||||||
|
check_key 69393c25c3b50e177f81f20f852dd604e768eb30052e23108b3cfa1a73f2736e true
|
||||||
|
check_key 3d5a89b676cb84c2be3428d20a660dc6a37cae13912e127888a5132e8bac2163 true
|
||||||
|
check_key 78cd665deb28cebc6208f307734c56fccdf5fa7e2933fadfcdd2b6246e9ae95c false
|
||||||
|
check_key e03b2414e260580f86ee294cd4c636a5b153e617f704e81dad248fbf715b2ee4 true
|
||||||
|
check_key 28c3503ce82d7cdc8e0d96c4553bcf0352bbcfc73925495dbe541e7e1df105fc false
|
||||||
|
check_key 06855c3c3e0d03fec354059bda319b39916bdc10b6581e3f41b335ee7b014fd5 false
|
||||||
|
check_key 556381485df0d7d5a268ab5ecfb2984b060acc63471183fcf538bf273b0c0cb5 true
|
||||||
|
check_key c7f76d82ac64b1e7fdc32761ff00d6f0f7ada4cf223aa5a11187e3a02e1d5319 true
|
||||||
|
check_key cfa85d8bdb6f633fcf031adee3a299ac42eeb6bd707744049f652f6322f5aa47 true
|
||||||
|
check_key 91e9b63ced2b08979fee713365464cc3417c4f238f9bdd3396efbb3c58e195ee true
|
||||||
|
check_key 7b56e76fe94bd30b3b2f2c4ba5fe4c504821753a8965eb1cbcf8896e2d6aba19 true
|
||||||
|
check_key 7338df494bc416cf5edcc02069e067f39cb269ce67bd9faba956021ce3b3de3a false
|
||||||
|
check_key f9a1f27b1618342a558379f4815fa5039a8fe9d98a09f45c1af857ba99231dc1 false
|
||||||
|
check_key b2a1f37718180d4448a7fcb5f788048b1a7132dde1cfd25f0b9b01776a21c687 true
|
||||||
|
check_key 0d3a0f9443a8b24510ad1e76a8117cca03bce416edfe35e3c2a2c2712454f8dc false
|
||||||
|
check_key d8d3d806a76f120c4027dc9c9d741ad32e06861b9cfbc4ce39289c04e251bb3c false
|
||||||
|
check_key 1e9e3ba7bc536cd113606842835d1f05b4b9e65875742f3a35bfb2d63164b5d5 true
|
||||||
|
check_key 5c52d0087997a2cdf1d01ed0560d94b4bfd328cb741cb9a8d46ff50374b35a57 true
|
||||||
|
check_key bb669d4d7ffc4b91a14defedcdbd96b330108b01adc63aa685e2165284c0033b false
|
||||||
|
check_key d2709ae751a0a6fd796c98456fa95a7b64b75a3434f1caa3496eeaf5c14109b4 true
|
||||||
|
check_key e0c238cba781684e655b10a7d4af04ab7ff2e7022182d7ed2279d6adf36b3e7a false
|
||||||
|
check_key 34ebb4bf871572cee5c6935716fab8c8ec28feef4f039763d8f039b84a50bf4c false
|
||||||
|
check_key 4730d4f38ec3f3b83e32e6335d2506df4ee39858848842c5a0184417fcc639e4 true
|
||||||
|
check_key d42cf7fdf5e17e0a8a7f88505a2b7a3d297113bd93d3c20fa87e11509ec905a2 true
|
||||||
|
check_key b757c95059cefabb0080d3a8ebca82e46efecfd29881be3121857f9d915e388c false
|
||||||
|
check_key bbe777aaf04d02b96c0632f4b1c6f35f1c7bcbc5f22af192f92c077709a2b50b false
|
||||||
|
check_key 73518522aabd28566f858c33fccb34b7a4de0e283f6f783f625604ee647afad9 true
|
||||||
|
check_key f230622c4a8f6e516590466bd10f86b64fbef61695f6a054d37604e0b024d5af false
|
||||||
|
check_key bc6b9a8379fd6c369f7c3bd9ddce58db6b78f27a41d798bb865c3920824d0943 false
|
||||||
|
check_key 45a4f87c25898cd6be105fa1602b85c4d862782adaac8b85c996c4a2bcd8af47 true
|
||||||
|
check_key eb4ad3561d21c4311affbd7cc2c7ff5fd509f72f88ba67dc097a75c31fdbd990 false
|
||||||
|
check_key 2f34f4630c09a23b7ecc19f02b4190a26df69e07e13de8069ae5ff80d23762fc true
|
||||||
|
check_key 2ea4e4fb5085eb5c8adee0d5ab7d35c67d74d343bd816cd13924536cffc2527c true
|
||||||
|
check_key 5d35467ee6705a0d35818aa9ae94e4603c3e5500bfc4cf4c4f77a7160a597aa6 true
|
||||||
|
check_key 8ff42bc76796e20c99b6e879369bd4b46a256db1366416291de9166e39d5a093 true
|
||||||
|
check_key 0262ba718850df6c621e8a24cd9e4831c047e38818a89e15c7a06a489a4558e1 false
|
||||||
|
check_key 58b29b2ba238b534b08fb46f05f430e61cb77dc251b0bb50afec1b6061fd9247 false
|
||||||
|
check_key 153170e3dc2b0e1b368fc0d0e31053e872f094cdace9a2846367f0d9245a109b false
|
||||||
|
check_key 40419d309d07522d493bb047ca9b5fb6c401aae226eefae6fd395f5bb9114200 true
|
||||||
|
check_key 713068818d256ef69c78cd6082492013fbd48de3c9e7e076415dd0a692994504 true
|
||||||
|
check_key a7218ee08e50781b0c87312d5e0031467e863c10081668e3792d96cbcee4e474 true
|
||||||
|
check_key 356ce516b00e674ef1729c75b0a68090e7265cef675bbf32bf809495b67e9342 false
|
||||||
|
check_key 52a5c053293675e3efd2c585047002ea6d77931cbf38f541b9070d319dc0d237 false
|
||||||
|
check_key 77c0080bf157e069b18c4c604cc9505c5ec6f0f9930e087592d70507ca1b5534 false
|
||||||
|
check_key e733bc41f880a4cfb1ca6f397916504130807289cacfca10b15f5b8d058ed1bf false
|
||||||
|
check_key c4f1d3c884908a574ecea8be10e02277de35ef84a1d10f105f2be996f285161f true
|
||||||
|
check_key aed677f7f69e146aa0863606ac580fc0bbdc22a88c4b4386abaa4bdfff66bcc9 false
|
||||||
|
check_key 6ad0edf59769599af8caa986f502afc67aecbebb8107aaf5e7d3ae51d5cf8dd8 false
|
||||||
|
check_key 64a0a70e99be1f775c222ee9cd6f1bee6f632cb9417899af398ff9aff70661c6 true
|
||||||
|
check_key c63afaa03bb5c4ed7bc77aac175dbfb73f904440b2e3056a65850ac1bd261332 false
|
||||||
|
check_key a4e89cd2471c26951513b1cfbdcf053a86575e095af52495276aa56ede8ce344 false
|
||||||
|
check_key 2ce935d97f7c3ddb973de685d20f58ee39938fe557216328045ec2b83f3132be true
|
||||||
|
check_key 3e3d38b1fca93c1559ac030d586616354c668aa76245a09e3fa6de55ac730973 true
|
||||||
|
check_key 8b81b9681f76a4254007fd07ed1ded25fc675973ccb23afd06074805194733a4 false
|
||||||
|
check_key 26d1c15dfc371489439e29bcef2afcf7ed01fac24960fdc2e7c20847a8067588 true
|
||||||
|
check_key 85c1199b5a4591fc4cc36d23660648c1b9cfbb0e9c47199fa3eea33299a3dcec false
|
||||||
|
check_key 60830ba5449c1f04ac54675dfc7cac7510106c4b7549852551f8fe65971123e2 false
|
||||||
|
check_key 3e43c28c024597b3b836e4bc16905047cbf6e841b80e0b8cd6a325049070c2a5 false
|
||||||
|
check_key 474792c16a0032343a6f28f4cb564747c3b1ea0b6a6b9a42f7c71d7cc3dd3b44 true
|
||||||
|
check_key c8ec5e67cb5786673085191881950a3ca20dde88f46851b01dd91c695cfbad16 true
|
||||||
|
check_key 861c4b24b24a87b8559e0bb665f84dcc506c147a909f335ae4573b92299f042f false
|
||||||
|
check_key 2c9e0fe3e4983d79f86c8c36928528f1bc90d94352ce427032cdef6906d84d0b true
|
||||||
|
check_key 9293742822c2dff63fdc1bf6645c864fd527cea2ddba6d4f3048d202fc340c9a true
|
||||||
|
check_key 3956422ad380ef19cb9fe360ef09cc7aaec7163eea4114392a7a0b2e2671914e true
|
||||||
|
check_key 5ae8e72cadda85e525922fec11bd53a261cf26ee230fe85a1187f831b1b2c258 false
|
||||||
|
check_key 973feca43a0baf450c30ace5dc19015e19400f0898316e28d9f3c631da31f99a true
|
||||||
|
check_key dd946c91a2077f45c5c16939e53859d9beabaf065e7b1b993d5e5cd385f8716e true
|
||||||
|
check_key b3928f2d67e47f6bd6da81f72e64908d8ff391af5689f0202c4c6fec7666ffe8 true
|
||||||
|
check_key 313382e82083697d7f9d256c3b3800b099b56c3ef33cacdccbd40a65622e25fc false
|
||||||
|
check_key 7d65380c12144802d39ed9306eed79fe165854273700437c0b4b50559800c058 true
|
||||||
|
check_key 4db5c20a49422fd27739c9ca80e2271a8a125dfcead22cb8f035d0e1b7b163be true
|
||||||
|
check_key dd76a9f565ef0e44d1531349ec4c5f7c3c387c2f5823e693b4952f4b0b70808c true
|
||||||
|
check_key 66430bf628eae23918c3ed17b42138db1f98c24819e55fc4a07452d0c85603eb true
|
||||||
|
check_key 9f0b677830c3f089c27daf724bb10be848537f8285de83ab0292d35afb617f77 false
|
||||||
|
check_key cbf98287391fb00b1e68ad64e9fb10198025864c099b8b9334d840457e673874 true
|
||||||
|
check_key a42552e9446e49a83aed9e3370506671216b2d1471392293b8fc2b81c81a73ee false
|
||||||
|
check_key fb3de55ac81a923d506a514602d65d004ec9d13e8b47e82d73af06da73006673 false
|
||||||
|
check_key e17abb78e58a4b72ff4ad7387b290f2811be880b394b8bcaae7748ac09930169 false
|
||||||
|
check_key 9ffbda7ace69753761cdb5eb01f75433efa5cdb6a4f1b664874182c6a95adcba true
|
||||||
|
check_key 507123c979179ea0a3f7f67fb485f71c8636ec4ec70aa47b92f3c707e7541a54 false
|
||||||
|
check_key f1d0b156571994ef578c61cb6545d34f834eb30e4357539a5633c862d4dffa91 false
|
||||||
|
check_key 3de62311ec14f9ee95828c190b2dc3f03059d6119e8dfccb7323efc640e07c75 false
|
||||||
|
check_key 5e50bb48bc9f6dd11d52c1f0d10d8ae5674d7a4af89cbbce178dafc8a562e5fe false
|
||||||
|
check_key 20b2c16497be101995391ceefb979814b0ea76f1ed5b6987985bcdcd17b36a81 false
|
||||||
|
check_key d63bff73b914ce791c840e99bfae0d47afdb99c2375e33c8f149d0df03d97873 false
|
||||||
|
check_key 3f24b3d94b5ddd244e4c4e67a6d9f533f0396ca30454aa0ca799f21328b81d47 true
|
||||||
|
check_key 6a44c016f09225a6d2e830290719d33eb29b53b553eea7737ed3a6e297b2e7d2 true
|
||||||
|
check_key ff0f34df0c76c207b8340be2009db72f730c69c2bbfeea2013105eaccf1d1f8e true
|
||||||
|
check_key 4baf559869fe4e915e219c3c8d9a2330fc91e542a5a2a7311d4d59fee996f807 true
|
||||||
|
check_key 1632207dfef26e97d13b0d0035ea9468fc5a8a89b0990fce77bb143c9d7f3b67 true
|
||||||
|
check_key fcb3dee3993d1a47630f29410903dd03706bd5e81c5802e6f1b9095cbdb404d3 true
|
||||||
|
check_key fb527092b9809e3d27d7588c7ef89915a769b99c1e03e7f72bbead9ed837daae false
|
||||||
|
check_key 902b118d27d40ab9cbd55edd375801ce302cdb59e09c8659a3ea1401918d8bba false
|
||||||
|
check_key 4d6fbf25ca51e263a700f1abf84f758dde3d11b632e908b3093d64fe2e70ea0a true
|
||||||
|
check_key f4c3211ec70affc1c9a94a6589460ee8360dad5f8c679152f16994038532e3fc true
|
||||||
|
check_key c2b3d73ac14956d7fdf12fa92235af1bb09e1566a6a6ffd0025682c750abdd69 false
|
||||||
|
check_key b7e68c12207d2e2104fb2ca224829b6fccc1c0e2154e8a931e3c837a945f4430 false
|
||||||
|
check_key 56ca0ca227708f1099bda1463db9559541c8c11ffad7b3d95c717471f25a01bf true
|
||||||
|
check_key 3eef3a46833e4d851671182a682e344e36bea7211a001f3b8af1093a9c83f1b2 true
|
||||||
|
check_key bd1f4a4f26cab7c1cbc0e17049b90854d6d28d2d55181e1b5f7a8045fcdfa06e true
|
||||||
|
check_key 8537b01c87e7c184d9555e8d93363dcd9b60a8acc94cd3e41eb7525fd3e1d35a false
|
||||||
|
check_key 68ace49179d549bad391d98ab2cc8afee65f98ce14955c3c1b16e850fabec231 true
|
||||||
|
check_key f9922f8a660e7c3e4f3735a817d18b72f59166a0be2d99795f953cf233a27e24 true
|
||||||
|
check_key 036b6be3da26e80508d5a5a6a5999a1fe0db1ac4e9ade8f1ea2eaf2ea9b1a70e true
|
||||||
|
check_key 5e595e886ce16b5ea31f53bcb619f16c8437276618c595739fece6339731feb0 false
|
||||||
|
check_key 4ee2cebae3476ed2eeb7efef9d20958538b3642f938403302682a04115c0f8ed false
|
||||||
|
check_key 519eedbd0da8676063ce7d5a605b3fc27afeecded857afa24b894ad248c87b5d false
|
||||||
|
check_key ce2b627c0accf4a3105796680c37792b30c6337d2d4fea11678282455ff82ff7 false
|
||||||
|
check_key aa26ed99071a8416215e8e7ded784aa7c2b303aab67e66f7539905d7e922eb4d false
|
||||||
|
check_key 435ae49c9ca26758aa103bdcca8d51393b1906fe27a61c5245361e554f335ec2 true
|
||||||
|
check_key 42568af395bd30024f6ccc95205c0e11a6ad1a7ee100f0ec46fcdf0af88e91fb false
|
||||||
|
check_key 0b4a78d1fde56181445f04ca4780f0725daa9c375b496fab6c037d6b2c2275db true
|
||||||
|
check_key 2f82d2a3c8ce801e1ad334f9e074a4fbf76ffac4080a7331dc1359c2b4f674a4 false
|
||||||
|
check_key 24297d8832d733ed052dd102d4c40e813f702006f325644ccf0cb2c31f77953f false
|
||||||
|
check_key 5231a53f6bea7c75b273bde4a9f673044ed87796f20e0909978f29d98fc8d4f0 true
|
||||||
|
check_key 94b5affcf78be5cf62765c32a0794bc06b4900e8a47ddba0e166ec20cec05935 true
|
||||||
|
check_key c14b4d846ea52ffbbb36aa62f059453af3cfae306280dada185d2d385ef8f317 true
|
||||||
|
check_key cceb34fddf01a6182deb79c6000a998742d4800d23d1d8472e3f43cd61f94508 true
|
||||||
|
check_key 1faffa33407fba1634d4136cf9447896776c16293b033c6794f06774b514744c true
|
||||||
|
check_key faaac98f644a2b77fb09ba0ebf5fcddf3ff55f6604c0e9e77f0278063e25113a true
|
||||||
|
check_key 09e8525b00bea395978279ca979247a76f38f86dce4465eb76c140a7f904c109 true
|
||||||
|
check_key 2d797fc725e7fb6d3b412694e7386040effe4823cdf01f6ec7edea4bc0e77e20 false
|
||||||
|
check_key bbb74dabee651a65f46bca472df6a8a749cc4ba5ca35078df5f6d27a772f922a false
|
||||||
|
check_key 77513ca00f3866607c3eff5c2c011beffa775c0022c5a4e7de1120a27e6687fd true
|
||||||
|
check_key 10064c14ace2a998fc2843eeeb62884fe3f7ab331ca70613d6a978f44d9868eb false
|
||||||
|
check_key 026ae84beb5e54c62629a7b63702e85044e38cadfc9a1fcabee6099ba185005c false
|
||||||
|
check_key aef91536292b7ba34a3e787fb019523c2fa7a0d56fca069cc82ccb6b02a45b14 false
|
||||||
|
check_key 147bb1a82c623c722540feaad82b7adf4b85c6ec0cbcef3ca52906f3e85617ac true
|
||||||
|
check_key fc9fb281a0847d58dc9340ef35ef02f7d20671142f12bdd1bfb324ab61d03911 false
|
||||||
|
check_key b739801b9455ac617ca4a7190e2806669f638d4b2f9288171afb55e1542c8d71 false
|
||||||
|
check_key 494cc1e2ee997eb1eb051f83c4c89968116714ddf74e460d4fa1c6e7c72e3eb3 true
|
||||||
|
check_key ed2fbdf2b727ed9284db90ec900a942224787a880bc41d95c4bc4cf136260fd7 true
|
||||||
|
check_key 02843d3e6fc6835ad03983670a592361a26948eb3e31648d572416a944d4909e true
|
||||||
|
check_key c14fea556a7e1b6b6c3d4e2e38a4e7e95d834220ff0140d3f7f561a34e460801 true
|
||||||
|
check_key 5f8f82a35452d0b0d09ffb40a1154641916c31e161ad1a6ab8cfddc2004efdf6 false
|
||||||
|
check_key 7b93d72429fab07b49956007eba335bb8c5629fbf9e7a601eaa030f196934a56 true
|
||||||
|
check_key 6a63ed96d2e46c2874beaf82344065d94b1e5c04406997f94caf4ccd97cfbab9 false
|
||||||
|
check_key c915f409e1e0f776d1f440aa6969cfec97559ef864b07d8c0d7c1163871b4603 true
|
||||||
|
check_key d06bc33630fc94303c2c369481308f805f5ce53c40141160aa4a1f072967617e false
|
||||||
|
check_key 1aafb14ca15043c2589bcd32c7c5f29479216a1980e127e9536729faf1c40266 true
|
||||||
|
check_key 58c115624a20f4b0c152ccd048c54a28a938556863ab8521b154d3165d3649cd false
|
||||||
|
check_key 9001ba086e8aa8a67e128f36d700cc641071556306db7ec9b8ac12a6256b27b7 false
|
||||||
|
check_key 898c468541634fb0def11f82c781341fce0def7b15695af4e642e397218c730c true
|
||||||
|
check_key 47ea6539e65b7b611b0e1ae9ee170adf7c31581ca9f78796d8ebbcc5cd74b712 false
|
||||||
|
check_key 0c60952a64eeac446652f5d3c136fd36966cf66310c15ee6ab2ecbf981461257 false
|
||||||
|
check_key 682264c4686dc7736b6e46bdc8ab231239bc5dac3f5cb9681a1e97a527945e8e true
|
||||||
|
check_key 276006845ca0ea4238b231434e20ad8b8b2a36876effbe1d1e3ffb1f14973397 true
|
||||||
|
check_key eecd3a49e55e32446f86c045dce123ef6fe2e5c57db1d850644b3c56ec689fce true
|
||||||
|
check_key a4dced63589118db3d5aebf6b5670e71250f07485ca4bb6dddf9cce3e4c227a1 false
|
||||||
|
check_key b8ade608ba43d55db7ab481da88b74a9be513fca651c03e04d30cc79f50e0276 false
|
||||||
|
check_key 0d91de88d007a03fe782f904808b036ff63dec6b73ce080c55231afd4ed261c3 true
|
||||||
|
check_key 87c59becb52dd16501edadbb0e06b0406d69541c4d46115351e79951a8dd9c28 true
|
||||||
|
check_key 9aee723be2265171fe10a86d1d3e9cf5a4e46178e859db83f86d1c6db104a247 false
|
||||||
|
check_key 509d34ae5bf56db011845b8cdf0cc7729ed602fce765e9564cb433b4d4421a43 false
|
||||||
|
check_key 06e766d9a6640558767c2aab29f73199130bfdc07fd858a73e6ae8e7b7ba23ba false
|
||||||
|
check_key 801c4fe5ab3e7cf13f7aa2ca3bc57cc8eba587d21f8bc4cd40b1e98db7aec8d9 false
|
||||||
|
check_key d85ad63aeb7d2faa22e5c9b87cd27f45b01e6d0fdc4c3ddf105584ac0a021465 false
|
||||||
|
check_key a7ca13051eb2baeb5befa5e236e482e0bb71803ad06a6eae3ae48742393329d2 true
|
||||||
|
check_key 5a9ba3ec20f116173d933bf5cf35c320ed3751432f3ab453e4a6c51c1d243257 false
|
||||||
|
check_key a4091add8a6710c03285a422d6e67863a48b818f61c62e989b1e9b2ace240a87 false
|
||||||
|
check_key bdee0c6442e6808f25bb18e21b19032cf93a55a5f5c6426fba2227a41c748684 true
|
||||||
|
check_key d4aeb6cdad9667ec3b65c7fbc5bfd1b82bba1939c6bb448a86e40aec42be5f25 false
|
||||||
|
check_key 73525b30a77f1212f7e339ec11f48c453e476f3669e6e70bebabc2fe9e37c160 true
|
||||||
|
check_key 45501f2dc4d0a3131f9e0fe37a51c14869ab610abd8bf0158111617924953629 false
|
||||||
|
check_key 07d0e4c592aa3676adf81cca31a95d50c8c269d995a78cde27b2a9a7a93083a6 false
|
||||||
|
check_key a1797d6178c18add443d22fdbf45ca5e49ead2f78b70bdf1500f570ee90adca5 true
|
||||||
|
check_key 0961e82e6e7855d7b7bf96777e14ae729f91c5bbd20f805bd7daac5ccbec4bab false
|
||||||
|
check_key 57f5ba0ad36e997a4fb585cd2fc81b9cc5418db702c4d1e366639bb432d37c73 true
|
||||||
|
check_key 82b005be61580856841e042ee8be74ae4ca66bb6733478e81ca1e56213de5c05 false
|
||||||
|
check_key d7733dcae1874c93e9a2bd46385f720801f913744d60479930dad7d56c767cdc false
|
||||||
|
check_key b8b8b698609ac3f1bd8f4965151b43b362e6c5e3d1c1feae312c1d43976d59ab true
|
||||||
|
check_key 4bba7815a9a1b86a5b80b17ac0b514e2faa7a24024f269b330e5b7032ae8c04e true
|
||||||
|
check_key 0f70da8f8266b58acda259935ef1a947c923f8698622c5503520ff31162e877b false
|
||||||
|
check_key 233eaa3db80f314c6c895d1328a658a9175158fa2483ed216670c288a04b27bc false
|
||||||
|
check_key a889f124fabfd7a1e2d176f485be0cbd8b3eeaafeee4f40e99e2a56befb665be true
|
||||||
|
check_key 2b7b8abc198b11cf7efa21bc63ec436f790fe1f9b8c044440f183ab291af61d6 true
|
||||||
|
check_key 2491804714f7938cf501fb2adf07597b4899b919cabbaab49518b8f8767fdc6a true
|
||||||
|
check_key 52744a54fcb00dc930a5d7c2bc866cbfc1e75dd38b38021fd792bb0ca9f43164 true
|
||||||
|
check_key e42cbf70b81ba318419104dffbb0cdc3b7e7d4698e422206b753a4e2e6fc69bb false
|
||||||
|
check_key 2faff73e4fed62965f3dbf2e6446b5fea0364666cc8c9450b6ed63bbb6f5f0e7 true
|
||||||
|
check_key 8b963928d75be661c3c18ddd4f4d1f37ebc095ce1edc13fe8b23784c8f416dfd false
|
||||||
|
check_key b1162f952808434e4d2562ffda98bd311613d655d8cf85dc86e0a6c59f7158bc true
|
||||||
|
check_key 5a69adcd9e4f5b0020467e968d85877cb3aa04fa86088d4499b57ca65a665836 true
|
||||||
|
check_key 61ab47da432c829d0bc9d4fdb59520b135428eec665ad509678188b81c7adf49 false
|
||||||
|
check_key 154bb547f22f65a87c0c3f56294f5791d04a3c14c8125d256aeed8ec54c4a06e true
|
||||||
|
check_key 0a78197861c30fd3547b5f2eabd96d3ac22ac0632f03b7afd9d5d2bfc2db352f true
|
||||||
|
check_key 8bdeadcca1f1f8a4a67b01ed2f10ef31aba7b034e8d1df3a69fe9aebf32454e0 false
|
||||||
|
check_key f4b17dfca559be7d5cea500ac01e834624fed9befae3af746b39073d5f63190d true
|
||||||
|
check_key 622c52821e16ddc63b58f3ec2b959fe8c6ea6b1a596d9a58fd81178963f41c01 true
|
||||||
|
check_key 07bedd5d55c937ef5e23a56c6e58f31adb91224d985285d7fef39ede3a9efb17 false
|
||||||
|
check_key 5179bf3b7458648e57dc20f003c6bbfd55e8cd7c0a6e90df6ef8e8183b46f99d true
|
||||||
|
check_key 683c80c3f304f10fdd53a84813b5c25b1627ebd14eb29b258b41cd14396ef41f true
|
||||||
|
check_key c266244ed597c438170875fe7874f81258a830105ca1108131e6b8fea95eb8ba true
|
||||||
|
check_key 0c1cdc693df29c2d1e66b2ce3747e34a30287d5eb6c302495634ec856593fe8e true
|
||||||
|
check_key 28950f508f6a0d4c20ab5e4d55b80565a6a539092e72b7eb0ed9fa5017ecef88 false
|
||||||
|
check_key 8328a2a5fcfc4433b1c283539a8943e6eb8cc16c59f29dedc3af2c77cfd56f25 true
|
||||||
|
check_key 5d0f82319676d4d3636ff5dc2a38ea5ec8aeaac4835fdcab983ab35d76b7967b false
|
||||||
|
check_key cafcc75e94a014115f25c23aaae86e67352f928f468d4312b92240ff0f3a4481 false
|
||||||
|
check_key 3e5fdd8072574218f389d018e959669e8ca4ef20b114ea7dce7bfb32339f9f42 true
|
||||||
|
check_key 591763e3390a78ccb529ceea3d3a97165878b179ad2edaa166fd3c78ec69d391 true
|
||||||
|
check_key 7a0a196935bf79dc2b1c3050e8f2bf0665f7773fc07511b828ec1c4b1451d317 false
|
||||||
|
check_key 9cf0c034162131fbaa94a608f58546d0acbcc2e67b62a0b2be2ce75fc8c25b9a false
|
||||||
|
check_key e3840846e3d32644d45654b96def09a5d6968caca9048c13fcaab7ae8851c316 false
|
||||||
|
check_key a4e330253739af588d70fbda23543f6df7d76d894a486d169e5fedf7ed32d2e2 false
|
||||||
|
check_key cfb41db7091223865f7ecbdda92b9a6fb08887827831451de5bcb3165395d95d true
|
||||||
|
check_key 3d10bd023cef8ae30229fdbfa7446a3c218423d00f330857ff6adde080749015 false
|
||||||
|
check_key 4403b53b8d4112bb1727bb8b5fd63d1f79f107705ffe17867704e70a61875328 false
|
||||||
|
check_key 121ef0813a9f76b7a9c045058557c5072de6a102f06a9b103ead6af079420c29 true
|
||||||
|
check_key 386204cf473caf3854351dda55844a41162eb9ce4740e1e31cfef037b41bc56e false
|
||||||
|
check_key eb5872300dc658161df469364283e4658f37f6a1349976f8973bd6b5d1d57a39 true
|
||||||
|
check_key b8f32188f0fc62eeb38a561ff7b7f3c94440e6d366a05ef7636958bc97834d02 false
|
||||||
|
check_key a817f129a8292df79eef8531736fdebb2e985304653e7ef286574d0703b40fb4 false
|
||||||
|
check_key 2c06595bc103447b9c20a71cd358c704cb43b0b34c23fb768e6730ac9494f39e true
|
||||||
|
check_key dd84bc4c366ced4f65c50c26beb8a9bc26c88b7d4a77effbb0f7af1b28e25734 false
|
||||||
|
check_key 76b4d33810eed637f90d49a530ac5415df97cafdac6f17eda1ba7eb9a14e5886 true
|
||||||
|
check_key 926ce5161c4c92d90ec4efc58e5f449a2c385766c42d2e60af16b7362097aef5 false
|
||||||
|
check_key 20c661f1e95e94a745eb9ec7a4fa719eff2f64052968e448d4734f90952aefee false
|
||||||
|
check_key 671b50abbd119c756010416e15fcdcc9a8e92eed0f67cbca240c3a9154db55c0 false
|
||||||
|
check_key df7aeee8458433e5c68253b8ef006a1c74ce3aef8951056f1fa918a8eb855213 false
|
||||||
|
check_key 70c81a38b92849cf547e3d5a6570d78e5228d4eaf9c8fdd15959edc9eb750daf false
|
||||||
|
check_key 55a512100b72d4ae0cfc16c75566fcaa3a7bb9116840db1559c71fd0e961cc36 false
|
||||||
|
check_key dbfbec4d0d2433a794ad40dc0aea965b6582875805c9a7351b47377403296acd true
|
||||||
|
check_key 0a7fe09eb9342214f98b38964f72ae3c787c19e5d7e256af9216f108f88b00a3 true
|
||||||
|
check_key a82e54681475f53ced9730ee9e3a607e341014d9403f5a42f3dbdbe8fc52e842 true
|
||||||
|
check_key 4d1f90059f7895a3f89abf16162e8d69b399c417f515ccb43b83144bbe8105f6 true
|
||||||
|
check_key 94e5c5b8486b1f2ff4e98ddf3b9295787eb252ba9b408ca4d7724595861da834 false
|
||||||
|
check_key d16e3e8dfa6d33d1d2db21c651006ccddbf4ce2e556594de5a22ae433e774ae6 false
|
||||||
|
check_key a1b203ec5e36098a3af08d6077068fec57eab3a754cbb5f8192983f37191c2df false
|
||||||
|
check_key 5378bb3ec8b4e49849bd7477356ed86f40757dd1ea3cee1e5183c7e7be4c3406 false
|
||||||
|
check_key 541a4162edeb57130295441dc1cb604072d7323b6c7dffa02ea5e4fed1d2ee9e true
|
||||||
|
check_key d8e86e189edcc4b5c262c26004691edd7bd909090997f886b00ed4b6af64d547 false
|
||||||
|
check_key 18a8731d1983d1df2ce2703b4c85e7357b6356634ac1412e6c2ac33ad35f8364 false
|
||||||
|
check_key b21212eac1eb11e811022514c5041233c4a07083a5b20acd7d632a938dc627de true
|
||||||
|
check_key 50efcfac1a55e9829d89334513d6d921abeb237594174015d154512054e4f9d1 true
|
||||||
|
check_key 9c44e8bcba31ddb4e67808422e42062540742ebd73439da0ba7837bf26649ec4 true
|
||||||
|
check_key b068a4f90d5bd78fd350daa129de35e5297b0ad6be9c85c7a6f129e3760a1482 false
|
||||||
|
check_key e9df93932f0096fcf2055564457c6dc685051673a4a6cd87779924be5c4abead true
|
||||||
|
check_key eddab2fc52dac8ed12914d1eb5b0da9978662c4d35b388d64ddf8f065606acaf true
|
||||||
|
check_key 54d3e6b3f2143d9083b4c98e4c22d98f99d274228050b2dc11695bf86631e89f true
|
||||||
|
check_key 6da1d5ef1827de8bbf886623561b058032e196d17f983cbc52199b31b2acc75b true
|
||||||
|
check_key e2a2df18e2235ebd743c9714e334f415d4ca4baf7ad1b335fb45021353d5117f true
|
||||||
|
check_key f34cb7d6e861c8bfe6e15ac19de68e74ccc9b345a7b751a10a5c7f85a99dfeb6 false
|
||||||
|
check_key f36e2f5967eb56244f9e4981a831f4d19c805e31983662641fe384e68176604a true
|
||||||
|
check_key c7e2dc9e8aa6f9c23d379e0f5e3057a69b931b886bbb74ded9f660c06d457463 true
|
||||||
|
check_key b97324364941e06f2ab4f5153a368f9b07c524a89e246720099042ad9e8c1c5b false
|
||||||
|
check_key eff75c70d425f5bba0eef426e116a4697e54feefac870660d9cf24c685078d75 false
|
||||||
|
check_key 161f3cd1a5873788755437e399136bcbf51ff5534700b3a8064f822995a15d24 false
|
||||||
|
check_key 63d6d3d2c21e88b06c9ff856809572024d86c85d85d6d62a52105c0672d92e66 false
|
||||||
|
check_key 1dc19b610b293de602f43dca6c204ce304702e6dc15d2a9337da55961bd26834 false
|
||||||
|
check_key 28a16d02405f509e1cfef5236c0c5f73c3bcadcd23c8eff377253941f82769db true
|
||||||
|
check_key 682d9cc3b65d149b8c2e54d6e20101e12b7cf96be90c9458e7a69699ec0c8ed7 false
|
||||||
|
check_key 0000000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0000000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0100000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0100000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 0200000000000000000000000000000000000000000000000000000000000000 false
|
||||||
|
check_key 0200000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 0300000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0300000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0400000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0400000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0500000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0500000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0600000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0600000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0700000000000000000000000000000000000000000000000000000000000000 false
|
||||||
|
check_key 0700000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 0800000000000000000000000000000000000000000000000000000000000000 false
|
||||||
|
check_key 0800000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 0900000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0900000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0a00000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0a00000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0b00000000000000000000000000000000000000000000000000000000000000 false
|
||||||
|
check_key 0b00000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 0c00000000000000000000000000000000000000000000000000000000000000 false
|
||||||
|
check_key 0c00000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 0d00000000000000000000000000000000000000000000000000000000000000 false
|
||||||
|
check_key 0d00000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 0e00000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0e00000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 0f00000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 0f00000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 1000000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 1000000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 1100000000000000000000000000000000000000000000000000000000000000 false
|
||||||
|
check_key 1100000000000000000000000000000000000000000000000000000000000080 false
|
||||||
|
check_key 1200000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 1200000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key 1300000000000000000000000000000000000000000000000000000000000000 true
|
||||||
|
check_key 1300000000000000000000000000000000000000000000000000000000000080 true
|
||||||
|
check_key daffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key daffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key dbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key dbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key dcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key dcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key ddffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key ddffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key deffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key deffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key dfffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key dfffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key e0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key e0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key e1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key e1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key e2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key e2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key e3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key e3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key e4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key e4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key e5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key e5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key e6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key e6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key e7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key e7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key e8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key e8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key e9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key e9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key eaffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key eaffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff true
|
||||||
|
check_key ebffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key ebffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key ecffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f true
|
||||||
|
check_key ecffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key edffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key edffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key eeffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key eeffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key efffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key efffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f0ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f1ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f2ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f3ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f4ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f5ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f6ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f7ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f8ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key f9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key f9ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key faffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key faffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key fbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key fbffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key fcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key fcffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key fdffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key fdffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key feffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key feffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
check_key ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff7f false
|
||||||
|
check_key ffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffffff false
|
||||||
|
hash_to_ec da66e9ba613919dec28ef367a125bb310d6d83fb9052e71034164b6dc4f392d0 52b3f38753b4e13b74624862e253072cf12f745d43fcfafbe8c217701a6e5875
|
||||||
|
hash_to_ec a7fbdeeccb597c2d5fdaf2ea2e10cbfcd26b5740903e7f6d46bcbf9a90384fc6 f055ba2d0d9828ce2e203d9896bfda494d7830e7e3a27fa27d5eaa825a79a19c
|
||||||
|
hash_to_ec ed6e6579368caba2cc4851672972e949c0ee586fee4d6d6a9476d4a908f64070 da3ceda9a2ef6316bf9272566e6dffd785ac71f57855c0202f422bbb86af4ec0
|
||||||
|
hash_to_ec 9ae78e5620f1c4e6b29d03da006869465b3b16dae87ab0a51f4e1b74bc8aa48b 72d8720da66f797f55fbb7fa538af0b4a4f5930c8289c991472c37dc5ec16853
|
||||||
|
hash_to_ec ab49eb4834d24db7f479753217b763f70604ecb79ed37e6c788528720f424e5b 45914ba926a1a22c8146459c7f050a51ef5f560f5b74bae436b93a379866e6b8
|
||||||
|
hash_to_ec 5b79158ef2341180b8327b976efddbf364620b7e88d2e0707fa56f3b902c34b3 eac991dcbba39cb3bd166906ab48e2c3c3f4cd289a05e1c188486d348ede7c2e
|
||||||
|
hash_to_ec f21daa7896c81d3a7a2e9df721035d3c3902fe546c9d739d0c334ed894fb1d21 a6bedc5ffcc867d0c13a88a03360c8c83a9e4ddf339851bd3768c53a124378ec
|
||||||
|
hash_to_ec 3dae79aaca1abe6aecea7b0d38646c6b013d40053c7cdde2bed094497d925d2b 1a442546a35860a4ab697a36b158ded8e001bbfe20aef1c63e2840e87485c613
|
||||||
|
hash_to_ec 3d219463a55c24ac6f55706a6e46ade3fcd1edc87bade7b967129372036aca63 b252922ab64e32968735b8ade861445aa8dc02b763bd249bff121d10829f7c52
|
||||||
|
hash_to_ec bc5db69aced2b3197398eaf7cf60fd782379874b5ca27cb21bd23692c3c885cc ae072a43f78a0f29dc9822ae5e70865bbd151236a6d7fe4ae3e8f8961e19b0e5
|
||||||
|
hash_to_ec 98a6ed760b225976f8ada0579540e35da643089656695b5d0b8c7265a37e2342 6a99dbfa8ead6228910498cc3ff3fb18cb8627c5735e4b8657da846c16d2dcad
|
||||||
|
hash_to_ec e9cdc9fd9425a4a2389a5d60f76a2d839f0afbf66330f079a88fe23d73eae930 8aa518d091928668f3ca40e71e14b2698f6cae097b8120d7f6ae9afba8fd3d60
|
||||||
|
hash_to_ec a50c026c0af2f9f9884c2e9b8464724ac83bef546fec2c86b7de0880980d24fb b07433f8df39da2453a1e13fd413123a158feae602d822b724d42ef6c8e443bf
|
||||||
|
hash_to_ec bf180e20d160fa23ccfa6993febe22b920160efc5a9614245f1a3a360076e87a 9d6454ff69779ce978ea5fb3be88576dc8feaedf151e93b70065f92505f2e800
|
||||||
|
hash_to_ec b2b64dfeb1d58c6afbf5a56d8c0c42012175ebb4b7df30f26a67b66be8c34614 0523b22e7f220c939b604a15780abc5816709b91b81d9ee1541d44bd2586bbd8
|
||||||
|
hash_to_ec 463fc877f4279740020d10652c950f088ebdebeae34aa7a366c92c9c8773f63a daa5fa72e70c4d3af407b8f2f3364708029b2d4863bbdde54bd67bd08db0fcad
|
||||||
|
hash_to_ec 721842f3809982e7b96a806ae1f162d98ae6911d476307ad1e4f24522fd26f55 4397c300a8cfcb42e7cc310bc975dc975ec2d191eaa7e0462998eb2830c34126
|
||||||
|
hash_to_ec 384da8d9b83972af8cbefc2da5efc744037c8ef40efa4b3bacc3238a6232963d 3c80f107e6868f73ef600ab9229a3f4bbe24f4adce52e6ab3a66d5d510e0670d
|
||||||
|
hash_to_ec e26f8adef5b6fe5bb01466bff0455ca23fda07e200133697b3b6430ca3332bde e262a58bcc1f8baf1980e00d5d40ba00803690174d14fb4c0f608429ce3df773
|
||||||
|
hash_to_ec 6e275b4ea4f085a5d3151aa08cf16a8c60b078e70be7ce5dac75b5d7b0eebe7c cb21b5a7744b4fcdc92ead4be0b04bcb9145e7bb4b06eff3bb2f0fe429b85108
|
||||||
|
hash_to_ec a0dde4561ad9daa796d9cd8a3c34fd41687cee76d128bf2e2252466e3ef3b068 79a2eb06bb7647f5d0aae5da7cf2e2b2d2ce890f25f2b1f81bfc5fef8c87a7d3
|
||||||
|
hash_to_ec dbaf63830e037b4c329969d1d85e58cb6c4f56014fd08eb38219bd20031ae27c 079c93ae27cd98075a487fd3f7457ad2fb57cdf12ec8651fedd944d765d07549
|
||||||
|
hash_to_ec 1e87ba8a9acf96948bc199ae55c83ab3277be152c6d0b1d68a07955768d81171 5c6339f834116791f9ea22fcc3970346aaeddacf13fbd0a7d4005fbd469492ca
|
||||||
|
hash_to_ec 5a544088e63ddf5b9f444ed75a75bc9315c4c50439522f06b4823ecaf5e8a08d e95ca0730d57c6469be3a0f3c94382f8490257e2e546de86c650bdbc6482eaee
|
||||||
|
hash_to_ec e4e06d92ebb036a5e4bb547dbaa43fd70db3929eef2702649455c86d7e59aa46 e26210ff8ee28e24ef2613df40aa8a874b5e3c1d07ae14acc59220615aa334dc
|
||||||
|
hash_to_ec 5793b8b32dcc0f204501647f2976493c4f8f1fa5132315226f99f29a5a6fdfce 656e390086906d99852c9696e831f62cb56fc8f85f9a5c936c327f23c7faf4fe
|
||||||
|
hash_to_ec 84f56fa4d7f12e0efd48b1f7c81c15d6e3843ebb419f4a27ec97028d4f9da19e 0cbd4f0cd288e1e071cce800877de6aef97b63fff867424a4f2b2bab25602608
|
||||||
|
hash_to_ec 242683ddf0a9fc55f6585de3aa64ea17c9c544896ff7677cd82c98f833bdf2ca 38c36d52314549213df7c7201ab7749a4724cbea92812f583bb48cabc20816ad
|
||||||
|
hash_to_ec a93ee320dc030aa382168c2eb6d75fce6e5a63a81f15632d514c6de8a7cfa5ee bd0a2facaa95bc95215a94be21996e46f789ee8beb38e75a1173b75fc686c505
|
||||||
|
hash_to_ec e36136601d84475d25c3f14efe030363d646658937a8a8a19a812d5e6deb5944 2fb93d78fae299c9f6b22346acfb829796ee7a47ec71db5456d8201bec6c35a3
|
||||||
|
hash_to_ec ba4b67d3d387c66baa4a32ec8b1db7681087e85076e71bab10036388c3aeb011 cc01329ce56f963bf444a124751c45b2c779ccb6dea16ca05251baca246b5401
|
||||||
|
hash_to_ec 3fbc91896a2585154d6f7094c5ab9c487e29a27951c226eec1235f618e44946b 7d983acbb901bf5497d0708392e5e742ec8c8036cbb0d03403e9929da8cc85a7
|
||||||
|
hash_to_ec a2da289fed650e9901f69a5f33535eb47c6bd07798633cbf6c00ce3172df76ac dca8a4d30ec2d657fefd0dba9c1c5fd45a79f665048b3cf72ac2c3b7363da1ac
|
||||||
|
hash_to_ec 99025d2d493f768e273ed66cacd3a5b392761e6bd158ca09c8fba84631ea1534 7ef5af79ab155ab7e1770a47fcd7f194aca43d79ec6e303c7ce18c6a20279b04
|
||||||
|
hash_to_ec 3cf1d01d0b70fb31f2a2f979c1bae812381430f474247d0b018167f2a2cd9a9f 7c53d799ec938a21bb305a6b5ca0a7a355fa9a68b01d289c4f22b36ce3738f95
|
||||||
|
hash_to_ec 639c421b49636b2a1f8416c5d6e64425fe51e3b52584c265502379189895668e 0b47216ae5e6e03667143a6cf8894d9d73e3152c64fb455631d81a424410e871
|
||||||
|
hash_to_ec 4ccf2c973348b7cc4b14f846f9bfcdcb959b7429accf6dede96248946841d990 7fd41f5b97ba42ed03947dd953f8e69770c92cc34b16236edad7ab3c78cbbb2e
|
||||||
|
hash_to_ec f76ae09fff537f8919fd1a43ff9b8922b6a77e9e30791c82cf2c4b8acb51363e 8e2c6bf86461ad2c230c496ee3896da33c11cc020fd4c70faa3645b329049234
|
||||||
|
hash_to_ec 98932da7450f15db6c1eef78359904915c31c2aa7572366ec8855180edb81e3a 86180adddfac0b4d1fb41d58e98445dde1da605b380d392e9386bd445f1d821c
|
||||||
|
hash_to_ec ab26a1660988ec7aba91fc01f7aa9a157bbc12927f5b197062b922a5c0c7f8dd 2c44a43eda0d0aad055f18333e761f2f2ec11c585ec7339081c19266af918e4f
|
||||||
|
hash_to_ec 4465d0c1b4930cc718252efd87d11d04162d2a321b9b850c4a19a6acdfca24f4 b03806287d804188a4d679a0ecee66f399d7bdc3bd1494f9b2b0772bbb5a034f
|
||||||
|
hash_to_ec 0f2a7867864ed00e5c40082df0a0b031c89fa5f978d9beb2fde75153f51cfb75 5c471e1b118ef9d76c93aec70e0578f46e8db1d55affd447c1f64c0ad9a5caa5
|
||||||
|
hash_to_ec 5c2808c07d8175f332cae050ce13bec4254870d76abff68faf34b0b8d3ad5000 eeff1d9a5aa428b7aecc575e63dde17294072eb246568493e1ed88ce5c95b779
|
||||||
|
hash_to_ec 36300a21601fad00d00da45e27b36c11923b857f97e50303bd01f21998eaef95 b33b077871e6f5dad8ff6bc621c1b6dedcf700777d996c8c02d73f7297108b7e
|
||||||
|
hash_to_ec 9e1afb76d6c480816d2cedd7f2ab08a36c309efaa3764dcdb51bad6049683805 4cd96ba7b543b1a224b8670bf20b3733e3910711d32456d3e58e920215788adf
|
||||||
|
hash_to_ec 685f152704664495459b76c81567a4b571e8b307dd0e3c9b08ee95651a006047 80dd6b637580cb3be76025867f1525852b65a7a66066993fda3af7eb187dc1a5
|
||||||
|
hash_to_ec 0b216444391a1163c14f7b27f9135e9747978c0e426dce1fa65c657f3e9146be 021259695a6854a4a03e8c74d09ab9630a401bfca06172a733fe122f01af90b4
|
||||||
|
hash_to_ec cfcb35e98f71226c3558eaa9cf620db5ae207ece081ab13ddea4b1f122850a5a 46763d2742e2cdffe80bb3d056f4d3a1565aa83f19aab0a1f89e54ad81ae0814
|
||||||
|
hash_to_ec 07e7292da8cdcdb58ee30c3fa16f1d609e9b3b1110dd6fa9b2cc18f4103a1c12 fe949ca251ac66f13a8925ae624a09cdbf6696d3c110442338d37700536e8ec7
|
||||||
|
hash_to_ec 813bc7e3749e658190cf2a4e358bc07a6671f262e2c4eef9f44c66066a72e6a7 6b92fbda984bd0e6f4af7a5e04c2b66b6f0f9d197a9694362a8556e5b7439f8a
|
||||||
|
hash_to_ec 89c50a1e5497156e0fae20d99f5e33e330362b962c9ca00eaf084fe91aaec71d ef36cb75eb95fb761a8fa8c376e9c4447bcd61421250f7a711bd289e6ed78a9b
|
||||||
|
hash_to_ec d9bd9ff2dd807eb25de7c5de865dbc43cce2466389cedbc92b90aab0eb014f81 30104771ff961cd1861cd053689feab888c57b8a4a2e3989646ea7dea40f3c04
|
||||||
|
hash_to_ec b8c837501b6ca3e118db9848717c847c062bf0ebeca5a7c211726c1426878af5 19a1e204b4a32ce9cccf5d96a541eb76a78789dceaf4fe69964e58ff96c29b63
|
||||||
|
hash_to_ec 84376c5350a42c07ac9f96e8d5c35a8c7f62c639a1834b09e4331b5962ecace8 ba1e4437d5048bd1294eadc502092eafc470b99fde82649e84a52225e68e88f2
|
||||||
|
hash_to_ec a3345e4a4cfc369bf0e7d11f49aed0d2a6ded00e3ff8c7605db9a919cf730640 0d318705c16e943c0fdcde134aaf6e4ccce9f3d9161d001861656fc7ea77a0b1
|
||||||
|
hash_to_ec 3c994dfb9c71e4f401e65fd552dc9f49885f88b8b3588e24e1d2e9b8870ffab1 984157de5d7c2c4b43b2bffea171809165d7bb442baea88e83b27f839ebdb939
|
||||||
|
hash_to_ec 153674c1c1b18a646f564af77c5bd7de452dc3f3e1e2326bfe9c57745b69ec5c e9a4a1e225ae472d1b3168c99f8ba1943ad2ed84ef29598f3f96314f22db9ef2
|
||||||
|
hash_to_ec 2d46a705d4fe5d8b5a1f4e9ef46d9e06467450eb357b6d39faa000995314e871 b9d1aec540bf6a9c0e1b325ab87d4fbe66b1df48986dde3cb62e66e136eba107
|
||||||
|
hash_to_ec 6764c3767f16ec8faecc62f9f76735f76b11d7556aeb61066aeaeaad4fc9042f 3a5c68fb94b023488fb5940e07d1005e7c18328e7a84f673ccd536c07560a57b
|
||||||
|
hash_to_ec c99c6ee5804d4b13a445bc03eaa07a6ef5bcb2fff0f71678dd3bd66b822f8be8 a9e1ce91deed4136e6e53e143d1c0af106abde9d77c066c78ebbf5d227f9dde0
|
||||||
|
hash_to_ec 3009182e1efac085c7eba24a7d9ef28ace98ebafa72211e73a41c935c37e6768 e55431a4c89d38bd95f8092cdf6e44d164ad5855677aba17ec262abc8c217c86
|
||||||
|
hash_to_ec e7153acd114a7636a207be0b67fa86fee56dd318f2808a81e35dd13d4251b2d0 ff2b98d257e4d4ff7379e8871441ca7d26e73f78f3f5afcf421d78c9799ba677
|
||||||
|
hash_to_ec 6378586744b721c5003976e3e18351c49cd28154c821bc45338892e5efedd197 3d765fb7bb4e165a3fa6ea00b5b5e22250f3861f0db0099626d9a9020443dda2
|
||||||
|
hash_to_ec 5be49aba389b7e3ad6def3ba3c7dbec0a11a3c36fc9d441130ef370b8a8d29c2 2d61faf38062dc98ae1aaafec05e90a925c9769df5b8b8f7090d9e91b2a11151
|
||||||
|
hash_to_ec f7bc382178d38e1b9a1a995bd8347c1283d8a2e8d150379faa53fd125e903d2b 544c815da65c3c5994b0ac7d6455578d03a2bc7cf558b788bcdb3430e231635a
|
||||||
|
hash_to_ec c28b5c4b6662eebb3ec358600644849ebeb59d827ed589c161d900ca18715fa8 a2d64db3c0e0353c257aadf9abc12ac779654d364f348b9f8e429aa7571203db
|
||||||
|
hash_to_ec 3a4792e5df9b2416a785739b9cf4e0d68aef600fa756a399cc949dd1fff5033a 4b54591bd79c30640b700dfb7f20158f692f467b6af70bd8a4e739c14a66c86a
|
||||||
|
hash_to_ec 002e70f25e1ceaf35cc14b2c6975a4c777b284a695550541e6f5424b962c19f5 73987e9342e338eb57a7a9e03bd33144db37c1091e952a10bd243c5bb295c18a
|
||||||
|
hash_to_ec 7eb671319f212c9cae0975571b6af109124724ba182937a9066546c92bdeff0c 49b46da3be0df1d141d2a323d5af82202afa2947a95b9f3df47722337f0d5798
|
||||||
|
hash_to_ec ca093712559c8edd5c51689e2ddcb8641c2960e5d9c8b03a44926bb798a0c8dc b9ef9cf0f8e4a3d123db565afafb1102338bfb75498444ac0a25c5ed70d615da
|
||||||
|
hash_to_ec cfea0a08a72777ff3aa7be0d8934587fa4127cd49a1a938232815dc3fd8b23ac b4de604b3d712f1ef578195fb0e53c865d41e2dfe425202c6cfe6f10e4404eb5
|
||||||
|
hash_to_ec aa0122ae258d6db21a26a31c0c92d8a0e3fdb46594aed41d561e069687dedcd6 5247eaec346de1c6cddf0ab04c12cd1d85cdb6d3a2fba2a5f9a5fe461abef5eb
|
||||||
|
hash_to_ec b3941734f4d3ba34ccaf03c4c737ac5a1e036eb74309300ce44d73aca24fef08 535938985c936e3780c61fe29a4121d6cb89a05080b6c2147031ea0c2b5b9829
|
||||||
|
hash_to_ec 8c2ee1041a2743b30dcbf413cc9232099b9268f82a5a21a09b63e7aff750882f 6ad0d4b3a65b522dfad0e9ac814b1fb939bc4910bd780943c72f57f362754cca
|
||||||
|
hash_to_ec 4b6829a2a2d46c8f0d0c23db0f735fcf976524bf39ccb623b919dd3b28ad5193 2e0097d7f92993bc45ba06baf4ca63d64899d86760adc4eb5eeefb4a78561050
|
||||||
|
hash_to_ec 9c1407cb6bba11e7b4c1d274d772f074f410d6fe9a1ee7a22cddf379257877d9 692261c7d6a9a7031c67d033f6d82a68ef3c27bd51a5666e55972238769821cd
|
||||||
|
hash_to_ec 638c42e4997abf8a4a9bffd040e31bd695d590cde8afbd7efd16ffdbae63bf66 793024c8ce196a2419f761dde8734734af6bd9eb772b30cc78f2cb89598dce97
|
||||||
|
hash_to_ec 1fb60d79600de151a1cf8a2334deb5828632cbd91cb5b3d45ae06e08187ae23d ff2542cde5bc2562e69471a31cfc3d0c26e2f6ccc1891a633b07a3968e42521c
|
||||||
|
hash_to_ec d2fdbbae4e38a1b734151c3df52540feb2d3ff74edfef2f740e49a5c363406ee 344c83ba6ff4e38b257077623d298d2f2b52002645021241bc9389f81b29ad12
|
||||||
|
hash_to_ec 836c27a6ddfe1a24aba3d6022dff6dfe970f142d8b4ac6afb8efcba5a051942f b8af481d33726b3f875268282d621e4c63f891a09f920b8f2f49080f3a507387
|
||||||
|
hash_to_ec 46281153ddcdf2e79d459693b6fe318c1969538dd59a750b790bfff6e9481abf 8eaf534919ab6573ba4e0fbde0e370ae01eae0763335177aa429f61c4295e9d4
|
||||||
|
hash_to_ec d57b789e050bf3db462b79a997dac76aa048d4be05f133c66edee56afd3dbe66 0c5a294cb2cbb6d9d1c0a1d57d938278f674867f612ed89dcbe4533449f1a131
|
||||||
|
hash_to_ec 548d524d03ac22da18ff4201ce8dbee83ad9af54ee4e26791d26ed2ab8f9bfc7 c6609d9e7d9fd982dec8a166ff4fb6f7d195b413aad2df85f73d555349134f3b
|
||||||
|
hash_to_ec cc920690422e307357f573b87a6e0e65f432c6ec12a604eb718b66ba18897a56 6f11c466d1c72fccd81e51d9bda03b6e8d6a395e1d931b2a84e392dc9a3efa18
|
||||||
|
hash_to_ec c7fb8a51f5fcd8824fc0875d4eb57ab4917cb97090a6e2288f852f2bb449edd9 45543fea6eed461016e48598b521f18ff70178afea18032b188deea3e56052fc
|
||||||
|
hash_to_ec c681bb1b829e24b1c52cb890036b89f0029d261c6a15e5b2c684ee7dfe91e746 263006fe2c6b08f1ab29cdf442472c298e2faf225bbf5c32399d3745cd3904bd
|
||||||
|
hash_to_ec e06411c542312fdd305e17e46be14c63bab5836dc8751da06164b1ae22d4e20f 901871be7a7ff5aecade2acff869846f3c50de69307ac155f2aa3a74d5472ef2
|
||||||
|
hash_to_ec 9c725a2acb80fa712f9781da510e5163b1b30f4e1c064c26b5185e537f0614ea 02420d49257846eb39fddd196d3171679f6be21d9adac667786b65a6e90f57b1
|
||||||
|
hash_to_ec 22792772820feafa85c5cb3fa8f876105251bef08617d389619697f47dff54f2 a3ad444e7811693687f3925e7c315ae55d08d9f4b0a29876bc2a891ab941c1c3
|
||||||
|
hash_to_ec 0587b790121395d0f4f39093d10b4817f58a1e80621a24eea22b3c127d6ac5a2 86c417c695c64c7becaad0d59ddbb2bca4cb2b409a21253d680aac1a08617095
|
||||||
|
hash_to_ec fa0b5f28399bef0cd87bfe6b8a2b69e9c5506fb4bacd22deba8049615a5db526 ede0ea240036ff75d075258a053f3ce5d6f77925d358dbe33c06509fc9b12111
|
||||||
|
hash_to_ec 62a3274fc0bed109d5057b865c2ba6b6a5a417cb90a3425674102fcd457ede2d ff7e46751bb4dcd1e800a8feab7cf6771f42dc0cfed7084c23b8a5d255a6f34e
|
||||||
|
hash_to_ec a6fcd4aecaaaf281563b9b7cd6fbc7b1829654f644f4165942669a2ef632b2bf 28f136be0eb957a5b36f8ec294399c9f73ad3a3c9bb953ad191758ced554a233
|
||||||
|
hash_to_ec 01baa4c06d6676c9b286cda76ed949fd80a408b3309500ba84a5bb7e3dce58e2 a943d1afa2efce284740e7db21ea02db70b124808be2ff80cbf9b9cb96c7b73e
|
||||||
|
hash_to_ec dd9aff9c006ba514cef8fae665657bc9813fe2715467cf479643ea4c4e365d6d 68de2f7d49de4004286ce0989a06a686b15d0f463a02ffd448a18914e1ddf713
|
||||||
|
hash_to_ec 3df3513d5e539161761ce7992ab9935f649bc934bed0da3c5e1095344b733bb9 e9c2dd747d7b2482474325943cd850102b8093164678362c7621993a790e2a8a
|
||||||
|
hash_to_ec 7680cfb244dc8ef37c671fff176be1a3dad00e5d283f93145d0cbee74cca2df4 a0fd8c3cca16a130eaa5864cbe8152b7adfbf09e8cf72244b2fc8364c3b20bf4
|
||||||
|
hash_to_ec 8a547c38bd6b219ea0d612d4a155eba9c56034a1405dcf4b608de787f37e0fd8 76bf0dc40fd0a5508c5e091d8bb7eccfa28b331e72c6a0d4ac0e05a3d651850b
|
||||||
|
hash_to_ec dd93901621f58465e9791012afa76908f1e80ad80e52b809dc7fc32bb004f0a8 09a0b7ecfe8058b1e9ee01c9b523826867ca97a32efad29ac8ceebca67a4ea00
|
||||||
|
hash_to_ec b643010220f1f4ee6c7565f6e1b3dc84c18274ede363ac36b6af3707e69a1542 233c9ff8de59e5f96c2f91892a71d9d93fa7316319f30d1615f10ac1e01f9285
|
||||||
|
hash_to_ec c2637b2299dfc1fd7e953e39a582bafd19e6e7fff3642978eb092b900dbfea80 339587ba1c05e2cba44196a4be1fd218b772199e2c61c3c0ff21dcd54b570c43
|
||||||
|
hash_to_ec 1f36d3a7e7c468eb000937de138809e381ad2e23414cbbaac49b7f33533ed486 7e5b0a96051c77237a027a79764c2763487af88121c7774645e97827fb744888
|
||||||
|
hash_to_ec 8c142a55f60b2edbe03335b7f90aa2bd63e567048a65d61c70cb28779c5200af d3d6d5563b3d81c8c91cf9806bb13b2850fb7c162c610fd2f5b83c464add8182
|
||||||
|
hash_to_ec 99e7b98293c9de1f81aff1376485a990014b8b176521b2a68cdbde6300190398 119cbc01a1d9b9fb4759031d3a70685aebea0f01bc5ee082ce824265fd21b3b4
|
||||||
|
hash_to_ec 9753bd38be072b51490290be6207ca4545e3541bdf194e0850ae0a9f9e64b8ba 1ad3aa759863153606fa6570f0e1290baded4c8c1f2ba0f67c1911bfc8ccd7a0
|
||||||
|
hash_to_ec 322703864ceee19b7f17cec2a822f310f0c4da3ff98b0be61a6fd30ac4db649c 89d9e7a5947e1cde874e4030de278070aae363063cd3592ce5411821474f0816
|
||||||
|
hash_to_ec c1acd01e1e535fad273a8b757d981470f43dd7d95af732901fbba16b6e245761 57e80445248111150da5e63c706b4abbf3eef2cc508bd0347ff6b81e8c59f5bc
|
||||||
|
hash_to_ec 492473559f181bbe78f60215bc6d3a5168435ea2fc0a508372d6f5ca126e9767 df3965f137cf6f60c56ebd7c8f246281fd6dc92ce23a37e9f846f8452c884e01
|
||||||
|
hash_to_ec afa9d6e0e2fb972ee806beb450c2c0165e58234b0676a4ec0ca19b6e710d7c35 669a57e69dd2845a5e50ed8e5d8423ac9ae792a43c7738554d6c5e765a7b088a
|
||||||
|
hash_to_ec 094de050bdadef3b7dbaeeca29381c667e63e71220970149d97b95db8f4db61b 0cf5d03530c5e97850d0964c6a394de9cde1e8e498f8c0e173c518242c07f99a
|
||||||
|
hash_to_ec 2ce583724bc699ad800b33176a1d983512fe3cb3afa65d99224b23dae223efb7 e1548fd563c75ae5b5366dbab4cb73c54e7d5e087c9e5453125ff8fbe6c83a5c
|
||||||
|
hash_to_ec 8064974b976ff5ef6adaade6196ab69cda6970cd74f7f5899181805f691ad970 98ae63c47331a4ac433cb2f17230c525982d89d21e2838515a36ec5744ec2d15
|
||||||
|
hash_to_ec 384911047de609c6ae8438c745897357989363885cef2381a8a00a090cf04a58 4692ec3a0a03263620841c108538d584322fdd24d221a74bf1e1f407f83828af
|
||||||
|
hash_to_ec 0e1b1ced5ae997ef9c10b72cfc6d8c36d7433c01fc04f4083447f87243282528 6ee443ab0637702b7340bd4a908b9e2e63df0cc423c409fb320eb3f383118b80
|
||||||
|
hash_to_ec 5a7aea70c85c040af6ff3384bcaa63ec45c015b55b44fffa37ab982a00dc57c5 2df2e20137cefd166c767646ecd2e386d28f405aebe43d739aa55beba04ed407
|
||||||
|
hash_to_ec 3e878a3567487f20f7c98ea0488a40b87f1ba99e50bbfe9f00a423f927cbd898 697c7e60e4bf8c429ba7ac22b11a4b248d7465fc6abe597ec6d1e1c973330688
|
||||||
|
hash_to_ec c0bb08350d8a4bb6bf8745f6440e9bd254653102a81c79d6528da2810da758e4 396a872ac9147a69b27223bf4ec4198345b26576b3690f233b832395f2598235
|
||||||
|
hash_to_ec 6c3026a9284053a4ddb754818f9ae306ffa96eb7003bd03826eeccc9a0cf656e bef73da51d3ba9972a33d1afb7d263094b66ab6dbe3988161b08c17f8c69c2d5
|
||||||
|
hash_to_ec f80b7d8f5a80d321af3a42130db199d9edcb8f5a82507d8bfca6d002d65458b6 aa59c167ea60ee024421bfbd00adbb3cbfc20e16bd3c9b172a6bef4d47ca7f57
|
||||||
|
hash_to_ec bc0ffc24615aa02fafef447f17e7b776489cd2cc909f71e8344e01cad9f1610d 5c4195cc8dc3518143f06a9c228ae59ec9a6425a8fab89bfc638ad997cf35220
|
||||||
|
hash_to_ec b15fad558737229f8816fcba8fbef805bd420c03e392d118c69bdf01890c4924 f5810477e37554728837f097e1b170d1d8c95351c7fff8abbbfc624e1a50c1b9
|
||||||
|
hash_to_ec ec8c1f10d8e9da9cf0d57c4a1f2c402771bed7970109f3cf21ad32111f1f198f a697e0a3f09827b0cf3a4ffb6386388feda80d30ffffcbd54443dafcba162b28
|
||||||
|
hash_to_ec a989647bf0d70fdb7533b8c303a2a07f5e42e26a45ffc4e48cff5ba88643a201 450fd73e636f94d0d232600dd39031386b0e2ecde4105124fc451341da9803db
|
||||||
|
hash_to_ec 7159971b03c365480d91d625a0fadc8e3a632c518acf0dbec87dd659da70e168 377bc43c038ac46cf6565aa0a6d6bf39968c0c1142755dba3141eeebf0acdf5d
|
||||||
|
hash_to_ec e39089a64fedac4b2c25e36312b33f79d02bf75a883f450f910915b8560a3b06 77efa7db1be020e77596f550de45626824a8268095d56a0991696b211cb329cc
|
||||||
|
hash_to_ec 2056b3c6347611bb0929dad00ec932a4d9bec0f06b2d57f17e01ffa1528a719e b6072c2be2ce928e8cbbb87e8eb7e06975c0f93b309dd3b6a29edaad2b56f99b
|
||||||
|
hash_to_ec 2c026793146e81b889fc741d62e06c341ce263560d57cd46d0376f5b29174489 8f1f64b67762aa784969e954c196a2c6610addc3604aa3291eb0b80304dfe9ef
|
||||||
|
hash_to_ec be6026d6704379c489fa7749832b58bdb1a9685a5ffb68c438537f2f76e0011f 0072569a4090a9ad383a205bb092196c9de871c22506e3bb63d6b9d1b2357c96
|
||||||
|
hash_to_ec f4db802d5c6b7d7b53663b03d988b4cd0c7cad6c26612c5307754a93ebdc9710 f21bc9be4cb28761f6fe1d0a555ad5e9748375a2e9faea25a1df75cc8d273e18
|
||||||
|
hash_to_ec c27d79a564c56b00956a55090481e85fbc837fd5fb5e8311ecb436e300c07e3a 1b1891e6abec74621501450cd68bb1eeaa5b2fffff4ec441a55d1235ff3a0842
|
||||||
|
hash_to_ec a1e2f93c717cad32af386efa624198973df5a710963dd19d4c3ac40032a3a286 69c60571e3f9f63d2bfb359386ae3b8cd9e49a2e9127753002866e85c0443573
|
||||||
|
hash_to_ec 76920d7b1763474bc94a16433c3c28241a9acdee3ff2b2cb0e6757ba415310aa c1b409169f102b696fc7fa1aa9c48631e58e08b5132b6aadf43407627bb1b499
|
||||||
|
hash_to_ec 57ac654b29fa227c181fff2121491fcb283af6cbe932c8199c946862c0e90cb2 a204e8d327ea93b0b1bd74a78ffc370b20cea6455e209f2bc258114baa16d728
|
||||||
|
hash_to_ec 88e66cfaef6432b759c50efce885097d1752252b479dac5ed822fa6c85d56427 6fb84790d3749a5c1088209ee3823848d9c19bf1524215c44031143dd8080d70
|
||||||
|
hash_to_ec c1e55da929c4f8f793696fc77ff4e1c317c34852d98403bfd15dd388ee7df0df 2f41e76f15c5b480665bd84067e3b543b85ce6de02be9da7a550b5e1ead94d34
|
||||||
|
hash_to_ec 29e9ace5aa3c5a572b13f4b62b738a764d90c8c293ccb062ad798acbab7c5ef4 bce791aba1edc2a66079628fd838799489ab16b0a475ce7fe62e24cc56fe131c
|
||||||
|
hash_to_ec f25b2340689dadacaa9a0ef08aee8447d80b982e8a1ea42cf0500a1b9d85b37d f7f53aa117e6772a9abc452b3931b0a99405ac45147e7c550ac9fcf7ffe377b5
|
||||||
|
hash_to_ec 0cb6c47fc8478063b33f5aed615a05bcc84d782c497b6cc8e76ec1fa11edbfdb 7a0b58b03147e7c9be1d98de49ead2ce738d0071b0af8ca03cc92ceb26fc2246
|
||||||
|
hash_to_ec 7bd7287d7c4b596fe46fe57a6982c959653487bea843a77dd47d40986200d576 343084618c58284c64a5ff076f891be64885dc2ac73fa1567f7b39fde6b91542
|
||||||
|
hash_to_ec e4984bf330708152254fb18ecef12d546afd24898a3cf00fba866957b6ee1b82 c70e88b061656181fbd6ff12aca578fb66de5553c756ea4698a248b177185bc6
|
||||||
|
hash_to_ec cefd6c3cb9754ea632d6aea140af017de5ea12e5184f868936b74d9aa349d603 4b476502a8a483aadd50667f262f95351901628dd3a2aac1a5a41c4ea03f1647
|
||||||
|
hash_to_ec da5d0f33344ee7f3345204badf183491b9452b84bccc907602c7bad43e5cf43e 9561b9e61241625e028361494d4fa5cd78df4c7219fa64c8fede6d8421b8904a
|
||||||
|
hash_to_ec d6f0a4f8c770a1274a76fd7ae4e5faf7779249263e1aaecc6f815cf376f5c302 cd5c55820be10f0d38feb81363ede3716a9168601a0dd1ce3109aab81367d698
|
||||||
|
hash_to_ec b6bf32491d12a41c275d8518fc534d9a0d17aade509e7e8b8409a95c86167307 4aae534abbd67a9a8f2974154606c0e9be8932e920c7a5e931b46a92859acf82
|
||||||
|
hash_to_ec 0f930beaad041f9cefd867bc194027dd651fb3c9bda5944ececdba8a7136b6d3 521708f8149891b418d0920369569a9d578029c78f8e41c68a0bb68d3ad5df60
|
||||||
|
hash_to_ec 49b1fe0f97be74b81e0b047027b3e9f726fa5e90a67dafa877309397291c06c5 0852e59dfae5ec32cce606c119376597bce5cd4d04879d329f74e3ec66414cd3
|
||||||
|
hash_to_ec 4d57647d03f2cfbd4782fcc933e0683b52d35fc8d37283e6c7de522ddfa7e698 cbeb9ebfbbc49ec81fac3b7b063fecac1bb40ea686d3ffb08f82b291715cd87f
|
||||||
|
hash_to_ec 4ea3238c06fc9346c7421ff85bc0244b893860b94bc437378472814d09b2e99f a1fbae941adc344031bbdf53385dfdc012311490a4eb5e9a2749a21b27ce917a
|
||||||
|
hash_to_ec 0cd3609f5c78b318cb853d189b73b1ee2d00edd4e5fce2812027daa3fcb1fed1 0c7a7241b16e3c47d41f5abbf205797bd4b63fc425a7120cb2a4bf324e08ae74
|
||||||
|
hash_to_ec d74ab71428e36943c9868f70d3243469babd27988a1666a06f499a5741a52e3e 65b7c259f3b4547c082b2a7669b2b363668c4d87ac14e80471317b03b34e5216
|
||||||
|
hash_to_ec f6b151998365e7d69bcbce383dd2e8b5bf93b8b72f029ff942588208c1619591 6ce840ce5dfbca238665c1e6eddb8b045aa85c69b5976fc55ab57e66d3d0a791
|
||||||
|
hash_to_ec 207751de234b2bd7ec20bdd8326210c23aa68f04875c94ad7e256a96520f25d6 fc8f79ab3af317c38bfb88f40fb84422995a0479cfa6b03fa6df7f4e5f2813fb
|
||||||
|
hash_to_ec 62291e2873f38c0a234b77d1964205f3f91905c261d3c06f81051a9b0cb787cb 076d1d767457518e6777cb3bd4df22c8a19eb617e4bbccd1b0bd37522d6597a5
|
||||||
|
hash_to_ec 4b060df2d2854036751d00190ee821cb0066d256d4172539fdfa6fbd1cdfe1f9 59866e927c69e7de5df00dc46c0d2a1ddf799d901128ff040cebb8fd61b95da4
|
||||||
|
hash_to_ec ac8daf73f9c609bb36bce4fdeec1e50be5f22de38c3904fabcf758f0fc180bc7 7d8dc4e956363b652468a5fecafd7c08d48a2297e93b8edcb38e595fdd5a1fde
|
||||||
|
hash_to_ec fef7b6563fd27f3aab1d659806b26b8f2ec38bc8feefad50288383c001d1c20f e6e42547f12df431439d45103d2c5a583248f44554a98a3a433cf8c38b11805d
|
||||||
|
hash_to_ec 40a3d6871c76ecc6bb7b28324478733e196cc11d062dd4c9265cf31be5cf5a97 8c55a3811c241a020b1be202a58d5defbc4c8945d73b132570b47dd7c019ccf0
|
||||||
|
hash_to_ec 0cd71e7e562b2b47f4bc8640caf20e69d3a62f10231b4c7a372c9691cff9ac3c fb8e4e3de479b3bf1f4f13b4ed5507df1e80bd9250567b9d021b03339d6e7197
|
||||||
|
hash_to_ec 40a4e62800a99b7a26e0b507ffb29592e5bdba25284dc473048f24b27d25b40a 90ae131d29ee4a71cd764ab26f1ca4e6d09a40db98f8692b345c3a0e130dc860
|
||||||
|
hash_to_ec 1ddf35193cf52860bfe3e41060a7f44281241c6ae49cd541d24c1aca679b7501 3b4f50013895c522776ced456329c4e727de03575f6b99ae7d238a9f70862121
|
||||||
|
hash_to_ec 014e0fa8ce9d5df262b9a1765725fde354a855de8aef3fc23684e05dd1ba8d34 3857f57776a3cb68721bcb7f1533a5f9fb416a1dc8824d719399b63a142d24de
|
||||||
|
hash_to_ec 09987979b0e98d1d5355df8a8698b8f54d3a037d12745c0a4317fe519c3df9cc 32a181e2b754aeced214c73ac459c97d99e63317be3eb923344c64a396173bca
|
||||||
|
hash_to_ec 51e9e8ec4413e92dbaaba067824c32b018487a8d16412ed310507b4741e18eed 0356b209156b4993fd5d5630308298429a1b0021c19bedecb7719ac607cfa644
|
||||||
|
hash_to_ec 14d91313dfe46e353310e6a4a23ee15d7a4e1f431700a444be8520e6043d08d9 6f345f4018b5d178d9f61894d9f46ac09ff639483727b0d113943507cee88cfd
|
||||||
|
hash_to_ec 0d5af9ace87382acfffb9ab1a34b6e921881aa015d4f6d9c73171b2b0a97600d a8dbf36c85bebe6a7b3733e70cd3cd9ed0eb282ca470f344e5fcf9fe959f2e6e
|
||||||
|
hash_to_ec 996690caac7328b19d20ed28eb0003d675b1a9ff79055ab530e3bf170eb22a94 14340d7d935cffce74b8b2f325c9d92ce0238b51807ef2c1512935bb843194ce
|
||||||
|
hash_to_ec ad839c4b4c278c8ebe16ff137a558255a1f74646aa87c6cd99e994c7bb97ce8a d4f2da327ffded913b50577be0e583db2b237b5ca74da648e9b985c247073b76
|
||||||
|
hash_to_ec 26fc2eeeee983e1300d72362fdff42edf08038e4eee277a6e2dbd1bd8c9d6560 3468b8269728c2c0bfc2e53b1575415124798bc0f59b60ea2f14967fc0ca19ce
|
||||||
|
hash_to_ec db33cecaf4ee6f0ceba338cc5fabfb7462cd952a9c9007357ff3f0ca8336f8bc 0bab38f58686d0ff770f770a297971510bc83e2ff2dfead34823d1c4d67f11af
|
||||||
|
hash_to_ec a0ee84b3c646526fb8787d26dcd9b7fe9dc713c8a6c1a4ea640465a9f36a64df 4d7a638f6759d3ec45339cd1300e1239cca5f0f658ca3cd29bc9bdb32f44faf0
|
||||||
|
hash_to_ec 6a702e7899fcf3988e2b6b55654c22e54f43d3fa29de19177bdff5b2295fe27f 145d5748d6054fb586568e276f6925aef593a5b9c8249ad3dbef510af99b4307
|
||||||
|
hash_to_ec 30ce0fd4f1fac8b62d613b8ee4a66deef6eb7094bd8466531050b837460f6971 f3aa850d593ba7cef01389f7e1916e57617f1d75cd42f64ce8f5f272384b148c
|
||||||
|
hash_to_ec 3aa31d4ad7046ad13d83eb11c9a6e90eb8483a374a77a9a7b2a7cc0978fefa76 2fe0827dc080d9c1e7ec475a78aa7ae3c86d1a35f4c3f25f4a1f7299cacf018a
|
||||||
|
hash_to_ec 8562a5a91e763b98014523ebb6e49120979098f89c31df1fde9eb3a49a15b20f ae223bf85e2009a9daf5fd8a14685e2e1e625fc88818b2fd437dd7e109a48f59
|
||||||
|
hash_to_ec ccf9c313a47b8dbf7ce42c94b785818bc24134d95b6d22acc53c1ec2be29cf27 3e79fce6fe5aa14251b6560df4b76e811d7739eec097f27052c4403a283be71d
|
||||||
|
hash_to_ec d1e33cd6f8918618d5fb6d67ad8de939db8beaec4f115551eac64479b739b773 613fffcbe1bf48bb2d7bfd64fd97790a06025f8f2429edddb9ac145707847ecf
|
||||||
|
hash_to_ec 81eaeced34dd44e448d5dafa5715225e4956c90911c964a96ff7aa5b86b969bc 8f81177495d120a1357380164d677509b167f2958eb8b962b616c3951d426d8c
|
||||||
|
hash_to_ec 2bc001a29f8eab1c7377de69957ba365fb5bdaf9c2c220889709af920dfe27d3 9bcb3010038f366fa4c280eed6e914a23bfc402594d0b83d0e66730a465a565b
|
||||||
|
hash_to_ec 6feeb703c05e86c58d9fc5623f1af8657ecd1e75a14d18c4eedb642a8a393d16 6544628ba67ed0e14854961739c4d467fcf49d6361e39d32ea73dabeae51e6c3
|
||||||
|
hash_to_ec e8ff145a7c26897f2c1639edd333a5412f87752f110079f581ccdc87fcce208c d4b5a6e06069c7e012e32119f8eda08ff04a8dfa784e1cf1bced455a4d41d905
|
||||||
|
hash_to_ec 80488131dcb2018527908dbf8cdf4b823ef0806dc1d360f4da671004ef7ff74d 9984a79d9fd4f317768b442161116eef84e2ca49e938642b268fd64312d59a27
|
||||||
|
hash_to_ec d8c4ca60446849a784d1462aa26a3b93073ff6841cb2da3ef52ab9785b00b1fd da5ec1562e7de2382d35728312f4eea3608d4dba775c1c108de510e1ce97d059
|
||||||
|
hash_to_ec 68645728dfc6b9358dfb426493238ba38f24a2f46a3e89edb47d212549939cb7 d3253aa7235113dcc1b577d3bb80be34f528398815a653dbdbacbcbdfd5887a1
|
||||||
|
hash_to_ec 4e8eb97ba2d1046e1b42e67530a61441e31c84e5e5e448d8e8dbe75d104eaccb de94f73e83222aa0e39b559d4fef70387b0815b9b2f6beff5da67262d8f0eb3e
|
||||||
|
hash_to_ec 104ff03122ffdf59b22b8c0fe3d8f2ef67d02328e4d5181916d3d2a92f9a0bb7 1517ccf69c0328327e1cf581f16944ff66bc91c37e1cd68a99525415e00b7c9f
|
||||||
|
hash_to_ec 80f23aae7356ae9a2f9f7504495a731214d26f870fb7df68fdc00b233494156f 7aef046b0a70f84e8d239aa95e192b5a3fffa0fae5090c91273e8996beca9e38
|
||||||
|
hash_to_ec 2424b33235955a737ebddbf1c6c59cd8778af74da3bd3e658447666a2ab2f557 d19e2be8d482950fbdae429618da7a9daedb8c5944dea19cd1b6b274e792231b
|
||||||
|
hash_to_ec 0adc839d2b8f099e4341a4763b074c06318d6bcbd1ec558d20a9820c4a426463 cea5da12a84e5c20011726d9224a9930bec30f9571762dd7ca857b86bd37d056
|
||||||
|
hash_to_ec 46c84d53951f1ba23c46a23d5d96bf019c559aa5d2d79e4535cfcdb36f38ce25 2a913a01a6f7dd78a43cdd5354d1160d9a5f0d824c489a892c80eba798a77567
|
||||||
|
hash_to_ec 99bdaaf68555ccdc93d97c3a0fb4c126a1aa8b1202194a1a753401a6cae21055 1f645efe173577a092f2d847cc966e28ba3b36397fe84c96dfa4724ed4fcfdf9
|
||||||
|
hash_to_ec c540ff78f1e063ad26ffa69febb8818c9f2a325072c566091ad816e40fe39af4 de7a762262c91ab4beccc0713233cb91163aec43e34de0dbcfad0c431e8a9722
|
||||||
|
hash_to_ec de8b1ff8978cd5e02681521542b7b6c3c2f8f4602065059f83594809d04e3dda 290601e75207085bff3e016746e55a80310a76dea9ef566c24181079c76da11c
|
||||||
|
hash_to_ec d555994c8a022e52602d2a8bdd01fc1bfa6b9ab6734ff72a1bd5f937de4627f8 5f6794e874f48c4b362d0a24207374c2d274e28de86351afc6ddb95d8cc2fd62
|
||||||
|
hash_to_ec 19db72f703fe6f1b73f21b6ba133ae6b111ae8cc496d3aa32e02411e34c0d8d7 42f159f43d2d62b8cf8a47d5f1340c5cf070e9860fc60de647c55d50fe9f5607
|
||||||
|
hash_to_ec 23a87a258c2a5d1353aa2d5946f9e5749b92f85e3c58e1d177c3b6c3dcac809c e5685016f79d5e87d1fecb3e2a0fe64e4875f7accd2f6649d7f6b16317549cb1
|
||||||
|
hash_to_ec 43e1738d7d1b5b565f5fc78e81480f7edf9a4dc18f104fc4be95135b98931b17 650f5b682e45f2d0c5d5e8bcfd9e0cda7d9071b55ecbfaf5e3b59941cd7479f2
|
||||||
|
hash_to_ec a9d644de0804edf62dee613efa2547e510990a9b7a987ebe55ec74c23873a878 52ad329f88499a4f110e6a6cba1f820012d8db6ccb8f6495ab1e3eb5a24786e1
|
||||||
|
hash_to_ec 11f2b5d89a0350d7c8727becf0f4dd19bd90f8c94ff207132ab13282dd9b94e6 b798a47bb98dc2a8f99deaf64d27638e33a0d504c5d2fbee477a2bc9b89e2838
|
||||||
|
hash_to_ec 5e206e3190b3b715d125f1a11fff424fb33e36e534c99ddde2a3517068b7dcc4 2738e9571c96b2ddf93cb5f4a72b1ea78d3731d9555b830494513c0683c950ca
|
||||||
|
hash_to_ec efc3d65a43d4f10795c7265a76671348f80173e0f507c812f7ae76793b99c529 cf4434d18ce8167b51f117fe930860143c46e1739a8db1fba73b6b0de830d707
|
||||||
|
hash_to_ec 81f00469788aad6631cf75b585ae06d43ec81c20479925a2009afac9687dff60 c335b5889b36ba4b4175bb0d986807e8eedb6f6b7329b70b922e2ab729c4202a
|
||||||
|
hash_to_ec 9ef5ff329b525ee8f5c3ac38e1dba7cb19985617341d356707c67ff273aed02d bef9f9e051ba0e24d1fdf72099cf43ecdd250d047fb329855b5372d5c422db9e
|
||||||
|
hash_to_ec 3fa1401bd63132cf8b385c0fa65f0715ba1fe6161e41d59f8033ae2b22f63fa1 8289a1cb3c2dae48879bb8913fafe2d196cc2fdab5f2a77607910efd33eae6df
|
||||||
|
hash_to_ec 6559836fd0081fa38a3f8d8408b564e5698b9797cf5e15f7f12a7d2c84511989 28d405a6687d2ecc90c1c66bf0454d58f3fa38835743075e1db58c658e15a104
|
||||||
|
hash_to_ec 8e0882d45f0e4c2fb2839d3be86ff699d4b2242f5b25ac5a3c2f65297c7d2032 2771fdcf9135a62007adb5f0004d8222f0e42f819c81710aa4dc3ab2042bebf3
|
||||||
|
hash_to_ec 1d91dc4dd9bd82646029d13aca1af96830c1d8a0400ddebeb14b00c93501c039 7792c62e897f32cbc9c4229f0d28f7882ceeae120329a1cd35f76a75ac704e93
|
||||||
|
hash_to_ec 09527f9052acbbdd7676cbbd9534780865f04a27aaadad2b7d4f1dac68883cf0 b934220cde1327f2dc6af67bcb4124bf424d5084ef4da945e4daad1717cd0bb8
|
||||||
|
hash_to_ec 2362e1abe73e64cdd2ca7f6c5ea9f467213747dd3f2b7c6e5df9cb21e03307d7 676b7122b96564358bbaaf77e3a5a4db1767e4f9a50f6ddd1c69df4566755af9
|
||||||
|
hash_to_ec 26c2dd2356e9b6c68a415b25f91d18614dc8500c66f346d28489da543ee75a94 0f4fd7086acd68eb7c9fa2410e2ecf18e34654eb44e979bc03ce436e992d5feb
|
||||||
|
hash_to_ec 422dc0a09d6a45a8e0b563eeb6a5ee84b08abd3a8cb34ff93f77ba3b163f4042 631f1b412ff5a0fccbe53a02b4a3deaa93a0418ed9874df401eb698ef75d7441
|
||||||
|
hash_to_ec ceecdf46f57ef3f36ff30a1a3579b609340282d1b26ab5ddef2f53514e91bab1 9bc6f981fe98d14a2fc5b01a8134b6d35e123ec9ab8a3f303e0a5abb28150e2e
|
||||||
|
hash_to_ec 024a9e6e0d73f28aa6207fb1e02ce86d444d2d46f8211e8aaab54f459db91a5a 5fb0c1d2c3b30f399102104ea1874099fa83110b3d9c1fcfffb2981c98bf8cdf
|
||||||
|
hash_to_ec 5b8e45e269c9ccac4c68e532a72b29346d218f4606f37a14064826a62050e3a8 c7be46a871b77fc05ce891d24bd6bd54d9775b7ef573c6bc2d92b67f3604c1d1
|
||||||
|
hash_to_ec 9a6593a385c266389eef14237874b97bdcd1823c3199311667d4853c2d12aa81 9f55ee9d94102d2b9c5670f30586cf9823bf205b4d4fe088c323e87c4e10f26f
|
||||||
|
hash_to_ec 27377e2811598c3569b92990865d39b72c7a5533e1be30f77330863187c11875 abd82bc726f2710a8b87e4c1cf5a069f0ae800de614468d3ff35639983020197
|
||||||
|
hash_to_ec 7cacfaa135fb7d568b8dce8ea9136498b1b28c6d1020af45d376288d78d411f0 229fccd49744c0692508af329224553d21561ee6062b2b8a21f080f73da5bd97
|
||||||
|
hash_to_ec 52abd90a5542d6496b8dec9567b020f30058e29458d64f2d4f3ad6f3bfc1a5a0 874e82ced7cf77577b3374087fb08a2300b7f403de628310c26bdb3be869d309
|
||||||
|
hash_to_ec 5c8eebe9d12309187afa8d0d5191de3fdb84e5a05485d7cd62e8804ce7fdc0bc 12b7537643488aa8b9dcc4bae040cd491f8b466163b7988157b0502fb6c9177f
|
||||||
|
hash_to_ec 6ca3dd5c7a21a6bf65d6eefbe20a66e9b1d6b64196344be0c075f47aea48e3aa 5e1d0705ee24675238293b73ab1d98359119d4b328275be2460cc6ee4d19cc88
|
||||||
|
hash_to_ec d7e6cd0d39b4308c2a5ee547c4569c8bb3887e49cedece62d218d7c3c5277797 793dc4397112dfd9a8f4e061f457eb6d6fbb1d7a58c40bad5f16002c64914186
|
||||||
|
hash_to_ec 9cb6de8ba967cca0f0f861c6e20546f8958446595c01c28dae7ba6cfa09d6b14 ba1a2f7502b58fee3499c20e35fa01bb932e7a7c4a925dc04fbf5d90f33cfb5e
|
||||||
|
hash_to_ec 8ef9c7366733a1edcd116238cdbd177d61222d5c3e05b30ef6b85014cbcb6b79 8fc89664722947164ac9b77086aed319897612068f56ecd57f47029f14671603
|
||||||
|
hash_to_ec 7f317a34e4fb7de9f69cb107ffc0e57fd9f5c85b85ccb5319d05cebfc169924a 4b71c42339c73db7d710cd63f374d478a6c13bdc352cff40e967282268965ba7
|
||||||
|
hash_to_ec 15beef8d9687b92918a903b01d594859db4e7128263c8db0cae9d423ff962c1e cd75e6323952f6ac88f138f391b69f38c46d70b7eda61f9e431725b6f1d514a5
|
||||||
|
hash_to_ec 7a1c04c9af8fc6649833fe81e96f0199fcfe94959256cbe1490075fc5be0904e 0368270cd979439ae0a9552a5d6c9f959e4247fcf920d9e071464582e79c04b1
|
||||||
|
hash_to_ec c854c583d338615f85f69061e0fa9c9d7c5bbbfe562e8774fef3be556fe8bb63 061620171d7320f64bee98414ff7200a1f481521d202fb281cab06be73b80402
|
||||||
|
hash_to_ec 0fb8af5aba05ad2503edf1cfad5a451da088e7e974772057cd991a4e0601a3eb d3cbc20384a4420143fcce2cb763b0c15bec4f3267d1bdad3c34c1ee6b790f5e
|
||||||
|
hash_to_ec 9a251cf59e84a9da5630642f9671c732440caa8fcf4c92446a7e5f5ef99da46c 9b9679086a433f2077f40bcd4c7545fb5cc87e7dbb8bba468d53cb04a74361a0
|
||||||
|
hash_to_ec 8c632e357cef00e0911eb566f8cc809136b3f5ac1e82d183e4d645cef89fa155 5e06b0f4f278fa1ccb5431866e0b35171cdb814e2e82b9189ce01d8d8a1b2408
|
||||||
|
hash_to_ec 4aa4c31463475086a5d96b3ff550340567ab3b4a86fa3f01cfe9be18bc4dcb54 76a2916cfc093f27992e1f07b50f431d61d58e255507e208cd29ea4d3bc56623
|
||||||
|
hash_to_ec 1d33d9aadb949346e3c78d065a0f5262374524f4cb97a7390c8cdaede7ca6578 9ad2f757f499359903031adea6126c577469c4e834a2959e3ac08ee74b13783c
|
||||||
|
hash_to_ec d9217b9a070df20c4d2f0db42ff0bb36bfba9f51b0b6df8fdfe150405dce4934 65a843c522b4b8ec081a696a0d2dd8dfdfea45db201de7a5889a1446c6dff8c7
|
||||||
|
hash_to_ec b665b2ca8a285e44ba84e785533b56496a5319730dbb95bc14d3bdfece7544dc 8a804cd13457497b0a29eeca2cecfaa858766ec1d270a0e0c6785b43fd49b824
|
||||||
|
hash_to_ec 43b5cbcc21b3404bca97fa9a661940fe64d40f3ca569310e50b1bb0173c4d5ee 6c12fffb540d536060bb8b96cf635c1b2cbaa4d875a8d2fb0bf79a690363df19
|
||||||
|
hash_to_ec 11c58f20562c00dec5bb4456be07cd98186837e9af38d50d45f5e7b6f0f9000d cee76b567586f66dadd38c01213bfc1a17d38e96a495efb4c26063dc498ba209
|
||||||
|
hash_to_ec b069a980b51d8e030262db0b30069e660f4a3f6f8075d1790c153ba12b879f8b 262391b00bdee71d1d827b2cfe50b46c29e265934dc91959bd369aca0cc6444e
|
||||||
|
hash_to_ec 75274bfd79bf33eb2f9ab046d34528af9a71811e7e3d55c20eb049c81ac692d8 cb93c850e36896fe6626e97c53652af6736ec3ba0641c7765d0cca2bad2352de
|
||||||
|
hash_to_ec 5cdb6a24d9736a00f197d9707949fedc5405f367744fe8c83b7cff650302b589 8b4ac03123fab9275dcf340345a1b11fba48ef106d410ba2e0e6f6457037a419
|
||||||
|
hash_to_ec 07fdc85f809f95a07b59b084402bf91c512ebbe05c7657d6ba27a9e7e121e3e2 61182b3def063630e11de648a278032bcb75949f3a24ef5a133da87830ae5c4e
|
||||||
|
hash_to_ec a4188ca634cbb796f9927822e343d7b267e0a609c1a0ffa4dcf3726b9ffcc8a2 a911e4899fda28fd6337d708d34553ac5e810ee4938f6f7d9d6e521cab069edb
|
||||||
|
hash_to_ec 3c128ec5c955ea189a5789df2c892e94193a534a9d5801b8f75df870bc492a69 59eef5ee9df0f681df5b5c67ead1f06b059a8a843837b67f20cce15779608170
|
||||||
|
hash_to_ec 51a4cc7ec4a14a98c0731e9de7f3ce0779123222d95455e940f2014a23729ec8 105863ccda076af7290d1bf9ec828651dc5811159839044d23f1c3e31a11c5e2
|
||||||
|
hash_to_ec 1b901a31acbb7807c3309facdc7d04bc3b5a4aa714e6e346bd1c6ad4634e6534 01b3c0000b6c6b471c67c6ab3f9c7a500beaea5edb5c8f2b34df91b69ff67f21
|
||||||
|
hash_to_ec d2f2c8d79cfa2e7cb2db80568ba62ca0576741acfbe5e2baa0d9b3c424a7c84d 7df9d9088022bd1ce6814d6f8051eef27a650ee38e789b184da2691efd27139d
|
||||||
|
hash_to_ec 04dcb7644fdfc12d8e34d6e57d7769db939b4a149ed2b81aa51a74ee90babe19 6cff0ab2dd3b32ba1bd1a78e3661722f3f10003a01ce83e430970557decedb2c
|
||||||
|
hash_to_ec 222798c6841eeaa07e7b7e29686942d7c7f9afc38d09360c8e1f52f2b7debd12 133e3a04ec82aa9b8dbbec18cadbafff446d1270bf7c6f3f97ddd3906dae2468
|
||||||
|
hash_to_ec 4f7277c3ef247a0689b486ad965f969c433fc63e95d7310e789c4708418ccabc 7e0f2c984dd3cffb35458938c95fe92acf2e697aed060b0e3377c7a07e53c494
|
||||||
|
hash_to_ec 359b4d6709413243ae2c5409ea02714a9f8961bbbb64a91e81daf01e18c981bf eab69af2cb7f113ad6a27035c0399853d10bd0b99291fad37794d100f7530431
|
||||||
|
hash_to_ec 6cea3c6a9eb38f60329537170aa4db8dbb869af2040061e53b10c267daf6568c da9a97f4fa96bd05dade5e2704a6a633ba4dbe5080a1e831cda888e9d4f86615
|
||||||
|
hash_to_ec 3dddecb954ef0209bcf61fd5b46b6c94f2384ef281c48a20ffee74f90788172d af9899c31f944617af54712f93d1a2b4944e48867f480d0d1aec61f3b713e32d
|
||||||
|
hash_to_ec 9605247462f50bdf7ff57fe966abbefe8b6efa0b65b5116252f0ec723717013f fc8f10904d42a74e09310ccf63db31a90f1dab88b278f15e3364a2356810f7e9
|
||||||
|
hash_to_ec a005143c4d299933f866db41d0a0b8c67264f5d4ea840dd243cb10c3526bc077 928df1fe9404ffa9c1f4a1c8b2d43ab9b81c5615c8330d2dc2074ac66d4d5200
|
||||||
|
hash_to_ec f45ce88065c34a163f8e77b6fb583502ed0eb1f490f63f76065a9d97e214e3a9 41bd6784270af4154f2f24f118617e2d7f5b7771a409f08b0f2b7bbcb5e3d666
|
||||||
|
hash_to_ec 7b40ac30ed02b12ff592a5479c80cf5a7673abfdd4dd38810e40e63275bc2eed 6c6bf5961d83851c9728801093d9af04e5a693bc6cbad237b9ac4b0ed580a771
|
||||||
|
hash_to_ec 9f985005794d3052a63361413a9820d2ce903198d6d5195b3f20a68f146c6d5c 88bcac53ba5b1c5b44730a24b4cc2cd782298fc70dc9d777b577a2b33b256449
|
||||||
|
hash_to_ec 31b8e37d01fd5669de4ebf78889d749bc44ffe997186ace56f1fb3e60b8742d2 776366b44170efb130a5045597db5675c6c0b56f3def84863c6b6358aa8dcf40
|
||||||
16
coins/monero/generators/src/varint.rs
Normal file
16
coins/monero/generators/src/varint.rs
Normal file
@@ -0,0 +1,16 @@
|
|||||||
|
use std_shims::io::{self, Write};
|
||||||
|
|
||||||
|
const VARINT_CONTINUATION_MASK: u8 = 0b1000_0000;
|
||||||
|
pub(crate) fn write_varint<W: Write>(varint: &u64, w: &mut W) -> io::Result<()> {
|
||||||
|
let mut varint = *varint;
|
||||||
|
while {
|
||||||
|
let mut b = u8::try_from(varint & u64::from(!VARINT_CONTINUATION_MASK)).unwrap();
|
||||||
|
varint >>= 7;
|
||||||
|
if varint != 0 {
|
||||||
|
b |= VARINT_CONTINUATION_MASK;
|
||||||
|
}
|
||||||
|
w.write_all(&[b])?;
|
||||||
|
varint != 0
|
||||||
|
} {}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
321
coins/monero/src/bin/reserialize_chain.rs
Normal file
321
coins/monero/src/bin/reserialize_chain.rs
Normal file
@@ -0,0 +1,321 @@
|
|||||||
|
#[cfg(feature = "binaries")]
|
||||||
|
mod binaries {
|
||||||
|
pub(crate) use std::sync::Arc;
|
||||||
|
|
||||||
|
pub(crate) use curve25519_dalek::{scalar::Scalar, edwards::EdwardsPoint};
|
||||||
|
|
||||||
|
pub(crate) use multiexp::BatchVerifier;
|
||||||
|
|
||||||
|
pub(crate) use serde::Deserialize;
|
||||||
|
pub(crate) use serde_json::json;
|
||||||
|
|
||||||
|
pub(crate) use monero_serai::{
|
||||||
|
Commitment,
|
||||||
|
ringct::RctPrunable,
|
||||||
|
transaction::{Input, Transaction},
|
||||||
|
block::Block,
|
||||||
|
rpc::{RpcError, Rpc, HttpRpc},
|
||||||
|
};
|
||||||
|
|
||||||
|
pub(crate) use monero_generators::decompress_point;
|
||||||
|
|
||||||
|
pub(crate) use tokio::task::JoinHandle;
|
||||||
|
|
||||||
|
pub(crate) async fn check_block(rpc: Arc<Rpc<HttpRpc>>, block_i: usize) {
|
||||||
|
let hash = loop {
|
||||||
|
match rpc.get_block_hash(block_i).await {
|
||||||
|
Ok(hash) => break hash,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_block_hash ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't get block {block_i}'s hash: {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
// TODO: Grab the JSON to also check it was deserialized correctly
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct BlockResponse {
|
||||||
|
blob: String,
|
||||||
|
}
|
||||||
|
let res: BlockResponse = loop {
|
||||||
|
match rpc.json_rpc_call("get_block", Some(json!({ "hash": hex::encode(hash) }))).await {
|
||||||
|
Ok(res) => break res,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_block ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't get block {block_i} via block.hash(): {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let blob = hex::decode(res.blob).expect("node returned non-hex block");
|
||||||
|
let block = Block::read(&mut blob.as_slice())
|
||||||
|
.unwrap_or_else(|e| panic!("couldn't deserialize block {block_i}: {e}"));
|
||||||
|
assert_eq!(block.hash(), hash, "hash differs");
|
||||||
|
assert_eq!(block.serialize(), blob, "serialization differs");
|
||||||
|
|
||||||
|
let txs_len = 1 + block.txs.len();
|
||||||
|
|
||||||
|
if !block.txs.is_empty() {
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct TransactionResponse {
|
||||||
|
tx_hash: String,
|
||||||
|
as_hex: String,
|
||||||
|
}
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct TransactionsResponse {
|
||||||
|
#[serde(default)]
|
||||||
|
missed_tx: Vec<String>,
|
||||||
|
txs: Vec<TransactionResponse>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut hashes_hex = block.txs.iter().map(hex::encode).collect::<Vec<_>>();
|
||||||
|
let mut all_txs = vec![];
|
||||||
|
while !hashes_hex.is_empty() {
|
||||||
|
let txs: TransactionsResponse = loop {
|
||||||
|
match rpc
|
||||||
|
.rpc_call(
|
||||||
|
"get_transactions",
|
||||||
|
Some(json!({
|
||||||
|
"txs_hashes": hashes_hex.drain(.. hashes_hex.len().min(100)).collect::<Vec<_>>(),
|
||||||
|
})),
|
||||||
|
)
|
||||||
|
.await
|
||||||
|
{
|
||||||
|
Ok(txs) => break txs,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_transactions ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't call get_transactions: {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
assert!(txs.missed_tx.is_empty());
|
||||||
|
all_txs.extend(txs.txs);
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut batch = BatchVerifier::new(block.txs.len());
|
||||||
|
for (tx_hash, tx_res) in block.txs.into_iter().zip(all_txs) {
|
||||||
|
assert_eq!(
|
||||||
|
tx_res.tx_hash,
|
||||||
|
hex::encode(tx_hash),
|
||||||
|
"node returned a transaction with different hash"
|
||||||
|
);
|
||||||
|
|
||||||
|
let tx = Transaction::read(
|
||||||
|
&mut hex::decode(&tx_res.as_hex).expect("node returned non-hex transaction").as_slice(),
|
||||||
|
)
|
||||||
|
.expect("couldn't deserialize transaction");
|
||||||
|
|
||||||
|
assert_eq!(
|
||||||
|
hex::encode(tx.serialize()),
|
||||||
|
tx_res.as_hex,
|
||||||
|
"Transaction serialization was different"
|
||||||
|
);
|
||||||
|
assert_eq!(tx.hash(), tx_hash, "Transaction hash was different");
|
||||||
|
|
||||||
|
if matches!(tx.rct_signatures.prunable, RctPrunable::Null) {
|
||||||
|
assert_eq!(tx.prefix.version, 1);
|
||||||
|
assert!(!tx.signatures.is_empty());
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
let sig_hash = tx.signature_hash();
|
||||||
|
// Verify all proofs we support proving for
|
||||||
|
// This is due to having debug_asserts calling verify within their proving, and CLSAG
|
||||||
|
// multisig explicitly calling verify as part of its signing process
|
||||||
|
// Accordingly, making sure our signature_hash algorithm is correct is great, and further
|
||||||
|
// making sure the verification functions are valid is appreciated
|
||||||
|
match tx.rct_signatures.prunable {
|
||||||
|
RctPrunable::Null |
|
||||||
|
RctPrunable::AggregateMlsagBorromean { .. } |
|
||||||
|
RctPrunable::MlsagBorromean { .. } => {}
|
||||||
|
RctPrunable::MlsagBulletproofs { bulletproofs, .. } => {
|
||||||
|
assert!(bulletproofs.batch_verify(
|
||||||
|
&mut rand_core::OsRng,
|
||||||
|
&mut batch,
|
||||||
|
(),
|
||||||
|
&tx.rct_signatures.base.commitments
|
||||||
|
));
|
||||||
|
}
|
||||||
|
RctPrunable::Clsag { bulletproofs, clsags, pseudo_outs } => {
|
||||||
|
assert!(bulletproofs.batch_verify(
|
||||||
|
&mut rand_core::OsRng,
|
||||||
|
&mut batch,
|
||||||
|
(),
|
||||||
|
&tx.rct_signatures.base.commitments
|
||||||
|
));
|
||||||
|
|
||||||
|
for (i, clsag) in clsags.into_iter().enumerate() {
|
||||||
|
let (amount, key_offsets, image) = match &tx.prefix.inputs[i] {
|
||||||
|
Input::Gen(_) => panic!("Input::Gen"),
|
||||||
|
Input::ToKey { amount, key_offsets, key_image } => (amount, key_offsets, key_image),
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut running_sum = 0;
|
||||||
|
let mut actual_indexes = vec![];
|
||||||
|
for offset in key_offsets {
|
||||||
|
running_sum += offset;
|
||||||
|
actual_indexes.push(running_sum);
|
||||||
|
}
|
||||||
|
|
||||||
|
async fn get_outs(
|
||||||
|
rpc: &Rpc<HttpRpc>,
|
||||||
|
amount: u64,
|
||||||
|
indexes: &[u64],
|
||||||
|
) -> Vec<[EdwardsPoint; 2]> {
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct Out {
|
||||||
|
key: String,
|
||||||
|
mask: String,
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Deserialize, Debug)]
|
||||||
|
struct Outs {
|
||||||
|
outs: Vec<Out>,
|
||||||
|
}
|
||||||
|
|
||||||
|
let outs: Outs = loop {
|
||||||
|
match rpc
|
||||||
|
.rpc_call(
|
||||||
|
"get_outs",
|
||||||
|
Some(json!({
|
||||||
|
"get_txid": true,
|
||||||
|
"outputs": indexes.iter().map(|o| json!({
|
||||||
|
"amount": amount,
|
||||||
|
"index": o
|
||||||
|
})).collect::<Vec<_>>()
|
||||||
|
})),
|
||||||
|
)
|
||||||
|
.await
|
||||||
|
{
|
||||||
|
Ok(outs) => break outs,
|
||||||
|
Err(RpcError::ConnectionError(e)) => {
|
||||||
|
println!("get_outs ConnectionError: {e}");
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
Err(e) => panic!("couldn't connect to RPC to get outs: {e:?}"),
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
let rpc_point = |point: &str| {
|
||||||
|
decompress_point(
|
||||||
|
hex::decode(point)
|
||||||
|
.expect("invalid hex for ring member")
|
||||||
|
.try_into()
|
||||||
|
.expect("invalid point len for ring member"),
|
||||||
|
)
|
||||||
|
.expect("invalid point for ring member")
|
||||||
|
};
|
||||||
|
|
||||||
|
outs
|
||||||
|
.outs
|
||||||
|
.iter()
|
||||||
|
.map(|out| {
|
||||||
|
let mask = rpc_point(&out.mask);
|
||||||
|
if amount != 0 {
|
||||||
|
assert_eq!(mask, Commitment::new(Scalar::from(1u8), amount).calculate());
|
||||||
|
}
|
||||||
|
[rpc_point(&out.key), mask]
|
||||||
|
})
|
||||||
|
.collect()
|
||||||
|
}
|
||||||
|
|
||||||
|
clsag
|
||||||
|
.verify(
|
||||||
|
&get_outs(&rpc, amount.unwrap_or(0), &actual_indexes).await,
|
||||||
|
image,
|
||||||
|
&pseudo_outs[i],
|
||||||
|
&sig_hash,
|
||||||
|
)
|
||||||
|
.unwrap();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
assert!(batch.verify_vartime());
|
||||||
|
}
|
||||||
|
|
||||||
|
println!("Deserialized, hashed, and reserialized {block_i} with {txs_len} TXs");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(feature = "binaries")]
|
||||||
|
#[tokio::main]
|
||||||
|
async fn main() {
|
||||||
|
use binaries::*;
|
||||||
|
|
||||||
|
let args = std::env::args().collect::<Vec<String>>();
|
||||||
|
|
||||||
|
// Read start block as the first arg
|
||||||
|
let mut block_i = args[1].parse::<usize>().expect("invalid start block");
|
||||||
|
|
||||||
|
// How many blocks to work on at once
|
||||||
|
let async_parallelism: usize =
|
||||||
|
args.get(2).unwrap_or(&"8".to_string()).parse::<usize>().expect("invalid parallelism argument");
|
||||||
|
|
||||||
|
// Read further args as RPC URLs
|
||||||
|
let default_nodes = vec![
|
||||||
|
"http://xmr-node.cakewallet.com:18081".to_string(),
|
||||||
|
"https://node.sethforprivacy.com".to_string(),
|
||||||
|
];
|
||||||
|
let mut specified_nodes = vec![];
|
||||||
|
{
|
||||||
|
let mut i = 0;
|
||||||
|
loop {
|
||||||
|
let Some(node) = args.get(3 + i) else { break };
|
||||||
|
specified_nodes.push(node.clone());
|
||||||
|
i += 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
let nodes = if specified_nodes.is_empty() { default_nodes } else { specified_nodes };
|
||||||
|
|
||||||
|
let rpc = |url: String| async move {
|
||||||
|
HttpRpc::new(url.clone())
|
||||||
|
.await
|
||||||
|
.unwrap_or_else(|_| panic!("couldn't create HttpRpc connected to {url}"))
|
||||||
|
};
|
||||||
|
let main_rpc = rpc(nodes[0].clone()).await;
|
||||||
|
let mut rpcs = vec![];
|
||||||
|
for i in 0 .. async_parallelism {
|
||||||
|
rpcs.push(Arc::new(rpc(nodes[i % nodes.len()].clone()).await));
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut rpc_i = 0;
|
||||||
|
let mut handles: Vec<JoinHandle<()>> = vec![];
|
||||||
|
let mut height = 0;
|
||||||
|
loop {
|
||||||
|
let new_height = main_rpc.get_height().await.expect("couldn't call get_height");
|
||||||
|
if new_height == height {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
height = new_height;
|
||||||
|
|
||||||
|
while block_i < height {
|
||||||
|
if handles.len() >= async_parallelism {
|
||||||
|
// Guarantee one handle is complete
|
||||||
|
handles.swap_remove(0).await.unwrap();
|
||||||
|
|
||||||
|
// Remove all of the finished handles
|
||||||
|
let mut i = 0;
|
||||||
|
while i < handles.len() {
|
||||||
|
if handles[i].is_finished() {
|
||||||
|
handles.swap_remove(i).await.unwrap();
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
i += 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
handles.push(tokio::spawn(check_block(rpcs[rpc_i].clone(), block_i)));
|
||||||
|
rpc_i = (rpc_i + 1) % rpcs.len();
|
||||||
|
block_i += 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[cfg(not(feature = "binaries"))]
|
||||||
|
fn main() {
|
||||||
|
panic!("To run binaries, please build with `--feature binaries`.");
|
||||||
|
}
|
||||||
130
coins/monero/src/block.rs
Normal file
130
coins/monero/src/block.rs
Normal file
@@ -0,0 +1,130 @@
|
|||||||
|
use std_shims::{
|
||||||
|
vec::Vec,
|
||||||
|
io::{self, Read, Write},
|
||||||
|
};
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
hash,
|
||||||
|
merkle::merkle_root,
|
||||||
|
serialize::*,
|
||||||
|
transaction::{Input, Transaction},
|
||||||
|
};
|
||||||
|
|
||||||
|
const CORRECT_BLOCK_HASH_202612: [u8; 32] =
|
||||||
|
hex_literal::hex!("426d16cff04c71f8b16340b722dc4010a2dd3831c22041431f772547ba6e331a");
|
||||||
|
const EXISTING_BLOCK_HASH_202612: [u8; 32] =
|
||||||
|
hex_literal::hex!("bbd604d2ba11ba27935e006ed39c9bfdd99b76bf4a50654bc1e1e61217962698");
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct BlockHeader {
|
||||||
|
pub major_version: u8,
|
||||||
|
pub minor_version: u8,
|
||||||
|
pub timestamp: u64,
|
||||||
|
pub previous: [u8; 32],
|
||||||
|
pub nonce: u32,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl BlockHeader {
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
write_varint(&self.major_version, w)?;
|
||||||
|
write_varint(&self.minor_version, w)?;
|
||||||
|
write_varint(&self.timestamp, w)?;
|
||||||
|
w.write_all(&self.previous)?;
|
||||||
|
w.write_all(&self.nonce.to_le_bytes())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn serialize(&self) -> Vec<u8> {
|
||||||
|
let mut serialized = vec![];
|
||||||
|
self.write(&mut serialized).unwrap();
|
||||||
|
serialized
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<BlockHeader> {
|
||||||
|
Ok(BlockHeader {
|
||||||
|
major_version: read_varint(r)?,
|
||||||
|
minor_version: read_varint(r)?,
|
||||||
|
timestamp: read_varint(r)?,
|
||||||
|
previous: read_bytes(r)?,
|
||||||
|
nonce: read_bytes(r).map(u32::from_le_bytes)?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct Block {
|
||||||
|
pub header: BlockHeader,
|
||||||
|
pub miner_tx: Transaction,
|
||||||
|
pub txs: Vec<[u8; 32]>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Block {
|
||||||
|
pub fn number(&self) -> Option<u64> {
|
||||||
|
match self.miner_tx.prefix.inputs.first() {
|
||||||
|
Some(Input::Gen(number)) => Some(*number),
|
||||||
|
_ => None,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
self.header.write(w)?;
|
||||||
|
self.miner_tx.write(w)?;
|
||||||
|
write_varint(&self.txs.len(), w)?;
|
||||||
|
for tx in &self.txs {
|
||||||
|
w.write_all(tx)?;
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
fn tx_merkle_root(&self) -> [u8; 32] {
|
||||||
|
merkle_root(self.miner_tx.hash(), &self.txs)
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Serialize the block as required for the proof of work hash.
|
||||||
|
///
|
||||||
|
/// This is distinct from the serialization required for the block hash. To get the block hash,
|
||||||
|
/// use the [`Block::hash`] function.
|
||||||
|
pub fn serialize_hashable(&self) -> Vec<u8> {
|
||||||
|
let mut blob = self.header.serialize();
|
||||||
|
blob.extend_from_slice(&self.tx_merkle_root());
|
||||||
|
write_varint(&(1 + u64::try_from(self.txs.len()).unwrap()), &mut blob).unwrap();
|
||||||
|
|
||||||
|
blob
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn hash(&self) -> [u8; 32] {
|
||||||
|
let mut hashable = self.serialize_hashable();
|
||||||
|
// Monero pre-appends a VarInt of the block hashing blobs length before getting the block hash
|
||||||
|
// but doesn't do this when getting the proof of work hash :)
|
||||||
|
let mut hashing_blob = Vec::with_capacity(8 + hashable.len());
|
||||||
|
write_varint(&u64::try_from(hashable.len()).unwrap(), &mut hashing_blob).unwrap();
|
||||||
|
hashing_blob.append(&mut hashable);
|
||||||
|
|
||||||
|
let hash = hash(&hashing_blob);
|
||||||
|
if hash == CORRECT_BLOCK_HASH_202612 {
|
||||||
|
return EXISTING_BLOCK_HASH_202612;
|
||||||
|
};
|
||||||
|
|
||||||
|
hash
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn serialize(&self) -> Vec<u8> {
|
||||||
|
let mut serialized = vec![];
|
||||||
|
self.write(&mut serialized).unwrap();
|
||||||
|
serialized
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<Block> {
|
||||||
|
let header = BlockHeader::read(r)?;
|
||||||
|
|
||||||
|
let miner_tx = Transaction::read(r)?;
|
||||||
|
if !matches!(miner_tx.prefix.inputs.as_slice(), &[Input::Gen(_)]) {
|
||||||
|
Err(io::Error::other("Miner transaction has incorrect input type."))?;
|
||||||
|
}
|
||||||
|
|
||||||
|
Ok(Block {
|
||||||
|
header,
|
||||||
|
miner_tx,
|
||||||
|
txs: (0_usize .. read_varint(r)?).map(|_| read_bytes(r)).collect::<Result<_, _>>()?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
241
coins/monero/src/lib.rs
Normal file
241
coins/monero/src/lib.rs
Normal file
@@ -0,0 +1,241 @@
|
|||||||
|
#![cfg_attr(docsrs, feature(doc_auto_cfg))]
|
||||||
|
#![doc = include_str!("../README.md")]
|
||||||
|
#![cfg_attr(not(feature = "std"), no_std)]
|
||||||
|
|
||||||
|
#[cfg(not(feature = "std"))]
|
||||||
|
#[macro_use]
|
||||||
|
extern crate alloc;
|
||||||
|
|
||||||
|
use std_shims::{sync::OnceLock, io};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||||
|
|
||||||
|
use sha3::{Digest, Keccak256};
|
||||||
|
|
||||||
|
use curve25519_dalek::{
|
||||||
|
constants::{ED25519_BASEPOINT_TABLE, ED25519_BASEPOINT_POINT},
|
||||||
|
scalar::Scalar,
|
||||||
|
edwards::{EdwardsPoint, VartimeEdwardsPrecomputation},
|
||||||
|
traits::VartimePrecomputedMultiscalarMul,
|
||||||
|
};
|
||||||
|
|
||||||
|
pub use monero_generators::{H, decompress_point};
|
||||||
|
|
||||||
|
mod merkle;
|
||||||
|
|
||||||
|
mod serialize;
|
||||||
|
use serialize::{read_byte, read_u16};
|
||||||
|
|
||||||
|
/// UnreducedScalar struct with functionality for recovering incorrectly reduced scalars.
|
||||||
|
mod unreduced_scalar;
|
||||||
|
|
||||||
|
/// Ring Signature structs and functionality.
|
||||||
|
pub mod ring_signatures;
|
||||||
|
|
||||||
|
/// RingCT structs and functionality.
|
||||||
|
pub mod ringct;
|
||||||
|
use ringct::RctType;
|
||||||
|
|
||||||
|
/// Transaction structs.
|
||||||
|
pub mod transaction;
|
||||||
|
/// Block structs.
|
||||||
|
pub mod block;
|
||||||
|
|
||||||
|
/// Monero daemon RPC interface.
|
||||||
|
pub mod rpc;
|
||||||
|
/// Wallet functionality, enabling scanning and sending transactions.
|
||||||
|
pub mod wallet;
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
mod tests;
|
||||||
|
|
||||||
|
pub const DEFAULT_LOCK_WINDOW: usize = 10;
|
||||||
|
pub const COINBASE_LOCK_WINDOW: usize = 60;
|
||||||
|
pub const BLOCK_TIME: usize = 120;
|
||||||
|
|
||||||
|
static INV_EIGHT_CELL: OnceLock<Scalar> = OnceLock::new();
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub(crate) fn INV_EIGHT() -> Scalar {
|
||||||
|
*INV_EIGHT_CELL.get_or_init(|| Scalar::from(8u8).invert())
|
||||||
|
}
|
||||||
|
|
||||||
|
static BASEPOINT_PRECOMP_CELL: OnceLock<VartimeEdwardsPrecomputation> = OnceLock::new();
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
pub(crate) fn BASEPOINT_PRECOMP() -> &'static VartimeEdwardsPrecomputation {
|
||||||
|
BASEPOINT_PRECOMP_CELL
|
||||||
|
.get_or_init(|| VartimeEdwardsPrecomputation::new([ED25519_BASEPOINT_POINT]))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Monero protocol version.
|
||||||
|
///
|
||||||
|
/// v15 is omitted as v15 was simply v14 and v16 being active at the same time, with regards to the
|
||||||
|
/// transactions supported. Accordingly, v16 should be used during v15.
|
||||||
|
#[derive(Clone, Copy, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
#[allow(non_camel_case_types)]
|
||||||
|
pub enum Protocol {
|
||||||
|
v14,
|
||||||
|
v16,
|
||||||
|
Custom {
|
||||||
|
ring_len: usize,
|
||||||
|
bp_plus: bool,
|
||||||
|
optimal_rct_type: RctType,
|
||||||
|
view_tags: bool,
|
||||||
|
v16_fee: bool,
|
||||||
|
},
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Protocol {
|
||||||
|
/// Amount of ring members under this protocol version.
|
||||||
|
pub fn ring_len(&self) -> usize {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => 11,
|
||||||
|
Protocol::v16 => 16,
|
||||||
|
Protocol::Custom { ring_len, .. } => *ring_len,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether or not the specified version uses Bulletproofs or Bulletproofs+.
|
||||||
|
///
|
||||||
|
/// This method will likely be reworked when versions not using Bulletproofs at all are added.
|
||||||
|
pub fn bp_plus(&self) -> bool {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => false,
|
||||||
|
Protocol::v16 => true,
|
||||||
|
Protocol::Custom { bp_plus, .. } => *bp_plus,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// TODO: Make this an Option when we support pre-RCT protocols
|
||||||
|
pub fn optimal_rct_type(&self) -> RctType {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => RctType::Clsag,
|
||||||
|
Protocol::v16 => RctType::BulletproofsPlus,
|
||||||
|
Protocol::Custom { optimal_rct_type, .. } => *optimal_rct_type,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether or not the specified version uses view tags.
|
||||||
|
pub fn view_tags(&self) -> bool {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => false,
|
||||||
|
Protocol::v16 => true,
|
||||||
|
Protocol::Custom { view_tags, .. } => *view_tags,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Whether or not the specified version uses the fee algorithm from Monero
|
||||||
|
/// hard fork version 16 (released in v18 binaries).
|
||||||
|
pub fn v16_fee(&self) -> bool {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => false,
|
||||||
|
Protocol::v16 => true,
|
||||||
|
Protocol::Custom { v16_fee, .. } => *v16_fee,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn write<W: io::Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
match self {
|
||||||
|
Protocol::v14 => w.write_all(&[0, 14]),
|
||||||
|
Protocol::v16 => w.write_all(&[0, 16]),
|
||||||
|
Protocol::Custom { ring_len, bp_plus, optimal_rct_type, view_tags, v16_fee } => {
|
||||||
|
// Custom, version 0
|
||||||
|
w.write_all(&[1, 0])?;
|
||||||
|
w.write_all(&u16::try_from(*ring_len).unwrap().to_le_bytes())?;
|
||||||
|
w.write_all(&[u8::from(*bp_plus)])?;
|
||||||
|
w.write_all(&[optimal_rct_type.to_byte()])?;
|
||||||
|
w.write_all(&[u8::from(*view_tags)])?;
|
||||||
|
w.write_all(&[u8::from(*v16_fee)])
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn read<R: io::Read>(r: &mut R) -> io::Result<Protocol> {
|
||||||
|
Ok(match read_byte(r)? {
|
||||||
|
// Monero protocol
|
||||||
|
0 => match read_byte(r)? {
|
||||||
|
14 => Protocol::v14,
|
||||||
|
16 => Protocol::v16,
|
||||||
|
_ => Err(io::Error::other("unrecognized monero protocol"))?,
|
||||||
|
},
|
||||||
|
// Custom
|
||||||
|
1 => match read_byte(r)? {
|
||||||
|
0 => Protocol::Custom {
|
||||||
|
ring_len: read_u16(r)?.into(),
|
||||||
|
bp_plus: match read_byte(r)? {
|
||||||
|
0 => false,
|
||||||
|
1 => true,
|
||||||
|
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||||
|
},
|
||||||
|
optimal_rct_type: RctType::from_byte(read_byte(r)?)
|
||||||
|
.ok_or_else(|| io::Error::other("invalid RctType serialization"))?,
|
||||||
|
view_tags: match read_byte(r)? {
|
||||||
|
0 => false,
|
||||||
|
1 => true,
|
||||||
|
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||||
|
},
|
||||||
|
v16_fee: match read_byte(r)? {
|
||||||
|
0 => false,
|
||||||
|
1 => true,
|
||||||
|
_ => Err(io::Error::other("invalid bool serialization"))?,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
_ => Err(io::Error::other("unrecognized custom protocol serialization"))?,
|
||||||
|
},
|
||||||
|
_ => Err(io::Error::other("unrecognized protocol serialization"))?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Transparent structure representing a Pedersen commitment's contents.
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
#[derive(Clone, PartialEq, Eq, Zeroize, ZeroizeOnDrop)]
|
||||||
|
pub struct Commitment {
|
||||||
|
pub mask: Scalar,
|
||||||
|
pub amount: u64,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl core::fmt::Debug for Commitment {
|
||||||
|
fn fmt(&self, fmt: &mut core::fmt::Formatter<'_>) -> Result<(), core::fmt::Error> {
|
||||||
|
fmt.debug_struct("Commitment").field("amount", &self.amount).finish_non_exhaustive()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Commitment {
|
||||||
|
/// A commitment to zero, defined with a mask of 1 (as to not be the identity).
|
||||||
|
pub fn zero() -> Commitment {
|
||||||
|
Commitment { mask: Scalar::ONE, amount: 0 }
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn new(mask: Scalar, amount: u64) -> Commitment {
|
||||||
|
Commitment { mask, amount }
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Calculate a Pedersen commitment, as a point, from the transparent structure.
|
||||||
|
pub fn calculate(&self) -> EdwardsPoint {
|
||||||
|
(&self.mask * ED25519_BASEPOINT_TABLE) + (Scalar::from(self.amount) * H())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Support generating a random scalar using a modern rand, as dalek's is notoriously dated.
|
||||||
|
pub fn random_scalar<R: RngCore + CryptoRng>(rng: &mut R) -> Scalar {
|
||||||
|
let mut r = [0; 64];
|
||||||
|
rng.fill_bytes(&mut r);
|
||||||
|
Scalar::from_bytes_mod_order_wide(&r)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash(data: &[u8]) -> [u8; 32] {
|
||||||
|
Keccak256::digest(data).into()
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Hash the provided data to a scalar via keccak256(data) % l.
|
||||||
|
pub fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||||
|
let scalar = Scalar::from_bytes_mod_order(hash(data));
|
||||||
|
// Monero will explicitly error in this case
|
||||||
|
// This library acknowledges its practical impossibility of it occurring, and doesn't bother to
|
||||||
|
// code in logic to handle it. That said, if it ever occurs, something must happen in order to
|
||||||
|
// not generate/verify a proof we believe to be valid when it isn't
|
||||||
|
assert!(scalar != Scalar::ZERO, "ZERO HASH: {data:?}");
|
||||||
|
scalar
|
||||||
|
}
|
||||||
55
coins/monero/src/merkle.rs
Normal file
55
coins/monero/src/merkle.rs
Normal file
@@ -0,0 +1,55 @@
|
|||||||
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
|
use crate::hash;
|
||||||
|
|
||||||
|
pub(crate) fn merkle_root(root: [u8; 32], leafs: &[[u8; 32]]) -> [u8; 32] {
|
||||||
|
match leafs.len() {
|
||||||
|
0 => root,
|
||||||
|
1 => hash(&[root, leafs[0]].concat()),
|
||||||
|
_ => {
|
||||||
|
let mut hashes = Vec::with_capacity(1 + leafs.len());
|
||||||
|
hashes.push(root);
|
||||||
|
hashes.extend(leafs);
|
||||||
|
|
||||||
|
// Monero preprocess this so the length is a power of 2
|
||||||
|
let mut high_pow_2 = 4; // 4 is the lowest value this can be
|
||||||
|
while high_pow_2 < hashes.len() {
|
||||||
|
high_pow_2 *= 2;
|
||||||
|
}
|
||||||
|
let low_pow_2 = high_pow_2 / 2;
|
||||||
|
|
||||||
|
// Merge right-most hashes until we're at the low_pow_2
|
||||||
|
{
|
||||||
|
let overage = hashes.len() - low_pow_2;
|
||||||
|
let mut rightmost = hashes.drain((low_pow_2 - overage) ..);
|
||||||
|
// This is true since we took overage from beneath and above low_pow_2, taking twice as
|
||||||
|
// many elements as overage
|
||||||
|
debug_assert_eq!(rightmost.len() % 2, 0);
|
||||||
|
|
||||||
|
let mut paired_hashes = Vec::with_capacity(overage);
|
||||||
|
while let Some(left) = rightmost.next() {
|
||||||
|
let right = rightmost.next().unwrap();
|
||||||
|
paired_hashes.push(hash(&[left.as_ref(), &right].concat()));
|
||||||
|
}
|
||||||
|
drop(rightmost);
|
||||||
|
|
||||||
|
hashes.extend(paired_hashes);
|
||||||
|
assert_eq!(hashes.len(), low_pow_2);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Do a traditional pairing off
|
||||||
|
let mut new_hashes = Vec::with_capacity(hashes.len() / 2);
|
||||||
|
while hashes.len() > 1 {
|
||||||
|
let mut i = 0;
|
||||||
|
while i < hashes.len() {
|
||||||
|
new_hashes.push(hash(&[hashes[i], hashes[i + 1]].concat()));
|
||||||
|
i += 2;
|
||||||
|
}
|
||||||
|
|
||||||
|
hashes = new_hashes;
|
||||||
|
new_hashes = Vec::with_capacity(hashes.len() / 2);
|
||||||
|
}
|
||||||
|
hashes[0]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
72
coins/monero/src/ring_signatures.rs
Normal file
72
coins/monero/src/ring_signatures.rs
Normal file
@@ -0,0 +1,72 @@
|
|||||||
|
use std_shims::{
|
||||||
|
io::{self, *},
|
||||||
|
vec::Vec,
|
||||||
|
};
|
||||||
|
|
||||||
|
use zeroize::Zeroize;
|
||||||
|
|
||||||
|
use curve25519_dalek::{EdwardsPoint, Scalar};
|
||||||
|
|
||||||
|
use monero_generators::hash_to_point;
|
||||||
|
|
||||||
|
use crate::{serialize::*, hash_to_scalar};
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
pub struct Signature {
|
||||||
|
c: Scalar,
|
||||||
|
r: Scalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Signature {
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
write_scalar(&self.c, w)?;
|
||||||
|
write_scalar(&self.r, w)?;
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<Signature> {
|
||||||
|
Ok(Signature { c: read_scalar(r)?, r: read_scalar(r)? })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
pub struct RingSignature {
|
||||||
|
sigs: Vec<Signature>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl RingSignature {
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
for sig in &self.sigs {
|
||||||
|
sig.write(w)?;
|
||||||
|
}
|
||||||
|
Ok(())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn read<R: Read>(members: usize, r: &mut R) -> io::Result<RingSignature> {
|
||||||
|
Ok(RingSignature { sigs: read_raw_vec(Signature::read, members, r)? })
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn verify(&self, msg: &[u8; 32], ring: &[EdwardsPoint], key_image: &EdwardsPoint) -> bool {
|
||||||
|
if ring.len() != self.sigs.len() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut buf = Vec::with_capacity(32 + (32 * 2 * ring.len()));
|
||||||
|
buf.extend_from_slice(msg);
|
||||||
|
|
||||||
|
let mut sum = Scalar::ZERO;
|
||||||
|
|
||||||
|
for (ring_member, sig) in ring.iter().zip(&self.sigs) {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let Li = EdwardsPoint::vartime_double_scalar_mul_basepoint(&sig.c, ring_member, &sig.r);
|
||||||
|
buf.extend_from_slice(Li.compress().as_bytes());
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let Ri = (sig.r * hash_to_point(ring_member.compress().to_bytes())) + (sig.c * key_image);
|
||||||
|
buf.extend_from_slice(Ri.compress().as_bytes());
|
||||||
|
|
||||||
|
sum += sig.c;
|
||||||
|
}
|
||||||
|
|
||||||
|
sum == hash_to_scalar(&buf)
|
||||||
|
}
|
||||||
|
}
|
||||||
97
coins/monero/src/ringct/borromean.rs
Normal file
97
coins/monero/src/ringct/borromean.rs
Normal file
@@ -0,0 +1,97 @@
|
|||||||
|
use core::fmt::Debug;
|
||||||
|
use std_shims::io::{self, Read, Write};
|
||||||
|
|
||||||
|
use curve25519_dalek::{traits::Identity, Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use monero_generators::H_pow_2;
|
||||||
|
|
||||||
|
use crate::{hash_to_scalar, unreduced_scalar::UnreducedScalar, serialize::*};
|
||||||
|
|
||||||
|
/// 64 Borromean ring signatures.
|
||||||
|
///
|
||||||
|
/// s0 and s1 are stored as `UnreducedScalar`s due to Monero not requiring they were reduced.
|
||||||
|
/// `UnreducedScalar` preserves their original byte encoding and implements a custom reduction
|
||||||
|
/// algorithm which was in use.
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct BorromeanSignatures {
|
||||||
|
pub s0: [UnreducedScalar; 64],
|
||||||
|
pub s1: [UnreducedScalar; 64],
|
||||||
|
pub ee: Scalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl BorromeanSignatures {
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanSignatures> {
|
||||||
|
Ok(BorromeanSignatures {
|
||||||
|
s0: read_array(UnreducedScalar::read, r)?,
|
||||||
|
s1: read_array(UnreducedScalar::read, r)?,
|
||||||
|
ee: read_scalar(r)?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
for s0 in &self.s0 {
|
||||||
|
s0.write(w)?;
|
||||||
|
}
|
||||||
|
for s1 in &self.s1 {
|
||||||
|
s1.write(w)?;
|
||||||
|
}
|
||||||
|
write_scalar(&self.ee, w)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn verify(&self, keys_a: &[EdwardsPoint], keys_b: &[EdwardsPoint]) -> bool {
|
||||||
|
let mut transcript = [0; 2048];
|
||||||
|
|
||||||
|
for i in 0 .. 64 {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let LL = EdwardsPoint::vartime_double_scalar_mul_basepoint(
|
||||||
|
&self.ee,
|
||||||
|
&keys_a[i],
|
||||||
|
&self.s0[i].recover_monero_slide_scalar(),
|
||||||
|
);
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let LV = EdwardsPoint::vartime_double_scalar_mul_basepoint(
|
||||||
|
&hash_to_scalar(LL.compress().as_bytes()),
|
||||||
|
&keys_b[i],
|
||||||
|
&self.s1[i].recover_monero_slide_scalar(),
|
||||||
|
);
|
||||||
|
transcript[(i * 32) .. ((i + 1) * 32)].copy_from_slice(LV.compress().as_bytes());
|
||||||
|
}
|
||||||
|
|
||||||
|
hash_to_scalar(&transcript) == self.ee
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// A range proof premised on Borromean ring signatures.
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct BorromeanRange {
|
||||||
|
pub sigs: BorromeanSignatures,
|
||||||
|
pub bit_commitments: [EdwardsPoint; 64],
|
||||||
|
}
|
||||||
|
|
||||||
|
impl BorromeanRange {
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<BorromeanRange> {
|
||||||
|
Ok(BorromeanRange {
|
||||||
|
sigs: BorromeanSignatures::read(r)?,
|
||||||
|
bit_commitments: read_array(read_point, r)?,
|
||||||
|
})
|
||||||
|
}
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
self.sigs.write(w)?;
|
||||||
|
write_raw_vec(write_point, &self.bit_commitments, w)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn verify(&self, commitment: &EdwardsPoint) -> bool {
|
||||||
|
if &self.bit_commitments.iter().sum::<EdwardsPoint>() != commitment {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let H_pow_2 = H_pow_2();
|
||||||
|
let mut commitments_sub_one = [EdwardsPoint::identity(); 64];
|
||||||
|
for i in 0 .. 64 {
|
||||||
|
commitments_sub_one[i] = self.bit_commitments[i] - H_pow_2[i];
|
||||||
|
}
|
||||||
|
|
||||||
|
self.sigs.verify(&self.bit_commitments, &commitments_sub_one)
|
||||||
|
}
|
||||||
|
}
|
||||||
151
coins/monero/src/ringct/bulletproofs/core.rs
Normal file
151
coins/monero/src/ringct/bulletproofs/core.rs
Normal file
@@ -0,0 +1,151 @@
|
|||||||
|
use std_shims::{vec::Vec, sync::OnceLock};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use subtle::{Choice, ConditionallySelectable};
|
||||||
|
|
||||||
|
use curve25519_dalek::edwards::EdwardsPoint as DalekPoint;
|
||||||
|
|
||||||
|
use group::{ff::Field, Group};
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use multiexp::multiexp as multiexp_const;
|
||||||
|
|
||||||
|
pub(crate) use monero_generators::Generators;
|
||||||
|
|
||||||
|
use crate::{INV_EIGHT as DALEK_INV_EIGHT, H as DALEK_H, Commitment, hash_to_scalar as dalek_hash};
|
||||||
|
pub(crate) use crate::ringct::bulletproofs::scalar_vector::*;
|
||||||
|
|
||||||
|
#[inline]
|
||||||
|
pub(crate) fn INV_EIGHT() -> Scalar {
|
||||||
|
Scalar(DALEK_INV_EIGHT())
|
||||||
|
}
|
||||||
|
|
||||||
|
#[inline]
|
||||||
|
pub(crate) fn H() -> EdwardsPoint {
|
||||||
|
EdwardsPoint(DALEK_H())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||||
|
Scalar(dalek_hash(data))
|
||||||
|
}
|
||||||
|
|
||||||
|
// Components common between variants
|
||||||
|
pub(crate) const MAX_M: usize = 16;
|
||||||
|
pub(crate) const LOG_N: usize = 6; // 2 << 6 == N
|
||||||
|
pub(crate) const N: usize = 64;
|
||||||
|
|
||||||
|
pub(crate) fn prove_multiexp(pairs: &[(Scalar, EdwardsPoint)]) -> EdwardsPoint {
|
||||||
|
multiexp_const(pairs) * INV_EIGHT()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn vector_exponent(
|
||||||
|
generators: &Generators,
|
||||||
|
a: &ScalarVector,
|
||||||
|
b: &ScalarVector,
|
||||||
|
) -> EdwardsPoint {
|
||||||
|
debug_assert_eq!(a.len(), b.len());
|
||||||
|
(a * &generators.G[.. a.len()]) + (b * &generators.H[.. b.len()])
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_cache(cache: &mut Scalar, mash: &[[u8; 32]]) -> Scalar {
|
||||||
|
let slice =
|
||||||
|
&[cache.to_bytes().as_ref(), mash.iter().copied().flatten().collect::<Vec<_>>().as_ref()]
|
||||||
|
.concat();
|
||||||
|
*cache = hash_to_scalar(slice);
|
||||||
|
*cache
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn MN(outputs: usize) -> (usize, usize, usize) {
|
||||||
|
let mut logM = 0;
|
||||||
|
let mut M;
|
||||||
|
while {
|
||||||
|
M = 1 << logM;
|
||||||
|
(M <= MAX_M) && (M < outputs)
|
||||||
|
} {
|
||||||
|
logM += 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
(logM + LOG_N, M, M * N)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn bit_decompose(commitments: &[Commitment]) -> (ScalarVector, ScalarVector) {
|
||||||
|
let (_, M, MN) = MN(commitments.len());
|
||||||
|
|
||||||
|
let sv = commitments.iter().map(|c| Scalar::from(c.amount)).collect::<Vec<_>>();
|
||||||
|
let mut aL = ScalarVector::new(MN);
|
||||||
|
let mut aR = ScalarVector::new(MN);
|
||||||
|
|
||||||
|
for j in 0 .. M {
|
||||||
|
for i in (0 .. N).rev() {
|
||||||
|
let bit =
|
||||||
|
if j < sv.len() { Choice::from((sv[j][i / 8] >> (i % 8)) & 1) } else { Choice::from(0) };
|
||||||
|
aL.0[(j * N) + i] = Scalar::conditional_select(&Scalar::ZERO, &Scalar::ONE, bit);
|
||||||
|
aR.0[(j * N) + i] = Scalar::conditional_select(&-Scalar::ONE, &Scalar::ZERO, bit);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
(aL, aR)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_commitments<C: IntoIterator<Item = DalekPoint>>(
|
||||||
|
commitments: C,
|
||||||
|
) -> (Scalar, Vec<EdwardsPoint>) {
|
||||||
|
let V = commitments.into_iter().map(|c| EdwardsPoint(c) * INV_EIGHT()).collect::<Vec<_>>();
|
||||||
|
(hash_to_scalar(&V.iter().flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>()), V)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn alpha_rho<R: RngCore + CryptoRng>(
|
||||||
|
rng: &mut R,
|
||||||
|
generators: &Generators,
|
||||||
|
aL: &ScalarVector,
|
||||||
|
aR: &ScalarVector,
|
||||||
|
) -> (Scalar, EdwardsPoint) {
|
||||||
|
let ar = Scalar::random(rng);
|
||||||
|
(ar, (vector_exponent(generators, aL, aR) + (EdwardsPoint::generator() * ar)) * INV_EIGHT())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn LR_statements(
|
||||||
|
a: &ScalarVector,
|
||||||
|
G_i: &[EdwardsPoint],
|
||||||
|
b: &ScalarVector,
|
||||||
|
H_i: &[EdwardsPoint],
|
||||||
|
cL: Scalar,
|
||||||
|
U: EdwardsPoint,
|
||||||
|
) -> Vec<(Scalar, EdwardsPoint)> {
|
||||||
|
let mut res = a
|
||||||
|
.0
|
||||||
|
.iter()
|
||||||
|
.copied()
|
||||||
|
.zip(G_i.iter().copied())
|
||||||
|
.chain(b.0.iter().copied().zip(H_i.iter().copied()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
res.push((cL, U));
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
static TWO_N_CELL: OnceLock<ScalarVector> = OnceLock::new();
|
||||||
|
pub(crate) fn TWO_N() -> &'static ScalarVector {
|
||||||
|
TWO_N_CELL.get_or_init(|| ScalarVector::powers(Scalar::from(2u8), N))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn challenge_products(w: &[Scalar], winv: &[Scalar]) -> Vec<Scalar> {
|
||||||
|
let mut products = vec![Scalar::ZERO; 1 << w.len()];
|
||||||
|
products[0] = winv[0];
|
||||||
|
products[1] = w[0];
|
||||||
|
for j in 1 .. w.len() {
|
||||||
|
let mut slots = (1 << (j + 1)) - 1;
|
||||||
|
while slots > 0 {
|
||||||
|
products[slots] = products[slots / 2] * w[j];
|
||||||
|
products[slots - 1] = products[slots / 2] * winv[j];
|
||||||
|
slots = slots.saturating_sub(2);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Sanity check as if the above failed to populate, it'd be critical
|
||||||
|
for w in &products {
|
||||||
|
debug_assert!(!bool::from(w.is_zero()));
|
||||||
|
}
|
||||||
|
|
||||||
|
products
|
||||||
|
}
|
||||||
229
coins/monero/src/ringct/bulletproofs/mod.rs
Normal file
229
coins/monero/src/ringct/bulletproofs/mod.rs
Normal file
@@ -0,0 +1,229 @@
|
|||||||
|
#![allow(non_snake_case)]
|
||||||
|
|
||||||
|
use std_shims::{
|
||||||
|
vec::Vec,
|
||||||
|
io::{self, Read, Write},
|
||||||
|
};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::{Zeroize, Zeroizing};
|
||||||
|
|
||||||
|
use curve25519_dalek::edwards::EdwardsPoint;
|
||||||
|
use multiexp::BatchVerifier;
|
||||||
|
|
||||||
|
use crate::{Commitment, wallet::TransactionError, serialize::*};
|
||||||
|
|
||||||
|
pub(crate) mod scalar_vector;
|
||||||
|
pub(crate) mod core;
|
||||||
|
use self::core::LOG_N;
|
||||||
|
|
||||||
|
pub(crate) mod original;
|
||||||
|
use self::original::OriginalStruct;
|
||||||
|
|
||||||
|
pub(crate) mod plus;
|
||||||
|
use self::plus::*;
|
||||||
|
|
||||||
|
pub(crate) const MAX_OUTPUTS: usize = self::core::MAX_M;
|
||||||
|
|
||||||
|
/// Bulletproofs enum, supporting the original and plus formulations.
|
||||||
|
#[allow(clippy::large_enum_variant)]
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub enum Bulletproofs {
|
||||||
|
Original(OriginalStruct),
|
||||||
|
Plus(AggregateRangeProof),
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Bulletproofs {
|
||||||
|
fn bp_fields(plus: bool) -> usize {
|
||||||
|
if plus {
|
||||||
|
6
|
||||||
|
} else {
|
||||||
|
9
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// https://github.com/monero-project/monero/blob/94e67bf96bbc010241f29ada6abc89f49a81759c/
|
||||||
|
// src/cryptonote_basic/cryptonote_format_utils.cpp#L106-L124
|
||||||
|
pub(crate) fn calculate_bp_clawback(plus: bool, n_outputs: usize) -> (usize, usize) {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let mut LR_len = 0;
|
||||||
|
let mut n_padded_outputs = 1;
|
||||||
|
while n_padded_outputs < n_outputs {
|
||||||
|
LR_len += 1;
|
||||||
|
n_padded_outputs = 1 << LR_len;
|
||||||
|
}
|
||||||
|
LR_len += LOG_N;
|
||||||
|
|
||||||
|
let mut bp_clawback = 0;
|
||||||
|
if n_padded_outputs > 2 {
|
||||||
|
let fields = Bulletproofs::bp_fields(plus);
|
||||||
|
let base = ((fields + (2 * (LOG_N + 1))) * 32) / 2;
|
||||||
|
let size = (fields + (2 * LR_len)) * 32;
|
||||||
|
bp_clawback = ((base * n_padded_outputs) - size) * 4 / 5;
|
||||||
|
}
|
||||||
|
|
||||||
|
(bp_clawback, LR_len)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn fee_weight(plus: bool, outputs: usize) -> usize {
|
||||||
|
#[allow(non_snake_case)]
|
||||||
|
let (bp_clawback, LR_len) = Bulletproofs::calculate_bp_clawback(plus, outputs);
|
||||||
|
32 * (Bulletproofs::bp_fields(plus) + (2 * LR_len)) + 2 + bp_clawback
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Prove the list of commitments are within [0 .. 2^64).
|
||||||
|
pub fn prove<R: RngCore + CryptoRng>(
|
||||||
|
rng: &mut R,
|
||||||
|
outputs: &[Commitment],
|
||||||
|
plus: bool,
|
||||||
|
) -> Result<Bulletproofs, TransactionError> {
|
||||||
|
if outputs.is_empty() {
|
||||||
|
Err(TransactionError::NoOutputs)?;
|
||||||
|
}
|
||||||
|
if outputs.len() > MAX_OUTPUTS {
|
||||||
|
Err(TransactionError::TooManyOutputs)?;
|
||||||
|
}
|
||||||
|
Ok(if !plus {
|
||||||
|
Bulletproofs::Original(OriginalStruct::prove(rng, outputs))
|
||||||
|
} else {
|
||||||
|
use dalek_ff_group::EdwardsPoint as DfgPoint;
|
||||||
|
Bulletproofs::Plus(
|
||||||
|
AggregateRangeStatement::new(outputs.iter().map(|com| DfgPoint(com.calculate())).collect())
|
||||||
|
.unwrap()
|
||||||
|
.prove(rng, &Zeroizing::new(AggregateRangeWitness::new(outputs.to_vec()).unwrap()))
|
||||||
|
.unwrap(),
|
||||||
|
)
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Verify the given Bulletproofs.
|
||||||
|
#[must_use]
|
||||||
|
pub fn verify<R: RngCore + CryptoRng>(&self, rng: &mut R, commitments: &[EdwardsPoint]) -> bool {
|
||||||
|
match self {
|
||||||
|
Bulletproofs::Original(bp) => bp.verify(rng, commitments),
|
||||||
|
Bulletproofs::Plus(bp) => {
|
||||||
|
let mut verifier = BatchVerifier::new(1);
|
||||||
|
// If this commitment is torsioned (which is allowed), this won't be a well-formed
|
||||||
|
// dfg::EdwardsPoint (expected to be of prime-order)
|
||||||
|
// The actual BP+ impl will perform a torsion clear though, making this safe
|
||||||
|
// TODO: Have AggregateRangeStatement take in dalek EdwardsPoint for clarity on this
|
||||||
|
let Some(statement) = AggregateRangeStatement::new(
|
||||||
|
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
|
||||||
|
) else {
|
||||||
|
return false;
|
||||||
|
};
|
||||||
|
if !statement.verify(rng, &mut verifier, (), bp.clone()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
verifier.verify_vartime()
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Accumulate the verification for the given Bulletproofs into the specified BatchVerifier.
|
||||||
|
/// Returns false if the Bulletproofs aren't sane, without mutating the BatchVerifier.
|
||||||
|
/// Returns true if the Bulletproofs are sane, regardless of their validity.
|
||||||
|
#[must_use]
|
||||||
|
pub fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<ID, dalek_ff_group::EdwardsPoint>,
|
||||||
|
id: ID,
|
||||||
|
commitments: &[EdwardsPoint],
|
||||||
|
) -> bool {
|
||||||
|
match self {
|
||||||
|
Bulletproofs::Original(bp) => bp.batch_verify(rng, verifier, id, commitments),
|
||||||
|
Bulletproofs::Plus(bp) => {
|
||||||
|
let Some(statement) = AggregateRangeStatement::new(
|
||||||
|
commitments.iter().map(|c| dalek_ff_group::EdwardsPoint(*c)).collect(),
|
||||||
|
) else {
|
||||||
|
return false;
|
||||||
|
};
|
||||||
|
statement.verify(rng, verifier, id, bp.clone())
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
fn write_core<W: Write, F: Fn(&[EdwardsPoint], &mut W) -> io::Result<()>>(
|
||||||
|
&self,
|
||||||
|
w: &mut W,
|
||||||
|
specific_write_vec: F,
|
||||||
|
) -> io::Result<()> {
|
||||||
|
match self {
|
||||||
|
Bulletproofs::Original(bp) => {
|
||||||
|
write_point(&bp.A, w)?;
|
||||||
|
write_point(&bp.S, w)?;
|
||||||
|
write_point(&bp.T1, w)?;
|
||||||
|
write_point(&bp.T2, w)?;
|
||||||
|
write_scalar(&bp.taux, w)?;
|
||||||
|
write_scalar(&bp.mu, w)?;
|
||||||
|
specific_write_vec(&bp.L, w)?;
|
||||||
|
specific_write_vec(&bp.R, w)?;
|
||||||
|
write_scalar(&bp.a, w)?;
|
||||||
|
write_scalar(&bp.b, w)?;
|
||||||
|
write_scalar(&bp.t, w)
|
||||||
|
}
|
||||||
|
|
||||||
|
Bulletproofs::Plus(bp) => {
|
||||||
|
write_point(&bp.A.0, w)?;
|
||||||
|
write_point(&bp.wip.A.0, w)?;
|
||||||
|
write_point(&bp.wip.B.0, w)?;
|
||||||
|
write_scalar(&bp.wip.r_answer.0, w)?;
|
||||||
|
write_scalar(&bp.wip.s_answer.0, w)?;
|
||||||
|
write_scalar(&bp.wip.delta_answer.0, w)?;
|
||||||
|
specific_write_vec(&bp.wip.L.iter().copied().map(|L| L.0).collect::<Vec<_>>(), w)?;
|
||||||
|
specific_write_vec(&bp.wip.R.iter().copied().map(|R| R.0).collect::<Vec<_>>(), w)
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn signature_write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
self.write_core(w, |points, w| write_raw_vec(write_point, points, w))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn write<W: Write>(&self, w: &mut W) -> io::Result<()> {
|
||||||
|
self.write_core(w, |points, w| write_vec(write_point, points, w))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub fn serialize(&self) -> Vec<u8> {
|
||||||
|
let mut serialized = vec![];
|
||||||
|
self.write(&mut serialized).unwrap();
|
||||||
|
serialized
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Read Bulletproofs.
|
||||||
|
pub fn read<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
|
||||||
|
Ok(Bulletproofs::Original(OriginalStruct {
|
||||||
|
A: read_point(r)?,
|
||||||
|
S: read_point(r)?,
|
||||||
|
T1: read_point(r)?,
|
||||||
|
T2: read_point(r)?,
|
||||||
|
taux: read_scalar(r)?,
|
||||||
|
mu: read_scalar(r)?,
|
||||||
|
L: read_vec(read_point, r)?,
|
||||||
|
R: read_vec(read_point, r)?,
|
||||||
|
a: read_scalar(r)?,
|
||||||
|
b: read_scalar(r)?,
|
||||||
|
t: read_scalar(r)?,
|
||||||
|
}))
|
||||||
|
}
|
||||||
|
|
||||||
|
/// Read Bulletproofs+.
|
||||||
|
pub fn read_plus<R: Read>(r: &mut R) -> io::Result<Bulletproofs> {
|
||||||
|
use dalek_ff_group::{Scalar as DfgScalar, EdwardsPoint as DfgPoint};
|
||||||
|
|
||||||
|
Ok(Bulletproofs::Plus(AggregateRangeProof {
|
||||||
|
A: DfgPoint(read_point(r)?),
|
||||||
|
wip: WipProof {
|
||||||
|
A: DfgPoint(read_point(r)?),
|
||||||
|
B: DfgPoint(read_point(r)?),
|
||||||
|
r_answer: DfgScalar(read_scalar(r)?),
|
||||||
|
s_answer: DfgScalar(read_scalar(r)?),
|
||||||
|
delta_answer: DfgScalar(read_scalar(r)?),
|
||||||
|
L: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
|
||||||
|
R: read_vec(read_point, r)?.into_iter().map(DfgPoint).collect(),
|
||||||
|
},
|
||||||
|
}))
|
||||||
|
}
|
||||||
|
}
|
||||||
322
coins/monero/src/ringct/bulletproofs/original.rs
Normal file
322
coins/monero/src/ringct/bulletproofs/original.rs
Normal file
@@ -0,0 +1,322 @@
|
|||||||
|
use std_shims::{vec::Vec, sync::OnceLock};
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::Zeroize;
|
||||||
|
|
||||||
|
use curve25519_dalek::{scalar::Scalar as DalekScalar, edwards::EdwardsPoint as DalekPoint};
|
||||||
|
|
||||||
|
use group::{ff::Field, Group};
|
||||||
|
use dalek_ff_group::{ED25519_BASEPOINT_POINT as G, Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use multiexp::{BatchVerifier, multiexp};
|
||||||
|
|
||||||
|
use crate::{Commitment, ringct::bulletproofs::core::*};
|
||||||
|
|
||||||
|
include!(concat!(env!("OUT_DIR"), "/generators.rs"));
|
||||||
|
|
||||||
|
static IP12_CELL: OnceLock<Scalar> = OnceLock::new();
|
||||||
|
pub(crate) fn IP12() -> Scalar {
|
||||||
|
*IP12_CELL.get_or_init(|| ScalarVector(vec![Scalar::ONE; N]).inner_product(TWO_N()))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hadamard_fold(
|
||||||
|
l: &[EdwardsPoint],
|
||||||
|
r: &[EdwardsPoint],
|
||||||
|
a: Scalar,
|
||||||
|
b: Scalar,
|
||||||
|
) -> Vec<EdwardsPoint> {
|
||||||
|
let mut res = Vec::with_capacity(l.len() / 2);
|
||||||
|
for i in 0 .. l.len() {
|
||||||
|
res.push(multiexp(&[(a, l[i]), (b, r[i])]));
|
||||||
|
}
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug)]
|
||||||
|
pub struct OriginalStruct {
|
||||||
|
pub(crate) A: DalekPoint,
|
||||||
|
pub(crate) S: DalekPoint,
|
||||||
|
pub(crate) T1: DalekPoint,
|
||||||
|
pub(crate) T2: DalekPoint,
|
||||||
|
pub(crate) taux: DalekScalar,
|
||||||
|
pub(crate) mu: DalekScalar,
|
||||||
|
pub(crate) L: Vec<DalekPoint>,
|
||||||
|
pub(crate) R: Vec<DalekPoint>,
|
||||||
|
pub(crate) a: DalekScalar,
|
||||||
|
pub(crate) b: DalekScalar,
|
||||||
|
pub(crate) t: DalekScalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl OriginalStruct {
|
||||||
|
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||||
|
rng: &mut R,
|
||||||
|
commitments: &[Commitment],
|
||||||
|
) -> OriginalStruct {
|
||||||
|
let (logMN, M, MN) = MN(commitments.len());
|
||||||
|
|
||||||
|
let (aL, aR) = bit_decompose(commitments);
|
||||||
|
let commitments_points = commitments.iter().map(Commitment::calculate).collect::<Vec<_>>();
|
||||||
|
let (mut cache, _) = hash_commitments(commitments_points.clone());
|
||||||
|
|
||||||
|
let (sL, sR) =
|
||||||
|
ScalarVector((0 .. (MN * 2)).map(|_| Scalar::random(&mut *rng)).collect::<Vec<_>>()).split();
|
||||||
|
|
||||||
|
let generators = GENERATORS();
|
||||||
|
let (mut alpha, A) = alpha_rho(&mut *rng, generators, &aL, &aR);
|
||||||
|
let (mut rho, S) = alpha_rho(&mut *rng, generators, &sL, &sR);
|
||||||
|
|
||||||
|
let y = hash_cache(&mut cache, &[A.compress().to_bytes(), S.compress().to_bytes()]);
|
||||||
|
let mut cache = hash_to_scalar(&y.to_bytes());
|
||||||
|
let z = cache;
|
||||||
|
|
||||||
|
let l0 = aL - z;
|
||||||
|
let l1 = sL;
|
||||||
|
|
||||||
|
let mut zero_twos = Vec::with_capacity(MN);
|
||||||
|
let zpow = ScalarVector::powers(z, M + 2);
|
||||||
|
for j in 0 .. M {
|
||||||
|
for i in 0 .. N {
|
||||||
|
zero_twos.push(zpow[j + 2] * TWO_N()[i]);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let yMN = ScalarVector::powers(y, MN);
|
||||||
|
let r0 = ((aR + z) * &yMN) + &ScalarVector(zero_twos);
|
||||||
|
let r1 = yMN * &sR;
|
||||||
|
|
||||||
|
let (T1, T2, x, mut taux) = {
|
||||||
|
let t1 = l0.clone().inner_product(&r1) + r0.clone().inner_product(&l1);
|
||||||
|
let t2 = l1.clone().inner_product(&r1);
|
||||||
|
|
||||||
|
let mut tau1 = Scalar::random(&mut *rng);
|
||||||
|
let mut tau2 = Scalar::random(&mut *rng);
|
||||||
|
|
||||||
|
let T1 = prove_multiexp(&[(t1, H()), (tau1, EdwardsPoint::generator())]);
|
||||||
|
let T2 = prove_multiexp(&[(t2, H()), (tau2, EdwardsPoint::generator())]);
|
||||||
|
|
||||||
|
let x =
|
||||||
|
hash_cache(&mut cache, &[z.to_bytes(), T1.compress().to_bytes(), T2.compress().to_bytes()]);
|
||||||
|
|
||||||
|
let taux = (tau2 * (x * x)) + (tau1 * x);
|
||||||
|
|
||||||
|
tau1.zeroize();
|
||||||
|
tau2.zeroize();
|
||||||
|
(T1, T2, x, taux)
|
||||||
|
};
|
||||||
|
|
||||||
|
let mu = (x * rho) + alpha;
|
||||||
|
alpha.zeroize();
|
||||||
|
rho.zeroize();
|
||||||
|
|
||||||
|
for (i, gamma) in commitments.iter().map(|c| Scalar(c.mask)).enumerate() {
|
||||||
|
taux += zpow[i + 2] * gamma;
|
||||||
|
}
|
||||||
|
|
||||||
|
let l = l0 + &(l1 * x);
|
||||||
|
let r = r0 + &(r1 * x);
|
||||||
|
|
||||||
|
let t = l.clone().inner_product(&r);
|
||||||
|
|
||||||
|
let x_ip =
|
||||||
|
hash_cache(&mut cache, &[x.to_bytes(), taux.to_bytes(), mu.to_bytes(), t.to_bytes()]);
|
||||||
|
|
||||||
|
let mut a = l;
|
||||||
|
let mut b = r;
|
||||||
|
|
||||||
|
let yinv = y.invert().unwrap();
|
||||||
|
let yinvpow = ScalarVector::powers(yinv, MN);
|
||||||
|
|
||||||
|
let mut G_proof = generators.G[.. a.len()].to_vec();
|
||||||
|
let mut H_proof = generators.H[.. a.len()].to_vec();
|
||||||
|
H_proof.iter_mut().zip(yinvpow.0.iter()).for_each(|(this_H, yinvpow)| *this_H *= yinvpow);
|
||||||
|
let U = H() * x_ip;
|
||||||
|
|
||||||
|
let mut L = Vec::with_capacity(logMN);
|
||||||
|
let mut R = Vec::with_capacity(logMN);
|
||||||
|
|
||||||
|
while a.len() != 1 {
|
||||||
|
let (aL, aR) = a.split();
|
||||||
|
let (bL, bR) = b.split();
|
||||||
|
|
||||||
|
let cL = aL.clone().inner_product(&bR);
|
||||||
|
let cR = aR.clone().inner_product(&bL);
|
||||||
|
|
||||||
|
let (G_L, G_R) = G_proof.split_at(aL.len());
|
||||||
|
let (H_L, H_R) = H_proof.split_at(aL.len());
|
||||||
|
|
||||||
|
let L_i = prove_multiexp(&LR_statements(&aL, G_R, &bR, H_L, cL, U));
|
||||||
|
let R_i = prove_multiexp(&LR_statements(&aR, G_L, &bL, H_R, cR, U));
|
||||||
|
L.push(L_i);
|
||||||
|
R.push(R_i);
|
||||||
|
|
||||||
|
let w = hash_cache(&mut cache, &[L_i.compress().to_bytes(), R_i.compress().to_bytes()]);
|
||||||
|
let winv = w.invert().unwrap();
|
||||||
|
|
||||||
|
a = (aL * w) + &(aR * winv);
|
||||||
|
b = (bL * winv) + &(bR * w);
|
||||||
|
|
||||||
|
if a.len() != 1 {
|
||||||
|
G_proof = hadamard_fold(G_L, G_R, winv, w);
|
||||||
|
H_proof = hadamard_fold(H_L, H_R, w, winv);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let res = OriginalStruct {
|
||||||
|
A: *A,
|
||||||
|
S: *S,
|
||||||
|
T1: *T1,
|
||||||
|
T2: *T2,
|
||||||
|
taux: *taux,
|
||||||
|
mu: *mu,
|
||||||
|
L: L.drain(..).map(|L| *L).collect(),
|
||||||
|
R: R.drain(..).map(|R| *R).collect(),
|
||||||
|
a: *a[0],
|
||||||
|
b: *b[0],
|
||||||
|
t: *t,
|
||||||
|
};
|
||||||
|
debug_assert!(res.verify(rng, &commitments_points));
|
||||||
|
res
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
fn verify_core<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
|
||||||
|
id: ID,
|
||||||
|
commitments: &[DalekPoint],
|
||||||
|
) -> bool {
|
||||||
|
// Verify commitments are valid
|
||||||
|
if commitments.is_empty() || (commitments.len() > MAX_M) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Verify L and R are properly sized
|
||||||
|
if self.L.len() != self.R.len() {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
let (logMN, M, MN) = MN(commitments.len());
|
||||||
|
if self.L.len() != logMN {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Rebuild all challenges
|
||||||
|
let (mut cache, commitments) = hash_commitments(commitments.iter().copied());
|
||||||
|
let y = hash_cache(&mut cache, &[self.A.compress().to_bytes(), self.S.compress().to_bytes()]);
|
||||||
|
|
||||||
|
let z = hash_to_scalar(&y.to_bytes());
|
||||||
|
cache = z;
|
||||||
|
|
||||||
|
let x = hash_cache(
|
||||||
|
&mut cache,
|
||||||
|
&[z.to_bytes(), self.T1.compress().to_bytes(), self.T2.compress().to_bytes()],
|
||||||
|
);
|
||||||
|
|
||||||
|
let x_ip = hash_cache(
|
||||||
|
&mut cache,
|
||||||
|
&[x.to_bytes(), self.taux.to_bytes(), self.mu.to_bytes(), self.t.to_bytes()],
|
||||||
|
);
|
||||||
|
|
||||||
|
let mut w = Vec::with_capacity(logMN);
|
||||||
|
let mut winv = Vec::with_capacity(logMN);
|
||||||
|
for (L, R) in self.L.iter().zip(&self.R) {
|
||||||
|
w.push(hash_cache(&mut cache, &[L.compress().to_bytes(), R.compress().to_bytes()]));
|
||||||
|
winv.push(cache.invert().unwrap());
|
||||||
|
}
|
||||||
|
|
||||||
|
// Convert the proof from * INV_EIGHT to its actual form
|
||||||
|
let normalize = |point: &DalekPoint| EdwardsPoint(point.mul_by_cofactor());
|
||||||
|
|
||||||
|
let L = self.L.iter().map(normalize).collect::<Vec<_>>();
|
||||||
|
let R = self.R.iter().map(normalize).collect::<Vec<_>>();
|
||||||
|
let T1 = normalize(&self.T1);
|
||||||
|
let T2 = normalize(&self.T2);
|
||||||
|
let A = normalize(&self.A);
|
||||||
|
let S = normalize(&self.S);
|
||||||
|
|
||||||
|
let commitments = commitments.iter().map(EdwardsPoint::mul_by_cofactor).collect::<Vec<_>>();
|
||||||
|
|
||||||
|
// Verify it
|
||||||
|
let mut proof = Vec::with_capacity(4 + commitments.len());
|
||||||
|
|
||||||
|
let zpow = ScalarVector::powers(z, M + 3);
|
||||||
|
let ip1y = ScalarVector::powers(y, M * N).sum();
|
||||||
|
let mut k = -(zpow[2] * ip1y);
|
||||||
|
for j in 1 ..= M {
|
||||||
|
k -= zpow[j + 2] * IP12();
|
||||||
|
}
|
||||||
|
let y1 = Scalar(self.t) - ((z * ip1y) + k);
|
||||||
|
proof.push((-y1, H()));
|
||||||
|
|
||||||
|
proof.push((-Scalar(self.taux), G));
|
||||||
|
|
||||||
|
for (j, commitment) in commitments.iter().enumerate() {
|
||||||
|
proof.push((zpow[j + 2], *commitment));
|
||||||
|
}
|
||||||
|
|
||||||
|
proof.push((x, T1));
|
||||||
|
proof.push((x * x, T2));
|
||||||
|
verifier.queue(&mut *rng, id, proof);
|
||||||
|
|
||||||
|
proof = Vec::with_capacity(4 + (2 * (MN + logMN)));
|
||||||
|
let z3 = (Scalar(self.t) - (Scalar(self.a) * Scalar(self.b))) * x_ip;
|
||||||
|
proof.push((z3, H()));
|
||||||
|
proof.push((-Scalar(self.mu), G));
|
||||||
|
|
||||||
|
proof.push((Scalar::ONE, A));
|
||||||
|
proof.push((x, S));
|
||||||
|
|
||||||
|
{
|
||||||
|
let ypow = ScalarVector::powers(y, MN);
|
||||||
|
let yinv = y.invert().unwrap();
|
||||||
|
let yinvpow = ScalarVector::powers(yinv, MN);
|
||||||
|
|
||||||
|
let w_cache = challenge_products(&w, &winv);
|
||||||
|
|
||||||
|
let generators = GENERATORS();
|
||||||
|
for i in 0 .. MN {
|
||||||
|
let g = (Scalar(self.a) * w_cache[i]) + z;
|
||||||
|
proof.push((-g, generators.G[i]));
|
||||||
|
|
||||||
|
let mut h = Scalar(self.b) * yinvpow[i] * w_cache[(!i) & (MN - 1)];
|
||||||
|
h -= ((zpow[(i / N) + 2] * TWO_N()[i % N]) + (z * ypow[i])) * yinvpow[i];
|
||||||
|
proof.push((-h, generators.H[i]));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
for i in 0 .. logMN {
|
||||||
|
proof.push((w[i] * w[i], L[i]));
|
||||||
|
proof.push((winv[i] * winv[i], R[i]));
|
||||||
|
}
|
||||||
|
verifier.queue(rng, id, proof);
|
||||||
|
|
||||||
|
true
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
pub(crate) fn verify<R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
commitments: &[DalekPoint],
|
||||||
|
) -> bool {
|
||||||
|
let mut verifier = BatchVerifier::new(1);
|
||||||
|
if self.verify_core(rng, &mut verifier, (), commitments) {
|
||||||
|
verifier.verify_vartime()
|
||||||
|
} else {
|
||||||
|
false
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[must_use]
|
||||||
|
pub(crate) fn batch_verify<ID: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
&self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<ID, EdwardsPoint>,
|
||||||
|
id: ID,
|
||||||
|
commitments: &[DalekPoint],
|
||||||
|
) -> bool {
|
||||||
|
self.verify_core(rng, verifier, id, commitments)
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,252 @@
|
|||||||
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::{Zeroize, ZeroizeOnDrop, Zeroizing};
|
||||||
|
|
||||||
|
use multiexp::{multiexp, multiexp_vartime, BatchVerifier};
|
||||||
|
use group::{
|
||||||
|
ff::{Field, PrimeField},
|
||||||
|
Group, GroupEncoding,
|
||||||
|
};
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use crate::{
|
||||||
|
Commitment,
|
||||||
|
ringct::{
|
||||||
|
bulletproofs::core::{MAX_M, N},
|
||||||
|
bulletproofs::plus::{
|
||||||
|
ScalarVector, PointVector, GeneratorsList, Generators,
|
||||||
|
transcript::*,
|
||||||
|
weighted_inner_product::{WipStatement, WipWitness, WipProof},
|
||||||
|
padded_pow_of_2, u64_decompose,
|
||||||
|
},
|
||||||
|
},
|
||||||
|
};
|
||||||
|
|
||||||
|
// Figure 3 of the Bulletproofs+ Paper
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub(crate) struct AggregateRangeStatement {
|
||||||
|
generators: Generators,
|
||||||
|
V: Vec<EdwardsPoint>,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Zeroize for AggregateRangeStatement {
|
||||||
|
fn zeroize(&mut self) {
|
||||||
|
self.V.zeroize();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
|
pub(crate) struct AggregateRangeWitness(Vec<Commitment>);
|
||||||
|
|
||||||
|
impl AggregateRangeWitness {
|
||||||
|
pub(crate) fn new(commitments: Vec<Commitment>) -> Option<Self> {
|
||||||
|
if commitments.is_empty() || (commitments.len() > MAX_M) {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
Some(AggregateRangeWitness(commitments))
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
pub struct AggregateRangeProof {
|
||||||
|
pub(crate) A: EdwardsPoint,
|
||||||
|
pub(crate) wip: WipProof,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl AggregateRangeStatement {
|
||||||
|
pub(crate) fn new(V: Vec<EdwardsPoint>) -> Option<Self> {
|
||||||
|
if V.is_empty() || (V.len() > MAX_M) {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
Some(Self { generators: Generators::new(), V })
|
||||||
|
}
|
||||||
|
|
||||||
|
fn transcript_A(transcript: &mut Scalar, A: EdwardsPoint) -> (Scalar, Scalar) {
|
||||||
|
let y = hash_to_scalar(&[transcript.to_repr().as_ref(), A.to_bytes().as_ref()].concat());
|
||||||
|
let z = hash_to_scalar(y.to_bytes().as_ref());
|
||||||
|
*transcript = z;
|
||||||
|
(y, z)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn d_j(j: usize, m: usize) -> ScalarVector {
|
||||||
|
let mut d_j = Vec::with_capacity(m * N);
|
||||||
|
for _ in 0 .. (j - 1) * N {
|
||||||
|
d_j.push(Scalar::ZERO);
|
||||||
|
}
|
||||||
|
d_j.append(&mut ScalarVector::powers(Scalar::from(2u8), N).0);
|
||||||
|
for _ in 0 .. (m - j) * N {
|
||||||
|
d_j.push(Scalar::ZERO);
|
||||||
|
}
|
||||||
|
ScalarVector(d_j)
|
||||||
|
}
|
||||||
|
|
||||||
|
fn compute_A_hat(
|
||||||
|
mut V: PointVector,
|
||||||
|
generators: &Generators,
|
||||||
|
transcript: &mut Scalar,
|
||||||
|
mut A: EdwardsPoint,
|
||||||
|
) -> (Scalar, ScalarVector, Scalar, Scalar, ScalarVector, EdwardsPoint) {
|
||||||
|
let (y, z) = Self::transcript_A(transcript, A);
|
||||||
|
A = A.mul_by_cofactor();
|
||||||
|
|
||||||
|
while V.len() < padded_pow_of_2(V.len()) {
|
||||||
|
V.0.push(EdwardsPoint::identity());
|
||||||
|
}
|
||||||
|
let mn = V.len() * N;
|
||||||
|
|
||||||
|
let mut z_pow = Vec::with_capacity(V.len());
|
||||||
|
|
||||||
|
let mut d = ScalarVector::new(mn);
|
||||||
|
for j in 1 ..= V.len() {
|
||||||
|
z_pow.push(z.pow(Scalar::from(2 * u64::try_from(j).unwrap()))); // TODO: Optimize this
|
||||||
|
d = d + &(Self::d_j(j, V.len()) * (z_pow[j - 1]));
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut ascending_y = ScalarVector(vec![y]);
|
||||||
|
for i in 1 .. d.len() {
|
||||||
|
ascending_y.0.push(ascending_y[i - 1] * y);
|
||||||
|
}
|
||||||
|
let y_pows = ascending_y.clone().sum();
|
||||||
|
|
||||||
|
let mut descending_y = ascending_y.clone();
|
||||||
|
descending_y.0.reverse();
|
||||||
|
|
||||||
|
let d_descending_y = d.clone() * &descending_y;
|
||||||
|
let d_descending_y_plus_z = d_descending_y + z;
|
||||||
|
|
||||||
|
let y_mn_plus_one = descending_y[0] * y;
|
||||||
|
|
||||||
|
let mut commitment_accum = EdwardsPoint::identity();
|
||||||
|
for (j, commitment) in V.0.iter().enumerate() {
|
||||||
|
commitment_accum += *commitment * z_pow[j];
|
||||||
|
}
|
||||||
|
|
||||||
|
let neg_z = -z;
|
||||||
|
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 2);
|
||||||
|
for (i, d_y_z) in d_descending_y_plus_z.0.iter().enumerate() {
|
||||||
|
A_terms.push((neg_z, generators.generator(GeneratorsList::GBold1, i)));
|
||||||
|
A_terms.push((*d_y_z, generators.generator(GeneratorsList::HBold1, i)));
|
||||||
|
}
|
||||||
|
A_terms.push((y_mn_plus_one, commitment_accum));
|
||||||
|
A_terms.push((
|
||||||
|
((y_pows * z) - (d.sum() * y_mn_plus_one * z) - (y_pows * z.square())),
|
||||||
|
Generators::g(),
|
||||||
|
));
|
||||||
|
|
||||||
|
(
|
||||||
|
y,
|
||||||
|
d_descending_y_plus_z,
|
||||||
|
y_mn_plus_one,
|
||||||
|
z,
|
||||||
|
ScalarVector(z_pow),
|
||||||
|
A + multiexp_vartime(&A_terms),
|
||||||
|
)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||||
|
self,
|
||||||
|
rng: &mut R,
|
||||||
|
witness: &AggregateRangeWitness,
|
||||||
|
) -> Option<AggregateRangeProof> {
|
||||||
|
// Check for consistency with the witness
|
||||||
|
if self.V.len() != witness.0.len() {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
for (commitment, witness) in self.V.iter().zip(witness.0.iter()) {
|
||||||
|
if witness.calculate() != **commitment {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let Self { generators, V } = self;
|
||||||
|
// Monero expects all of these points to be torsion-free
|
||||||
|
// Generally, for Bulletproofs, it sends points * INV_EIGHT and then performs a torsion clear
|
||||||
|
// by multiplying by 8
|
||||||
|
// This also restores the original value due to the preprocessing
|
||||||
|
// Commitments aren't transmitted INV_EIGHT though, so this multiplies by INV_EIGHT to enable
|
||||||
|
// clearing its cofactor without mutating the value
|
||||||
|
// For some reason, these values are transcripted * INV_EIGHT, not as transmitted
|
||||||
|
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
|
||||||
|
let mut transcript = initial_transcript(V.iter());
|
||||||
|
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
|
||||||
|
|
||||||
|
// Pad V
|
||||||
|
while V.len() < padded_pow_of_2(V.len()) {
|
||||||
|
V.push(EdwardsPoint::identity());
|
||||||
|
}
|
||||||
|
|
||||||
|
let generators = generators.reduce(V.len() * N);
|
||||||
|
|
||||||
|
let mut d_js = Vec::with_capacity(V.len());
|
||||||
|
let mut a_l = ScalarVector(Vec::with_capacity(V.len() * N));
|
||||||
|
for j in 1 ..= V.len() {
|
||||||
|
d_js.push(Self::d_j(j, V.len()));
|
||||||
|
#[allow(clippy::map_unwrap_or)]
|
||||||
|
a_l.0.append(
|
||||||
|
&mut u64_decompose(
|
||||||
|
*witness.0.get(j - 1).map(|commitment| &commitment.amount).unwrap_or(&0),
|
||||||
|
)
|
||||||
|
.0,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
let a_r = a_l.clone() - Scalar::ONE;
|
||||||
|
|
||||||
|
let alpha = Scalar::random(&mut *rng);
|
||||||
|
|
||||||
|
let mut A_terms = Vec::with_capacity((generators.len() * 2) + 1);
|
||||||
|
for (i, a_l) in a_l.0.iter().enumerate() {
|
||||||
|
A_terms.push((*a_l, generators.generator(GeneratorsList::GBold1, i)));
|
||||||
|
}
|
||||||
|
for (i, a_r) in a_r.0.iter().enumerate() {
|
||||||
|
A_terms.push((*a_r, generators.generator(GeneratorsList::HBold1, i)));
|
||||||
|
}
|
||||||
|
A_terms.push((alpha, Generators::h()));
|
||||||
|
let mut A = multiexp(&A_terms);
|
||||||
|
A_terms.zeroize();
|
||||||
|
|
||||||
|
// Multiply by INV_EIGHT per earlier commentary
|
||||||
|
A.0 *= crate::INV_EIGHT();
|
||||||
|
|
||||||
|
let (y, d_descending_y_plus_z, y_mn_plus_one, z, z_pow, A_hat) =
|
||||||
|
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, A);
|
||||||
|
|
||||||
|
let a_l = a_l - z;
|
||||||
|
let a_r = a_r + &d_descending_y_plus_z;
|
||||||
|
let mut alpha = alpha;
|
||||||
|
for j in 1 ..= witness.0.len() {
|
||||||
|
alpha += z_pow[j - 1] * Scalar(witness.0[j - 1].mask) * y_mn_plus_one;
|
||||||
|
}
|
||||||
|
|
||||||
|
Some(AggregateRangeProof {
|
||||||
|
A,
|
||||||
|
wip: WipStatement::new(generators, A_hat, y)
|
||||||
|
.prove(rng, transcript, &Zeroizing::new(WipWitness::new(a_l, a_r, alpha).unwrap()))
|
||||||
|
.unwrap(),
|
||||||
|
})
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
|
||||||
|
id: Id,
|
||||||
|
proof: AggregateRangeProof,
|
||||||
|
) -> bool {
|
||||||
|
let Self { generators, V } = self;
|
||||||
|
|
||||||
|
let mut V = V.into_iter().map(|V| EdwardsPoint(V.0 * crate::INV_EIGHT())).collect::<Vec<_>>();
|
||||||
|
let mut transcript = initial_transcript(V.iter());
|
||||||
|
V.iter_mut().for_each(|V| *V = V.mul_by_cofactor());
|
||||||
|
|
||||||
|
let generators = generators.reduce(V.len() * N);
|
||||||
|
|
||||||
|
let (y, _, _, _, _, A_hat) =
|
||||||
|
Self::compute_A_hat(PointVector(V), &generators, &mut transcript, proof.A);
|
||||||
|
WipStatement::new(generators, A_hat, y).verify(rng, verifier, id, transcript, proof.wip)
|
||||||
|
}
|
||||||
|
}
|
||||||
85
coins/monero/src/ringct/bulletproofs/plus/mod.rs
Normal file
85
coins/monero/src/ringct/bulletproofs/plus/mod.rs
Normal file
@@ -0,0 +1,85 @@
|
|||||||
|
#![allow(non_snake_case)]
|
||||||
|
|
||||||
|
use group::Group;
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
pub(crate) use crate::ringct::bulletproofs::scalar_vector::ScalarVector;
|
||||||
|
mod point_vector;
|
||||||
|
pub(crate) use point_vector::PointVector;
|
||||||
|
|
||||||
|
pub(crate) mod transcript;
|
||||||
|
pub(crate) mod weighted_inner_product;
|
||||||
|
pub(crate) use weighted_inner_product::*;
|
||||||
|
pub(crate) mod aggregate_range_proof;
|
||||||
|
pub(crate) use aggregate_range_proof::*;
|
||||||
|
|
||||||
|
pub(crate) fn padded_pow_of_2(i: usize) -> usize {
|
||||||
|
let mut next_pow_of_2 = 1;
|
||||||
|
while next_pow_of_2 < i {
|
||||||
|
next_pow_of_2 <<= 1;
|
||||||
|
}
|
||||||
|
next_pow_of_2
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, Copy, PartialEq, Eq, Hash, Debug)]
|
||||||
|
pub(crate) enum GeneratorsList {
|
||||||
|
GBold1,
|
||||||
|
HBold1,
|
||||||
|
}
|
||||||
|
|
||||||
|
// TODO: Table these
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub(crate) struct Generators {
|
||||||
|
g_bold1: &'static [EdwardsPoint],
|
||||||
|
h_bold1: &'static [EdwardsPoint],
|
||||||
|
}
|
||||||
|
|
||||||
|
mod generators {
|
||||||
|
use std_shims::sync::OnceLock;
|
||||||
|
use monero_generators::Generators;
|
||||||
|
include!(concat!(env!("OUT_DIR"), "/generators_plus.rs"));
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Generators {
|
||||||
|
#[allow(clippy::new_without_default)]
|
||||||
|
pub(crate) fn new() -> Self {
|
||||||
|
let gens = generators::GENERATORS();
|
||||||
|
Generators { g_bold1: &gens.G, h_bold1: &gens.H }
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn len(&self) -> usize {
|
||||||
|
self.g_bold1.len()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn g() -> EdwardsPoint {
|
||||||
|
dalek_ff_group::EdwardsPoint(crate::H())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn h() -> EdwardsPoint {
|
||||||
|
EdwardsPoint::generator()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn generator(&self, list: GeneratorsList, i: usize) -> EdwardsPoint {
|
||||||
|
match list {
|
||||||
|
GeneratorsList::GBold1 => self.g_bold1[i],
|
||||||
|
GeneratorsList::HBold1 => self.h_bold1[i],
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn reduce(&self, generators: usize) -> Self {
|
||||||
|
// Round to the nearest power of 2
|
||||||
|
let generators = padded_pow_of_2(generators);
|
||||||
|
assert!(generators <= self.g_bold1.len());
|
||||||
|
|
||||||
|
Generators { g_bold1: &self.g_bold1[.. generators], h_bold1: &self.h_bold1[.. generators] }
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Returns the little-endian decomposition.
|
||||||
|
fn u64_decompose(value: u64) -> ScalarVector {
|
||||||
|
let mut bits = ScalarVector::new(64);
|
||||||
|
for bit in 0 .. 64 {
|
||||||
|
bits[bit] = Scalar::from((value >> bit) & 1);
|
||||||
|
}
|
||||||
|
bits
|
||||||
|
}
|
||||||
50
coins/monero/src/ringct/bulletproofs/plus/point_vector.rs
Normal file
50
coins/monero/src/ringct/bulletproofs/plus/point_vector.rs
Normal file
@@ -0,0 +1,50 @@
|
|||||||
|
use core::ops::{Index, IndexMut};
|
||||||
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
|
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||||
|
|
||||||
|
use dalek_ff_group::EdwardsPoint;
|
||||||
|
|
||||||
|
#[cfg(test)]
|
||||||
|
use multiexp::multiexp;
|
||||||
|
#[cfg(test)]
|
||||||
|
use crate::ringct::bulletproofs::plus::ScalarVector;
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
|
pub(crate) struct PointVector(pub(crate) Vec<EdwardsPoint>);
|
||||||
|
|
||||||
|
impl Index<usize> for PointVector {
|
||||||
|
type Output = EdwardsPoint;
|
||||||
|
fn index(&self, index: usize) -> &EdwardsPoint {
|
||||||
|
&self.0[index]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl IndexMut<usize> for PointVector {
|
||||||
|
fn index_mut(&mut self, index: usize) -> &mut EdwardsPoint {
|
||||||
|
&mut self.0[index]
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
impl PointVector {
|
||||||
|
#[cfg(test)]
|
||||||
|
pub(crate) fn multiexp(&self, vector: &ScalarVector) -> EdwardsPoint {
|
||||||
|
debug_assert_eq!(self.len(), vector.len());
|
||||||
|
let mut res = Vec::with_capacity(self.len());
|
||||||
|
for (point, scalar) in self.0.iter().copied().zip(vector.0.iter().copied()) {
|
||||||
|
res.push((scalar, point));
|
||||||
|
}
|
||||||
|
multiexp(&res)
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn len(&self) -> usize {
|
||||||
|
self.0.len()
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn split(mut self) -> (Self, Self) {
|
||||||
|
debug_assert!(self.len() > 1);
|
||||||
|
let r = self.0.split_off(self.0.len() / 2);
|
||||||
|
debug_assert_eq!(self.len(), r.len());
|
||||||
|
(self, PointVector(r))
|
||||||
|
}
|
||||||
|
}
|
||||||
24
coins/monero/src/ringct/bulletproofs/plus/transcript.rs
Normal file
24
coins/monero/src/ringct/bulletproofs/plus/transcript.rs
Normal file
@@ -0,0 +1,24 @@
|
|||||||
|
use std_shims::{sync::OnceLock, vec::Vec};
|
||||||
|
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use monero_generators::{hash_to_point as raw_hash_to_point};
|
||||||
|
use crate::{hash, hash_to_scalar as dalek_hash};
|
||||||
|
|
||||||
|
// Monero starts BP+ transcripts with the following constant.
|
||||||
|
static TRANSCRIPT_CELL: OnceLock<[u8; 32]> = OnceLock::new();
|
||||||
|
pub(crate) fn TRANSCRIPT() -> [u8; 32] {
|
||||||
|
// Why this uses a hash_to_point is completely unknown.
|
||||||
|
*TRANSCRIPT_CELL
|
||||||
|
.get_or_init(|| raw_hash_to_point(hash(b"bulletproof_plus_transcript")).compress().to_bytes())
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn hash_to_scalar(data: &[u8]) -> Scalar {
|
||||||
|
Scalar(dalek_hash(data))
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn initial_transcript(commitments: core::slice::Iter<'_, EdwardsPoint>) -> Scalar {
|
||||||
|
let commitments_hash =
|
||||||
|
hash_to_scalar(&commitments.flat_map(|V| V.compress().to_bytes()).collect::<Vec<_>>());
|
||||||
|
hash_to_scalar(&[TRANSCRIPT().as_ref(), &commitments_hash.to_bytes()].concat())
|
||||||
|
}
|
||||||
@@ -0,0 +1,444 @@
|
|||||||
|
use std_shims::vec::Vec;
|
||||||
|
|
||||||
|
use rand_core::{RngCore, CryptoRng};
|
||||||
|
|
||||||
|
use zeroize::{Zeroize, ZeroizeOnDrop};
|
||||||
|
|
||||||
|
use multiexp::{BatchVerifier, multiexp, multiexp_vartime};
|
||||||
|
use group::{
|
||||||
|
ff::{Field, PrimeField},
|
||||||
|
GroupEncoding,
|
||||||
|
};
|
||||||
|
use dalek_ff_group::{Scalar, EdwardsPoint};
|
||||||
|
|
||||||
|
use crate::ringct::bulletproofs::plus::{
|
||||||
|
ScalarVector, PointVector, GeneratorsList, Generators, padded_pow_of_2, transcript::*,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Figure 1 of the Bulletproofs+ paper
|
||||||
|
#[derive(Clone, Debug)]
|
||||||
|
pub(crate) struct WipStatement {
|
||||||
|
generators: Generators,
|
||||||
|
P: EdwardsPoint,
|
||||||
|
y: ScalarVector,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl Zeroize for WipStatement {
|
||||||
|
fn zeroize(&mut self) {
|
||||||
|
self.P.zeroize();
|
||||||
|
self.y.zeroize();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, Debug, Zeroize, ZeroizeOnDrop)]
|
||||||
|
pub(crate) struct WipWitness {
|
||||||
|
a: ScalarVector,
|
||||||
|
b: ScalarVector,
|
||||||
|
alpha: Scalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl WipWitness {
|
||||||
|
pub(crate) fn new(mut a: ScalarVector, mut b: ScalarVector, alpha: Scalar) -> Option<Self> {
|
||||||
|
if a.0.is_empty() || (a.len() != b.len()) {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Pad to the nearest power of 2
|
||||||
|
let missing = padded_pow_of_2(a.len()) - a.len();
|
||||||
|
a.0.reserve(missing);
|
||||||
|
b.0.reserve(missing);
|
||||||
|
for _ in 0 .. missing {
|
||||||
|
a.0.push(Scalar::ZERO);
|
||||||
|
b.0.push(Scalar::ZERO);
|
||||||
|
}
|
||||||
|
|
||||||
|
Some(Self { a, b, alpha })
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
#[derive(Clone, PartialEq, Eq, Debug, Zeroize)]
|
||||||
|
pub(crate) struct WipProof {
|
||||||
|
pub(crate) L: Vec<EdwardsPoint>,
|
||||||
|
pub(crate) R: Vec<EdwardsPoint>,
|
||||||
|
pub(crate) A: EdwardsPoint,
|
||||||
|
pub(crate) B: EdwardsPoint,
|
||||||
|
pub(crate) r_answer: Scalar,
|
||||||
|
pub(crate) s_answer: Scalar,
|
||||||
|
pub(crate) delta_answer: Scalar,
|
||||||
|
}
|
||||||
|
|
||||||
|
impl WipStatement {
|
||||||
|
pub(crate) fn new(generators: Generators, P: EdwardsPoint, y: Scalar) -> Self {
|
||||||
|
debug_assert_eq!(generators.len(), padded_pow_of_2(generators.len()));
|
||||||
|
|
||||||
|
// y ** n
|
||||||
|
let mut y_vec = ScalarVector::new(generators.len());
|
||||||
|
y_vec[0] = y;
|
||||||
|
for i in 1 .. y_vec.len() {
|
||||||
|
y_vec[i] = y_vec[i - 1] * y;
|
||||||
|
}
|
||||||
|
|
||||||
|
Self { generators, P, y: y_vec }
|
||||||
|
}
|
||||||
|
|
||||||
|
fn transcript_L_R(transcript: &mut Scalar, L: EdwardsPoint, R: EdwardsPoint) -> Scalar {
|
||||||
|
let e = hash_to_scalar(
|
||||||
|
&[transcript.to_repr().as_ref(), L.to_bytes().as_ref(), R.to_bytes().as_ref()].concat(),
|
||||||
|
);
|
||||||
|
*transcript = e;
|
||||||
|
e
|
||||||
|
}
|
||||||
|
|
||||||
|
fn transcript_A_B(transcript: &mut Scalar, A: EdwardsPoint, B: EdwardsPoint) -> Scalar {
|
||||||
|
let e = hash_to_scalar(
|
||||||
|
&[transcript.to_repr().as_ref(), A.to_bytes().as_ref(), B.to_bytes().as_ref()].concat(),
|
||||||
|
);
|
||||||
|
*transcript = e;
|
||||||
|
e
|
||||||
|
}
|
||||||
|
|
||||||
|
// Prover's variant of the shared code block to calculate G/H/P when n > 1
|
||||||
|
// Returns each permutation of G/H since the prover needs to do operation on each permutation
|
||||||
|
// P is dropped as it's unused in the prover's path
|
||||||
|
// TODO: It'd still probably be faster to keep in terms of the original generators, both between
|
||||||
|
// the reduced amount of group operations and the potential tabling of the generators under
|
||||||
|
// multiexp
|
||||||
|
#[allow(clippy::too_many_arguments)]
|
||||||
|
fn next_G_H(
|
||||||
|
transcript: &mut Scalar,
|
||||||
|
mut g_bold1: PointVector,
|
||||||
|
mut g_bold2: PointVector,
|
||||||
|
mut h_bold1: PointVector,
|
||||||
|
mut h_bold2: PointVector,
|
||||||
|
L: EdwardsPoint,
|
||||||
|
R: EdwardsPoint,
|
||||||
|
y_inv_n_hat: Scalar,
|
||||||
|
) -> (Scalar, Scalar, Scalar, Scalar, PointVector, PointVector) {
|
||||||
|
debug_assert_eq!(g_bold1.len(), g_bold2.len());
|
||||||
|
debug_assert_eq!(h_bold1.len(), h_bold2.len());
|
||||||
|
debug_assert_eq!(g_bold1.len(), h_bold1.len());
|
||||||
|
|
||||||
|
let e = Self::transcript_L_R(transcript, L, R);
|
||||||
|
let inv_e = e.invert().unwrap();
|
||||||
|
|
||||||
|
// This vartime is safe as all of these arguments are public
|
||||||
|
let mut new_g_bold = Vec::with_capacity(g_bold1.len());
|
||||||
|
let e_y_inv = e * y_inv_n_hat;
|
||||||
|
for g_bold in g_bold1.0.drain(..).zip(g_bold2.0.drain(..)) {
|
||||||
|
new_g_bold.push(multiexp_vartime(&[(inv_e, g_bold.0), (e_y_inv, g_bold.1)]));
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut new_h_bold = Vec::with_capacity(h_bold1.len());
|
||||||
|
for h_bold in h_bold1.0.drain(..).zip(h_bold2.0.drain(..)) {
|
||||||
|
new_h_bold.push(multiexp_vartime(&[(e, h_bold.0), (inv_e, h_bold.1)]));
|
||||||
|
}
|
||||||
|
|
||||||
|
let e_square = e.square();
|
||||||
|
let inv_e_square = inv_e.square();
|
||||||
|
|
||||||
|
(e, inv_e, e_square, inv_e_square, PointVector(new_g_bold), PointVector(new_h_bold))
|
||||||
|
}
|
||||||
|
|
||||||
|
/*
|
||||||
|
This has room for optimization worth investigating further. It currently takes
|
||||||
|
an iterative approach. It can be optimized further via divide and conquer.
|
||||||
|
|
||||||
|
Assume there are 4 challenges.
|
||||||
|
|
||||||
|
Iterative approach (current):
|
||||||
|
1. Do the optimal multiplications across challenge column 0 and 1.
|
||||||
|
2. Do the optimal multiplications across that result and column 2.
|
||||||
|
3. Do the optimal multiplications across that result and column 3.
|
||||||
|
|
||||||
|
Divide and conquer (worth investigating further):
|
||||||
|
1. Do the optimal multiplications across challenge column 0 and 1.
|
||||||
|
2. Do the optimal multiplications across challenge column 2 and 3.
|
||||||
|
3. Multiply both results together.
|
||||||
|
|
||||||
|
When there are 4 challenges (n=16), the iterative approach does 28 multiplications
|
||||||
|
versus divide and conquer's 24.
|
||||||
|
*/
|
||||||
|
fn challenge_products(challenges: &[(Scalar, Scalar)]) -> Vec<Scalar> {
|
||||||
|
let mut products = vec![Scalar::ONE; 1 << challenges.len()];
|
||||||
|
|
||||||
|
if !challenges.is_empty() {
|
||||||
|
products[0] = challenges[0].1;
|
||||||
|
products[1] = challenges[0].0;
|
||||||
|
|
||||||
|
for (j, challenge) in challenges.iter().enumerate().skip(1) {
|
||||||
|
let mut slots = (1 << (j + 1)) - 1;
|
||||||
|
while slots > 0 {
|
||||||
|
products[slots] = products[slots / 2] * challenge.0;
|
||||||
|
products[slots - 1] = products[slots / 2] * challenge.1;
|
||||||
|
|
||||||
|
slots = slots.saturating_sub(2);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Sanity check since if the above failed to populate, it'd be critical
|
||||||
|
for product in &products {
|
||||||
|
debug_assert!(!bool::from(product.is_zero()));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
products
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn prove<R: RngCore + CryptoRng>(
|
||||||
|
self,
|
||||||
|
rng: &mut R,
|
||||||
|
mut transcript: Scalar,
|
||||||
|
witness: &WipWitness,
|
||||||
|
) -> Option<WipProof> {
|
||||||
|
let WipStatement { generators, P, mut y } = self;
|
||||||
|
#[cfg(not(debug_assertions))]
|
||||||
|
let _ = P;
|
||||||
|
|
||||||
|
if generators.len() != witness.a.len() {
|
||||||
|
return None;
|
||||||
|
}
|
||||||
|
let (g, h) = (Generators::g(), Generators::h());
|
||||||
|
let mut g_bold = vec![];
|
||||||
|
let mut h_bold = vec![];
|
||||||
|
for i in 0 .. generators.len() {
|
||||||
|
g_bold.push(generators.generator(GeneratorsList::GBold1, i));
|
||||||
|
h_bold.push(generators.generator(GeneratorsList::HBold1, i));
|
||||||
|
}
|
||||||
|
let mut g_bold = PointVector(g_bold);
|
||||||
|
let mut h_bold = PointVector(h_bold);
|
||||||
|
|
||||||
|
// Check P has the expected relationship
|
||||||
|
#[cfg(debug_assertions)]
|
||||||
|
{
|
||||||
|
let mut P_terms = witness
|
||||||
|
.a
|
||||||
|
.0
|
||||||
|
.iter()
|
||||||
|
.copied()
|
||||||
|
.zip(g_bold.0.iter().copied())
|
||||||
|
.chain(witness.b.0.iter().copied().zip(h_bold.0.iter().copied()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
P_terms.push((witness.a.clone().weighted_inner_product(&witness.b, &y), g));
|
||||||
|
P_terms.push((witness.alpha, h));
|
||||||
|
debug_assert_eq!(multiexp(&P_terms), P);
|
||||||
|
P_terms.zeroize();
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut a = witness.a.clone();
|
||||||
|
let mut b = witness.b.clone();
|
||||||
|
let mut alpha = witness.alpha;
|
||||||
|
|
||||||
|
// From here on, g_bold.len() is used as n
|
||||||
|
debug_assert_eq!(g_bold.len(), a.len());
|
||||||
|
|
||||||
|
let mut L_vec = vec![];
|
||||||
|
let mut R_vec = vec![];
|
||||||
|
|
||||||
|
// else n > 1 case from figure 1
|
||||||
|
while g_bold.len() > 1 {
|
||||||
|
let (a1, a2) = a.clone().split();
|
||||||
|
let (b1, b2) = b.clone().split();
|
||||||
|
let (g_bold1, g_bold2) = g_bold.split();
|
||||||
|
let (h_bold1, h_bold2) = h_bold.split();
|
||||||
|
|
||||||
|
let n_hat = g_bold1.len();
|
||||||
|
debug_assert_eq!(a1.len(), n_hat);
|
||||||
|
debug_assert_eq!(a2.len(), n_hat);
|
||||||
|
debug_assert_eq!(b1.len(), n_hat);
|
||||||
|
debug_assert_eq!(b2.len(), n_hat);
|
||||||
|
debug_assert_eq!(g_bold1.len(), n_hat);
|
||||||
|
debug_assert_eq!(g_bold2.len(), n_hat);
|
||||||
|
debug_assert_eq!(h_bold1.len(), n_hat);
|
||||||
|
debug_assert_eq!(h_bold2.len(), n_hat);
|
||||||
|
|
||||||
|
let y_n_hat = y[n_hat - 1];
|
||||||
|
y.0.truncate(n_hat);
|
||||||
|
|
||||||
|
let d_l = Scalar::random(&mut *rng);
|
||||||
|
let d_r = Scalar::random(&mut *rng);
|
||||||
|
|
||||||
|
let c_l = a1.clone().weighted_inner_product(&b2, &y);
|
||||||
|
let c_r = (a2.clone() * y_n_hat).weighted_inner_product(&b1, &y);
|
||||||
|
|
||||||
|
// TODO: Calculate these with a batch inversion
|
||||||
|
let y_inv_n_hat = y_n_hat.invert().unwrap();
|
||||||
|
|
||||||
|
let mut L_terms = (a1.clone() * y_inv_n_hat)
|
||||||
|
.0
|
||||||
|
.drain(..)
|
||||||
|
.zip(g_bold2.0.iter().copied())
|
||||||
|
.chain(b2.0.iter().copied().zip(h_bold1.0.iter().copied()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
L_terms.push((c_l, g));
|
||||||
|
L_terms.push((d_l, h));
|
||||||
|
let L = multiexp(&L_terms) * Scalar(crate::INV_EIGHT());
|
||||||
|
L_vec.push(L);
|
||||||
|
L_terms.zeroize();
|
||||||
|
|
||||||
|
let mut R_terms = (a2.clone() * y_n_hat)
|
||||||
|
.0
|
||||||
|
.drain(..)
|
||||||
|
.zip(g_bold1.0.iter().copied())
|
||||||
|
.chain(b1.0.iter().copied().zip(h_bold2.0.iter().copied()))
|
||||||
|
.collect::<Vec<_>>();
|
||||||
|
R_terms.push((c_r, g));
|
||||||
|
R_terms.push((d_r, h));
|
||||||
|
let R = multiexp(&R_terms) * Scalar(crate::INV_EIGHT());
|
||||||
|
R_vec.push(R);
|
||||||
|
R_terms.zeroize();
|
||||||
|
|
||||||
|
let (e, inv_e, e_square, inv_e_square);
|
||||||
|
(e, inv_e, e_square, inv_e_square, g_bold, h_bold) =
|
||||||
|
Self::next_G_H(&mut transcript, g_bold1, g_bold2, h_bold1, h_bold2, L, R, y_inv_n_hat);
|
||||||
|
|
||||||
|
a = (a1 * e) + &(a2 * (y_n_hat * inv_e));
|
||||||
|
b = (b1 * inv_e) + &(b2 * e);
|
||||||
|
alpha += (d_l * e_square) + (d_r * inv_e_square);
|
||||||
|
|
||||||
|
debug_assert_eq!(g_bold.len(), a.len());
|
||||||
|
debug_assert_eq!(g_bold.len(), h_bold.len());
|
||||||
|
debug_assert_eq!(g_bold.len(), b.len());
|
||||||
|
}
|
||||||
|
|
||||||
|
// n == 1 case from figure 1
|
||||||
|
debug_assert_eq!(g_bold.len(), 1);
|
||||||
|
debug_assert_eq!(h_bold.len(), 1);
|
||||||
|
|
||||||
|
debug_assert_eq!(a.len(), 1);
|
||||||
|
debug_assert_eq!(b.len(), 1);
|
||||||
|
|
||||||
|
let r = Scalar::random(&mut *rng);
|
||||||
|
let s = Scalar::random(&mut *rng);
|
||||||
|
let delta = Scalar::random(&mut *rng);
|
||||||
|
let eta = Scalar::random(&mut *rng);
|
||||||
|
|
||||||
|
let ry = r * y[0];
|
||||||
|
|
||||||
|
let mut A_terms =
|
||||||
|
vec![(r, g_bold[0]), (s, h_bold[0]), ((ry * b[0]) + (s * y[0] * a[0]), g), (delta, h)];
|
||||||
|
let A = multiexp(&A_terms) * Scalar(crate::INV_EIGHT());
|
||||||
|
A_terms.zeroize();
|
||||||
|
|
||||||
|
let mut B_terms = vec![(ry * s, g), (eta, h)];
|
||||||
|
let B = multiexp(&B_terms) * Scalar(crate::INV_EIGHT());
|
||||||
|
B_terms.zeroize();
|
||||||
|
|
||||||
|
let e = Self::transcript_A_B(&mut transcript, A, B);
|
||||||
|
|
||||||
|
let r_answer = r + (a[0] * e);
|
||||||
|
let s_answer = s + (b[0] * e);
|
||||||
|
let delta_answer = eta + (delta * e) + (alpha * e.square());
|
||||||
|
|
||||||
|
Some(WipProof { L: L_vec, R: R_vec, A, B, r_answer, s_answer, delta_answer })
|
||||||
|
}
|
||||||
|
|
||||||
|
pub(crate) fn verify<Id: Copy + Zeroize, R: RngCore + CryptoRng>(
|
||||||
|
self,
|
||||||
|
rng: &mut R,
|
||||||
|
verifier: &mut BatchVerifier<Id, EdwardsPoint>,
|
||||||
|
id: Id,
|
||||||
|
mut transcript: Scalar,
|
||||||
|
mut proof: WipProof,
|
||||||
|
) -> bool {
|
||||||
|
let WipStatement { generators, P, y } = self;
|
||||||
|
|
||||||
|
let (g, h) = (Generators::g(), Generators::h());
|
||||||
|
|
||||||
|
// Verify the L/R lengths
|
||||||
|
{
|
||||||
|
let mut lr_len = 0;
|
||||||
|
while (1 << lr_len) < generators.len() {
|
||||||
|
lr_len += 1;
|
||||||
|
}
|
||||||
|
if (proof.L.len() != lr_len) ||
|
||||||
|
(proof.R.len() != lr_len) ||
|
||||||
|
(generators.len() != (1 << lr_len))
|
||||||
|
{
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
let inv_y = {
|
||||||
|
let inv_y = y[0].invert().unwrap();
|
||||||
|
let mut res = Vec::with_capacity(y.len());
|
||||||
|
res.push(inv_y);
|
||||||
|
while res.len() < y.len() {
|
||||||
|
res.push(inv_y * res.last().unwrap());
|
||||||
|
}
|
||||||
|
res
|
||||||
|
};
|
||||||
|
|
||||||
|
let mut P_terms = vec![(Scalar::ONE, P)];
|
||||||
|
P_terms.reserve(6 + (2 * generators.len()) + proof.L.len());
|
||||||
|
|
||||||
|
let mut challenges = Vec::with_capacity(proof.L.len());
|
||||||
|
let product_cache = {
|
||||||
|
let mut es = Vec::with_capacity(proof.L.len());
|
||||||
|
for (L, R) in proof.L.iter_mut().zip(proof.R.iter_mut()) {
|
||||||
|
es.push(Self::transcript_L_R(&mut transcript, *L, *R));
|
||||||
|
*L = L.mul_by_cofactor();
|
||||||
|
*R = R.mul_by_cofactor();
|
||||||
|
}
|
||||||
|
|
||||||
|
let mut inv_es = es.clone();
|
||||||
|
let mut scratch = vec![Scalar::ZERO; es.len()];
|
||||||
|
group::ff::BatchInverter::invert_with_external_scratch(&mut inv_es, &mut scratch);
|
||||||
|
drop(scratch);
|
||||||
|
|
||||||
|
debug_assert_eq!(es.len(), inv_es.len());
|
||||||
|
debug_assert_eq!(es.len(), proof.L.len());
|
||||||
|
debug_assert_eq!(es.len(), proof.R.len());
|
||||||
|
for ((e, inv_e), (L, R)) in
|
||||||
|
es.drain(..).zip(inv_es.drain(..)).zip(proof.L.iter().zip(proof.R.iter()))
|
||||||
|
{
|
||||||
|
debug_assert_eq!(e.invert().unwrap(), inv_e);
|
||||||
|
|
||||||
|
challenges.push((e, inv_e));
|
||||||
|
|
||||||
|
let e_square = e.square();
|
||||||
|
let inv_e_square = inv_e.square();
|
||||||
|
P_terms.push((e_square, *L));
|
||||||
|
P_terms.push((inv_e_square, *R));
|
||||||
|
}
|
||||||
|
|
||||||
|
Self::challenge_products(&challenges)
|
||||||
|
};
|
||||||
|
|
||||||
|
let e = Self::transcript_A_B(&mut transcript, proof.A, proof.B);
|
||||||
|
proof.A = proof.A.mul_by_cofactor();
|
||||||
|
proof.B = proof.B.mul_by_cofactor();
|
||||||
|
let neg_e_square = -e.square();
|
||||||
|
|
||||||
|
let mut multiexp = P_terms;
|
||||||
|
multiexp.reserve(4 + (2 * generators.len()));
|
||||||
|
for (scalar, _) in &mut multiexp {
|
||||||
|
*scalar *= neg_e_square;
|
||||||
|
}
|
||||||
|
|
||||||
|
let re = proof.r_answer * e;
|
||||||
|
for i in 0 .. generators.len() {
|
||||||
|
let mut scalar = product_cache[i] * re;
|
||||||
|
if i > 0 {
|
||||||
|
scalar *= inv_y[i - 1];
|
||||||
|
}
|
||||||
|
multiexp.push((scalar, generators.generator(GeneratorsList::GBold1, i)));
|
||||||
|
}
|
||||||
|
|
||||||
|
let se = proof.s_answer * e;
|
||||||
|
for i in 0 .. generators.len() {
|
||||||
|
multiexp.push((
|
||||||
|
se * product_cache[product_cache.len() - 1 - i],
|
||||||
|
generators.generator(GeneratorsList::HBold1, i),
|
||||||
|
));
|
||||||
|
}
|
||||||
|
|
||||||
|
multiexp.push((-e, proof.A));
|
||||||
|
multiexp.push((proof.r_answer * y[0] * proof.s_answer, g));
|
||||||
|
multiexp.push((proof.delta_answer, h));
|
||||||
|
multiexp.push((-Scalar::ONE, proof.B));
|
||||||
|
|
||||||
|
verifier.queue(rng, id, multiexp);
|
||||||
|
|
||||||
|
true
|
||||||
|
}
|
||||||
|
}
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user